3.3
This commit is contained in:
Marc Delisle
11
CREDITS
11
CREDITS
@@ -1,11 +0,0 @@
|
||||
$Id$
|
||||
|
||||
|
||||
phpMyAdmin - Credits
|
||||
====================
|
||||
|
||||
Please have a look to the Documentation.txt or
|
||||
Documentation.html files, or visit
|
||||
http://www.phpmyadmin.net/home_page/team.php and
|
||||
http://www.phpmyadmin.net/home_page/about.php
|
||||
|
||||
312
ChangeLog
312
ChangeLog
@@ -1,312 +0,0 @@
|
||||
----------------------
|
||||
phpMyAdmin - ChangeLog
|
||||
----------------------
|
||||
|
||||
$Id$
|
||||
$HeadURL: https://phpmyadmin.svn.sourceforge.net/svnroot/phpmyadmin/trunk/phpMyAdmin/ChangeLog $
|
||||
|
||||
3.3.0.0 (not yet released)
|
||||
+ rfe #2308632 [edit] Use hex for (var)binary fields,
|
||||
thanks to Maarten Dieleman - maartendieleman
|
||||
+ patch #2794819 [navi] Filter for displayed table names,
|
||||
thanks to Michael Valushko - dylfin
|
||||
- bug #2794840 [core] Cannot redeclare pma_tableheader()
|
||||
- rfe #2726479 [core] configurable maximal length of URL
|
||||
+ patch #2724755 [display] Full/partial text links (big T) are back,
|
||||
thanks to nullbarriere - nullbarriere
|
||||
- bug [display] handle NavigationBarIconic as documented for navi buttons
|
||||
+ rfe #2726479 [export] Export tables preselect
|
||||
+ patch #2805828 [export] PHP array export plugin,
|
||||
thanks to Geoffray Warnants - amnsk
|
||||
+ patch #2798592 [import] Progress bar,
|
||||
thanks to Tomas Srnka - tomassrnka
|
||||
- bug [gui] Generate Password not working for 'Change Login Information', only for 'Change password'
|
||||
+ [lang] Arabic update, thanks to Meno25 - meno25
|
||||
+ rfe #2822190 [structure] BOOLEAN is standard SQL
|
||||
+ [lang] German update, thanks to knittl
|
||||
+ [lang] German update, thanks to virsacer
|
||||
+ rfe #2813867 [structure] Default sorting order in list of tables
|
||||
+ [import] Added MySQL type-detection functionality to import library,
|
||||
thanks to Derek Schaefer
|
||||
+ [import] Added ODS, Excel XLS, Excel XLSX, and XML import modules,
|
||||
thanks to Derek Schaefer
|
||||
+ [export] Added Excel XLSX export module,
|
||||
thanks to Derek Schaefer
|
||||
+ [core] Added ability for tracking changes made through phpMyAdmin
|
||||
+ rfe #2839504 [engines] Support InnoDB plugin's new row formats
|
||||
+ [core] Added ability for synchronizing databases among servers.
|
||||
+ [lang] #2843101 Dutch update, thanks to scavenger2008
|
||||
+ [lang] Galician update, thanks to Xosé Calvo - xosecalvo
|
||||
+ [export] Added MediaWiki export module,
|
||||
thanks to Derek Schaefer - drummingds1
|
||||
+ [lang] Turkish update, thanks to Burak Yavuz
|
||||
+ [auth] Add custom port configuration in signon, thanks to Gary Smith
|
||||
- [core] Removed context from the error handler
|
||||
- bug #2883633 [export] Export of InnoDB table is incomplete
|
||||
+ rfe #2862575 [status] Order query statistics by % desc, skip rows with 0
|
||||
+ rfe #2823686 [interface] Increase default height of query window
|
||||
+ rfe #2129902 [structure] Don't hide indexes
|
||||
+ patch #2812070 [interface] Allow selecting a range of rows by holding shift, thanks to Joolee
|
||||
|
||||
3.2.5.0 (not yet released)
|
||||
- patch #2903400 [bookmarks] Status of bookmark table,
|
||||
thanks to Virsacer - virsacer
|
||||
- bug [history] QueryHistoryDB is not respected
|
||||
- bug #2905629 [auth] Blowfish secret is not hashed
|
||||
- bug #2910000 [gui] ShowServerInfo should hide all server info from main page
|
||||
- bug #2910568 [structure] Table size for ARCHIVE tables is not displayed
|
||||
- patch #2899969 [core] Session lock blocks working from a second window,
|
||||
thanks to Greg Roach - fisharebest
|
||||
- patch #2915168 [import] Incorrect parsing of DELIMITER keyword,
|
||||
thanks to Greg Roach - fisharebest
|
||||
- patch #2918831 [export] Missing backquotes on reserved words,
|
||||
thanks to Virsacer - virsacer
|
||||
- [core] Fix broken cleanup of $_GET
|
||||
|
||||
3.2.4.0 (2009-12-02)
|
||||
- bug [engines] Innodb_buffer_pool_pages_latched no longer returned in status
|
||||
- bug #2890451 [setup] Inconsistent generated "designer_coords"
|
||||
- bug #2890443 [mysqli] "No index used in query" exception is reported
|
||||
- bug #2891250 [ob] Garbled data in navi frame (PHP 5.2.11 bug)
|
||||
- bug #2887357 [core] Slow loading times with large databases (partial fix)
|
||||
- bug #2893931 [lang] Typo and empty message
|
||||
+ [lang] Russian update, thanks to Victor Volkov
|
||||
- bug #2823599 [edit] UUID Primary Key wrongly updated
|
||||
- bug #2895894 [structure] Empty default value not set properly
|
||||
- bug #2897536 [parser] Copying table with bit field with default
|
||||
- bug #2893221 [core] Statement may not be safe to log in statement format
|
||||
|
||||
3.2.3.0 (2009-10-30)
|
||||
- patch #2856664 [export] Date, time, and datetime column types now export correctly to
|
||||
OpenOffice Spreadsheet, thanks to Thomas Pulickal - jemajoign
|
||||
- patch #2859788 [parser] Double-character delimiters (bug #2846239),
|
||||
thanks to Thomas Pulickal - jemajoign
|
||||
- bug #2832600 [export] Slow export when having lots of databases
|
||||
- bug #2537766 [import] Comments are stripped when editing store procedures
|
||||
- bug #2852370 [operations] Renaming database deletes triggers
|
||||
- bug #2872247 [interface] Failed opening required 'mysql_charsets.lib.php', thanks to CyberLeo Kitsana - cyberleo
|
||||
- bug [structure] "In use" table incorrectly reported as "view"
|
||||
- bug #2879909 [interface] Removed double htmlspecialchars when editing enum column
|
||||
- bug #2868328 [relations] Adding foreign key when table name contains a dot
|
||||
- bug #2883381 [doc] Side effects of MemoryLimit setting
|
||||
- bug #2826128 [display] Inverting sort order when expression contains a function name
|
||||
|
||||
3.2.2.1 (2009-10-12)
|
||||
- [security] XSS and SQL injection, thanks to Herman van Rink
|
||||
|
||||
3.2.2.0 (2009-09-13)
|
||||
- bug #2825293 [structure] Default value for a BIT column
|
||||
- bug [display] Red arrows were reversed in the list of tables
|
||||
- bug #2813879 [export] Duplicate empty lines when exporting without comments
|
||||
- bug #2825919 [export] Trigger export with database name
|
||||
- bug #2823996 [data] Cannot edit row with no PK and a BIT field
|
||||
- bug [export] Exporting results of a query which contains a LIMIT clause
|
||||
inside a subquery
|
||||
- bug #2837722 [export] Run complex SQL then export does not work
|
||||
- bug #2839548 [export] Triggers order on export
|
||||
- bug #2826986 [display] Order by BLOB and range display
|
||||
- bug [display] After clicking on Show Function or Function, the UPDATE query
|
||||
is not shown after execution
|
||||
- bug [structure] Missing validation for BINARY and VARBINARY
|
||||
|
||||
3.2.1.0 (2009-08-09)
|
||||
- bug #2799009 Login with ipv6 IP address breaks redirect
|
||||
- bug #2796066 [priv] Inconsistent display of databases list
|
||||
- bug #2802870 [display] Incorrect overhead value for InnoDB
|
||||
- bug [display] Incorrect display in replication status,
|
||||
thanks to Tomas Srnka - tomassrnka
|
||||
- bug #1601625 [display] The Ignore checkbox is not unchecked for ENUM
|
||||
- bug #2809930 [setup] Notice: Undefined variable: k in setup/index.php
|
||||
- bug [features] Incorrect report of missing relational features
|
||||
- [security] XSS: Insufficient output sanitizing (not exploitable without a valid token)
|
||||
thanks to Sven Vetsch/Disenchant for informing us in a responsible manner
|
||||
- bug #2634827 [import] Using DELIMITER produces infinite cycle
|
||||
+ new language files: uzbek_cyrillic and urbek_latin
|
||||
- bug #2814109 [search] Right frame is blank
|
||||
- bug #2816840 [priv] Cannot change a user's details
|
||||
- bug #2816165 [display] Executed query not always displayed
|
||||
- bug #2819944 [setup] Incorrect mention of designer_coords
|
||||
- bug #2821757 [insert] "Insert another new row" no longer worked
|
||||
+ [lang] Norwegian update, thanks to Sven-Erik Andersen
|
||||
- bug [core] PMA_pow() can support negative exponents in the pow() case
|
||||
+ [lang] Brazilian Portuguese update, thanks to Fabio Bucior - fabiobucior
|
||||
- patch #2822384 [docs] Missing auth_type in docs-example,
|
||||
thanks to Jürgen Wind - windkiel
|
||||
- patch #2819728 [display] Slider effect jumping to top of page,
|
||||
thanks to Jan Radem - summsel
|
||||
- bug [display] Incorrect computation of overhead stats in server view
|
||||
for tables under the InnoDB engine
|
||||
+ [lang] Swedish update, thanks to Björn T. Hallberg
|
||||
|
||||
3.2.0.1 (2009-06-30)
|
||||
- [security] XSS: Insufficient output sanitizing in bookmarks
|
||||
|
||||
3.2.0.0 (2009-06-15)
|
||||
- [core] better support for vendor customisation (based on what Debian needs)
|
||||
+ rfe #2127987 warn when session.gc_maxlifetime is less than cookie validity
|
||||
+ rfe #2100910 configurable default charset for import
|
||||
+ rfe #1913541 link to InnoDB status when error 150 occurs
|
||||
+ rfe #1927189 strip ` from column names on import
|
||||
+ rfe #1821619 LeftFrameDBSeparator can be an array
|
||||
+ patch #1821619 [privileges] Extra back reference when editing table-specific
|
||||
privileges, thanks to Herman van Rink - helmo
|
||||
+ patch #2356575 [display] Sortable database columns,
|
||||
thanks to Bryce Thornton - brycethornton
|
||||
- patch #2486825 [lang] Wrong string in setup script hints,
|
||||
thanks to Isaac Bennetch - ibennetch
|
||||
- patch #2498350 [cleanup] XHTML cleanup, thanks to Virsacer - virsacer
|
||||
+ patch #2494192 [display] Possibility of disabling the sliders,
|
||||
thanks to Virsacer - virsacer
|
||||
+ patch #2506831 [privileges] Create user for existing database,
|
||||
thanks to Herman van Rink and Virsacer
|
||||
+ patch #2505255 [privileges] Cleanup, thanks to Virsacer - virsacer
|
||||
- bug #2414056 [auth] AllowNoPasswordRoot error message is too vague
|
||||
- patch #2596230 [XHTML] View table headers/footers completely,
|
||||
thanks to Virsacer - virsacer
|
||||
- patch #2602633 [core] support column name having square brackets,
|
||||
thanks to Herman van Rink - helmo
|
||||
+ [lang] Lithuanian update, thanks to Rytis Slatkevicius - rytis_s
|
||||
+ [auth] New setting AllowNoPassword (supercedes AllowNoPasswordRoot) that
|
||||
applies to all accounts (even the anonymous user)
|
||||
- patch #2652972 [relation] Missing code with hashing for relationship
|
||||
editing, thanks to knittl - knittl
|
||||
+ rfe #2123386 Added option to disable mcrypt warning.
|
||||
- bug #2648502 Request-URI Too Large error from Location header
|
||||
+ rfe #1731967 Check for relations support on main page.
|
||||
+ rfe #2186820 Explanation for using Host table.
|
||||
+ rfe #1369509 Link to download more themes.
|
||||
+ rfe #1666487 Add option to generate password on change password page.
|
||||
+ rfe #1694104 Allow logging of user status with Apache.
|
||||
- patch #2649087 None default is different than other None in some languages.
|
||||
+ [lang] Chinese Simplified update, thanks to Shanyan Baishui - rimyxp
|
||||
- patch #2550286 [display] Sort arrows problem, thanks to Virsacer - virsacer
|
||||
- [security] warn about existence of config directory on main page
|
||||
+ patch #2706761 [lang] Polish update,
|
||||
thanks to Pawel Smolinski - zipoking
|
||||
+ patch #2715142 [export] (rfe 2416960, escape new line in CSV export)
|
||||
thanks to Derek Schaefer - drummingds1
|
||||
- patch #2727250 Optimizations for PHP loops
|
||||
thanks to Haeber
|
||||
- bug #2650776 [import] SQL_MODE not saved during Partial Import
|
||||
- patch #1863739 [auth] cache control missing (PHP-CGI), thanks to stmfd
|
||||
- patch #2750541 [parser] Incorrect parsing of constraints in ALTER TABLE,
|
||||
thanks to Yannick Betemps - arkhee
|
||||
+ patch #2735162 [status] Server status - replication,
|
||||
thanks to Tomas Srnka - tomassrnka
|
||||
+ patch #2745215 [edit] Multi-row change with "]" improved,
|
||||
thanks to Virsacer - virsacer
|
||||
+ rfe #2657696 Automatically copy generated password
|
||||
- bug #2787162 [interface] Table with name 'log_views' is incorrectly displayed as a view
|
||||
+ patch #2665440 Detect mcrypt initialization failure
|
||||
+ [lang] Galician update, thanks to Xosé Calvo - xosecalvo
|
||||
+ [lang] Swedish update, thanks to Björn T. Hallberg
|
||||
+ [lang] Norwegian update, thanks to Sven-Erik Andersen
|
||||
+ [lang] Catalan update, thanks to Xavier Navarro
|
||||
+ [lang] Finnish update, thanks to Jouni Kahkonen
|
||||
+ [lang] Hungarian update, thanks to Jozsef Tamas Herczeg - dodika
|
||||
|
||||
3.1.6.0 (not released)
|
||||
- bug #2785912 [doc] no ON UPDATE CURRENT_TIMESTAMP in list of attributes
|
||||
|
||||
3.1.5.0 (2009-05-15)
|
||||
- patch #2739001 [export] XML does not allow spaces in element names,
|
||||
thanks to Derek Schaefer - drummingds1
|
||||
- bug #2780722 [import] Incorrect maximum file size
|
||||
- bug #2780356 [calendar] Null checkbox not unchecked when date is chosen
|
||||
- bug [calendar] js error "window.parent.addEvent is not a function"
|
||||
- patch #2773818 [export] Invalid "Content-Encoding" header,
|
||||
thanks to abignale - abignale
|
||||
- bug #2787162 [interface] Table with name 'log_views' is incorrectly displayed as a view
|
||||
- bug #2784400 [parser] INVOKER not understood by parser
|
||||
- [core] Compatibility with PHP 5.3.0RC2
|
||||
|
||||
3.1.4.0 (2009-04-25)
|
||||
+ patch #1808339 [doc] Apache SSLOptions and StdEnvVars FAQ,
|
||||
thanks to JT Justman - jtjustman
|
||||
- bug #2491017 [operations] ANSI mode not supported (db rename and table move)
|
||||
- bug #2609346 [operations] Fix copying views.
|
||||
- rfe #2127983 Readd documentation link, it does not protect against anything.
|
||||
- bug #1675249 [doc] Apache reverse proxy and cookies FAQ
|
||||
- bug #2682140 UUID() and CURRENT_USER() should not accept arguments
|
||||
- patch #2682833 [core] Fatal error: Call to a member function isDisplayed(),
|
||||
thanks to Christian Rodriguez - judas_iscariote
|
||||
- patch #2702772 [lang] Duplicate sentence in Polish,
|
||||
thanks to Pawel Smolinski - zipoking
|
||||
- patch #2709040 [doc] Wrong link in ChangeLog formatter,
|
||||
thanks to Petr Vorel - pevik
|
||||
- patch #2715417 [interface] Fixed truncation of enum/set values containing parenthesis
|
||||
thanks to Marco Moreno - mmoreno
|
||||
+ [lang] Spanish update, thanks to Daniel Hinostroza
|
||||
- bug #2724844 Add Fields: Add index is missing quotes
|
||||
thanks to Luke Armstrong
|
||||
- bug #2740550 [interface] Using textarea CharEditing drops default values
|
||||
- bug #2729191 [config] CheckConfigurationPermissions = false is worthless
|
||||
- bug #2687046 [export] Structure export: Null always YES
|
||||
- [doc] typos, thanks to Cédric Corazza
|
||||
|
||||
3.1.3.2 (2009-04-14)
|
||||
- [security] Insufficient output sanitizing when generating configuration file
|
||||
|
||||
3.1.3.1 (2009-03-24)
|
||||
- [security] HTTP Response Splitting and file inclusion vulnerabilities
|
||||
- [security] XSS vulnerability on export page
|
||||
- [security] Insufficient output sanitizing when generating configuration file
|
||||
|
||||
3.1.3.0 (2009-02-28)
|
||||
+ [lang] Turkish update, thanks to Burak Yavuz
|
||||
- patch #2496403 [display] Multi-row change with "]",
|
||||
thanks to Virsacer - virsacer
|
||||
- bug #2027720 [parser] Missing space after BINARY used as cast
|
||||
- patch #2520747 [core] E_DEPRECATED compatibility for PHP 5.3,
|
||||
thanks to Giovanni Giacobbi - themnemonic
|
||||
- bug [display] Message "Bookmark created" is not displaying
|
||||
+ [display] Show AUTO_INCREMENT instead of A_I when in vertical mode
|
||||
- patch #2538358 [display] Conditions for relational display field,
|
||||
thanks to Virsacer - virsacer
|
||||
+ [lang] Mongolian update, thanks to Bayarsaikhan Enkhtaivan - bayaraa
|
||||
- patch #2553372 [display] DB comment tooltips not shown on navi,
|
||||
thanks to Erdem - ahard
|
||||
- patch #2561433 [structure] Display true number of rows in a view
|
||||
if it contains less than MaxExactCountViews,
|
||||
thanks to Virsacer - virsacer
|
||||
+ [lang] Polish update, thanks to Fixer - fixeron
|
||||
- bug #2568722 [designer] Compound key not shown
|
||||
- patch #2550323 [XHTML] in server_databases.php, thanks to Virsacer - virsacer
|
||||
- patch #2358861 [navi] Row count tooltip wrong for information_schema,
|
||||
thanks to Herman van Rink - helmo
|
||||
- bug #2565948 [core] Changing the connection collation changed the client
|
||||
charset.
|
||||
+ [lang] Romanian update, thanks to Sergiu Bivol - sbivol
|
||||
- patch #1760205 [data] Insert as new row: BLOB is lost,
|
||||
thanks to Herman van Rink - helmo
|
||||
+ [lang] Georgian update, thanks to George Machitidze
|
||||
|
||||
3.1.2.0 (2009-01-19)
|
||||
- bug #1253252 [display] Can't NULL a column with relation defined
|
||||
- bug #2009500 [SQL] Small improvements in generated SQL (partial fix)
|
||||
- bug #1963184 [export] YAML export improvement,
|
||||
thanks to Bryce Thornton - brycethornton
|
||||
+ [lang] Dutch update, thanks to Herman van Rink - helmo
|
||||
- patch #2407785 [cleanup] ereg*() deprecated in PHP 5.3,
|
||||
thanks to Alex Frase - atfrase
|
||||
- bug #2417058 [properties] Edit fields: losing auto-increment setting
|
||||
- patch #2444082 [changelog] changelog.php linkifies one link wrong,
|
||||
thanks to Robert Xiao - nneonneo
|
||||
- bug #2363653 [properties] Various problems with table structure
|
||||
- bug [display] BIT field contents disappear when edited
|
||||
+ [lang] Czech update, thanks to Ondřej Vadinský.
|
||||
- bug #2461735 [operations] Table operations adds "row_format"
|
||||
- bug #2445213 [export] Commas for CSV Excel 2008 for Mac
|
||||
- bug #2397877 [core] ForceSSL and http auth_type
|
||||
- bug #2473127 [display] Deleting rows displays tbl structure, not contents
|
||||
- patch #2478940 [core] PHP 5.2+ warning does not work,
|
||||
thanks to Jürgen Wind - windkiel
|
||||
- bug #2416418 [privileges] Escaping special characters
|
||||
|
||||
--- Older ChangeLogs can be found on our project website ---
|
||||
http://www.phpmyadmin.net/old-stuff/ChangeLogs/
|
||||
|
||||
# vim: et ts=4 sw=4 sts=4
|
||||
# vim: ft=changelog fenc=utf-8 encoding=utf-8
|
||||
# vim: fde=getline(v\:lnum-1)=~'^\\s*$'&&getline(v\:lnum)=~'\\S'?'>1'\:1&&v\:lnum>8&&getline(v\:lnum)!~'^#'
|
||||
# vim: fdn=1 fdm=expr
|
||||
4967
Documentation.html
4967
Documentation.html
File diff suppressed because it is too large
Load Diff
9
INSTALL
9
INSTALL
@@ -1,9 +0,0 @@
|
||||
$Id$
|
||||
|
||||
phpMyAdmin - Installation
|
||||
-------------------------
|
||||
|
||||
Please have a look to the Documentation.txt or
|
||||
Documentation.html files.
|
||||
|
||||
|
||||
340
LICENSE
340
LICENSE
@@ -1,340 +0,0 @@
|
||||
GNU GENERAL PUBLIC LICENSE
|
||||
Version 2, June 1991
|
||||
|
||||
Copyright (C) 1989, 1991 Free Software Foundation, Inc.
|
||||
51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
Everyone is permitted to copy and distribute verbatim copies
|
||||
of this license document, but changing it is not allowed.
|
||||
|
||||
Preamble
|
||||
|
||||
The licenses for most software are designed to take away your
|
||||
freedom to share and change it. By contrast, the GNU General Public
|
||||
License is intended to guarantee your freedom to share and change free
|
||||
software--to make sure the software is free for all its users. This
|
||||
General Public License applies to most of the Free Software
|
||||
Foundation's software and to any other program whose authors commit to
|
||||
using it. (Some other Free Software Foundation software is covered by
|
||||
the GNU Library General Public License instead.) You can apply it to
|
||||
your programs, too.
|
||||
|
||||
When we speak of free software, we are referring to freedom, not
|
||||
price. Our General Public Licenses are designed to make sure that you
|
||||
have the freedom to distribute copies of free software (and charge for
|
||||
this service if you wish), that you receive source code or can get it
|
||||
if you want it, that you can change the software or use pieces of it
|
||||
in new free programs; and that you know you can do these things.
|
||||
|
||||
To protect your rights, we need to make restrictions that forbid
|
||||
anyone to deny you these rights or to ask you to surrender the rights.
|
||||
These restrictions translate to certain responsibilities for you if you
|
||||
distribute copies of the software, or if you modify it.
|
||||
|
||||
For example, if you distribute copies of such a program, whether
|
||||
gratis or for a fee, you must give the recipients all the rights that
|
||||
you have. You must make sure that they, too, receive or can get the
|
||||
source code. And you must show them these terms so they know their
|
||||
rights.
|
||||
|
||||
We protect your rights with two steps: (1) copyright the software, and
|
||||
(2) offer you this license which gives you legal permission to copy,
|
||||
distribute and/or modify the software.
|
||||
|
||||
Also, for each author's protection and ours, we want to make certain
|
||||
that everyone understands that there is no warranty for this free
|
||||
software. If the software is modified by someone else and passed on, we
|
||||
want its recipients to know that what they have is not the original, so
|
||||
that any problems introduced by others will not reflect on the original
|
||||
authors' reputations.
|
||||
|
||||
Finally, any free program is threatened constantly by software
|
||||
patents. We wish to avoid the danger that redistributors of a free
|
||||
program will individually obtain patent licenses, in effect making the
|
||||
program proprietary. To prevent this, we have made it clear that any
|
||||
patent must be licensed for everyone's free use or not licensed at all.
|
||||
|
||||
The precise terms and conditions for copying, distribution and
|
||||
modification follow.
|
||||
|
||||
GNU GENERAL PUBLIC LICENSE
|
||||
TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
|
||||
|
||||
0. This License applies to any program or other work which contains
|
||||
a notice placed by the copyright holder saying it may be distributed
|
||||
under the terms of this General Public License. The "Program", below,
|
||||
refers to any such program or work, and a "work based on the Program"
|
||||
means either the Program or any derivative work under copyright law:
|
||||
that is to say, a work containing the Program or a portion of it,
|
||||
either verbatim or with modifications and/or translated into another
|
||||
language. (Hereinafter, translation is included without limitation in
|
||||
the term "modification".) Each licensee is addressed as "you".
|
||||
|
||||
Activities other than copying, distribution and modification are not
|
||||
covered by this License; they are outside its scope. The act of
|
||||
running the Program is not restricted, and the output from the Program
|
||||
is covered only if its contents constitute a work based on the
|
||||
Program (independent of having been made by running the Program).
|
||||
Whether that is true depends on what the Program does.
|
||||
|
||||
1. You may copy and distribute verbatim copies of the Program's
|
||||
source code as you receive it, in any medium, provided that you
|
||||
conspicuously and appropriately publish on each copy an appropriate
|
||||
copyright notice and disclaimer of warranty; keep intact all the
|
||||
notices that refer to this License and to the absence of any warranty;
|
||||
and give any other recipients of the Program a copy of this License
|
||||
along with the Program.
|
||||
|
||||
You may charge a fee for the physical act of transferring a copy, and
|
||||
you may at your option offer warranty protection in exchange for a fee.
|
||||
|
||||
2. You may modify your copy or copies of the Program or any portion
|
||||
of it, thus forming a work based on the Program, and copy and
|
||||
distribute such modifications or work under the terms of Section 1
|
||||
above, provided that you also meet all of these conditions:
|
||||
|
||||
a) You must cause the modified files to carry prominent notices
|
||||
stating that you changed the files and the date of any change.
|
||||
|
||||
b) You must cause any work that you distribute or publish, that in
|
||||
whole or in part contains or is derived from the Program or any
|
||||
part thereof, to be licensed as a whole at no charge to all third
|
||||
parties under the terms of this License.
|
||||
|
||||
c) If the modified program normally reads commands interactively
|
||||
when run, you must cause it, when started running for such
|
||||
interactive use in the most ordinary way, to print or display an
|
||||
announcement including an appropriate copyright notice and a
|
||||
notice that there is no warranty (or else, saying that you provide
|
||||
a warranty) and that users may redistribute the program under
|
||||
these conditions, and telling the user how to view a copy of this
|
||||
License. (Exception: if the Program itself is interactive but
|
||||
does not normally print such an announcement, your work based on
|
||||
the Program is not required to print an announcement.)
|
||||
|
||||
These requirements apply to the modified work as a whole. If
|
||||
identifiable sections of that work are not derived from the Program,
|
||||
and can be reasonably considered independent and separate works in
|
||||
themselves, then this License, and its terms, do not apply to those
|
||||
sections when you distribute them as separate works. But when you
|
||||
distribute the same sections as part of a whole which is a work based
|
||||
on the Program, the distribution of the whole must be on the terms of
|
||||
this License, whose permissions for other licensees extend to the
|
||||
entire whole, and thus to each and every part regardless of who wrote it.
|
||||
|
||||
Thus, it is not the intent of this section to claim rights or contest
|
||||
your rights to work written entirely by you; rather, the intent is to
|
||||
exercise the right to control the distribution of derivative or
|
||||
collective works based on the Program.
|
||||
|
||||
In addition, mere aggregation of another work not based on the Program
|
||||
with the Program (or with a work based on the Program) on a volume of
|
||||
a storage or distribution medium does not bring the other work under
|
||||
the scope of this License.
|
||||
|
||||
3. You may copy and distribute the Program (or a work based on it,
|
||||
under Section 2) in object code or executable form under the terms of
|
||||
Sections 1 and 2 above provided that you also do one of the following:
|
||||
|
||||
a) Accompany it with the complete corresponding machine-readable
|
||||
source code, which must be distributed under the terms of Sections
|
||||
1 and 2 above on a medium customarily used for software interchange; or,
|
||||
|
||||
b) Accompany it with a written offer, valid for at least three
|
||||
years, to give any third party, for a charge no more than your
|
||||
cost of physically performing source distribution, a complete
|
||||
machine-readable copy of the corresponding source code, to be
|
||||
distributed under the terms of Sections 1 and 2 above on a medium
|
||||
customarily used for software interchange; or,
|
||||
|
||||
c) Accompany it with the information you received as to the offer
|
||||
to distribute corresponding source code. (This alternative is
|
||||
allowed only for noncommercial distribution and only if you
|
||||
received the program in object code or executable form with such
|
||||
an offer, in accord with Subsection b above.)
|
||||
|
||||
The source code for a work means the preferred form of the work for
|
||||
making modifications to it. For an executable work, complete source
|
||||
code means all the source code for all modules it contains, plus any
|
||||
associated interface definition files, plus the scripts used to
|
||||
control compilation and installation of the executable. However, as a
|
||||
special exception, the source code distributed need not include
|
||||
anything that is normally distributed (in either source or binary
|
||||
form) with the major components (compiler, kernel, and so on) of the
|
||||
operating system on which the executable runs, unless that component
|
||||
itself accompanies the executable.
|
||||
|
||||
If distribution of executable or object code is made by offering
|
||||
access to copy from a designated place, then offering equivalent
|
||||
access to copy the source code from the same place counts as
|
||||
distribution of the source code, even though third parties are not
|
||||
compelled to copy the source along with the object code.
|
||||
|
||||
4. You may not copy, modify, sublicense, or distribute the Program
|
||||
except as expressly provided under this License. Any attempt
|
||||
otherwise to copy, modify, sublicense or distribute the Program is
|
||||
void, and will automatically terminate your rights under this License.
|
||||
However, parties who have received copies, or rights, from you under
|
||||
this License will not have their licenses terminated so long as such
|
||||
parties remain in full compliance.
|
||||
|
||||
5. You are not required to accept this License, since you have not
|
||||
signed it. However, nothing else grants you permission to modify or
|
||||
distribute the Program or its derivative works. These actions are
|
||||
prohibited by law if you do not accept this License. Therefore, by
|
||||
modifying or distributing the Program (or any work based on the
|
||||
Program), you indicate your acceptance of this License to do so, and
|
||||
all its terms and conditions for copying, distributing or modifying
|
||||
the Program or works based on it.
|
||||
|
||||
6. Each time you redistribute the Program (or any work based on the
|
||||
Program), the recipient automatically receives a license from the
|
||||
original licensor to copy, distribute or modify the Program subject to
|
||||
these terms and conditions. You may not impose any further
|
||||
restrictions on the recipients' exercise of the rights granted herein.
|
||||
You are not responsible for enforcing compliance by third parties to
|
||||
this License.
|
||||
|
||||
7. If, as a consequence of a court judgment or allegation of patent
|
||||
infringement or for any other reason (not limited to patent issues),
|
||||
conditions are imposed on you (whether by court order, agreement or
|
||||
otherwise) that contradict the conditions of this License, they do not
|
||||
excuse you from the conditions of this License. If you cannot
|
||||
distribute so as to satisfy simultaneously your obligations under this
|
||||
License and any other pertinent obligations, then as a consequence you
|
||||
may not distribute the Program at all. For example, if a patent
|
||||
license would not permit royalty-free redistribution of the Program by
|
||||
all those who receive copies directly or indirectly through you, then
|
||||
the only way you could satisfy both it and this License would be to
|
||||
refrain entirely from distribution of the Program.
|
||||
|
||||
If any portion of this section is held invalid or unenforceable under
|
||||
any particular circumstance, the balance of the section is intended to
|
||||
apply and the section as a whole is intended to apply in other
|
||||
circumstances.
|
||||
|
||||
It is not the purpose of this section to induce you to infringe any
|
||||
patents or other property right claims or to contest validity of any
|
||||
such claims; this section has the sole purpose of protecting the
|
||||
integrity of the free software distribution system, which is
|
||||
implemented by public license practices. Many people have made
|
||||
generous contributions to the wide range of software distributed
|
||||
through that system in reliance on consistent application of that
|
||||
system; it is up to the author/donor to decide if he or she is willing
|
||||
to distribute software through any other system and a licensee cannot
|
||||
impose that choice.
|
||||
|
||||
This section is intended to make thoroughly clear what is believed to
|
||||
be a consequence of the rest of this License.
|
||||
|
||||
8. If the distribution and/or use of the Program is restricted in
|
||||
certain countries either by patents or by copyrighted interfaces, the
|
||||
original copyright holder who places the Program under this License
|
||||
may add an explicit geographical distribution limitation excluding
|
||||
those countries, so that distribution is permitted only in or among
|
||||
countries not thus excluded. In such case, this License incorporates
|
||||
the limitation as if written in the body of this License.
|
||||
|
||||
9. The Free Software Foundation may publish revised and/or new versions
|
||||
of the General Public License from time to time. Such new versions will
|
||||
be similar in spirit to the present version, but may differ in detail to
|
||||
address new problems or concerns.
|
||||
|
||||
Each version is given a distinguishing version number. If the Program
|
||||
specifies a version number of this License which applies to it and "any
|
||||
later version", you have the option of following the terms and conditions
|
||||
either of that version or of any later version published by the Free
|
||||
Software Foundation. If the Program does not specify a version number of
|
||||
this License, you may choose any version ever published by the Free Software
|
||||
Foundation.
|
||||
|
||||
10. If you wish to incorporate parts of the Program into other free
|
||||
programs whose distribution conditions are different, write to the author
|
||||
to ask for permission. For software which is copyrighted by the Free
|
||||
Software Foundation, write to the Free Software Foundation; we sometimes
|
||||
make exceptions for this. Our decision will be guided by the two goals
|
||||
of preserving the free status of all derivatives of our free software and
|
||||
of promoting the sharing and reuse of software generally.
|
||||
|
||||
NO WARRANTY
|
||||
|
||||
11. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY
|
||||
FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW. EXCEPT WHEN
|
||||
OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES
|
||||
PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED
|
||||
OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
|
||||
MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE. THE ENTIRE RISK AS
|
||||
TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU. SHOULD THE
|
||||
PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING,
|
||||
REPAIR OR CORRECTION.
|
||||
|
||||
12. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
|
||||
WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR
|
||||
REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES,
|
||||
INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING
|
||||
OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED
|
||||
TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY
|
||||
YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER
|
||||
PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE
|
||||
POSSIBILITY OF SUCH DAMAGES.
|
||||
|
||||
END OF TERMS AND CONDITIONS
|
||||
|
||||
How to Apply These Terms to Your New Programs
|
||||
|
||||
If you develop a new program, and you want it to be of the greatest
|
||||
possible use to the public, the best way to achieve this is to make it
|
||||
free software which everyone can redistribute and change under these terms.
|
||||
|
||||
To do so, attach the following notices to the program. It is safest
|
||||
to attach them to the start of each source file to most effectively
|
||||
convey the exclusion of warranty; and each file should have at least
|
||||
the "copyright" line and a pointer to where the full notice is found.
|
||||
|
||||
<one line to give the program's name and a brief idea of what it does.>
|
||||
Copyright (C) <year> <name of author>
|
||||
|
||||
This program is free software; you can redistribute it and/or modify
|
||||
it under the terms of the GNU General Public License as published by
|
||||
the Free Software Foundation; either version 2 of the License, or
|
||||
(at your option) any later version.
|
||||
|
||||
This program is distributed in the hope that it will be useful,
|
||||
but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
GNU General Public License for more details.
|
||||
|
||||
You should have received a copy of the GNU General Public License
|
||||
along with this program; if not, write to the Free Software
|
||||
Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
|
||||
|
||||
Also add information on how to contact you by electronic and paper mail.
|
||||
|
||||
If the program is interactive, make it output a short notice like this
|
||||
when it starts in an interactive mode:
|
||||
|
||||
Gnomovision version 69, Copyright (C) year name of author
|
||||
Gnomovision comes with ABSOLUTELY NO WARRANTY; for details type `show w'.
|
||||
This is free software, and you are welcome to redistribute it
|
||||
under certain conditions; type `show c' for details.
|
||||
|
||||
The hypothetical commands `show w' and `show c' should show the appropriate
|
||||
parts of the General Public License. Of course, the commands you use may
|
||||
be called something other than `show w' and `show c'; they could even be
|
||||
mouse-clicks or menu items--whatever suits your program.
|
||||
|
||||
You should also get your employer (if you work as a programmer) or your
|
||||
school, if any, to sign a "copyright disclaimer" for the program, if
|
||||
necessary. Here is a sample; alter the names:
|
||||
|
||||
Yoyodyne, Inc., hereby disclaims all copyright interest in the program
|
||||
`Gnomovision' (which makes passes at compilers) written by James Hacker.
|
||||
|
||||
<signature of Ty Coon>, 1 April 1989
|
||||
Ty Coon, President of Vice
|
||||
|
||||
This General Public License does not permit incorporating your program into
|
||||
proprietary programs. If your program is a subroutine library, you may
|
||||
consider it more useful to permit linking proprietary applications with the
|
||||
library. If this is what you want to do, use the GNU Library General
|
||||
Public License instead of this License.
|
||||
74
README
74
README
@@ -1,74 +0,0 @@
|
||||
$Id$
|
||||
|
||||
phpMyAdmin - Readme
|
||||
===================
|
||||
|
||||
A set of PHP-scripts to manage MySQL over the web.
|
||||
|
||||
Version 3.3.0-dev
|
||||
-----------------
|
||||
http://www.phpmyadmin.net/
|
||||
|
||||
Copyright (C) 1998-2000 Tobias Ratschiller <tobias_at_ratschiller.com>
|
||||
Copyright (C) 2001-2009 Marc Delisle <marc_at_infomarc.info>
|
||||
Olivier Müller <om_at_omnis.ch>
|
||||
Robin Johnson <robbat2_at_users.sourceforge.net>
|
||||
Alexander M. Turek <me_at_derrabus.de>
|
||||
Michal Čihař <michal_at_cihar.com>
|
||||
Garvin Hicking <me_at_supergarv.de>
|
||||
Michael Keck <mkkeck_at_users.sourceforge.net>
|
||||
Sebastian Mendel <cybot_tm_at_users.sourceforge.net>
|
||||
[check Documentation.txt/.html file for more details]
|
||||
|
||||
This program is free software; you can redistribute it and/or modify
|
||||
it under the terms of the GNU General Public License version 2,
|
||||
as published by the Free Software Foundation.
|
||||
|
||||
This program is distributed in the hope that it will be useful,
|
||||
but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
GNU General Public License for more details.
|
||||
|
||||
You should have received a copy of the GNU General Public License
|
||||
along with this program; if not, write to the Free Software
|
||||
Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
|
||||
Requirements:
|
||||
php 5.2 or later
|
||||
MySQL 5.0 or later
|
||||
a web-browser (doh!)
|
||||
|
||||
Summary:
|
||||
phpMyAdmin is intended to handle the administration of MySQL over the web.
|
||||
For a summary of features, please see the Documentation.txt/.html file.
|
||||
|
||||
Download:
|
||||
You can get the newest version at http://www.phpmyadmin.net/.
|
||||
|
||||
Credits:
|
||||
Please see the Documentation.txt/.html file.
|
||||
|
||||
Installation:
|
||||
Please see the Documentation.txt/.html file.
|
||||
|
||||
ChangeLog:
|
||||
Now in ChangeLog
|
||||
|
||||
Documentation:
|
||||
Basic documentation available in Documentation.txt/.html
|
||||
|
||||
Support:
|
||||
See reference about support forums under http://www.phpmyadmin.net/
|
||||
|
||||
|
||||
Enjoy!
|
||||
The phpMyAdmin Devel team
|
||||
|
||||
|
||||
PS: Please, don't send us emails with question like "How do I compile
|
||||
PHP with MySQL-support". We just don't have the time to be your
|
||||
free helpdesk.
|
||||
Please send your questions to the appropriate mailinglists / forums.
|
||||
Before contacting us, please read the Documentation.html (esp. the
|
||||
FAQ part).
|
||||
|
||||
@@ -1,19 +0,0 @@
|
||||
$Id: README 10967 2007-12-08 12:46:36Z lem9 $
|
||||
|
||||
phpMyAdmin - hints for distributing phpMyAdmin
|
||||
==============================================
|
||||
|
||||
This document is intended to give advices to people who want to
|
||||
redistribute phpMyAdmin inside other software package such as Linux
|
||||
distribution or some all in one package including web server and MySQL
|
||||
server.
|
||||
|
||||
Generally you can customize some basic aspects (paths to some files and
|
||||
behavior) in libraries/vendor_config.php.
|
||||
|
||||
For example if you want setup script to generate config file in var,
|
||||
change SETUP_CONFIG_FILE to /var/lib/phpmyadmin/config.inc.php and you
|
||||
will also probably want to skip directory writable check, so set
|
||||
SETUP_DIR_WRITABLE to false.
|
||||
|
||||
# vim: et ts=4 sw=4 sts=4 tw=72 spell spelllang=en_us
|
||||
10
TODO
10
TODO
@@ -1,10 +0,0 @@
|
||||
$Id$
|
||||
|
||||
phpMyAdmin - Todo
|
||||
=================
|
||||
|
||||
We are currently using the Sourceforge Tracker as Todo list:
|
||||
|
||||
http://sourceforge.net/tracker/?atid=377411&group_id=23067&func=browse
|
||||
|
||||
-- swix/20010704
|
||||
@@ -1,290 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* display selection for relational field values
|
||||
*
|
||||
* @version $Id$
|
||||
* @package phpMyAdmin
|
||||
*/
|
||||
|
||||
/**
|
||||
* Gets a core script and starts output buffering work
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
|
||||
PMA_checkParameters(array('db', 'table', 'field'));
|
||||
|
||||
require_once './libraries/ob.lib.php';
|
||||
PMA_outBufferPre();
|
||||
|
||||
require_once './libraries/header_http.inc.php';
|
||||
|
||||
/**
|
||||
* Displays the frame
|
||||
*/
|
||||
$per_page = 200;
|
||||
require_once './libraries/relation.lib.php'; // foreign keys
|
||||
require_once './libraries/transformations.lib.php'; // Transformations
|
||||
$cfgRelation = PMA_getRelationsParam();
|
||||
$foreigners = ($cfgRelation['relwork'] ? PMA_getForeigners($db, $table) : FALSE);
|
||||
|
||||
$override_total = TRUE;
|
||||
|
||||
if (!isset($pos)) {
|
||||
$pos = 0;
|
||||
}
|
||||
|
||||
$foreign_limit = 'LIMIT ' . $pos . ', ' . $per_page . ' ';
|
||||
if (isset($foreign_navig) && $foreign_navig == $strShowAll) {
|
||||
unset($foreign_limit);
|
||||
}
|
||||
|
||||
$foreignData = PMA_getForeignData($foreigners, $field, $override_total, isset($foreign_filter) ? $foreign_filter : '', $foreign_limit);
|
||||
|
||||
if (isset($pk)) {
|
||||
$pk_uri = '&pk=' . urlencode($pk);
|
||||
?>
|
||||
<input type="hidden" name="pk" value="<?php echo htmlspecialchars($pk); ?>" />
|
||||
<?php
|
||||
} else {
|
||||
$pk_uri = '';
|
||||
}
|
||||
|
||||
$gotopage = '';
|
||||
$showall = '';
|
||||
|
||||
if (is_array($foreignData['disp_row'])) {
|
||||
|
||||
if ($cfg['ShowAll'] && ($foreignData['the_total'] > $per_page)) {
|
||||
$showall = '<input type="submit" name="foreign_navig" value="' . $strShowAll . '" />';
|
||||
}
|
||||
|
||||
$session_max_rows = $per_page;
|
||||
$pageNow = @floor($pos / $session_max_rows) + 1;
|
||||
$nbTotalPage = @ceil($foreignData['the_total'] / $session_max_rows);
|
||||
|
||||
if ($foreignData['the_total'] > $per_page) {
|
||||
$gotopage = PMA_pageselector(
|
||||
'browse_foreigners.php?field=' . urlencode($field) .
|
||||
'&' . PMA_generate_common_url($db, $table)
|
||||
. $pk_uri .
|
||||
'&fieldkey=' . (isset($fieldkey) ? urlencode($fieldkey) : '') .
|
||||
'&foreign_filter=' . (isset($foreign_filter) ? urlencode($foreign_filter) : '') .
|
||||
'&',
|
||||
$session_max_rows,
|
||||
$pageNow,
|
||||
$nbTotalPage,
|
||||
200,
|
||||
5,
|
||||
5,
|
||||
20,
|
||||
10,
|
||||
$GLOBALS['strPageNumber']
|
||||
);
|
||||
}
|
||||
}
|
||||
?>
|
||||
<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN"
|
||||
"http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
|
||||
<html xmlns="http://www.w3.org/1999/xhtml"
|
||||
xml:lang="<?php echo $available_languages[$lang][2]; ?>"
|
||||
lang="<?php echo $available_languages[$lang][2]; ?>"
|
||||
dir="<?php echo $text_dir; ?>">
|
||||
|
||||
<head>
|
||||
<title>phpMyAdmin</title>
|
||||
<meta http-equiv="Content-Type" content="text/html; charset=<?php echo $charset; ?>" />
|
||||
<link rel="stylesheet" type="text/css"
|
||||
href="phpmyadmin.css.php?<?php echo PMA_generate_common_url('', ''); ?>&js_frame=right&nocache=<?php echo $_SESSION['PMA_Config']->getThemeUniqueValue(); ?>" />
|
||||
<script src="./js/functions.js" type="text/javascript"></script>
|
||||
<script type="text/javascript">
|
||||
//<![CDATA[
|
||||
self.focus();
|
||||
function formupdate(field, key) {
|
||||
if (opener && opener.document && opener.document.insertForm) {
|
||||
var field = 'field_' + field;
|
||||
|
||||
<?php if (isset($pk)) { ?>
|
||||
var element_name = field + '[multi_edit][<?php echo htmlspecialchars($pk); ?>][]';
|
||||
<?php } else { ?>
|
||||
var element_name = field + '[]';
|
||||
<?php } ?>
|
||||
|
||||
<?php if (isset($fieldkey) && is_numeric($fieldkey)) { ?>
|
||||
var element_name_alt = field + '[<?php echo $fieldkey; ?>]';
|
||||
<?php } else { ?>
|
||||
var element_name_alt = field + '[0]';
|
||||
<?php } ?>
|
||||
|
||||
if (opener.document.insertForm.elements[element_name]) {
|
||||
// Edit/Insert form
|
||||
opener.document.insertForm.elements[element_name].value = key;
|
||||
self.close();
|
||||
return false;
|
||||
} else if (opener.document.insertForm.elements[element_name_alt]) {
|
||||
// Search form
|
||||
opener.document.insertForm.elements[element_name_alt].value = key;
|
||||
self.close();
|
||||
return false;
|
||||
}
|
||||
}
|
||||
|
||||
alert('<?php echo PMA_jsFormat($strWindowNotFound); ?>');
|
||||
}
|
||||
//]]>
|
||||
</script>
|
||||
</head>
|
||||
|
||||
<body id="body_browse_foreigners">
|
||||
|
||||
<form action="browse_foreigners.php" method="post">
|
||||
<fieldset>
|
||||
<?php echo PMA_generate_common_hidden_inputs($db, $table); ?>
|
||||
<input type="hidden" name="field" value="<?php echo htmlspecialchars($field); ?>" />
|
||||
<input type="hidden" name="fieldkey"
|
||||
value="<?php echo isset($fieldkey) ? htmlspecialchars($fieldkey) : ''; ?>" />
|
||||
<?php if (isset($pk)) { ?>
|
||||
<input type="hidden" name="pk" value="<?php echo htmlspecialchars($pk); ?>" />
|
||||
<?php } ?>
|
||||
<span class="formelement">
|
||||
<label for="input_foreign_filter"><?php echo $strSearch . ':'; ?></label>
|
||||
<input type="text" name="foreign_filter" id="input_foreign_filter"
|
||||
value="<?php echo isset($foreign_filter) ? htmlspecialchars($foreign_filter) : ''; ?>" />
|
||||
<input type="submit" name="submit_foreign_filter" value="<?php echo $strGo;?>" />
|
||||
</span>
|
||||
<span class="formelement">
|
||||
<?php echo $gotopage; ?>
|
||||
</span>
|
||||
<span class="formelement">
|
||||
<?php echo $showall; ?>
|
||||
</span>
|
||||
</fieldset>
|
||||
</form>
|
||||
|
||||
<table width="100%">
|
||||
<?php
|
||||
if (is_array($foreignData['disp_row'])) {
|
||||
$header = '<tr>
|
||||
<th>' . $strKeyname . '</th>
|
||||
<th>' . $strDescription . '</th>
|
||||
<td width="20%"></td>
|
||||
<th>' . $strDescription . '</th>
|
||||
<th>' . $strKeyname . '</th>
|
||||
</tr>';
|
||||
|
||||
echo '<thead>' . $header . '</thead>' . "\n"
|
||||
.'<tfoot>' . $header . '</tfoot>' . "\n"
|
||||
.'<tbody>' . "\n";
|
||||
|
||||
$values = array();
|
||||
$keys = array();
|
||||
foreach ($foreignData['disp_row'] as $relrow) {
|
||||
if ($foreignData['foreign_display'] != FALSE) {
|
||||
$values[] = $relrow[$foreignData['foreign_display']];
|
||||
} else {
|
||||
$values[] = '';
|
||||
}
|
||||
|
||||
$keys[] = $relrow[$foreignData['foreign_field']];
|
||||
}
|
||||
|
||||
asort($keys);
|
||||
|
||||
$hcount = 0;
|
||||
$odd_row = true;
|
||||
$val_ordered_current_row = 0;
|
||||
$val_ordered_current_equals_data = false;
|
||||
$key_ordered_current_equals_data = false;
|
||||
foreach ($keys as $key_ordered_current_row => $value) {
|
||||
//for ($i = 0; $i < $count; $i++) {
|
||||
$hcount++;
|
||||
|
||||
if ($cfg['RepeatCells'] > 0 && $hcount > $cfg['RepeatCells']) {
|
||||
echo $header;
|
||||
$hcount = 0;
|
||||
$odd_row = true;
|
||||
}
|
||||
|
||||
$key_ordered_current_key = $keys[$key_ordered_current_row];
|
||||
$key_ordered_current_val = $values[$key_ordered_current_row];
|
||||
|
||||
$val_ordered_current_key = $keys[$val_ordered_current_row];
|
||||
$val_ordered_current_val = $values[$val_ordered_current_row];
|
||||
|
||||
$val_ordered_current_row++;
|
||||
|
||||
if (PMA_strlen($val_ordered_current_val) <= $cfg['LimitChars']) {
|
||||
$val_ordered_current_val = htmlspecialchars($val_ordered_current_val);
|
||||
$val_ordered_current_val_title = '';
|
||||
} else {
|
||||
$val_ordered_current_val_title =
|
||||
htmlspecialchars($val_ordered_current_val);
|
||||
$val_ordered_current_val =
|
||||
htmlspecialchars(PMA_substr($val_ordered_current_val, 0,
|
||||
$cfg['LimitChars']) . '...');
|
||||
}
|
||||
if (PMA_strlen($key_ordered_current_val) <= $cfg['LimitChars']) {
|
||||
$key_ordered_current_val = htmlspecialchars($key_ordered_current_val);
|
||||
$key_ordered_current_val_title = '';
|
||||
} else {
|
||||
$key_ordered_current_val_title =
|
||||
htmlspecialchars($key_ordered_current_val);
|
||||
$key_ordered_current_val =
|
||||
htmlspecialchars(PMA_substr($key_ordered_current_val, 0,
|
||||
$cfg['LimitChars']) . '...');
|
||||
}
|
||||
|
||||
if (! empty($data)) {
|
||||
$val_ordered_current_equals_data = $val_ordered_current_key == $data;
|
||||
$key_ordered_current_equals_data = $key_ordered_current_key == $data;
|
||||
}
|
||||
|
||||
?>
|
||||
<tr class="<?php echo $odd_row ? 'odd' : 'even'; $odd_row = ! $odd_row; ?>">
|
||||
<td nowrap="nowrap">
|
||||
<?php
|
||||
echo ($key_ordered_current_equals_data ? '<strong>' : '')
|
||||
.'<a href="#" title="' . $strUseThisValue
|
||||
. ($key_ordered_current_val_title != '' ? ': ' . $key_ordered_current_val_title : '') . '"'
|
||||
.' onclick="formupdate(\'' . md5($field) . '\', \''
|
||||
. PMA_jsFormat($key_ordered_current_key, false) . '\'); return false;">'
|
||||
.htmlspecialchars($key_ordered_current_key) . '</a>' . ($key_ordered_current_equals_data ? '</strong>' : '');
|
||||
?></td>
|
||||
<td>
|
||||
<?php
|
||||
echo ($key_ordered_current_equals_data ? '<strong>' : '')
|
||||
. '<a href="#" title="' . $strUseThisValue . ($key_ordered_current_val_title != '' ? ': '
|
||||
. $key_ordered_current_val_title : '') . '" onclick="formupdate(\''
|
||||
. md5($field) . '\', \'' . PMA_jsFormat($key_ordered_current_key, false) . '\'); return false;">'
|
||||
. $key_ordered_current_val . '</a>' . ($key_ordered_current_equals_data ? '</strong>' : '');
|
||||
?></td>
|
||||
<td width="20%">
|
||||
<img src="<?php echo $GLOBALS['pmaThemeImage'] . 'spacer.png'; ?>"
|
||||
alt="" width="1" height="1"></td>
|
||||
|
||||
<td>
|
||||
<?php
|
||||
echo ($val_ordered_current_equals_data ? '<strong>' : '')
|
||||
. '<a href="#" title="' . $strUseThisValue . ($val_ordered_current_val_title != '' ? ': '
|
||||
. $val_ordered_current_val_title : '') . '" onclick="formupdate(\'' . md5($field)
|
||||
. '\', \'' . PMA_jsFormat($val_ordered_current_key, false) . '\'); return false;">'
|
||||
. $val_ordered_current_val . '</a>' . ($val_ordered_current_equals_data ? '</strong>' : '');
|
||||
?></td>
|
||||
<td nowrap="nowrap">
|
||||
<?php
|
||||
echo ($val_ordered_current_equals_data ? '<strong>' : '') . '<a href="#" title="'
|
||||
. $strUseThisValue . ($val_ordered_current_val_title != '' ? ': ' . $val_ordered_current_val_title : '')
|
||||
. '" onclick="formupdate(\'' . md5($field) . '\', \''
|
||||
. PMA_jsFormat($val_ordered_current_key, false) . '\'); return false;">' . htmlspecialchars($val_ordered_current_key)
|
||||
. '</a>' . ($val_ordered_current_equals_data ? '</strong>' : '');
|
||||
?></td>
|
||||
</tr>
|
||||
<?php
|
||||
} // end while
|
||||
}
|
||||
?>
|
||||
</tbody>
|
||||
</table>
|
||||
|
||||
</body>
|
||||
</html>
|
||||
@@ -1,101 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* @author Raj Kissu Rajandran
|
||||
* @version 1.0
|
||||
* @package BLOBStreaming
|
||||
*/
|
||||
|
||||
/**
|
||||
* Core library.
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
|
||||
/**
|
||||
* @var string contains database name
|
||||
*/
|
||||
$bsDB = isset($_REQUEST['bs_db']) ? urldecode($_REQUEST['bs_db']) : NULL;
|
||||
|
||||
/**
|
||||
* @var string contains table name
|
||||
*/
|
||||
$bsTable = isset($_REQUEST['bs_table']) ? urldecode($_REQUEST['bs_table']) : NULL;
|
||||
|
||||
/**
|
||||
* @var string contains BLOB reference
|
||||
*/
|
||||
$bsReference = isset($_REQUEST['bs_reference']) ? urldecode($_REQUEST['bs_reference']) : NULL;
|
||||
|
||||
/**
|
||||
* @var string contains MIME type
|
||||
*/
|
||||
$bsNewMIMEType = isset($_REQUEST['bs_new_mime_type']) ? urldecode($_REQUEST['bs_new_mime_type']) : NULL;
|
||||
|
||||
// necessary variables exist
|
||||
if ($bsDB && $bsTable && $bsReference && $bsNewMIMEType)
|
||||
{
|
||||
// load PMA configuration
|
||||
$PMA_Config = $_SESSION['PMA_Config'];
|
||||
|
||||
// if PMA configuration exists
|
||||
if (!empty($PMA_Config))
|
||||
{
|
||||
// if BS plugins exist
|
||||
if ($PMA_Config->get('BLOBSTREAMING_PLUGINS_EXIST'))
|
||||
{
|
||||
$pbms_ref_tbl = $PMA_Config->get('PBMS_NAME') . '_reference';
|
||||
$pbms_cust_content_type_tbl = $PMA_Config->get('PBMS_NAME') . '_custom_content_type';
|
||||
|
||||
// if specified DB is selected
|
||||
if (PMA_DBI_select_db($bsDB))
|
||||
{
|
||||
$query = "SELECT * FROM " . PMA_backquote($pbms_ref_tbl);
|
||||
$query .= " WHERE Blob_url='" . PMA_sqlAddslashes($bsReference) . "'";
|
||||
|
||||
$result = PMA_DBI_query($query);
|
||||
|
||||
// if record exists
|
||||
if ($data = PMA_DBI_fetch_assoc($result))
|
||||
{
|
||||
$query = "SELECT count(*) FROM " . PMA_backquote($pbms_cust_content_type_tbl);
|
||||
$query .= " WHERE Blob_url='" . PMA_sqlAddslashes($bsReference) . "'";
|
||||
|
||||
$result = PMA_DBI_query($query);
|
||||
|
||||
// if record exists
|
||||
if ($data = PMA_DBI_fetch_assoc($result))
|
||||
{
|
||||
if (1 == $data['count(*)'])
|
||||
{
|
||||
$query = "UPDATE " . PMA_backquote($pbms_cust_content_type_tbl) . " SET Content_type='";
|
||||
$query .= PMA_sqlAddslashes($bsNewMIMEType) . "' WHERE Blob_url='" . PMA_sqlAddslashes($bsReference) . "'";
|
||||
}
|
||||
else
|
||||
{
|
||||
$query = "INSERT INTO " . PMA_backquote($pbms_cust_content_type_tbl) . " (Blob_url, Content_type)";
|
||||
$query .= " VALUES('" . PMA_sqlAddslashes($bsReference) . "', '" . PMA_sqlAddslashes($bsNewMIMEType) . "')";
|
||||
}
|
||||
|
||||
$result = PMA_DBI_query($query);
|
||||
|
||||
// if query execution succeeded
|
||||
if ($result)
|
||||
{
|
||||
// determine redirector page
|
||||
$newLoc = $cfg['PmaAbsoluteUri'] . 'sql.php?' . PMA_generate_common_url ('','', '&') . (isset($bsDB) ? '&db=' . urlencode($bsDB) : '') . (isset($bsTable) ? '&table=' . urlencode($bsTable) : '') . (isset($token) ? '&token=' . urlencode($token) : '') . (isset($goto) ? '&goto=' . urlencode($goto) : '') . '&reload=1&purge=1';
|
||||
|
||||
// redirect to specified page
|
||||
?>
|
||||
<script>
|
||||
window.location = "<?php echo $newLoc ?>";
|
||||
</script>
|
||||
<?php
|
||||
} // end if ($result)
|
||||
} // end if ($data = PMA_DBI_fetch_assoc($result))
|
||||
} // end if ($data = PMA_DBI_fetch_assoc($result))
|
||||
} // end if (PMA_DBI_select_db($bsDB))
|
||||
} // end if ($PMA_Config->get('BLOBSTREAMING_PLUGINS_EXIST'))
|
||||
} // end if (!empty($PMA_Config))
|
||||
} // end if ($bsDB && $bsTable && $bsReference && $bsNewMIMEType)
|
||||
|
||||
?>
|
||||
@@ -1,70 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* @author Raj Kissu Rajandran
|
||||
* @version 1.0
|
||||
* @package BLOBStreaming
|
||||
*/
|
||||
|
||||
/**
|
||||
* Core library.
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
|
||||
// load PMA configuration
|
||||
$PMA_Config = $_SESSION['PMA_Config'];
|
||||
|
||||
// retrieve BS server variables from PMA configuration
|
||||
$bs_server = $PMA_Config->get('BLOBSTREAMING_SERVER');
|
||||
if (empty($bs_server)) die('No blob streaming server configured!');
|
||||
|
||||
// Check URL parameters
|
||||
PMA_checkParameters(array('reference', 'c_type'));
|
||||
|
||||
// Increase time limit, because fetching blob might take some time
|
||||
set_time_limit(0);
|
||||
|
||||
$reference = $_REQUEST['reference'];
|
||||
/*
|
||||
* FIXME: Maybe it would be better to check MIME type against whitelist as
|
||||
* this code sems to support only few MIME types (check
|
||||
* function PMA_BS_CreateReferenceLink in libraries/blobstreaming.lib.php).
|
||||
*/
|
||||
$c_type = preg_replace('/[^A-Za-z0-9/_-]/', '_', $_REQUEST['c_type']);
|
||||
|
||||
$filename = 'http://' . $bs_server . '/' . $reference;
|
||||
|
||||
$hdrs = get_headers($filename, 1);
|
||||
|
||||
if ($hdrs === FALSE) die('Failed to fetch headers');
|
||||
|
||||
$fHnd = fopen($filename, "rb");
|
||||
|
||||
if ($fHnd === FALSE) die('Failed to open remote URL');
|
||||
|
||||
$f_size = $hdrs['Content-Length'];
|
||||
|
||||
header("Expires: 0");
|
||||
header("Last-Modified: " . gmdate("D, d M Y H:i:s") . " GMT");
|
||||
header("Cache-Control: no-store, no-cache, must-revalidate");
|
||||
header("Cache-Control: post-check=0, pre-check=0", false);
|
||||
header("Pragma: no-cache");
|
||||
header("Content-type: $c_type");
|
||||
header('Content-length: ' . $f_size);
|
||||
header("Content-disposition: attachment; filename=" . basename($filename));
|
||||
|
||||
$pos = 0;
|
||||
$content = "";
|
||||
|
||||
while (!feof($fHnd)) {
|
||||
$content .= fread($fHnd, $f_size);
|
||||
$pos = strlen($content);
|
||||
|
||||
if ($pos >= $f_size)
|
||||
break;
|
||||
}
|
||||
|
||||
echo $content;
|
||||
flush();
|
||||
|
||||
fclose($fHnd);
|
||||
@@ -1,77 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* @author Raj Kissu Rajandran
|
||||
* @version 1.0
|
||||
* @package BLOBStreaming
|
||||
*/
|
||||
|
||||
/**
|
||||
* Core library.
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
|
||||
/*
|
||||
* @var string contains media type of BLOB reference
|
||||
*/
|
||||
$mediaType = isset($_REQUEST['media_type']) ? $_REQUEST['media_type'] : NULL;
|
||||
|
||||
/*
|
||||
* @var string indicates whether media type is of custom type
|
||||
*/
|
||||
$customType = isset($_REQUEST['custom_type']) ? $_REQUEST['custom_type'] : false;
|
||||
|
||||
/*
|
||||
* @var string contains BLOB reference
|
||||
*/
|
||||
$bsReference = isset($_REQUEST['bs_reference']) ? $_REQUEST['bs_reference'] : NULL;
|
||||
|
||||
// if media type and BS reference are specified
|
||||
if (isset($mediaType) && isset($bsReference))
|
||||
{
|
||||
// load PMA configuration
|
||||
$PMA_Config = $_SESSION['PMA_Config'];
|
||||
|
||||
// if PMA configuration exists
|
||||
if (!empty($PMA_Config))
|
||||
{
|
||||
// retrieve BS server variables from PMA configuration
|
||||
$bs_server = $PMA_Config->get('BLOBSTREAMING_SERVER');
|
||||
if (empty($bs_server)) die('No blob streaming server configured!');
|
||||
|
||||
$bs_file_path = "http://" . $bs_server . '/' . $bsReference;
|
||||
|
||||
if (isset($customType) && $customType)
|
||||
|
||||
$bs_file_path = 'bs_disp_as_mime_type.php' . PMA_generate_common_url(array('reference' => $bsReference, 'c_type' => $mediaType));
|
||||
|
||||
?>
|
||||
<html>
|
||||
<head>
|
||||
</head>
|
||||
<body>
|
||||
<?php
|
||||
|
||||
// supported media types
|
||||
switch ($mediaType)
|
||||
{
|
||||
// audio content
|
||||
case 'audio/mpeg':
|
||||
?><embed width=620 height=100 src="<?php echo htmlspecialchars($bs_file_path); ?>" autostart=true></embed><?php
|
||||
break;
|
||||
// video content
|
||||
case 'application/x-flash-video':
|
||||
case 'video/mpeg':
|
||||
?><embed width=620 height=460 src="<?php echo htmlspecialchars($bs_file_path); ?>" autostart=true></embed><?php
|
||||
break;
|
||||
default:
|
||||
// do nothing
|
||||
}
|
||||
?>
|
||||
</body>
|
||||
</html>
|
||||
<?php
|
||||
} // end if (!empty($PMA_Config))
|
||||
} // end if (isset($mediaType) && isset($bsReference))
|
||||
|
||||
?>
|
||||
32
calendar.php
32
calendar.php
@@ -1,32 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
*
|
||||
* @version $Id$
|
||||
* @package phpMyAdmin
|
||||
*/
|
||||
|
||||
/**
|
||||
*
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
require_once './libraries/header_http.inc.php';
|
||||
$page_title = $strCalendar;
|
||||
require './libraries/header_meta_style.inc.php';
|
||||
$GLOBALS['js_include'][] = 'common.js';
|
||||
$GLOBALS['js_include'][] = 'tbl_change.js';
|
||||
require './libraries/header_scripts.inc.php';
|
||||
?>
|
||||
<script type="text/javascript">
|
||||
//<![CDATA[
|
||||
var month_names = new Array("<?php echo implode('","', $month); ?>");
|
||||
var day_names = new Array("<?php echo implode('","', $day_of_week); ?>");
|
||||
var submit_text = "<?php echo $strGo . ' (' . $strTime . ')'; ?>";
|
||||
//]]>
|
||||
</script>
|
||||
</head>
|
||||
<body onload="initCalendar();">
|
||||
<div id="calendar_data"></div>
|
||||
<div id="clock_data"></div>
|
||||
</body>
|
||||
</html>
|
||||
108
changelog.php
108
changelog.php
@@ -1,108 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* Simple script to set correct charset for changelog
|
||||
*
|
||||
* @version $Id$
|
||||
* @package phpMyAdmin
|
||||
*/
|
||||
|
||||
/**
|
||||
* Load paths.
|
||||
*/
|
||||
require('./libraries/vendor_config.php');
|
||||
|
||||
/**
|
||||
* Read changelog.
|
||||
*/
|
||||
if (substr(CHANGELOG_FILE, -3) == '.gz') {
|
||||
ob_start();
|
||||
readgzfile(CHANGELOG_FILE);
|
||||
$changelog = ob_get_contents();
|
||||
ob_end_clean();
|
||||
} else {
|
||||
$changelog = file_get_contents(CHANGELOG_FILE);
|
||||
}
|
||||
|
||||
/**
|
||||
* Whole changelog in variable.
|
||||
*/
|
||||
$changelog = htmlspecialchars($changelog);
|
||||
|
||||
$replaces = array(
|
||||
'@(http://[./a-zA-Z0-9.-_-]*[/a-zA-Z0-9_])@'
|
||||
=> '<a href="\\1">\\1</a>',
|
||||
|
||||
// sourceforge users
|
||||
'/([0-9]{4}-[0-9]{2}-[0-9]{2}) (.+[^ ]) +<(.*)@users.sourceforge.net>/i'
|
||||
=> '\\1 <a href="https://sourceforge.net/users/\\3/">\\2</a>',
|
||||
'/thanks to ([^\(\r\n]+) \(([-\w]+)\)/i'
|
||||
=> 'thanks to <a href="https://sourceforge.net/users/\\2/">\\1</a>',
|
||||
'/thanks to ([^\(\r\n]+) -\s+([-\w]+)/i'
|
||||
=> 'thanks to <a href="https://sourceforge.net/users/\\2/">\\1</a>',
|
||||
|
||||
// mail adresse
|
||||
'/([0-9]{4}-[0-9]{2}-[0-9]{2}) (.+[^ ]) +<(.*@.*)>/i'
|
||||
=> '\\1 <a href="mailto:\\3">\\2</a>',
|
||||
|
||||
// linking patches
|
||||
'/patch\s*#?([0-9]{6,})/i'
|
||||
=> '<a href="https://sourceforge.net/support/tracker.php?aid=\\1">patch #\\1</a>',
|
||||
|
||||
// linking RFE
|
||||
'/(?:rfe|feature)\s*#?([0-9]{6,})/i'
|
||||
=> '<a href="https://sourceforge.net/support/tracker.php?aid=\\1">RFE #\\1</a>',
|
||||
|
||||
// linking files
|
||||
'/(\s+)([\\/a-z_0-9\.]+\.(?:php3?|html|pl|js|sh))/i'
|
||||
=> '\\1<a href="http://phpmyadmin.svn.sourceforge.net/viewvc/phpmyadmin/trunk/phpMyAdmin/\\2?annotate=HEAD">\\2</a>',
|
||||
|
||||
// FAQ entries
|
||||
'/FAQ ([0-9]+)\.([0-9a-z]+)/i'
|
||||
=> '<a href="http://localhost/phpMyAdmin/Documentation.html#faq\\1_\\2">FAQ \\1.\\2</a>',
|
||||
|
||||
// linking bugs
|
||||
'/bug\s*#?([0-9]{6,})/i'
|
||||
=> '<a href="https://sourceforge.net/support/tracker.php?aid=\\1">bug #\\1</a>',
|
||||
|
||||
// all other 6+ digit numbers are treated as bugs
|
||||
'/(?<!BUG|RFE|patch) #?([0-9]{6,})/i'
|
||||
=> ' <a href="https://sourceforge.net/support/tracker.php?aid=\\1">bug #\\1</a>',
|
||||
|
||||
// CVE/CAN entries
|
||||
'/((CAN|CVE)-[0-9]+-[0-9]+)/'
|
||||
=> '<a href="http://cve.mitre.org/cgi-bin/cvename.cgi?name=\\1">\\1</a>',
|
||||
|
||||
// Highlight releases (with links)
|
||||
'/(( ### )(([0-9]+)\.([0-9]+)\.([0-9]+)\.([0-9]+) (.*)))/'
|
||||
=> '<a name="\\4_\\5_\\6_\\7"></a>\\2<a href="http://svn.sourceforge.net/viewvc/phpmyadmin/tags/RELEASE_\\4_\\5_\\6_\\7/phpMyAdmin">\\4.\\5.\\6.\\7 \\8</a>',
|
||||
'/(( ### )(([0-9]+)\.([0-9]+)\.([0-9]+) (.*)))/'
|
||||
=> '<a name="\\4_\\5_\\6_\\7"></a>\\2<a href="http://svn.sourceforge.net/viewvc/phpmyadmin/tags/RELEASE_\\4_\\5_\\6/phpMyAdmin">\\4.\\5.\\6 \\7</a>',
|
||||
|
||||
// Highlight releases (not linkable)
|
||||
'/( ### )(.*)/'
|
||||
=> '\\1<b>\\2</b>',
|
||||
|
||||
);
|
||||
|
||||
header('Content-type: text/html; charset=utf-8');
|
||||
echo '<?xml version="1.0" encoding="utf-8"?'.'>';
|
||||
?>
|
||||
<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN"
|
||||
"http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
|
||||
<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en" lang="en" dir="ltr">
|
||||
<head>
|
||||
<link rel="icon" href="./favicon.ico" type="image/x-icon" />
|
||||
<link rel="shortcut icon" href="./favicon.ico" type="image/x-icon" />
|
||||
<title>phpMyAdmin - ChangeLog</title>
|
||||
<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
|
||||
</head>
|
||||
<body>
|
||||
<h1>phpMyAdmin - ChangeLog</h1>
|
||||
<?php
|
||||
echo '<pre>';
|
||||
echo preg_replace(array_keys($replaces), $replaces, $changelog);
|
||||
echo '</pre>';
|
||||
?>
|
||||
</body>
|
||||
</html>
|
||||
28
chk_rel.php
28
chk_rel.php
@@ -1,28 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
*
|
||||
* @version $Id$
|
||||
* @package phpMyAdmin
|
||||
*/
|
||||
|
||||
/**
|
||||
* Gets some core libraries
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
$GLOBALS['js_include'][] = 'functions.js';
|
||||
require_once './libraries/header.inc.php';
|
||||
require_once './libraries/relation.lib.php';
|
||||
|
||||
|
||||
/**
|
||||
* Gets the relation settings
|
||||
*/
|
||||
$cfgRelation = PMA_getRelationsParam(TRUE);
|
||||
|
||||
|
||||
/**
|
||||
* Displays the footer
|
||||
*/
|
||||
require_once './libraries/footer.inc.php';
|
||||
?>
|
||||
@@ -1,72 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* phpMyAdmin sample configuration, you can use it as base for
|
||||
* manual configuration. For easier setup you can use setup/
|
||||
*
|
||||
* All directives are explained in Documentation.html and on phpMyAdmin
|
||||
* wiki <http://wiki.phpmyadmin.net>.
|
||||
*
|
||||
* @version $Id$
|
||||
* @package phpMyAdmin
|
||||
*/
|
||||
|
||||
/*
|
||||
* This is needed for cookie based authentication to encrypt password in
|
||||
* cookie
|
||||
*/
|
||||
$cfg['blowfish_secret'] = ''; /* YOU MUST FILL IN THIS FOR COOKIE AUTH! */
|
||||
|
||||
/*
|
||||
* Servers configuration
|
||||
*/
|
||||
$i = 0;
|
||||
|
||||
/*
|
||||
* First server
|
||||
*/
|
||||
$i++;
|
||||
/* Authentication type */
|
||||
$cfg['Servers'][$i]['auth_type'] = 'cookie';
|
||||
/* Server parameters */
|
||||
$cfg['Servers'][$i]['host'] = 'localhost';
|
||||
$cfg['Servers'][$i]['connect_type'] = 'tcp';
|
||||
$cfg['Servers'][$i]['compress'] = false;
|
||||
/* Select mysqli if your server has it */
|
||||
$cfg['Servers'][$i]['extension'] = 'mysql';
|
||||
$cfg['Servers'][$i]['AllowNoPassword'] = false;
|
||||
|
||||
/* rajk - for blobstreaming */
|
||||
$cfg['Servers'][$i]['bs_garbage_threshold'] = 50;
|
||||
$cfg['Servers'][$i]['bs_repository_threshold'] = '32M';
|
||||
$cfg['Servers'][$i]['bs_temp_blob_timeout'] = 600;
|
||||
$cfg['Servers'][$i]['bs_temp_log_threshold'] = '32M';
|
||||
|
||||
/* User for advanced features */
|
||||
// $cfg['Servers'][$i]['controluser'] = 'pma';
|
||||
// $cfg['Servers'][$i]['controlpass'] = 'pmapass';
|
||||
/* Advanced phpMyAdmin features */
|
||||
// $cfg['Servers'][$i]['pmadb'] = 'phpmyadmin';
|
||||
// $cfg['Servers'][$i]['bookmarktable'] = 'pma_bookmark';
|
||||
// $cfg['Servers'][$i]['relation'] = 'pma_relation';
|
||||
// $cfg['Servers'][$i]['table_info'] = 'pma_table_info';
|
||||
// $cfg['Servers'][$i]['table_coords'] = 'pma_table_coords';
|
||||
// $cfg['Servers'][$i]['pdf_pages'] = 'pma_pdf_pages';
|
||||
// $cfg['Servers'][$i]['column_info'] = 'pma_column_info';
|
||||
// $cfg['Servers'][$i]['history'] = 'pma_history';
|
||||
// $cfg['Servers'][$i]['tracking'] = 'pma_tracking';
|
||||
// $cfg['Servers'][$i]['designer_coords'] = 'pma_designer_coords';
|
||||
/* Contrib / Swekey authentication */
|
||||
// $cfg['Servers'][$i]['auth_swekey_config'] = '/etc/swekey-pma.conf';
|
||||
|
||||
/*
|
||||
* End of servers configuration
|
||||
*/
|
||||
|
||||
/*
|
||||
* Directories for saving/loading files from server
|
||||
*/
|
||||
$cfg['UploadDir'] = '';
|
||||
$cfg['SaveDir'] = '';
|
||||
|
||||
?>
|
||||
@@ -1,12 +0,0 @@
|
||||
$Id$
|
||||
|
||||
This directory contains various stuff contributed by users that might be
|
||||
useful to other. There is no guarantee it will work for you.
|
||||
|
||||
Current content of this directory:
|
||||
|
||||
packaging - Contains files needed for creating packages for various
|
||||
distributions. Please prefer official packages from your vendor if
|
||||
possible.
|
||||
|
||||
vim: expandtab ts=4 sw=4 sts=4 tw=78
|
||||
@@ -1,19 +0,0 @@
|
||||
RewriteEngine on
|
||||
|
||||
# Allow only GET and POST verbs
|
||||
RewriteCond %{REQUEST_METHOD} !^(GET|POST)$ [NC,OR]
|
||||
|
||||
# Ban Typical Vulnerability Scanners and others
|
||||
# Kick out Script Kiddies
|
||||
RewriteCond %{HTTP_USER_AGENT} ^(java|curl|wget).* [NC,OR]
|
||||
RewriteCond %{HTTP_USER_AGENT} ^.*(libwww-perl|curl|wget|python|nikto|wkito|pikto|scan|acunetix).* [NC,OR]
|
||||
RewriteCond %{HTTP_USER_AGENT} ^.*(winhttp|HTTrack|clshttp|archiver|loader|email|harvest|extract|grab|miner).* [NC,OR]
|
||||
|
||||
# Ban Search Engines, Crawlers to your administrative panel
|
||||
# No reasons to access from bots
|
||||
# Ultimately Better than the useless robots.txt
|
||||
# Did google respect robots.txt?
|
||||
# Try google: intitle:phpMyAdmin intext:"Welcome to phpMyAdmin *.*.*" intext:"Log in" -wiki -forum -forums -questions intext:"Cookies must be enabled"
|
||||
RewriteCond %{HTTP_USER_AGENT} ^.*(AdsBot-Google|ia_archiver|Scooter|Ask.Jeeves|Baiduspider|Exabot|FAST.Enterprise.Crawler|FAST-WebCrawler|www\.neomo\.de|Gigabot|Mediapartners-Google|Google.Desktop|Feedfetcher-Google|Googlebot|heise-IT-Markt-Crawler|heritrix|ibm.com\cs/crawler|ICCrawler|ichiro|MJ12bot|MetagerBot|msnbot-NewsBlogs|msnbot|msnbot-media|NG-Search|lucene.apache.org|NutchCVS|OmniExplorer_Bot|online.link.validator|psbot0|Seekbot|Sensis.Web.Crawler|SEO.search.Crawler|Seoma.\[SEO.Crawler\]|SEOsearch|Snappy|www.urltrends.com|www.tkl.iis.u-tokyo.ac.jp/~crawler|SynooBot|crawleradmin.t-info@telekom.de|TurnitinBot|voyager|W3.SiteSearch.Crawler|W3C-checklink|W3C_Validator|www.WISEnutbot.com|yacybot|Yahoo-MMCrawler|Yahoo\!.DE.Slurp|Yahoo\!.Slurp|YahooSeeker).* [NC]
|
||||
RewriteRule .* - [F]
|
||||
|
||||
@@ -1,12 +0,0 @@
|
||||
#
|
||||
# MySQL server administration.
|
||||
#
|
||||
Alias /phpMyAdmin /var/www/myadmin
|
||||
|
||||
<Directory /var/www/myadmin>
|
||||
DirectoryIndex index.php
|
||||
Options Indexes Includes ExecCGI
|
||||
AllowOverride None
|
||||
Order deny,allow
|
||||
Allow from all
|
||||
</Directory>
|
||||
@@ -1,163 +0,0 @@
|
||||
%define _myadminpath /var/www/myadmin
|
||||
%define pkgrelease rc1
|
||||
%define microrelease 1
|
||||
|
||||
Name: phpMyAdmin
|
||||
Version: 2.8.0
|
||||
Release: %{pkgrelease}.%{microrelease}
|
||||
License: GPL
|
||||
Group: Applications/Databases/Interfaces
|
||||
Source0: http://prdownloads.sourceforge.net/phpmyadmin/%{name}-%{version}-%{pkgrelease}.tar.bz2
|
||||
Source1: phpMyAdmin-http.conf
|
||||
URL: http://sourceforge.net/projects/phpmyadmin/
|
||||
Requires: mysql
|
||||
Requires: php-mysql
|
||||
Buildarch: noarch
|
||||
BuildRoot: %{_tmppath}/%{name}-root
|
||||
|
||||
Summary: phpMyAdmin - web-based MySQL administration
|
||||
|
||||
%description
|
||||
phpMyAdmin can manage a whole MySQL-server (needs a super-user) but
|
||||
also a single database. To accomplish the latter you'll need a
|
||||
properly set up MySQL-user which can read/write only the desired
|
||||
database. It's up to you to look up the appropiate part in the MySQL
|
||||
manual. Currently phpMyAdmin can:
|
||||
- create and drop databases
|
||||
- create, copy, drop and alter tables
|
||||
- delete, edit and add fields
|
||||
- execute any SQL-statement, even batch-queries
|
||||
- manage keys on fields
|
||||
- load text files into tables
|
||||
- create (*) and read dumps of tables
|
||||
- export (*) and import data to CSV values
|
||||
- administer multiple servers and single databases
|
||||
- check referencial integrity
|
||||
- create complex queries automatically connecting required tables
|
||||
- create PDF graphics of your database layout
|
||||
- communicate in more than 38 different languages
|
||||
|
||||
|
||||
%prep
|
||||
%setup -q -n %{name}-%{version}-%{pkgrelease}
|
||||
|
||||
|
||||
%build
|
||||
|
||||
|
||||
%install
|
||||
[ "${RPM_BUILD_ROOT}" != "/" ] && [ -d "${RPM_BUILD_ROOT}" ] && \
|
||||
rm -rf "${RPM_BUILD_ROOT}"
|
||||
|
||||
# Create directories.
|
||||
|
||||
install -d "${RPM_BUILD_ROOT}%{_myadminpath}"/{css,js,lang,libraries,themes}
|
||||
install -d "${RPM_BUILD_ROOT}%{_myadminpath}"/libraries/{auth,dbg,dbi,engines}
|
||||
install -d "${RPM_BUILD_ROOT}%{_myadminpath}"/libraries/{export,tcpdf,import}
|
||||
install -d "${RPM_BUILD_ROOT}%{_myadminpath}"/libraries/transformations
|
||||
install -d "${RPM_BUILD_ROOT}%{_myadminpath}"/libraries/tcpdf/font
|
||||
install -d "${RPM_BUILD_ROOT}%{_myadminpath}"/themes/{darkblue_orange,original}
|
||||
install -d "${RPM_BUILD_ROOT}%{_myadminpath}"/themes/darkblue_orange/{css,img}
|
||||
install -d "${RPM_BUILD_ROOT}%{_myadminpath}"/themes/original/{css,img}
|
||||
|
||||
# Install files.
|
||||
|
||||
install libraries/config.default.php \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}"/config.inc.php
|
||||
install *.{php,ico} "${RPM_BUILD_ROOT}%{_myadminpath}"/
|
||||
install ChangeLog LICENSE README "${RPM_BUILD_ROOT}%{_myadminpath}"/
|
||||
install Documentation.html docs.css "${RPM_BUILD_ROOT}%{_myadminpath}"/
|
||||
install css/* "${RPM_BUILD_ROOT}%{_myadminpath}/css"/
|
||||
install js/* "${RPM_BUILD_ROOT}%{_myadminpath}/js"/
|
||||
install lang/*.php "${RPM_BUILD_ROOT}%{_myadminpath}/lang"/
|
||||
install libraries/*.php "${RPM_BUILD_ROOT}%{_myadminpath}/libraries"/
|
||||
install libraries/auth/*.php "${RPM_BUILD_ROOT}%{_myadminpath}/libraries/auth"/
|
||||
install libraries/dbg/*.php "${RPM_BUILD_ROOT}%{_myadminpath}/libraries/dbg"/
|
||||
install libraries/dbi/*.php "${RPM_BUILD_ROOT}%{_myadminpath}/libraries/dbi"/
|
||||
install libraries/engines/*.php \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}/libraries/engines"/
|
||||
install libraries/export/*.php \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}/libraries/export"/
|
||||
install libraries/tcpdf/*.php "${RPM_BUILD_ROOT}%{_myadminpath}/libraries/tcpdf"/
|
||||
install libraries/tcpdf/font/*.{php,z} \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}/libraries/tcpdf/font"/
|
||||
install libraries/import/*.php \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}/libraries/import"/
|
||||
install libraries/transformations/*.php \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}/libraries/transformations"/
|
||||
install themes/darkblue_orange/*.{php,png} \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}/themes/darkblue_orange"/
|
||||
install themes/darkblue_orange/css/*.php \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}/themes/darkblue_orange/css"/
|
||||
install themes/darkblue_orange/img/*.{png,ico} \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}/themes/darkblue_orange/img"/
|
||||
install themes/original/*.{php,png} \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}/themes/original"/
|
||||
install themes/original/css/*.php \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}/themes/original/css"/
|
||||
install themes/original/img/*.{png,ico} \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}/themes/original/img"/
|
||||
|
||||
# Create documentation directories.
|
||||
|
||||
DOCROOT="${RPM_BUILD_ROOT}%{_docdir}/%{name}-%{version}"
|
||||
install -d "${DOCROOT}"
|
||||
install -d "${DOCROOT}"/{lang,scripts,transformations}
|
||||
|
||||
# Install documentation files.
|
||||
|
||||
install RELEASE-DATE-* "${DOCROOT}"/
|
||||
install CREDITS ChangeLog INSTALL LICENSE "${DOCROOT}"/
|
||||
install README TODO "${DOCROOT}"/
|
||||
install Documentation.* docs.css "${DOCROOT}"/
|
||||
install translators.html "${DOCROOT}"/
|
||||
install lang/*.sh "${DOCROOT}"/lang/
|
||||
install scripts/* "${DOCROOT}"/scripts/
|
||||
install libraries/tcpdf/README "${DOCROOT}"/README.tcpdf
|
||||
install libraries/import/README "${DOCROOT}"/README.import
|
||||
install libraries/transformations/README "${DOCROOT}"/transformations/
|
||||
install libraries/transformations/TEMPLATE* "${DOCROOT}"/transformations/
|
||||
install libraries/transformations/*.sh "${DOCROOT}"/transformations/
|
||||
|
||||
# Install configuration file for Apache.
|
||||
|
||||
install -d "${RPM_BUILD_ROOT}%{_sysconfdir}/httpd/conf.d"
|
||||
install "%{SOURCE1}" \
|
||||
"${RPM_BUILD_ROOT}%{_sysconfdir}/httpd/conf.d/phpMyAdmin.conf"
|
||||
|
||||
# Generate non-configuration file list.
|
||||
|
||||
(cd "${RPM_BUILD_ROOT}"; ls -d ."%{_myadminpath}"/*) |
|
||||
sed -e '/\/config\.inc\.php$/d' -e 's/^.//' > files.list
|
||||
|
||||
|
||||
|
||||
%clean
|
||||
[ "${RPM_BUILD_ROOT}" != "/" ] && [ -d "${RPM_BUILD_ROOT}" ] && \
|
||||
rm -rf "${RPM_BUILD_ROOT}"
|
||||
|
||||
|
||||
%files -f files.list
|
||||
%defattr(644, root, root, 755)
|
||||
%doc %{_docdir}/%{name}-%{version}
|
||||
%dir %{_myadminpath}
|
||||
%attr(640,root,apache) %config(noreplace) %verify(not size mtime md5) %{_myadminpath}/config.inc.php
|
||||
%config(noreplace) %verify(not size mtime md5) %{_sysconfdir}/httpd/conf.d/*
|
||||
|
||||
|
||||
%changelog
|
||||
* Thu Feb 23 2006 Patrick Monnerat <pm@datasphere.ch>
|
||||
- Version 2.8.0-rc1.1.
|
||||
|
||||
* Thu Dec 22 2005 Patrick Monnerat <patrick.monnerat@econophone.ch>
|
||||
- Path "nullpw" to allow trying connection with null password after failure.
|
||||
- Version 2.7.0-pl1.1.
|
||||
|
||||
* Mon Aug 22 2005 Patrick Monnerat <patrick.monnerat@econophone.ch>
|
||||
- Version 2.6.3-pl1.
|
||||
|
||||
* Wed Jul 21 2004 Patrick Monnerat <patrick.monnerat@econophone.ch>
|
||||
- Version 2.5.7-pl1.
|
||||
|
||||
* Fri Nov 22 2002 Patrick Monnerat <patrick.monnerat@econophone.ch>
|
||||
- Version 2.3.0-rc1.
|
||||
@@ -1,44 +0,0 @@
|
||||
# This is a typical file used to enable Swekey hardware authentication.
|
||||
#
|
||||
# To activate the Swekey authentication add the following line to your config.inc.php file.
|
||||
# $cfg['Servers'][$i]['auth_swekey_config'] = '/etc/swekey-pma.conf';
|
||||
# Then rename this file "swekey-pma.conf" and copy it to the /etc directory.
|
||||
# Add all the Swekey ids you want to grant access to in the file.
|
||||
# After each Swekey id put the corresponding user name.
|
||||
#
|
||||
# If you don't know the id of a Swekey just visit http://www.swekey.com?sel=support
|
||||
# while your Swekey is connected.
|
||||
#
|
||||
# If you need to purchase a Swekey please visit http://phpmyadmin.net/auth_key
|
||||
# since this link provides funding to PhpMyAdmin.
|
||||
#
|
||||
|
||||
0000000000000000000000000000763A:root
|
||||
000000000000000000000000000089E4:steve
|
||||
0000000000000000000000000000231E:scott
|
||||
|
||||
#
|
||||
# It is recommended to include the following lines to contact the
|
||||
# authentication servers in SSL mode.
|
||||
#
|
||||
|
||||
SERVER_CHECK=https://auth-check-ssl.musbe.net
|
||||
SERVER_RNDTOKEN=https://auth-rnd-gen-ssl.musbe.net
|
||||
SERVER_STATUS=https://auth-status-ssl.musbe.net
|
||||
|
||||
#
|
||||
# The path of the root certificate file used to ensure a secure
|
||||
# communication with the authentication servers in SSL mode.
|
||||
# If not specified, will use musbe-ca.crt found in your
|
||||
# phpMyAdmin/libraries/auth/swekey.
|
||||
#
|
||||
|
||||
#CA_FILE=/var/http-root/phpmyadmin/libraries/auth/swekey/musbe-ca.crt
|
||||
|
||||
#
|
||||
# If your server receives many login requests, you can enable the random
|
||||
# token caching to accelerate the authentication process.
|
||||
# Token caching is enabled by default.
|
||||
#
|
||||
|
||||
#ENABLE_TOKEN_CACHE=0
|
||||
@@ -1,53 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
*
|
||||
* @version $Id$
|
||||
* @package phpMyAdmin
|
||||
*/
|
||||
|
||||
/**
|
||||
* Gets some core libraries
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
$GLOBALS['js_include'][] = 'functions.js';
|
||||
require_once './libraries/mysql_charsets.lib.php';
|
||||
|
||||
PMA_checkParameters(array('new_db'));
|
||||
|
||||
/**
|
||||
* Defines the url to return to in case of error in a sql statement
|
||||
*/
|
||||
$err_url = 'main.php?' . PMA_generate_common_url();
|
||||
|
||||
/**
|
||||
* Builds and executes the db creation sql query
|
||||
*/
|
||||
$sql_query = 'CREATE DATABASE ' . PMA_backquote($new_db);
|
||||
if (!empty($db_collation)) {
|
||||
list($db_charset) = explode('_', $db_collation);
|
||||
if (in_array($db_charset, $mysql_charsets) && in_array($db_collation, $mysql_collations[$db_charset])) {
|
||||
$sql_query .= ' DEFAULT' . PMA_generateCharsetQueryPart($db_collation);
|
||||
}
|
||||
unset($db_charset, $db_collation);
|
||||
}
|
||||
$sql_query .= ';';
|
||||
|
||||
$result = PMA_DBI_try_query($sql_query);
|
||||
|
||||
if (! $result) {
|
||||
$message = PMA_Message::rawError(PMA_DBI_getError());
|
||||
// avoid displaying the not-created db name in header or navi panel
|
||||
$GLOBALS['db'] = '';
|
||||
$GLOBALS['table'] = '';
|
||||
require_once './libraries/header.inc.php';
|
||||
require_once './main.php';
|
||||
} else {
|
||||
$message = PMA_Message::success('strDatabaseHasBeenCreated');
|
||||
$message->addParam($new_db);
|
||||
$GLOBALS['db'] = $new_db;
|
||||
|
||||
require_once './libraries/header.inc.php';
|
||||
require_once './' . $cfg['DefaultTabDatabase'];
|
||||
}
|
||||
?>
|
||||
325
db_datadict.php
325
db_datadict.php
@@ -1,325 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
*
|
||||
* @version $Id$
|
||||
* @package phpMyAdmin
|
||||
*/
|
||||
|
||||
/**
|
||||
* Gets the variables sent or posted to this script, then displays headers
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
|
||||
if (!isset($selected_tbl)) {
|
||||
require_once './libraries/header.inc.php';
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Gets the relations settings
|
||||
*/
|
||||
require_once './libraries/relation.lib.php';
|
||||
require_once './libraries/transformations.lib.php';
|
||||
|
||||
$cfgRelation = PMA_getRelationsParam();
|
||||
|
||||
/**
|
||||
* Check parameters
|
||||
*/
|
||||
PMA_checkParameters(array('db'));
|
||||
|
||||
/**
|
||||
* Defines the url to return to in case of error in a sql statement
|
||||
*/
|
||||
if (strlen($table)) {
|
||||
$err_url = 'tbl_sql.php?' . PMA_generate_common_url($db, $table);
|
||||
} else {
|
||||
$err_url = 'db_sql.php?' . PMA_generate_common_url($db);
|
||||
}
|
||||
|
||||
if ($cfgRelation['commwork']) {
|
||||
$comment = PMA_getDbComment($db);
|
||||
|
||||
/**
|
||||
* Displays DB comment
|
||||
*/
|
||||
if ($comment) {
|
||||
?>
|
||||
<p> <?php echo $strDBComment; ?>
|
||||
<i><?php echo htmlspecialchars($comment); ?></i></p>
|
||||
<?php
|
||||
} // end if
|
||||
}
|
||||
|
||||
/**
|
||||
* Selects the database and gets tables names
|
||||
*/
|
||||
PMA_DBI_select_db($db);
|
||||
$rowset = PMA_DBI_query('SHOW TABLES FROM ' . PMA_backquote($db) . ';', null, PMA_DBI_QUERY_STORE);
|
||||
|
||||
$count = 0;
|
||||
while ($row = PMA_DBI_fetch_assoc($rowset)) {
|
||||
$myfieldname = 'Tables_in_' . htmlspecialchars($db);
|
||||
$table = $row[$myfieldname];
|
||||
$comments = PMA_getComments($db, $table);
|
||||
|
||||
if ($count != 0) {
|
||||
echo '<div style="page-break-before: always;">' . "\n";
|
||||
} else {
|
||||
echo '<div>' . "\n";
|
||||
}
|
||||
|
||||
echo '<h2>' . $table . '</h2>' . "\n";
|
||||
|
||||
/**
|
||||
* Gets table informations
|
||||
*/
|
||||
// The 'show table' statement works correct since 3.23.03
|
||||
$num_rows = PMA_Table::sGetStatusInfo($db, $table, 'TABLE_ROWS');
|
||||
$show_comment = PMA_Table::sGetStatusInfo($db, $table, 'TABLE_COMMENT');
|
||||
|
||||
/**
|
||||
* Gets table keys and retains them
|
||||
*/
|
||||
|
||||
PMA_DBI_select_db($db);
|
||||
$result = PMA_DBI_query('SHOW KEYS FROM ' . PMA_backquote($table) . ';');
|
||||
$primary = '';
|
||||
$indexes = array();
|
||||
$lastIndex = '';
|
||||
$indexes_info = array();
|
||||
$indexes_data = array();
|
||||
$pk_array = array(); // will be use to emphasis prim. keys in the table
|
||||
// view
|
||||
while ($row = PMA_DBI_fetch_assoc($result)) {
|
||||
// Backups the list of primary keys
|
||||
if ($row['Key_name'] == 'PRIMARY') {
|
||||
$primary .= $row['Column_name'] . ', ';
|
||||
$pk_array[$row['Column_name']] = 1;
|
||||
}
|
||||
// Retains keys informations
|
||||
if ($row['Key_name'] != $lastIndex){
|
||||
$indexes[] = $row['Key_name'];
|
||||
$lastIndex = $row['Key_name'];
|
||||
}
|
||||
$indexes_info[$row['Key_name']]['Sequences'][] = $row['Seq_in_index'];
|
||||
$indexes_info[$row['Key_name']]['Non_unique'] = $row['Non_unique'];
|
||||
if (isset($row['Cardinality'])) {
|
||||
$indexes_info[$row['Key_name']]['Cardinality'] = $row['Cardinality'];
|
||||
}
|
||||
// I don't know what does following column mean....
|
||||
// $indexes_info[$row['Key_name']]['Packed'] = $row['Packed'];
|
||||
|
||||
$indexes_info[$row['Key_name']]['Comment'] = $row['Comment'];
|
||||
|
||||
$indexes_data[$row['Key_name']][$row['Seq_in_index']]['Column_name'] = $row['Column_name'];
|
||||
if (isset($row['Sub_part'])) {
|
||||
$indexes_data[$row['Key_name']][$row['Seq_in_index']]['Sub_part'] = $row['Sub_part'];
|
||||
}
|
||||
|
||||
} // end while
|
||||
if ($result) {
|
||||
PMA_DBI_free_result($result);
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Gets fields properties
|
||||
*/
|
||||
$result = PMA_DBI_query('SHOW FIELDS FROM ' . PMA_backquote($table) . ';', null, PMA_DBI_QUERY_STORE);
|
||||
$fields_cnt = PMA_DBI_num_rows($result);
|
||||
|
||||
if (PMA_MYSQL_INT_VERSION < 50025) {
|
||||
// We need this to correctly learn if a TIMESTAMP is NOT NULL, since
|
||||
// SHOW FULL FIELDS or INFORMATION_SCHEMA incorrectly says NULL
|
||||
// and SHOW CREATE TABLE says NOT NULL
|
||||
// http://bugs.mysql.com/20910.
|
||||
|
||||
$show_create_table = PMA_DBI_fetch_value(
|
||||
'SHOW CREATE TABLE ' . PMA_backquote($db) . '.' . PMA_backquote($table),
|
||||
0, 1);
|
||||
$analyzed_sql = PMA_SQP_analyze(PMA_SQP_parse($show_create_table));
|
||||
}
|
||||
|
||||
// Check if we can use Relations (Mike Beck)
|
||||
if (!empty($cfgRelation['relation'])) {
|
||||
// Find which tables are related with the current one and write it in
|
||||
// an array
|
||||
$res_rel = PMA_getForeigners($db, $table);
|
||||
|
||||
if (count($res_rel) > 0) {
|
||||
$have_rel = TRUE;
|
||||
} else {
|
||||
$have_rel = FALSE;
|
||||
}
|
||||
} else {
|
||||
$have_rel = FALSE;
|
||||
} // end if
|
||||
|
||||
|
||||
/**
|
||||
* Displays the comments of the table if MySQL >= 3.23
|
||||
*/
|
||||
if (!empty($show_comment)) {
|
||||
echo $strTableComments . ': ' . htmlspecialchars($show_comment) . '<br /><br />';
|
||||
}
|
||||
|
||||
/**
|
||||
* Displays the table structure
|
||||
*/
|
||||
?>
|
||||
|
||||
<table width="100%" class="print">
|
||||
<tr><th width="50"><?php echo $strField; ?></th>
|
||||
<th width="80"><?php echo $strType; ?></th>
|
||||
<?php /* <th width="50"><?php echo $strAttr; ?></th>*/ ?>
|
||||
<th width="40"><?php echo $strNull; ?></th>
|
||||
<th width="70"><?php echo $strDefault; ?></th>
|
||||
<?php /* <th width="50"><?php echo $strExtra; ?></th>*/ ?>
|
||||
<?php
|
||||
if ($have_rel) {
|
||||
echo ' <th>' . $strLinksTo . '</th>' . "\n";
|
||||
}
|
||||
echo ' <th>' . $strComments . '</th>' . "\n";
|
||||
if ($cfgRelation['mimework']) {
|
||||
echo ' <th>MIME</th>' . "\n";
|
||||
}
|
||||
?>
|
||||
</tr>
|
||||
<?php
|
||||
$odd_row = true;
|
||||
while ($row = PMA_DBI_fetch_assoc($result)) {
|
||||
|
||||
if ($row['Null'] == '') {
|
||||
$row['Null'] = 'NO';
|
||||
}
|
||||
$type = $row['Type'];
|
||||
// reformat mysql query output - staybyte - 9. June 2001
|
||||
// loic1: set or enum types: slashes single quotes inside options
|
||||
if (preg_match('@^(set|enum)\((.+)\)$@i', $type, $tmp)) {
|
||||
$tmp[2] = substr(preg_replace('@([^,])\'\'@', '\\1\\\'', ',' . $tmp[2]), 1);
|
||||
$type = $tmp[1] . '(' . str_replace(',', ', ', $tmp[2]) . ')';
|
||||
$type_nowrap = '';
|
||||
|
||||
$binary = 0;
|
||||
$unsigned = 0;
|
||||
$zerofill = 0;
|
||||
} else {
|
||||
$binary = stristr($row['Type'], 'binary');
|
||||
$unsigned = stristr($row['Type'], 'unsigned');
|
||||
$zerofill = stristr($row['Type'], 'zerofill');
|
||||
$type_nowrap = ' nowrap="nowrap"';
|
||||
$type = preg_replace('@BINARY@i', '', $type);
|
||||
$type = preg_replace('@ZEROFILL@i', '', $type);
|
||||
$type = preg_replace('@UNSIGNED@i', '', $type);
|
||||
if (empty($type)) {
|
||||
$type = ' ';
|
||||
}
|
||||
}
|
||||
$strAttribute = ' ';
|
||||
if ($binary) {
|
||||
$strAttribute = 'BINARY';
|
||||
}
|
||||
if ($unsigned) {
|
||||
$strAttribute = 'UNSIGNED';
|
||||
}
|
||||
if ($zerofill) {
|
||||
$strAttribute = 'UNSIGNED ZEROFILL';
|
||||
}
|
||||
if (!isset($row['Default'])) {
|
||||
if ($row['Null'] != 'NO') {
|
||||
$row['Default'] = '<i>NULL</i>';
|
||||
}
|
||||
} else {
|
||||
$row['Default'] = htmlspecialchars($row['Default']);
|
||||
}
|
||||
$field_name = htmlspecialchars($row['Field']);
|
||||
|
||||
if (PMA_MYSQL_INT_VERSION < 50025
|
||||
&& ! empty($analyzed_sql[0]['create_table_fields'][$field_name]['type'])
|
||||
&& $analyzed_sql[0]['create_table_fields'][$field_name]['type'] == 'TIMESTAMP'
|
||||
&& $analyzed_sql[0]['create_table_fields'][$field_name]['timestamp_not_null']) {
|
||||
// here, we have a TIMESTAMP that SHOW FULL FIELDS reports as having the
|
||||
// NULL attribute, but SHOW CREATE TABLE says the contrary. Believe
|
||||
// the latter.
|
||||
/**
|
||||
* @todo merge this logic with the one in tbl_structure.php
|
||||
* or move it in a function similar to PMA_DBI_get_columns_full()
|
||||
* but based on SHOW CREATE TABLE because information_schema
|
||||
* cannot be trusted in this case (MySQL bug)
|
||||
*/
|
||||
$row['Null'] = 'NO';
|
||||
}
|
||||
?>
|
||||
<tr class="<?php echo $odd_row ? 'odd' : 'even'; $odd_row = ! $odd_row; ?>">
|
||||
<td nowrap="nowrap">
|
||||
<?php
|
||||
if (isset($pk_array[$row['Field']])) {
|
||||
echo '<u>' . $field_name . '</u>';
|
||||
} else {
|
||||
echo $field_name;
|
||||
}
|
||||
?>
|
||||
</td>
|
||||
<td<?php echo $type_nowrap; ?> xml:lang="en" dir="ltr"><?php echo $type; ?></td>
|
||||
<?php /* <td<?php echo $type_nowrap; ?>><?php echo $strAttribute; ?></td>*/ ?>
|
||||
<td><?php echo (($row['Null'] == 'NO') ? $strNo : $strYes); ?></td>
|
||||
<td nowrap="nowrap"><?php if (isset($row['Default'])) { echo $row['Default']; } ?></td>
|
||||
<?php /* <td<?php echo $type_nowrap; ?>><?php echo $row['Extra']; ?></td>*/ ?>
|
||||
<?php
|
||||
if ($have_rel) {
|
||||
echo ' <td>';
|
||||
if (isset($res_rel[$field_name])) {
|
||||
echo htmlspecialchars($res_rel[$field_name]['foreign_table'] . ' -> ' . $res_rel[$field_name]['foreign_field']);
|
||||
}
|
||||
echo '</td>' . "\n";
|
||||
}
|
||||
echo ' <td>';
|
||||
if (isset($comments[$field_name])) {
|
||||
echo htmlspecialchars($comments[$field_name]);
|
||||
}
|
||||
echo '</td>' . "\n";
|
||||
if ($cfgRelation['mimework']) {
|
||||
$mime_map = PMA_getMIME($db, $table, true);
|
||||
|
||||
echo ' <td>';
|
||||
if (isset($mime_map[$field_name])) {
|
||||
echo htmlspecialchars(str_replace('_', '/', $mime_map[$field_name]['mimetype']));
|
||||
}
|
||||
echo '</td>' . "\n";
|
||||
}
|
||||
?>
|
||||
</tr>
|
||||
<?php
|
||||
} // end while
|
||||
PMA_DBI_free_result($result);
|
||||
$count++;
|
||||
?>
|
||||
</table>
|
||||
</div>
|
||||
<?php
|
||||
} //ends main while
|
||||
|
||||
/**
|
||||
* Displays the footer
|
||||
*/
|
||||
?>
|
||||
<script type="text/javascript">
|
||||
//<![CDATA[
|
||||
function printPage()
|
||||
{
|
||||
document.getElementById('print').style.visibility = 'hidden';
|
||||
// Do print the page
|
||||
if (typeof(window.print) != 'undefined') {
|
||||
window.print();
|
||||
}
|
||||
document.getElementById('print').style.visibility = '';
|
||||
}
|
||||
//]]>
|
||||
</script>
|
||||
<?php
|
||||
echo '<br /><br /><input type="button" id="print" value="' . $strPrint . '" onclick="printPage()" />';
|
||||
|
||||
require_once './libraries/footer.inc.php';
|
||||
?>
|
||||
@@ -1,77 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* dumps a database
|
||||
*
|
||||
* @version $Id$
|
||||
* @uses libraries/db_common.inc.php
|
||||
* @uses libraries/db_info.inc.php
|
||||
* @uses libraries/display_export.lib.php
|
||||
* @uses $tables from libraries/db_info.inc.php
|
||||
* @package phpMyAdmin
|
||||
*/
|
||||
|
||||
/**
|
||||
* Gets some core libraries
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
|
||||
// $sub_part is also used in db_info.inc.php to see if we are coming from
|
||||
// db_export.php, in which case we don't obey $cfg['MaxTableList']
|
||||
$sub_part = '_export';
|
||||
require_once './libraries/db_common.inc.php';
|
||||
$url_query .= '&goto=db_export.php';
|
||||
require_once './libraries/db_info.inc.php';
|
||||
|
||||
/**
|
||||
* Displays the form
|
||||
*/
|
||||
$export_page_title = $strViewDumpDB;
|
||||
|
||||
// exit if no tables in db found
|
||||
if ($num_tables < 1) {
|
||||
PMA_Message::error('strNoTablesFound')->display();
|
||||
require './libraries/footer.inc.php';
|
||||
exit;
|
||||
} // end if
|
||||
|
||||
$checkall_url = 'db_export.php?'
|
||||
. PMA_generate_common_url($db)
|
||||
. '&goto=db_export.php';
|
||||
|
||||
$multi_values = '<div align="center">';
|
||||
$multi_values .= '<a href="' . $checkall_url . '" onclick="setSelectOptions(\'dump\', \'table_select[]\', true); return false;">' . $strSelectAll . '</a>
|
||||
/
|
||||
<a href="' . $checkall_url . '&unselectall=1" onclick="setSelectOptions(\'dump\', \'table_select[]\', false); return false;">' . $strUnselectAll . '</a><br />';
|
||||
|
||||
$multi_values .= '<select name="table_select[]" size="10" multiple="multiple">';
|
||||
$multi_values .= "\n";
|
||||
|
||||
if (!empty($selected_tbl) && empty($table_select)) {
|
||||
$table_select = $selected_tbl;
|
||||
}
|
||||
|
||||
foreach ($tables as $each_table) {
|
||||
if (! empty($unselectall)
|
||||
|| (! empty($table_select) && !in_array($each_table['Name'], $table_select))) {
|
||||
$is_selected = '';
|
||||
} else {
|
||||
$is_selected = ' selected="selected"';
|
||||
}
|
||||
$table_html = htmlspecialchars($each_table['Name']);
|
||||
$multi_values .= ' <option value="' . $table_html . '"'
|
||||
. $is_selected . '>'
|
||||
. str_replace(' ', ' ', $table_html) . '</option>' . "\n";
|
||||
} // end for
|
||||
|
||||
$multi_values .= "\n";
|
||||
$multi_values .= '</select></div><br />';
|
||||
|
||||
$export_type = 'database';
|
||||
require_once './libraries/display_export.lib.php';
|
||||
|
||||
/**
|
||||
* Displays the footer
|
||||
*/
|
||||
require_once './libraries/footer.inc.php';
|
||||
?>
|
||||
@@ -1,33 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
*
|
||||
* @version $Id$
|
||||
* @package phpMyAdmin
|
||||
*/
|
||||
|
||||
/**
|
||||
*
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
|
||||
/**
|
||||
* Load mootools for upload progress bar
|
||||
*/
|
||||
$GLOBALS['js_include'][] = 'mootools.js';
|
||||
|
||||
/**
|
||||
* Gets tables informations and displays top links
|
||||
*/
|
||||
require './libraries/db_common.inc.php';
|
||||
require './libraries/db_info.inc.php';
|
||||
|
||||
$import_type = 'database';
|
||||
require './libraries/display_import.lib.php';
|
||||
|
||||
/**
|
||||
* Displays the footer
|
||||
*/
|
||||
require './libraries/footer.inc.php';
|
||||
?>
|
||||
|
||||
@@ -1,690 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* handles miscellaneous db operations:
|
||||
* - move/rename
|
||||
* - copy
|
||||
* - changing collation
|
||||
* - changing comment
|
||||
* - adding tables
|
||||
* - viewing PDF schemas
|
||||
*
|
||||
* @version $Id$
|
||||
* @package phpMyAdmin
|
||||
*/
|
||||
|
||||
/**
|
||||
* requirements
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
require_once './libraries/Table.class.php';
|
||||
require_once './libraries/mysql_charsets.lib.php';
|
||||
|
||||
// add blobstreaming library functions
|
||||
require_once "./libraries/blobstreaming.lib.php";
|
||||
|
||||
/**
|
||||
* Rename/move or copy database
|
||||
*/
|
||||
if (strlen($db) && (! empty($db_rename) || ! empty($db_copy))) {
|
||||
|
||||
if (! empty($db_rename)) {
|
||||
$move = true;
|
||||
} else {
|
||||
$move = false;
|
||||
}
|
||||
|
||||
if (!isset($newname) || !strlen($newname)) {
|
||||
$message = PMA_Message::error('strDatabaseEmpty');
|
||||
} else {
|
||||
$sql_query = ''; // in case target db exists
|
||||
$_error = false;
|
||||
if ($move ||
|
||||
(isset($create_database_before_copying) && $create_database_before_copying)) {
|
||||
// lower_case_table_names=1 `DB` becomes `db`
|
||||
$lower_case_table_names = PMA_DBI_fetch_value('SHOW VARIABLES LIKE "lower_case_table_names"', 0, 1);
|
||||
if ($lower_case_table_names === '1') {
|
||||
$newname = strtolower($newname);
|
||||
}
|
||||
|
||||
$local_query = 'CREATE DATABASE ' . PMA_backquote($newname);
|
||||
if (isset($db_collation)) {
|
||||
$local_query .= ' DEFAULT' . PMA_generateCharsetQueryPart($db_collation);
|
||||
}
|
||||
$local_query .= ';';
|
||||
$sql_query = $local_query;
|
||||
PMA_DBI_query($local_query);
|
||||
|
||||
// rebuild the database list because PMA_Table::moveCopy
|
||||
// checks in this list if the target db exists
|
||||
$GLOBALS['pma']->databases->build();
|
||||
}
|
||||
|
||||
if (isset($GLOBALS['add_constraints'])) {
|
||||
$GLOBALS['sql_constraints_query_full_db'] = '';
|
||||
}
|
||||
|
||||
$tables_full = PMA_DBI_get_tables_full($db);
|
||||
$views = array();
|
||||
foreach ($tables_full as $each_table => $tmp) {
|
||||
// to be able to rename a db containing views, we
|
||||
// first collect in $views all the views we find and we
|
||||
// will handle them after the tables
|
||||
/**
|
||||
* @todo support a view of a view
|
||||
*/
|
||||
if (PMA_Table::isView($db, $each_table)) {
|
||||
$views[] = $each_table;
|
||||
continue;
|
||||
}
|
||||
|
||||
$back = $sql_query;
|
||||
$sql_query = '';
|
||||
|
||||
// value of $what for this table only
|
||||
$this_what = $what;
|
||||
|
||||
// do not copy the data from a Merge table
|
||||
// note: on the calling FORM, 'data' means 'structure and data'
|
||||
if ($tables_full[$each_table]['Engine'] == 'MRG_MyISAM') {
|
||||
if ($this_what == 'data') {
|
||||
$this_what = 'structure';
|
||||
}
|
||||
if ($this_what == 'dataonly') {
|
||||
$this_what = 'nocopy';
|
||||
}
|
||||
}
|
||||
|
||||
if ($this_what != 'nocopy') {
|
||||
// keep the triggers from the original db+table
|
||||
// (third param is empty because delimiters are only intended
|
||||
// for importing via the mysql client or our Import feature)
|
||||
$triggers = PMA_DBI_get_triggers($db, $each_table, '');
|
||||
|
||||
if (! PMA_Table::moveCopy($db, $each_table, $newname, $each_table,
|
||||
isset($this_what) ? $this_what : 'data', $move, 'db_copy'))
|
||||
{
|
||||
$_error = true;
|
||||
// $sql_query is filled by PMA_Table::moveCopy()
|
||||
$sql_query = $back . $sql_query;
|
||||
break;
|
||||
}
|
||||
// apply the triggers to the destination db+table
|
||||
if ($triggers) {
|
||||
PMA_DBI_select_db($newname);
|
||||
foreach ($triggers as $trigger) {
|
||||
PMA_DBI_query($trigger['create']);
|
||||
}
|
||||
unset($trigger);
|
||||
}
|
||||
unset($triggers);
|
||||
|
||||
if (isset($GLOBALS['add_constraints'])) {
|
||||
$GLOBALS['sql_constraints_query_full_db'] .= $GLOBALS['sql_constraints_query'];
|
||||
unset($GLOBALS['sql_constraints_query']);
|
||||
}
|
||||
}
|
||||
// $sql_query is filled by PMA_Table::moveCopy()
|
||||
$sql_query = $back . $sql_query;
|
||||
} // end (foreach)
|
||||
unset($each_table);
|
||||
|
||||
// handle the views
|
||||
if (! $_error) {
|
||||
foreach ($views as $view) {
|
||||
if (! PMA_Table::moveCopy($db, $view, $newname, $view,
|
||||
'structure', $move, 'db_copy')) {
|
||||
$_error = true;
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
unset($view, $views);
|
||||
|
||||
// now that all tables exist, create all the accumulated constraints
|
||||
if (! $_error && isset($GLOBALS['add_constraints'])) {
|
||||
/**
|
||||
* @todo this works with mysqli but not with mysql, because
|
||||
* mysql extension does not accept more than one statement; maybe
|
||||
* interface with the sql import plugin that handles statement delimiter
|
||||
*/
|
||||
PMA_DBI_query($GLOBALS['sql_constraints_query_full_db']);
|
||||
|
||||
// and prepare to display them
|
||||
$GLOBALS['sql_query'] .= "\n" . $GLOBALS['sql_constraints_query_full_db'];
|
||||
unset($GLOBALS['sql_constraints_query_full_db']);
|
||||
}
|
||||
|
||||
if (PMA_MYSQL_INT_VERSION >= 50000) {
|
||||
// here I don't use DELIMITER because it's not part of the
|
||||
// language; I have to send each statement one by one
|
||||
|
||||
// to avoid selecting alternatively the current and new db
|
||||
// we would need to modify the CREATE definitions to qualify
|
||||
// the db name
|
||||
$procedure_names = PMA_DBI_get_procedures_or_functions($db, 'PROCEDURE');
|
||||
if ($procedure_names) {
|
||||
foreach($procedure_names as $procedure_name) {
|
||||
PMA_DBI_select_db($db);
|
||||
$tmp_query = PMA_DBI_get_definition($db, 'PROCEDURE', $procedure_name);
|
||||
// collect for later display
|
||||
$GLOBALS['sql_query'] .= "\n" . $tmp_query;
|
||||
PMA_DBI_select_db($newname);
|
||||
PMA_DBI_query($tmp_query);
|
||||
}
|
||||
}
|
||||
|
||||
$function_names = PMA_DBI_get_procedures_or_functions($db, 'FUNCTION');
|
||||
if ($function_names) {
|
||||
foreach($function_names as $function_name) {
|
||||
PMA_DBI_select_db($db);
|
||||
$tmp_query = PMA_DBI_get_definition($db, 'FUNCTION', $function_name);
|
||||
// collect for later display
|
||||
$GLOBALS['sql_query'] .= "\n" . $tmp_query;
|
||||
PMA_DBI_select_db($newname);
|
||||
PMA_DBI_query($tmp_query);
|
||||
}
|
||||
}
|
||||
}
|
||||
// go back to current db, just in case
|
||||
PMA_DBI_select_db($db);
|
||||
|
||||
// Duplicate the bookmarks for this db (done once for each db)
|
||||
if (! $_error && $db != $newname) {
|
||||
$get_fields = array('user', 'label', 'query');
|
||||
$where_fields = array('dbase' => $db);
|
||||
$new_fields = array('dbase' => $newname);
|
||||
PMA_Table::duplicateInfo('bookmarkwork', 'bookmark', $get_fields,
|
||||
$where_fields, $new_fields);
|
||||
}
|
||||
|
||||
if (! $_error && $move) {
|
||||
/**
|
||||
* cleanup pmadb stuff for this db
|
||||
*/
|
||||
require_once './libraries/relation_cleanup.lib.php';
|
||||
PMA_relationsCleanupDatabase($db);
|
||||
|
||||
// if someday the RENAME DATABASE reappears, do not DROP
|
||||
$local_query = 'DROP DATABASE ' . PMA_backquote($db) . ';';
|
||||
$sql_query .= "\n" . $local_query;
|
||||
PMA_DBI_query($local_query);
|
||||
|
||||
$message = PMA_Message::success('strRenameDatabaseOK');
|
||||
$message->addParam($db);
|
||||
$message->addParam($newname);
|
||||
} elseif (! $_error) {
|
||||
$message = PMA_Message::success('strCopyDatabaseOK');
|
||||
$message->addParam($db);
|
||||
$message->addParam($newname);
|
||||
}
|
||||
$reload = true;
|
||||
|
||||
/* Change database to be used */
|
||||
if (! $_error && $move) {
|
||||
$db = $newname;
|
||||
} elseif (! $_error) {
|
||||
if (isset($switch_to_new) && $switch_to_new == 'true') {
|
||||
PMA_setCookie('pma_switch_to_new', 'true');
|
||||
$db = $newname;
|
||||
} else {
|
||||
PMA_setCookie('pma_switch_to_new', '');
|
||||
}
|
||||
}
|
||||
|
||||
if ($_error && ! isset($message)) {
|
||||
$message = PMA_Message::error();
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/*
|
||||
* Enable/Disable/Repair BLOB Repository Monitoring for current database
|
||||
*/
|
||||
if (strlen($db) > 0 && !empty($db_blob_streaming_op))
|
||||
{
|
||||
// load PMA_Config
|
||||
$PMA_Config = $_SESSION['PMA_Config'];
|
||||
|
||||
if (!empty($PMA_Config))
|
||||
{
|
||||
if ($PMA_Config->get('PBXT_NAME') !== strtolower($db))
|
||||
{
|
||||
// if Blobstreaming plugins exist, begin checking for Blobstreaming tables
|
||||
if ($PMA_Config->get('BLOBSTREAMING_PLUGINS_EXIST'))
|
||||
{
|
||||
$bs_tables = $PMA_Config->get('BLOBSTREAMABLE_DATABASES');
|
||||
$bs_tables = $bs_tables[$db];
|
||||
|
||||
$oneBSTableExists = FALSE;
|
||||
|
||||
// check if at least one blobstreaming table exists
|
||||
foreach ($bs_tables as $table_key=>$tbl)
|
||||
if ($bs_tables[$table_key]['Exists'])
|
||||
{
|
||||
$oneBSTableExists = TRUE;
|
||||
break;
|
||||
}
|
||||
|
||||
switch ($db_blob_streaming_op)
|
||||
{
|
||||
// enable BLOB repository monitoring
|
||||
case "enable":
|
||||
// if blobstreaming tables do not exist, create them
|
||||
if (!$oneBSTableExists)
|
||||
PMA_BS_CreateTables($db);
|
||||
break;
|
||||
// disable BLOB repository monitoring
|
||||
case "disable":
|
||||
// if at least one blobstreaming table exists, execute drop
|
||||
if ($oneBSTableExists)
|
||||
PMA_BS_DropTables($db);
|
||||
break;
|
||||
// repair BLOB repository
|
||||
case "repair":
|
||||
// check if a blobstreaming table is missing
|
||||
foreach ($bs_tables as $table_key=>$tbl)
|
||||
if (!$bs_tables[$table_key]['Exists'])
|
||||
{
|
||||
PMA_DBI_select_db($db);
|
||||
PMA_DBI_query(PMA_BS_GetTableStruct($table_key));
|
||||
}
|
||||
}
|
||||
|
||||
// refresh side menu
|
||||
PMA_sendHeaderLocation($cfg['PmaAbsoluteUri'] . 'db_operations.php?' . PMA_generate_common_url ('','', '&') . (isset($db) ? '&db=' . urlencode($db) : '') . (isset($token) ? '&token=' . urlencode($token) : '') . (isset($goto) ? '&goto=' . urlencode($goto) : '') . 'reload=1&purge=1');
|
||||
} // end if ($PMA_Config->get('BLOBSTREAMING_PLUGINS_EXIST'))
|
||||
} // end if ($PMA_Config->get('PBXT_NAME') !== strtolower($db))
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Settings for relations stuff
|
||||
*/
|
||||
|
||||
require_once './libraries/relation.lib.php';
|
||||
$cfgRelation = PMA_getRelationsParam();
|
||||
|
||||
/**
|
||||
* Check if comments were updated
|
||||
* (must be done before displaying the menu tabs)
|
||||
*/
|
||||
if (isset($_REQUEST['comment'])) {
|
||||
PMA_setDbComment($db, $comment);
|
||||
}
|
||||
|
||||
/**
|
||||
* Prepares the tables list if the user where not redirected to this script
|
||||
* because there is no table in the database ($is_info is true)
|
||||
*/
|
||||
if (empty($is_info)) {
|
||||
require './libraries/db_common.inc.php';
|
||||
$url_query .= '&goto=db_operations.php';
|
||||
|
||||
// Gets the database structure
|
||||
$sub_part = '_structure';
|
||||
require './libraries/db_info.inc.php';
|
||||
echo "\n";
|
||||
|
||||
if (isset($message)) {
|
||||
PMA_showMessage($message, $sql_query);
|
||||
unset($message);
|
||||
}
|
||||
}
|
||||
|
||||
$db_collation = PMA_getDbCollation($db);
|
||||
if ($db == 'information_schema') {
|
||||
$is_information_schema = true;
|
||||
} else {
|
||||
$is_information_schema = false;
|
||||
}
|
||||
|
||||
if (!$is_information_schema) {
|
||||
|
||||
require './libraries/display_create_table.lib.php';
|
||||
|
||||
if ($cfgRelation['commwork']) {
|
||||
/**
|
||||
* database comment
|
||||
*/
|
||||
?>
|
||||
<form method="post" action="db_operations.php">
|
||||
<?php echo PMA_generate_common_hidden_inputs($db); ?>
|
||||
<fieldset>
|
||||
<legend>
|
||||
<?php echo PMA_getIcon('b_comment.png', $strDBComment, false, true); ?>
|
||||
</legend>
|
||||
<input type="text" name="comment" class="textfield" size="30"
|
||||
value="<?php
|
||||
echo htmlspecialchars(PMA_getDBComment($db)); ?>" />
|
||||
<input type="submit" value="<?php echo $strGo; ?>" />
|
||||
</fieldset>
|
||||
</form>
|
||||
<?php
|
||||
}
|
||||
/**
|
||||
* rename database
|
||||
*/
|
||||
?>
|
||||
<form method="post" action="db_operations.php"
|
||||
onsubmit="return emptyFormElements(this, 'newname')">
|
||||
<?php
|
||||
if (isset($db_collation)) {
|
||||
echo '<input type="hidden" name="db_collation" value="' . $db_collation
|
||||
.'" />' . "\n";
|
||||
}
|
||||
?>
|
||||
<input type="hidden" name="what" value="data" />
|
||||
<input type="hidden" name="db_rename" value="true" />
|
||||
<?php echo PMA_generate_common_hidden_inputs($db); ?>
|
||||
<fieldset>
|
||||
<legend>
|
||||
<?php
|
||||
if ($cfg['PropertiesIconic']) {
|
||||
echo '<img class="icon" src="' . $pmaThemeImage . 'b_edit.png"'
|
||||
.' alt="" width="16" height="16" />';
|
||||
}
|
||||
echo $strDBRename . ':';
|
||||
?>
|
||||
</legend>
|
||||
<input type="text" name="newname" size="30" class="textfield" value="" />
|
||||
<?php
|
||||
echo '(' . $strCommand . ': ';
|
||||
/**
|
||||
* @todo (see explanations above in a previous todo)
|
||||
*/
|
||||
//if (PMA_MYSQL_INT_VERSION >= XYYZZ) {
|
||||
// echo 'RENAME DATABASE';
|
||||
//} else {
|
||||
echo 'INSERT INTO ... SELECT';
|
||||
//}
|
||||
echo ')'; ?>
|
||||
<input type="submit" value="<?php echo $strGo; ?>" onclick="return confirmLink(this, 'CREATE DATABASE ... <?php echo $strAndThen; ?> DROP DATABASE <?php echo PMA_jsFormat($db); ?>')" />
|
||||
</fieldset>
|
||||
</form>
|
||||
|
||||
<?php
|
||||
/**
|
||||
* Copy database
|
||||
*/
|
||||
?>
|
||||
<form method="post" action="db_operations.php"
|
||||
onsubmit="return emptyFormElements(this, 'newname')">
|
||||
<?php
|
||||
if (isset($db_collation)) {
|
||||
echo '<input type="hidden" name="db_collation" value="' . $db_collation
|
||||
.'" />' . "\n";
|
||||
}
|
||||
echo '<input type="hidden" name="db_copy" value="true" />' . "\n";
|
||||
echo PMA_generate_common_hidden_inputs($db);
|
||||
?>
|
||||
<fieldset>
|
||||
<legend>
|
||||
<?php
|
||||
if ($cfg['PropertiesIconic']) {
|
||||
echo '<img class="icon" src="' . $pmaThemeImage . 'b_edit.png"'
|
||||
.' alt="" width="16" height="16" />';
|
||||
}
|
||||
echo $strDBCopy . ':';
|
||||
$drop_clause = 'DROP TABLE / DROP VIEW';
|
||||
?>
|
||||
</legend>
|
||||
<input type="text" name="newname" size="30" class="textfield" value="" /><br />
|
||||
<?php
|
||||
$choices = array(
|
||||
'structure' => $strStrucOnly,
|
||||
'data' => $strStrucData,
|
||||
'dataonly' => $strDataOnly);
|
||||
PMA_display_html_radio('what', $choices, 'data', true);
|
||||
unset($choices);
|
||||
?>
|
||||
<input type="checkbox" name="create_database_before_copying" value="1"
|
||||
id="checkbox_create_database_before_copying"
|
||||
style="vertical-align: middle" checked="checked" />
|
||||
<label for="checkbox_create_database_before_copying">
|
||||
<?php echo $strCreateDatabaseBeforeCopying; ?></label><br />
|
||||
<input type="checkbox" name="drop_if_exists" value="true"
|
||||
id="checkbox_drop" style="vertical-align: middle" />
|
||||
<label for="checkbox_drop"><?php echo sprintf($strAddClause, $drop_clause); ?></label><br />
|
||||
<input type="checkbox" name="sql_auto_increment" value="1" checked="checked"
|
||||
id="checkbox_auto_increment" style="vertical-align: middle" />
|
||||
<label for="checkbox_auto_increment">
|
||||
<?php echo $strAddAutoIncrement; ?></label><br />
|
||||
<input type="checkbox" name="add_constraints" value="1"
|
||||
id="checkbox_constraints" style="vertical-align: middle" />
|
||||
<label for="checkbox_constraints">
|
||||
<?php echo $strAddConstraints; ?></label><br />
|
||||
<?php
|
||||
unset($drop_clause);
|
||||
|
||||
if (isset($_COOKIE) && isset($_COOKIE['pma_switch_to_new'])
|
||||
&& $_COOKIE['pma_switch_to_new'] == 'true') {
|
||||
$pma_switch_to_new = 'true';
|
||||
}
|
||||
?>
|
||||
<input type="checkbox" name="switch_to_new" value="true"
|
||||
id="checkbox_switch"
|
||||
<?php echo ((isset($pma_switch_to_new) && $pma_switch_to_new == 'true') ? ' checked="checked"' : ''); ?>
|
||||
style="vertical-align: middle" />
|
||||
<label for="checkbox_switch"><?php echo $strSwitchToDatabase; ?></label>
|
||||
</fieldset>
|
||||
<fieldset class="tblFooters">
|
||||
<input type="submit" name="submit_copy" value="<?php echo $strGo; ?>" />
|
||||
</fieldset>
|
||||
</form>
|
||||
|
||||
<?php
|
||||
/*
|
||||
* BLOB streaming support
|
||||
*/
|
||||
|
||||
// load PMA_Config
|
||||
$PMA_Config = $_SESSION['PMA_Config'];
|
||||
|
||||
// if all blobstreaming plugins exist, begin checking for blobstreaming tables
|
||||
if (!empty($PMA_Config))
|
||||
{
|
||||
if ($PMA_Config->get('PBXT_NAME') !== strtolower($db))
|
||||
{
|
||||
if ($PMA_Config->get('BLOBSTREAMING_PLUGINS_EXIST'))
|
||||
{
|
||||
$bs_tables = $PMA_Config->get('BLOBSTREAMABLE_DATABASES');
|
||||
$bs_tables = $bs_tables[$db];
|
||||
|
||||
$oneBSTableExists = FALSE;
|
||||
$allBSTablesExist = TRUE;
|
||||
|
||||
// first check that all blobstreaming tables do not exist
|
||||
foreach ($bs_tables as $table_key=>$tbl)
|
||||
if ($bs_tables[$table_key]['Exists'])
|
||||
$oneBSTableExists = TRUE;
|
||||
else
|
||||
$allBSTablesExist = FALSE;
|
||||
|
||||
?>
|
||||
|
||||
<form method="post" action="./db_operations.php">
|
||||
<?php echo PMA_generate_common_hidden_inputs($db); ?>
|
||||
<fieldset>
|
||||
<legend>
|
||||
<?php echo PMA_getIcon('b_edit.png', $strBLOBRepository, false, true); ?>
|
||||
</legend>
|
||||
|
||||
<?php echo $strStatus; ?>:
|
||||
|
||||
<?php
|
||||
|
||||
// if the blobstreaming tables exist, provide option to disable the BLOB repository
|
||||
if ($allBSTablesExist)
|
||||
{
|
||||
?>
|
||||
<?php echo $strBLOBRepositoryEnabled; ?>
|
||||
</fieldset>
|
||||
<fieldset class="tblFooters">
|
||||
<input type="hidden" name="db_blob_streaming_op" value="disable" />
|
||||
<input type="submit" onclick="return confirmDisableRepository('<?php echo $db; ?>');" value="<?php echo $strBLOBRepositoryDisable; ?>" />
|
||||
</fieldset>
|
||||
<?php
|
||||
}
|
||||
else
|
||||
{
|
||||
// if any of the blobstreaming tables are missing, provide option to repair the BLOB repository
|
||||
if ($oneBSTableExists && !$allBSTablesExist)
|
||||
{
|
||||
?>
|
||||
<?php echo $strBLOBRepositoryDamaged; ?>
|
||||
</fieldset>
|
||||
<fieldset class="tblFooters">
|
||||
<input type="hidden" name="db_blob_streaming_op" value="repair" />
|
||||
<input type="submit" value="<?php echo $strBLOBRepositoryRepair; ?>" />
|
||||
</fieldset>
|
||||
<?php
|
||||
}
|
||||
// if none of the blobstreaming tables exist, provide option to enable BLOB repository
|
||||
else
|
||||
{
|
||||
?>
|
||||
<?php echo $strBLOBRepositoryDisabled; ?>
|
||||
</fieldset>
|
||||
<fieldset class="tblFooters">
|
||||
<input type="hidden" name="db_blob_streaming_op" value="enable" />
|
||||
<input type="submit" value="<?php echo $strBLOBRepositoryEnable; ?>" />
|
||||
</fieldset>
|
||||
<?php
|
||||
}
|
||||
} // end if ($allBSTablesExist)
|
||||
|
||||
?>
|
||||
</form>
|
||||
<?php
|
||||
} // end if ($PMA_Config->get('BLOBSTREAMING_PLUGINS_EXIST'))
|
||||
} // end if ($PMA_Config->get('PBXT_NAME') !== strtolower($db))
|
||||
}
|
||||
|
||||
/**
|
||||
* Change database charset
|
||||
*/
|
||||
echo '<form method="post" action="./db_operations.php">' . "\n"
|
||||
. PMA_generate_common_hidden_inputs($db, $table)
|
||||
. '<fieldset>' . "\n"
|
||||
. ' <legend>';
|
||||
if ($cfg['PropertiesIconic']) {
|
||||
echo '<img class="icon" src="' . $pmaThemeImage . 's_asci.png"'
|
||||
.' alt="" width="16" height="16" />';
|
||||
}
|
||||
echo ' <label for="select_db_collation">' . $strCollation . ':</label>' . "\n"
|
||||
. ' </legend>' . "\n"
|
||||
. PMA_generateCharsetDropdownBox(PMA_CSDROPDOWN_COLLATION,
|
||||
'db_collation', 'select_db_collation', $db_collation, false, 3)
|
||||
. ' <input type="submit" name="submitcollation"'
|
||||
. ' value="' . $strGo . '" style="vertical-align: middle" />' . "\n"
|
||||
. '</fieldset>' . "\n"
|
||||
. '</form>' . "\n";
|
||||
|
||||
if ($num_tables > 0
|
||||
&& !$cfgRelation['allworks'] && $cfg['PmaNoRelation_DisableWarning'] == false) {
|
||||
$message = PMA_Message::notice('strRelationNotWorking');
|
||||
$message->addParam('<a href="' . $cfg['PmaAbsoluteUri'] . 'chk_rel.php?' . $url_query . '">', false);
|
||||
$message->addParam('</a>', false);
|
||||
/* Show error if user has configured something, notice elsewhere */
|
||||
if (!empty($cfg['Servers'][$server]['pmadb'])) {
|
||||
$message->isError(true);
|
||||
}
|
||||
$message->display();
|
||||
} // end if
|
||||
} // end if (!$is_information_schema)
|
||||
|
||||
|
||||
// not sure about displaying the PDF dialog in case db is information_schema
|
||||
if ($cfgRelation['pdfwork'] && $num_tables > 0) { ?>
|
||||
<!-- Work on PDF Pages -->
|
||||
|
||||
<?php
|
||||
// We only show this if we find something in the new pdf_pages table
|
||||
|
||||
$test_query = '
|
||||
SELECT *
|
||||
FROM ' . PMA_backquote($GLOBALS['cfgRelation']['db']) . '.' . PMA_backquote($cfgRelation['pdf_pages']) . '
|
||||
WHERE db_name = \'' . PMA_sqlAddslashes($db) . '\'';
|
||||
$test_rs = PMA_query_as_controluser($test_query, null, PMA_DBI_QUERY_STORE);
|
||||
|
||||
if ($test_rs && PMA_DBI_num_rows($test_rs) > 0) { ?>
|
||||
<!-- PDF schema -->
|
||||
<form method="post" action="pdf_schema.php">
|
||||
<fieldset>
|
||||
<legend>
|
||||
<?php
|
||||
echo PMA_generate_common_hidden_inputs($db);
|
||||
if ($cfg['PropertiesIconic']) {
|
||||
echo '<img class="icon" src="' . $pmaThemeImage . 'b_view.png"'
|
||||
.' alt="" width="16" height="16" />';
|
||||
}
|
||||
echo $strDisplayPDF;
|
||||
?>:
|
||||
</legend>
|
||||
<label for="pdf_page_number_opt"><?php echo $strPageNumber; ?></label>
|
||||
<select name="pdf_page_number" id="pdf_page_number_opt">
|
||||
<?php
|
||||
while ($pages = @PMA_DBI_fetch_assoc($test_rs)) {
|
||||
echo ' <option value="' . $pages['page_nr'] . '">'
|
||||
. $pages['page_nr'] . ': ' . htmlspecialchars($pages['page_descr']) . '</option>' . "\n";
|
||||
} // end while
|
||||
PMA_DBI_free_result($test_rs);
|
||||
unset($test_rs);
|
||||
?>
|
||||
</select><br />
|
||||
|
||||
<input type="checkbox" name="show_grid" id="show_grid_opt" />
|
||||
<label for="show_grid_opt"><?php echo $strShowGrid; ?></label><br />
|
||||
<input type="checkbox" name="show_color" id="show_color_opt"
|
||||
checked="checked" />
|
||||
<label for="show_color_opt"><?php echo $strShowColor; ?></label><br />
|
||||
<input type="checkbox" name="show_table_dimension" id="show_table_dim_opt" />
|
||||
<label for="show_table_dim_opt"><?php echo $strShowTableDimension; ?>
|
||||
</label><br />
|
||||
<input type="checkbox" name="all_tab_same_wide" id="all_tab_same_wide" />
|
||||
<label for="all_tab_same_wide"><?php echo $strAllTableSameWidth; ?>
|
||||
</label><br />
|
||||
<input type="checkbox" name="with_doc" id="with_doc" checked="checked" />
|
||||
<label for="with_doc"><?php echo $strDataDict; ?></label><br />
|
||||
<input type="checkbox" name="show_keys" id="show_keys" />
|
||||
<label for="show_keys"><?php echo $strShowKeys; ?></label><br />
|
||||
|
||||
<label for="orientation_opt"><?php echo $strShowDatadictAs; ?></label>
|
||||
<select name="orientation" id="orientation_opt">
|
||||
<option value="L"><?php echo $strLandscape;?></option>
|
||||
<option value="P"><?php echo $strPortrait;?></option>
|
||||
</select><br />
|
||||
|
||||
<label for="paper_opt"><?php echo $strPaperSize; ?></label>
|
||||
<select name="paper" id="paper_opt">
|
||||
<?php
|
||||
foreach ($cfg['PDFPageSizes'] AS $key => $val) {
|
||||
echo '<option value="' . $val . '"';
|
||||
if ($val == $cfg['PDFDefaultPageSize']) {
|
||||
echo ' selected="selected"';
|
||||
}
|
||||
echo ' >' . $val . '</option>' . "\n";
|
||||
}
|
||||
?>
|
||||
</select>
|
||||
</fieldset>
|
||||
<fieldset class="tblFooters">
|
||||
<input type="submit" value="<?php echo $strGo; ?>" />
|
||||
</fieldset>
|
||||
</form>
|
||||
<?php
|
||||
} // end if
|
||||
echo '<br /><a href="pdf_pages.php?' . $url_query . '">';
|
||||
if ($cfg['PropertiesIconic']) {
|
||||
echo '<img class="icon" src="' . $pmaThemeImage . 'b_edit.png"'
|
||||
.' alt="" width="16" height="16" />';
|
||||
}
|
||||
echo $strEditPDFPages . '</a>';
|
||||
} // end if
|
||||
|
||||
/**
|
||||
* Displays the footer
|
||||
*/
|
||||
require_once './libraries/footer.inc.php';
|
||||
?>
|
||||
270
db_printview.php
270
db_printview.php
@@ -1,270 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
*
|
||||
* @version $Id$
|
||||
* @package phpMyAdmin
|
||||
*/
|
||||
|
||||
/**
|
||||
*
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
|
||||
/**
|
||||
* Gets the variables sent or posted to this script, then displays headers
|
||||
*/
|
||||
$print_view = true;
|
||||
require_once './libraries/header.inc.php';
|
||||
|
||||
PMA_checkParameters(array('db'));
|
||||
|
||||
/**
|
||||
* Defines the url to return to in case of error in a sql statement
|
||||
*/
|
||||
$err_url = 'db_sql.php?' . PMA_generate_common_url($db);
|
||||
|
||||
/**
|
||||
* Settings for relations stuff
|
||||
*/
|
||||
require_once './libraries/relation.lib.php';
|
||||
$cfgRelation = PMA_getRelationsParam();
|
||||
|
||||
/**
|
||||
* Gets the list of the table in the current db and informations about these
|
||||
* tables if possible
|
||||
*
|
||||
* @todo merge this speedup _optionaly_ into PMA_DBI_get_tables_full()
|
||||
*
|
||||
// staybyte: speedup view on locked tables - 11 June 2001
|
||||
// Special speedup for newer MySQL Versions (in 4.0 format changed)
|
||||
if ($cfg['SkipLockedTables'] == true) {
|
||||
$result = PMA_DBI_query('SHOW OPEN TABLES FROM ' . PMA_backquote($db) . ';');
|
||||
// Blending out tables in use
|
||||
if ($result != false && PMA_DBI_num_rows($result) > 0) {
|
||||
while ($tmp = PMA_DBI_fetch_row($result)) {
|
||||
// if in use memorize tablename
|
||||
if (preg_match('@in_use=[1-9]+@i', $tmp[0])) {
|
||||
$sot_cache[$tmp[0]] = true;
|
||||
}
|
||||
}
|
||||
PMA_DBI_free_result($result);
|
||||
|
||||
if (isset($sot_cache)) {
|
||||
$result = PMA_DBI_query('SHOW TABLES FROM ' . PMA_backquote($db) . ';', null, PMA_DBI_QUERY_STORE);
|
||||
if ($result != false && PMA_DBI_num_rows($result) > 0) {
|
||||
while ($tmp = PMA_DBI_fetch_row($result)) {
|
||||
if (!isset($sot_cache[$tmp[0]])) {
|
||||
$sts_result = PMA_DBI_query('SHOW TABLE STATUS FROM ' . PMA_backquote($db) . ' LIKE \'' . addslashes($tmp[0]) . '\';');
|
||||
$sts_tmp = PMA_DBI_fetch_assoc($sts_result);
|
||||
$tables[] = $sts_tmp;
|
||||
} else { // table in use
|
||||
$tables[] = array('Name' => $tmp[0]);
|
||||
}
|
||||
}
|
||||
PMA_DBI_free_result($result);
|
||||
$sot_ready = true;
|
||||
}
|
||||
}
|
||||
unset($tmp, $result);
|
||||
}
|
||||
}
|
||||
|
||||
if (! isset($sot_ready)) {
|
||||
$result = PMA_DBI_query('SHOW TABLE STATUS FROM ' . PMA_backquote($db) . ';');
|
||||
if (PMA_DBI_num_rows($result) > 0) {
|
||||
while ($sts_tmp = PMA_DBI_fetch_assoc($result)) {
|
||||
$tables[] = $sts_tmp;
|
||||
}
|
||||
PMA_DBI_free_result($result);
|
||||
unset($res);
|
||||
}
|
||||
}
|
||||
*/
|
||||
|
||||
/**
|
||||
* If there is at least one table, displays the printer friendly view, else
|
||||
* an error message
|
||||
*/
|
||||
$tables = PMA_DBI_get_tables_full($db);
|
||||
$num_tables = count($tables);
|
||||
|
||||
echo '<br />';
|
||||
|
||||
// 1. No table
|
||||
if ($num_tables == 0) {
|
||||
echo $strNoTablesFound;
|
||||
}
|
||||
// 2. Shows table informations on mysql >= 3.23.03 - staybyte - 11 June 2001
|
||||
else {
|
||||
?>
|
||||
<table>
|
||||
<thead>
|
||||
<tr>
|
||||
<th><?php echo $strTable; ?></th>
|
||||
<th><?php echo $strRecords; ?></th>
|
||||
<th><?php echo $strType; ?></th>
|
||||
<?php
|
||||
if ($cfg['ShowStats']) {
|
||||
echo '<th>' . $strSize . '</th>';
|
||||
}
|
||||
?>
|
||||
<th><?php echo $strComments; ?></th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
<?php
|
||||
$sum_entries = $sum_size = 0;
|
||||
$odd_row = true;
|
||||
foreach ($tables as $sts_data) {
|
||||
if (strtoupper($sts_data['ENGINE']) == 'MRG_MYISAM'
|
||||
|| strtoupper($sts_data['ENGINE']) == 'FEDERATED') {
|
||||
$merged_size = true;
|
||||
} else {
|
||||
$merged_size = false;
|
||||
}
|
||||
$sum_entries += $sts_data['TABLE_ROWS'];
|
||||
?>
|
||||
<tr class="<?php echo $odd_row ? 'odd' : 'even'; ?>">
|
||||
<th>
|
||||
<?php echo htmlspecialchars($sts_data['TABLE_NAME']); ?>
|
||||
</th>
|
||||
<?php
|
||||
|
||||
if (isset($sts_data['TABLE_ROWS'])) {
|
||||
?>
|
||||
<td align="right">
|
||||
<?php
|
||||
if ($merged_size) {
|
||||
echo '<i>' . PMA_formatNumber($sts_data['TABLE_ROWS'], 0) . '</i>' . "\n";
|
||||
} else {
|
||||
echo PMA_formatNumber($sts_data['TABLE_ROWS'], 0) . "\n";
|
||||
}
|
||||
?>
|
||||
</td>
|
||||
<td nowrap="nowrap">
|
||||
<?php echo $sts_data['ENGINE']; ?>
|
||||
</td>
|
||||
<?php
|
||||
if ($cfg['ShowStats']) {
|
||||
$tblsize = $sts_data['Data_length'] + $sts_data['Index_length'];
|
||||
$sum_size += $tblsize;
|
||||
list($formated_size, $unit) = PMA_formatByteDown($tblsize, 3, 1);
|
||||
?>
|
||||
<td align="right" nowrap="nowrap">
|
||||
<?php echo $formated_size . ' ' . $unit; ?>
|
||||
</td>
|
||||
<?php
|
||||
} // end if
|
||||
} else {
|
||||
?>
|
||||
<td colspan="3" align="center">
|
||||
<?php echo $strInUse; ?>
|
||||
</td>
|
||||
<?php
|
||||
}
|
||||
?>
|
||||
<td>
|
||||
<?php
|
||||
if (! empty($sts_data['Comment'])) {
|
||||
echo htmlspecialchars($sts_data['Comment']);
|
||||
$needs_break = '<br />';
|
||||
} else {
|
||||
$needs_break = '';
|
||||
}
|
||||
|
||||
if (! empty($sts_data['Create_time'])
|
||||
|| ! empty($sts_data['Update_time'])
|
||||
|| ! empty($sts_data['Check_time'])) {
|
||||
echo $needs_break;
|
||||
?>
|
||||
<table width="100%">
|
||||
<?php
|
||||
|
||||
if (! empty($sts_data['Create_time'])) {
|
||||
?>
|
||||
<tr>
|
||||
<td align="right"><?php echo $strStatCreateTime . ': '; ?></td>
|
||||
<td align="right"><?php echo PMA_localisedDate(strtotime($sts_data['Create_time'])); ?></td>
|
||||
</tr>
|
||||
<?php
|
||||
}
|
||||
|
||||
if (! empty($sts_data['Update_time'])) {
|
||||
?>
|
||||
<tr>
|
||||
<td align="right"><?php echo $strStatUpdateTime . ': '; ?></td>
|
||||
<td align="right"><?php echo PMA_localisedDate(strtotime($sts_data['Update_time'])); ?></td>
|
||||
</tr>
|
||||
<?php
|
||||
}
|
||||
|
||||
if (! empty($sts_data['Check_time'])) {
|
||||
?>
|
||||
<tr>
|
||||
<td align="right"><?php echo $strStatCheckTime . ': '; ?></td>
|
||||
<td align="right"><?php echo PMA_localisedDate(strtotime($sts_data['Check_time'])); ?></td>
|
||||
</tr>
|
||||
<?php
|
||||
}
|
||||
?>
|
||||
</table>
|
||||
<?php
|
||||
}
|
||||
?>
|
||||
</td>
|
||||
</tr>
|
||||
<?php
|
||||
}
|
||||
?>
|
||||
<tr>
|
||||
<th align="center">
|
||||
<?php echo sprintf($strTables, PMA_formatNumber($num_tables, 0)); ?>
|
||||
</th>
|
||||
<th align="right" nowrap="nowrap">
|
||||
<?php echo PMA_formatNumber($sum_entries, 0); ?>
|
||||
</th>
|
||||
<th align="center">
|
||||
--
|
||||
</th>
|
||||
<?php
|
||||
if ($cfg['ShowStats']) {
|
||||
list($sum_formated, $unit) = PMA_formatByteDown($sum_size, 3, 1);
|
||||
?>
|
||||
<th align="right" nowrap="nowrap">
|
||||
<?php echo $sum_formated . ' ' . $unit; ?>
|
||||
</th>
|
||||
<?php
|
||||
}
|
||||
?>
|
||||
<th></th>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
<?php
|
||||
}
|
||||
|
||||
/**
|
||||
* Displays the footer
|
||||
*/
|
||||
?>
|
||||
|
||||
<script type="text/javascript">
|
||||
//<![CDATA[
|
||||
function printPage()
|
||||
{
|
||||
// Do print the page
|
||||
if (typeof(window.print) != 'undefined') {
|
||||
window.print();
|
||||
}
|
||||
}
|
||||
//]]>
|
||||
</script>
|
||||
<br /><br />
|
||||
|
||||
<input type="button" class="print_ignore"
|
||||
id="print" value="<?php echo $strPrint; ?>" onclick="printPage()" />
|
||||
|
||||
<?php
|
||||
require_once './libraries/footer.inc.php';
|
||||
?>
|
||||
945
db_qbe.php
945
db_qbe.php
@@ -1,945 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* query by example the whole database
|
||||
*
|
||||
* @version $Id$
|
||||
* @package phpMyAdmin
|
||||
*/
|
||||
|
||||
/**
|
||||
* requirements
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
require_once './libraries/Table.class.php';
|
||||
require_once './libraries/relation.lib.php';
|
||||
|
||||
|
||||
/**
|
||||
* Gets the relation settings
|
||||
*/
|
||||
$cfgRelation = PMA_getRelationsParam();
|
||||
|
||||
|
||||
/**
|
||||
* A query has been submitted -> execute it, else display the headers
|
||||
*/
|
||||
if (isset($_REQUEST['submit_sql']) && ! empty($sql_query)) {
|
||||
$goto = 'db_sql.php';
|
||||
$zero_rows = htmlspecialchars($GLOBALS['strSuccess']);
|
||||
require './sql.php';
|
||||
exit;
|
||||
} else {
|
||||
$sub_part = '_qbe';
|
||||
require './libraries/db_common.inc.php';
|
||||
$url_query .= '&goto=db_qbe.php';
|
||||
$url_params['goto'] = 'db_qbe.php';
|
||||
require './libraries/db_info.inc.php';
|
||||
}
|
||||
|
||||
if (isset($_REQUEST['submit_sql'])
|
||||
&& ! preg_match('@^SELECT@i', $sql_query)) {
|
||||
PMA_Message::warning('strHaveToShow')->display();
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Initialize some variables
|
||||
*/
|
||||
$col_cnt = PMA_ifSetOr($_REQUEST['col_cnt'], 3, 'numeric');
|
||||
$add_col = PMA_ifSetOr($_REQUEST['add_col'], 0, 'numeric');
|
||||
$add_row = PMA_ifSetOr($_REQUEST['add_row'], 0, 'numeric');
|
||||
|
||||
$rows = PMA_ifSetOr($_REQUEST['rows'], 0, 'numeric');
|
||||
$ins_col = PMA_ifSetOr($_REQUEST['ins_col'], null, 'array');
|
||||
$del_col = PMA_ifSetOr($_REQUEST['del_col'], null, 'array');
|
||||
|
||||
$prev_criteria = isset($_REQUEST['prev_criteria'])
|
||||
? $_REQUEST['prev_criteria']
|
||||
: array();
|
||||
$criteria = isset($_REQUEST['criteria'])
|
||||
? $_REQUEST['criteria']
|
||||
: array_fill(0, $col_cnt, '');
|
||||
|
||||
$ins_row = isset($_REQUEST['ins_row'])
|
||||
? $_REQUEST['ins_row']
|
||||
: array_fill(0, $col_cnt, '');
|
||||
$del_row = isset($_REQUEST['del_row'])
|
||||
? $_REQUEST['del_row']
|
||||
: array_fill(0, $col_cnt, '');
|
||||
$and_or_row = isset($_REQUEST['and_or_row'])
|
||||
? $_REQUEST['and_or_row']
|
||||
: array_fill(0, $col_cnt, '');
|
||||
$and_or_col = isset($_REQUEST['and_or_col'])
|
||||
? $_REQUEST['and_or_col']
|
||||
: array_fill(0, $col_cnt, '');
|
||||
|
||||
// minimum width
|
||||
$form_column_width = 12;
|
||||
$col = max($col_cnt + $add_col, 0);
|
||||
$row = max($rows + $add_row, 0);
|
||||
|
||||
|
||||
// The tables list sent by a previously submitted form
|
||||
if (PMA_isValid($_REQUEST['TableList'], 'array')) {
|
||||
foreach ($_REQUEST['TableList'] as $each_table) {
|
||||
$tbl_names[$each_table] = ' selected="selected"';
|
||||
}
|
||||
} // end if
|
||||
|
||||
|
||||
// this was a work in progress, deactivated for now
|
||||
//$columns = PMA_DBI_get_columns_full($GLOBALS['db']);
|
||||
//$tables = PMA_DBI_get_columns_full($GLOBALS['db']);
|
||||
|
||||
|
||||
/**
|
||||
* Prepares the form
|
||||
*/
|
||||
$tbl_result = PMA_DBI_query('SHOW TABLES FROM ' . PMA_backquote($db) . ';', null, PMA_DBI_QUERY_STORE);
|
||||
$tbl_result_cnt = PMA_DBI_num_rows($tbl_result);
|
||||
if (0 == $tbl_result_cnt) {
|
||||
PMA_Message::error('strNoTablesFound')->display();
|
||||
require_once './libraries/footer.inc.php';
|
||||
exit;
|
||||
}
|
||||
|
||||
// The tables list gets from MySQL
|
||||
while (list($tbl) = PMA_DBI_fetch_row($tbl_result)) {
|
||||
$fld_results = PMA_DBI_get_fields($db, $tbl);
|
||||
|
||||
if (empty($tbl_names[$tbl]) && !empty($_REQUEST['TableList'])) {
|
||||
$tbl_names[$tbl] = '';
|
||||
} else {
|
||||
$tbl_names[$tbl] = ' selected="selected"';
|
||||
} // end if
|
||||
|
||||
// The fields list per selected tables
|
||||
if ($tbl_names[$tbl] == ' selected="selected"') {
|
||||
$each_table = PMA_backquote($tbl);
|
||||
$fld[] = $each_table . '.*';
|
||||
foreach ($fld_results as $each_field) {
|
||||
$each_field = $each_table . '.' . PMA_backquote($each_field['Field']);
|
||||
$fld[] = $each_field;
|
||||
|
||||
// increase the width if necessary
|
||||
$form_column_width = max(strlen($each_field), $form_column_width);
|
||||
} // end foreach
|
||||
} // end if
|
||||
} // end while
|
||||
PMA_DBI_free_result($tbl_result);
|
||||
|
||||
// largest width found
|
||||
$realwidth = $form_column_width . 'ex';
|
||||
|
||||
|
||||
/**
|
||||
* Displays the Query by example form
|
||||
*/
|
||||
|
||||
/**
|
||||
* Enter description here...
|
||||
*
|
||||
* @param array $columns
|
||||
* @param numeric $column_number
|
||||
* @param string $selected
|
||||
*/
|
||||
function showColumnSelectCell($columns, $column_number, $selected = '')
|
||||
{
|
||||
?>
|
||||
<td align="center">
|
||||
<select name="Field[<?php echo $column_number; ?>]" size="1">
|
||||
<option value=""> </option>
|
||||
<?php
|
||||
foreach ($columns as $column) {
|
||||
if ($column === $selected) {
|
||||
$sel = ' selected="selected"';
|
||||
} else {
|
||||
$sel = '';
|
||||
}
|
||||
echo '<option value="' . htmlspecialchars($column) . '"' . $sel . '>'
|
||||
. str_replace(' ', ' ', htmlspecialchars($column)) . '</option>' . "\n";
|
||||
}
|
||||
?>
|
||||
</select>
|
||||
</td>
|
||||
<?php
|
||||
}
|
||||
|
||||
?>
|
||||
<form action="db_qbe.php" method="post">
|
||||
<fieldset>
|
||||
<table class="data" style="width: 100%;">
|
||||
<tr class="odd noclick">
|
||||
<th><?php echo $strField; ?>:</th>
|
||||
<?php
|
||||
$z = 0;
|
||||
for ($x = 0; $x < $col; $x++) {
|
||||
if (isset($ins_col[$x]) && $ins_col[$x] == 'on') {
|
||||
showColumnSelectCell($fld, $z);
|
||||
$z++;
|
||||
}
|
||||
|
||||
if (! empty($del_col) && isset($del_col[$x]) && $del_col[$x] == 'on') {
|
||||
continue;
|
||||
}
|
||||
|
||||
$selected = '';
|
||||
if (isset($Field[$x])) {
|
||||
$selected = $Field[$x];
|
||||
$curField[$z] = $Field[$x];
|
||||
}
|
||||
showColumnSelectCell($fld, $z, $selected);
|
||||
$z++;
|
||||
} // end for
|
||||
?>
|
||||
</tr>
|
||||
|
||||
<!-- Sort row -->
|
||||
<tr class="even noclick">
|
||||
<th><?php echo $strSort; ?>:</th>
|
||||
<?php
|
||||
$z = 0;
|
||||
for ($x = 0; $x < $col; $x++) {
|
||||
if (!empty($ins_col) && isset($ins_col[$x]) && $ins_col[$x] == 'on') {
|
||||
?>
|
||||
<td align="center">
|
||||
<select style="width: <?php echo $realwidth; ?>" name="Sort[<?php echo $z; ?>]" size="1">
|
||||
<option value=""> </option>
|
||||
<option value="ASC"><?php echo $strAscending; ?></option>
|
||||
<option value="DESC"><?php echo $strDescending; ?></option>
|
||||
</select>
|
||||
</td>
|
||||
<?php
|
||||
$z++;
|
||||
} // end if
|
||||
echo "\n";
|
||||
|
||||
if (!empty($del_col) && isset($del_col[$x]) && $del_col[$x] == 'on') {
|
||||
continue;
|
||||
}
|
||||
?>
|
||||
<td align="center">
|
||||
<select style="width: <?php echo $realwidth; ?>" name="Sort[<?php echo $z; ?>]" size="1">
|
||||
<option value=""> </option>
|
||||
<?php
|
||||
echo "\n";
|
||||
|
||||
// If they have chosen all fields using the * selector,
|
||||
// then sorting is not available
|
||||
// Robbat2 - Fix for Bug #570698
|
||||
if (isset($Sort[$x]) && isset($Field[$x])
|
||||
&& substr($Field[$x], -2) == '.*') {
|
||||
$Sort[$x] = '';
|
||||
} //end if
|
||||
|
||||
if (isset($Sort[$x]) && $Sort[$x] == 'ASC') {
|
||||
$curSort[$z] = $Sort[$x];
|
||||
$sel = ' selected="selected"';
|
||||
} else {
|
||||
$sel = '';
|
||||
} // end if
|
||||
echo ' ';
|
||||
echo '<option value="ASC"' . $sel . '>' . $strAscending . '</option>' . "\n";
|
||||
if (isset($Sort[$x]) && $Sort[$x] == 'DESC') {
|
||||
$curSort[$z] = $Sort[$x];
|
||||
$sel = ' selected="selected"';
|
||||
} else {
|
||||
$sel = '';
|
||||
} // end if
|
||||
echo ' ';
|
||||
echo '<option value="DESC"' . $sel . '>' . $strDescending . '</option>' . "\n";
|
||||
?>
|
||||
</select>
|
||||
</td>
|
||||
<?php
|
||||
$z++;
|
||||
echo "\n";
|
||||
} // end for
|
||||
?>
|
||||
</tr>
|
||||
|
||||
<!-- Show row -->
|
||||
<tr class="odd noclick">
|
||||
<th><?php echo $strShow; ?>:</th>
|
||||
<?php
|
||||
$z = 0;
|
||||
for ($x = 0; $x < $col; $x++) {
|
||||
if (!empty($ins_col) && isset($ins_col[$x]) && $ins_col[$x] == 'on') {
|
||||
?>
|
||||
<td align="center">
|
||||
<input type="checkbox" name="Show[<?php echo $z; ?>]" />
|
||||
</td>
|
||||
<?php
|
||||
$z++;
|
||||
} // end if
|
||||
echo "\n";
|
||||
|
||||
if (!empty($del_col) && isset($del_col[$x]) && $del_col[$x] == 'on') {
|
||||
continue;
|
||||
}
|
||||
if (isset($Show[$x])) {
|
||||
$checked = ' checked="checked"';
|
||||
$curShow[$z] = $Show[$x];
|
||||
} else {
|
||||
$checked = '';
|
||||
}
|
||||
?>
|
||||
<td align="center">
|
||||
<input type="checkbox" name="Show[<?php echo $z; ?>]"<?php echo $checked; ?> />
|
||||
</td>
|
||||
<?php
|
||||
$z++;
|
||||
echo "\n";
|
||||
} // end for
|
||||
?>
|
||||
</tr>
|
||||
|
||||
<!-- Criteria row -->
|
||||
<tr class="even noclick">
|
||||
<th><?php echo $strCriteria; ?>:</th>
|
||||
<?php
|
||||
$z = 0;
|
||||
for ($x = 0; $x < $col; $x++) {
|
||||
if (!empty($ins_col) && isset($ins_col[$x]) && $ins_col[$x] == 'on') {
|
||||
?>
|
||||
<td align="center">
|
||||
<input type="text" name="criteria[<?php echo $z; ?>]" value="" class="textfield" style="width: <?php echo $realwidth; ?>" size="20" />
|
||||
</td>
|
||||
<?php
|
||||
$z++;
|
||||
} // end if
|
||||
echo "\n";
|
||||
|
||||
if (!empty($del_col) && isset($del_col[$x]) && $del_col[$x] == 'on') {
|
||||
continue;
|
||||
}
|
||||
if (isset($criteria[$x])) {
|
||||
$stripped_Criteria = $criteria[$x];
|
||||
}
|
||||
if ((empty($prev_criteria) || !isset($prev_criteria[$x]))
|
||||
|| $prev_criteria[$x] != htmlspecialchars($stripped_Criteria)) {
|
||||
$curCriteria[$z] = $stripped_Criteria;
|
||||
} else {
|
||||
$curCriteria[$z] = $prev_criteria[$x];
|
||||
}
|
||||
?>
|
||||
<td align="center">
|
||||
<input type="hidden" name="prev_criteria[<?php echo $z; ?>]" value="<?php echo htmlspecialchars($curCriteria[$z]); ?>" />
|
||||
<input type="text" name="criteria[<?php echo $z; ?>]" value="<?php echo htmlspecialchars($stripped_Criteria); ?>" class="textfield" style="width: <?php echo $realwidth; ?>" size="20" />
|
||||
</td>
|
||||
<?php
|
||||
$z++;
|
||||
echo "\n";
|
||||
} // end for
|
||||
?>
|
||||
</tr>
|
||||
|
||||
<!-- And/Or columns and rows -->
|
||||
<?php
|
||||
$w = 0;
|
||||
$odd_row = true;
|
||||
for ($y = 0; $y <= $row; $y++) {
|
||||
if (isset($ins_row[$y]) && $ins_row[$y] == 'on') {
|
||||
$chk['or'] = ' checked="checked"';
|
||||
$chk['and'] = '';
|
||||
?>
|
||||
<tr class="<?php echo $odd_row ? 'odd' : 'even'; ?> noclick">
|
||||
<td align="<?php echo $cell_align_right; ?>" nowrap="nowrap">
|
||||
<!-- Row controls -->
|
||||
<table cellpadding="0" cellspacing="0" border="0">
|
||||
<tr>
|
||||
<td align="<?php echo $cell_align_right; ?>" nowrap="nowrap">
|
||||
<small><?php echo $strQBEIns; ?>:</small>
|
||||
<input type="checkbox" name="ins_row[<?php echo $w; ?>]" />
|
||||
</td>
|
||||
<td align="<?php echo $cell_align_right; ?>">
|
||||
<strong><?php echo $strAnd; ?>:</strong>
|
||||
</td>
|
||||
<td>
|
||||
<input type="radio" name="and_or_row[<?php echo $w; ?>]" value="and"<?php echo $chk['and']; ?> />
|
||||
|
||||
</td>
|
||||
</tr>
|
||||
<tr>
|
||||
<td align="<?php echo $cell_align_right; ?>" nowrap="nowrap">
|
||||
<small><?php echo $strQBEDel; ?>:</small>
|
||||
<input type="checkbox" name="del_row[<?php echo $w; ?>]" />
|
||||
</td>
|
||||
<td align="<?php echo $cell_align_right; ?>">
|
||||
<strong><?php echo $strOr; ?>:</strong>
|
||||
</td>
|
||||
<td>
|
||||
<input type="radio" name="and_or_row[<?php echo $w; ?>]" value="or"<?php echo $chk['or']; ?> />
|
||||
|
||||
</td>
|
||||
</tr>
|
||||
</table>
|
||||
</td>
|
||||
<?php
|
||||
$z = 0;
|
||||
for ($x = 0; $x < $col; $x++) {
|
||||
if (isset($ins_col[$x]) && $ins_col[$x] == 'on') {
|
||||
echo "\n";
|
||||
$or = 'Or' . $w . '[' . $z . ']';
|
||||
?>
|
||||
<td align="center">
|
||||
<textarea cols="20" rows="2" style="width: <?php echo $realwidth; ?>" name="<?php echo $or; ?>" dir="<?php echo $text_dir; ?>"></textarea>
|
||||
</td>
|
||||
<?php
|
||||
$z++;
|
||||
} // end if
|
||||
if (isset($del_col[$x]) && $del_col[$x] == 'on') {
|
||||
continue;
|
||||
}
|
||||
|
||||
echo "\n";
|
||||
$or = 'Or' . $w . '[' . $z . ']';
|
||||
?>
|
||||
<td align="center">
|
||||
<textarea cols="20" rows="2" style="width: <?php echo $realwidth; ?>" name="<?php echo $or; ?>" dir="<?php echo $text_dir; ?>"></textarea>
|
||||
</td>
|
||||
<?php
|
||||
$z++;
|
||||
} // end for
|
||||
$w++;
|
||||
echo "\n";
|
||||
?>
|
||||
</tr>
|
||||
<?php
|
||||
$odd_row =! $odd_row;
|
||||
} // end if
|
||||
|
||||
if (isset($del_row[$y]) && $del_row[$y] == 'on') {
|
||||
continue;
|
||||
}
|
||||
|
||||
if (isset($and_or_row[$y])) {
|
||||
$curAndOrRow[$w] = $and_or_row[$y];
|
||||
}
|
||||
if (isset($and_or_row[$y]) && $and_or_row[$y] == 'and') {
|
||||
$chk['and'] = ' checked="checked"';
|
||||
$chk['or'] = '';
|
||||
} else {
|
||||
$chk['or'] = ' checked="checked"';
|
||||
$chk['and'] = '';
|
||||
}
|
||||
echo "\n";
|
||||
?>
|
||||
<tr class="<?php echo $odd_row ? 'odd' : 'even'; ?> noclick">
|
||||
<td align="<?php echo $cell_align_right; ?>" nowrap="nowrap">
|
||||
<!-- Row controls -->
|
||||
<table border="0" cellpadding="0" cellspacing="0">
|
||||
<tr>
|
||||
<td align="<?php echo $cell_align_right; ?>" nowrap="nowrap">
|
||||
<small><?php echo $strQBEIns; ?>:</small>
|
||||
<input type="checkbox" name="ins_row[<?php echo $w; ?>]" />
|
||||
</td>
|
||||
<td align="<?php echo $cell_align_right; ?>">
|
||||
<strong><?php echo $strAnd; ?>:</strong>
|
||||
</td>
|
||||
<td>
|
||||
<input type="radio" name="and_or_row[<?php echo $w; ?>]" value="and"<?php echo $chk['and']; ?> />
|
||||
</td>
|
||||
</tr>
|
||||
<tr>
|
||||
<td align="<?php echo $cell_align_right; ?>" nowrap="nowrap">
|
||||
<small><?php echo $strQBEDel; ?>:</small>
|
||||
<input type="checkbox" name="del_row[<?php echo $w; ?>]" />
|
||||
</td>
|
||||
<td align="<?php echo $cell_align_right; ?>">
|
||||
<strong><?php echo $strOr; ?>:</strong>
|
||||
</td>
|
||||
<td>
|
||||
<input type="radio" name="and_or_row[<?php echo $w; ?>]" value="or"<?php echo $chk['or']; ?> />
|
||||
</td>
|
||||
</tr>
|
||||
</table>
|
||||
</td>
|
||||
<?php
|
||||
$z = 0;
|
||||
for ($x = 0; $x < $col; $x++) {
|
||||
if (!empty($ins_col) && isset($ins_col[$x]) && $ins_col[$x] == 'on') {
|
||||
echo "\n";
|
||||
$or = 'Or' . $w . '[' . $z . ']';
|
||||
?>
|
||||
<td align="center">
|
||||
<textarea cols="20" rows="2" style="width: <?php echo $realwidth; ?>" name="<?php echo $or; ?>" dir="<?php echo $text_dir; ?>"></textarea>
|
||||
</td>
|
||||
<?php
|
||||
$z++;
|
||||
} // end if
|
||||
if (!empty($del_col) && isset($del_col[$x]) && $del_col[$x] == 'on') {
|
||||
continue;
|
||||
}
|
||||
|
||||
echo "\n";
|
||||
$or = 'Or' . $y;
|
||||
if (!isset(${$or})) {
|
||||
${$or} = '';
|
||||
}
|
||||
if (!empty(${$or}) && isset(${$or}[$x])) {
|
||||
$stripped_or = ${$or}[$x];
|
||||
} else {
|
||||
$stripped_or = '';
|
||||
}
|
||||
?>
|
||||
<td align="center">
|
||||
<textarea cols="20" rows="2" style="width: <?php echo $realwidth; ?>" name="Or<?php echo $w . '[' . $z . ']'; ?>" dir="<?php echo $text_dir; ?>"><?php echo htmlspecialchars($stripped_or); ?></textarea>
|
||||
</td>
|
||||
<?php
|
||||
if (!empty(${$or}) && isset(${$or}[$x])) {
|
||||
${'cur' . $or}[$z] = ${$or}[$x];
|
||||
}
|
||||
$z++;
|
||||
} // end for
|
||||
$w++;
|
||||
echo "\n";
|
||||
?>
|
||||
</tr>
|
||||
<?php
|
||||
echo "\n";
|
||||
$odd_row =! $odd_row;
|
||||
} // end for
|
||||
?>
|
||||
<!-- Modify columns -->
|
||||
<tr class="even noclick">
|
||||
<th><?php echo $strModify; ?>:</th>
|
||||
<?php
|
||||
$z = 0;
|
||||
for ($x = 0; $x < $col; $x++) {
|
||||
if (!empty($ins_col) && isset($ins_col[$x]) && $ins_col[$x] == 'on') {
|
||||
$curAndOrCol[$z] = $and_or_col[$y];
|
||||
if ($and_or_col[$z] == 'or') {
|
||||
$chk['or'] = ' checked="checked"';
|
||||
$chk['and'] = '';
|
||||
} else {
|
||||
$chk['and'] = ' checked="checked"';
|
||||
$chk['or'] = '';
|
||||
}
|
||||
?>
|
||||
<td align="center">
|
||||
<strong><?php echo $strOr; ?>:</strong>
|
||||
<input type="radio" name="and_or_col[<?php echo $z; ?>]" value="or"<?php echo $chk['or']; ?> />
|
||||
<strong><?php echo $strAnd; ?>:</strong>
|
||||
<input type="radio" name="and_or_col[<?php echo $z; ?>]" value="and"<?php echo $chk['and']; ?> />
|
||||
<br />
|
||||
<?php echo $strQBEIns . "\n"; ?>
|
||||
<input type="checkbox" name="ins_col[<?php echo $z; ?>]" />
|
||||
<?php echo $strQBEDel . "\n"; ?>
|
||||
<input type="checkbox" name="del_col[<?php echo $z; ?>]" />
|
||||
</td>
|
||||
<?php
|
||||
$z++;
|
||||
} // end if
|
||||
echo "\n";
|
||||
|
||||
if (!empty($del_col) && isset($del_col[$x]) && $del_col[$x] == 'on') {
|
||||
continue;
|
||||
}
|
||||
|
||||
if (isset($and_or_col[$y])) {
|
||||
$curAndOrCol[$z] = $and_or_col[$y];
|
||||
}
|
||||
if (isset($and_or_col[$z]) && $and_or_col[$z] == 'or') {
|
||||
$chk['or'] = ' checked="checked"';
|
||||
$chk['and'] = '';
|
||||
} else {
|
||||
$chk['and'] = ' checked="checked"';
|
||||
$chk['or'] = '';
|
||||
}
|
||||
?>
|
||||
<td align="center">
|
||||
<strong><?php echo $strOr; ?>:</strong>
|
||||
<input type="radio" name="and_or_col[<?php echo $z; ?>]" value="or"<?php echo $chk['or']; ?> />
|
||||
<strong><?php echo $strAnd; ?>:</strong>
|
||||
<input type="radio" name="and_or_col[<?php echo $z; ?>]" value="and"<?php echo $chk['and']; ?> />
|
||||
<br />
|
||||
<?php echo $strQBEIns . "\n"; ?>
|
||||
<input type="checkbox" name="ins_col[<?php echo $z; ?>]" />
|
||||
<?php echo $strQBEDel . "\n"; ?>
|
||||
<input type="checkbox" name="del_col[<?php echo $z; ?>]" />
|
||||
</td>
|
||||
<?php
|
||||
$z++;
|
||||
echo "\n";
|
||||
} // end for
|
||||
?>
|
||||
</tr>
|
||||
</table>
|
||||
|
||||
<!-- Other controls -->
|
||||
<?php
|
||||
$w--;
|
||||
$url_params['db'] = $db;
|
||||
$url_params['col_cnt'] = $z;
|
||||
$url_params['rows'] = $w;
|
||||
echo PMA_generate_common_hidden_inputs($url_params);
|
||||
?>
|
||||
</fieldset>
|
||||
<fieldset class="tblFooters">
|
||||
<table border="0" cellpadding="2" cellspacing="1">
|
||||
<tr>
|
||||
<td nowrap="nowrap">
|
||||
<?php echo $strAddDeleteRow; ?>:
|
||||
<select size="1" name="add_row" style="vertical-align: middle">
|
||||
<option value="-3">-3</option>
|
||||
<option value="-2">-2</option>
|
||||
<option value="-1">-1</option>
|
||||
<option value="0" selected="selected">0</option>
|
||||
<option value="1">1</option>
|
||||
<option value="2">2</option>
|
||||
<option value="3">3</option>
|
||||
</select>
|
||||
</td>
|
||||
<td width="10"> </td>
|
||||
<td nowrap="nowrap"><?php echo $strAddDeleteColumn; ?>:
|
||||
<select size="1" name="add_col" style="vertical-align: middle">
|
||||
<option value="-3">-3</option>
|
||||
<option value="-2">-2</option>
|
||||
<option value="-1">-1</option>
|
||||
<option value="0" selected="selected">0</option>
|
||||
<option value="1">1</option>
|
||||
<option value="2">2</option>
|
||||
<option value="3">3</option>
|
||||
</select>
|
||||
</td>
|
||||
<td width="10"> </td>
|
||||
<!-- Generates a query -->
|
||||
<td><input type="submit" name="modify" value="<?php echo $strUpdateQuery; ?>" /></td>
|
||||
</tr>
|
||||
</table>
|
||||
</fieldset>
|
||||
|
||||
<table>
|
||||
<tr><td>
|
||||
<fieldset>
|
||||
<legend><?php echo $strUseTables; ?></legend>
|
||||
<?php
|
||||
$strTableListOptions = '';
|
||||
$numTableListOptions = 0;
|
||||
foreach ($tbl_names as $key => $val) {
|
||||
$strTableListOptions .= ' ';
|
||||
$strTableListOptions .= '<option value="' . htmlspecialchars($key) . '"' . $val . '>'
|
||||
. str_replace(' ', ' ', htmlspecialchars($key)) . '</option>' . "\n";
|
||||
$numTableListOptions++;
|
||||
}
|
||||
?>
|
||||
<select name="TableList[]" multiple="multiple" id="listTable"
|
||||
size="<?php echo ($numTableListOptions > 30) ? '15' : '7'; ?>">
|
||||
<?php echo $strTableListOptions; ?>
|
||||
</select>
|
||||
</fieldset>
|
||||
<fieldset class="tblFooters">
|
||||
<input type="submit" name="modify" value="<?php echo $strUpdateQuery; ?>" />
|
||||
</fieldset>
|
||||
</td>
|
||||
<td width="20"> </td>
|
||||
<td>
|
||||
<fieldset>
|
||||
<legend><?php echo sprintf($strQueryOnDb, PMA_getDbLink($db)); ?>
|
||||
</legend>
|
||||
<textarea cols="80" name="sql_query" id="textSqlquery"
|
||||
rows="<?php echo ($numTableListOptions > 30) ? '15' : '7'; ?>"
|
||||
dir="<?php echo $text_dir; ?>">
|
||||
<?php
|
||||
// 1. SELECT
|
||||
$last_select = 0;
|
||||
if (!isset($qry_select)) {
|
||||
$qry_select = '';
|
||||
}
|
||||
for ($x = 0; $x < $col; $x++) {
|
||||
if (!empty($curField[$x]) && isset($curShow[$x]) && $curShow[$x] == 'on') {
|
||||
if ($last_select) {
|
||||
$qry_select .= ', ';
|
||||
}
|
||||
$qry_select .= $curField[$x];
|
||||
$last_select = 1;
|
||||
}
|
||||
} // end for
|
||||
if (!empty($qry_select)) {
|
||||
echo 'SELECT ' . htmlspecialchars($qry_select) . "\n";
|
||||
}
|
||||
|
||||
// 2. FROM
|
||||
|
||||
// Create LEFT JOINS out of Relations
|
||||
// Code originally by Mike Beck <mike.beck@ibmiller.de>
|
||||
// If we can use Relations we could make some left joins.
|
||||
// First find out if relations are available in this database.
|
||||
|
||||
// First we need the really needed Tables - those in TableList might still be
|
||||
// all Tables.
|
||||
if (isset($Field) && count($Field) > 0) {
|
||||
// Initialize some variables
|
||||
$tab_all = array();
|
||||
$col_all = array();
|
||||
$tab_wher = array();
|
||||
$tab_know = array();
|
||||
$tab_left = array();
|
||||
$col_where = array();
|
||||
$fromclause = '';
|
||||
|
||||
// We only start this if we have fields, otherwise it would be dumb
|
||||
foreach ($Field as $value) {
|
||||
$parts = explode('.', $value);
|
||||
if (!empty($parts[0]) && !empty($parts[1])) {
|
||||
$tab_raw = $parts[0];
|
||||
$tab = str_replace('`', '', $tab_raw);
|
||||
$tab_all[$tab] = $tab;
|
||||
|
||||
$col_raw = $parts[1];
|
||||
$col_all[] = $tab . '.' . str_replace('`', '', $col_raw);
|
||||
}
|
||||
} // end while
|
||||
|
||||
// Check 'where' clauses
|
||||
if ($cfgRelation['relwork'] && count($tab_all) > 0) {
|
||||
// Now we need all tables that we have in the where clause
|
||||
$crit_cnt = count($criteria);
|
||||
for ($x = 0; $x < $crit_cnt; $x++) {
|
||||
$curr_tab = explode('.', $Field[$x]);
|
||||
if (!empty($curr_tab[0]) && !empty($curr_tab[1])) {
|
||||
$tab_raw = $curr_tab[0];
|
||||
$tab = str_replace('`', '', $tab_raw);
|
||||
|
||||
$col_raw = $curr_tab[1];
|
||||
$col1 = str_replace('`', '', $col_raw);
|
||||
$col1 = $tab . '.' . $col1;
|
||||
// Now we know that our array has the same numbers as $criteria
|
||||
// we can check which of our columns has a where clause
|
||||
if (!empty($criteria[$x])) {
|
||||
if (substr($criteria[$x], 0, 1) == '=' || stristr($criteria[$x], 'is')) {
|
||||
$col_where[$col] = $col1;
|
||||
$tab_wher[$tab] = $tab;
|
||||
}
|
||||
} // end if
|
||||
} // end if
|
||||
} // end for
|
||||
|
||||
// Cleans temp vars w/o further use
|
||||
unset($tab_raw);
|
||||
unset($col_raw);
|
||||
unset($col1);
|
||||
|
||||
if (count($tab_wher) == 1) {
|
||||
// If there is exactly one column that has a decent where-clause
|
||||
// we will just use this
|
||||
$master = key($tab_wher);
|
||||
} else {
|
||||
// Now let's find out which of the tables has an index
|
||||
// (When the control user is the same as the normal user
|
||||
// because he is using one of his databases as pmadb,
|
||||
// the last db selected is not always the one where we need to work)
|
||||
PMA_DBI_select_db($db);
|
||||
|
||||
foreach ($tab_all as $tab) {
|
||||
$ind_rs = PMA_DBI_query('SHOW INDEX FROM ' . PMA_backquote($tab) . ';');
|
||||
while ($ind = PMA_DBI_fetch_assoc($ind_rs)) {
|
||||
$col1 = $tab . '.' . $ind['Column_name'];
|
||||
if (isset($col_all[$col1])) {
|
||||
if ($ind['non_unique'] == 0) {
|
||||
if (isset($col_where[$col1])) {
|
||||
$col_unique[$col1] = 'Y';
|
||||
} else {
|
||||
$col_unique[$col1] = 'N';
|
||||
}
|
||||
} else {
|
||||
if (isset($col_where[$col1])) {
|
||||
$col_index[$col1] = 'Y';
|
||||
} else {
|
||||
$col_index[$col1] = 'N';
|
||||
}
|
||||
}
|
||||
}
|
||||
} // end while (each col of tab)
|
||||
} // end while (each tab)
|
||||
// now we want to find the best.
|
||||
if (isset($col_unique) && count($col_unique) > 0) {
|
||||
$col_cand = $col_unique;
|
||||
$needsort = 1;
|
||||
} elseif (isset($col_index) && count($col_index) > 0) {
|
||||
$col_cand = $col_index;
|
||||
$needsort = 1;
|
||||
} elseif (isset($col_where) && count($col_where) > 0) {
|
||||
$col_cand = $tab_wher;
|
||||
$needsort = 0;
|
||||
} else {
|
||||
$col_cand = $tab_all;
|
||||
$needsort = 0;
|
||||
}
|
||||
|
||||
// If we came up with $col_unique (very good) or $col_index (still
|
||||
// good) as $col_cand we want to check if we have any 'Y' there
|
||||
// (that would mean that they were also found in the whereclauses
|
||||
// which would be great). if yes, we take only those
|
||||
if ($needsort == 1) {
|
||||
foreach ($col_cand as $col => $is_where) {
|
||||
$tab = explode('.', $col);
|
||||
$tab = $tab[0];
|
||||
if ($is_where == 'Y') {
|
||||
$vg[$col] = $tab;
|
||||
} else {
|
||||
$sg[$col] = $tab;
|
||||
}
|
||||
}
|
||||
if (isset($vg)) {
|
||||
$col_cand = $vg;
|
||||
// Candidates restricted in index+where
|
||||
} else {
|
||||
$col_cand = $sg;
|
||||
// None of the candidates where in a where-clause
|
||||
}
|
||||
}
|
||||
|
||||
// If our array of candidates has more than one member we'll just
|
||||
// find the smallest table.
|
||||
// Of course the actual query would be faster if we check for
|
||||
// the Criteria which gives the smallest result set in its table,
|
||||
// but it would take too much time to check this
|
||||
if (count($col_cand) > 1) {
|
||||
// Of course we only want to check each table once
|
||||
$checked_tables = $col_cand;
|
||||
foreach ($col_cand as $tab) {
|
||||
if ($checked_tables[$tab] != 1) {
|
||||
$tsize[$tab] = PMA_Table::countRecords($db, $tab, false);
|
||||
$checked_tables[$tab] = 1;
|
||||
}
|
||||
$csize[$tab] = $tsize[$tab];
|
||||
}
|
||||
asort($csize);
|
||||
reset($csize);
|
||||
$master = key($csize); // Smallest
|
||||
} else {
|
||||
reset($col_cand);
|
||||
$master = current($col_cand); // Only one single candidate
|
||||
}
|
||||
} // end if (exactly one where clause)
|
||||
|
||||
$tab_left = $tab_all;
|
||||
unset($tab_left[$master]);
|
||||
$tab_know[$master] = $master;
|
||||
|
||||
$run = 0;
|
||||
$emerg = '';
|
||||
while (count($tab_left) > 0) {
|
||||
if ($run % 2 == 0) {
|
||||
PMA_getRelatives('master');
|
||||
} else {
|
||||
PMA_getRelatives('foreign');
|
||||
}
|
||||
$run++;
|
||||
if ($run > 5) {
|
||||
|
||||
foreach ($tab_left as $tab) {
|
||||
$emerg .= ', ' . PMA_backquote($tab);
|
||||
unset($tab_left[$tab]);
|
||||
}
|
||||
}
|
||||
} // end while
|
||||
$qry_from = PMA_backquote($master) . $emerg . $fromclause;
|
||||
} // end if ($cfgRelation['relwork'] && count($tab_all) > 0)
|
||||
|
||||
} // end count($Field) > 0
|
||||
|
||||
// In case relations are not defined, just generate the FROM clause
|
||||
// from the list of tables, however we don't generate any JOIN
|
||||
|
||||
if (empty($qry_from) && isset($tab_all)) {
|
||||
$qry_from = implode(', ', $tab_all);
|
||||
}
|
||||
// Now let's see what we got
|
||||
if (!empty($qry_from)) {
|
||||
echo 'FROM ' . htmlspecialchars($qry_from) . "\n";
|
||||
}
|
||||
|
||||
// 3. WHERE
|
||||
$qry_where = '';
|
||||
$criteria_cnt = 0;
|
||||
for ($x = 0; $x < $col; $x++) {
|
||||
if (!empty($curField[$x]) && !empty($curCriteria[$x]) && $x && isset($last_where) && isset($curAndOrCol)) {
|
||||
$qry_where .= ' ' . strtoupper($curAndOrCol[$last_where]) . ' ';
|
||||
}
|
||||
if (!empty($curField[$x]) && !empty($curCriteria[$x])) {
|
||||
$qry_where .= '(' . $curField[$x] . ' ' . $curCriteria[$x] . ')';
|
||||
$last_where = $x;
|
||||
$criteria_cnt++;
|
||||
}
|
||||
} // end for
|
||||
if ($criteria_cnt > 1) {
|
||||
$qry_where = '(' . $qry_where . ')';
|
||||
}
|
||||
// OR rows ${'cur' . $or}[$x]
|
||||
if (!isset($curAndOrRow)) {
|
||||
$curAndOrRow = array();
|
||||
}
|
||||
for ($y = 0; $y <= $row; $y++) {
|
||||
$criteria_cnt = 0;
|
||||
$qry_orwhere = '';
|
||||
$last_orwhere = '';
|
||||
for ($x = 0; $x < $col; $x++) {
|
||||
if (!empty($curField[$x]) && !empty(${'curOr' . $y}[$x]) && $x) {
|
||||
$qry_orwhere .= ' ' . strtoupper($curAndOrCol[$last_orwhere]) . ' ';
|
||||
}
|
||||
if (!empty($curField[$x]) && !empty(${'curOr' . $y}[$x])) {
|
||||
$qry_orwhere .= '(' . $curField[$x]
|
||||
. ' '
|
||||
. ${'curOr' . $y}[$x]
|
||||
. ')';
|
||||
$last_orwhere = $x;
|
||||
$criteria_cnt++;
|
||||
}
|
||||
} // end for
|
||||
if ($criteria_cnt > 1) {
|
||||
$qry_orwhere = '(' . $qry_orwhere . ')';
|
||||
}
|
||||
if (!empty($qry_orwhere)) {
|
||||
$qry_where .= "\n"
|
||||
. strtoupper(isset($curAndOrRow[$y]) ? $curAndOrRow[$y] . ' ' : '')
|
||||
. $qry_orwhere;
|
||||
} // end if
|
||||
} // end for
|
||||
|
||||
if (!empty($qry_where) && $qry_where != '()') {
|
||||
echo 'WHERE ' . htmlspecialchars($qry_where) . "\n";
|
||||
} // end if
|
||||
|
||||
|
||||
// 4. ORDER BY
|
||||
$last_orderby = 0;
|
||||
if (!isset($qry_orderby)) {
|
||||
$qry_orderby = '';
|
||||
}
|
||||
for ($x = 0; $x < $col; $x++) {
|
||||
if ($last_orderby && $x && !empty($curField[$x]) && !empty($curSort[$x])) {
|
||||
$qry_orderby .= ', ';
|
||||
}
|
||||
if (!empty($curField[$x]) && !empty($curSort[$x])) {
|
||||
// if they have chosen all fields using the * selector,
|
||||
// then sorting is not available
|
||||
// Robbat2 - Fix for Bug #570698
|
||||
if (substr($curField[$x], -2) != '.*') {
|
||||
$qry_orderby .= $curField[$x] . ' ' . $curSort[$x];
|
||||
$last_orderby = 1;
|
||||
}
|
||||
}
|
||||
} // end for
|
||||
if (!empty($qry_orderby)) {
|
||||
echo 'ORDER BY ' . htmlspecialchars($qry_orderby) . "\n";
|
||||
}
|
||||
?>
|
||||
</textarea>
|
||||
</fieldset>
|
||||
<fieldset class="tblFooters">
|
||||
<input type="submit" name="submit_sql" value="<?php echo $strRunQuery; ?>" />
|
||||
</fieldset>
|
||||
</td>
|
||||
</tr>
|
||||
</table>
|
||||
</form>
|
||||
<?php
|
||||
/**
|
||||
* Displays the footer
|
||||
*/
|
||||
require_once './libraries/footer.inc.php';
|
||||
?>
|
||||
373
db_search.php
373
db_search.php
@@ -1,373 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* searchs the entire database
|
||||
*
|
||||
* @todo make use of UNION when searching multiple tables
|
||||
* @todo display executed query, optional?
|
||||
* @uses $cfg['UseDbSearch']
|
||||
* @uses $GLOBALS['db']
|
||||
* @uses $GLOBALS['strAccessDenied']
|
||||
* @uses $GLOBALS['strSearchOption1']
|
||||
* @uses $GLOBALS['strSearchOption2']
|
||||
* @uses $GLOBALS['strSearchOption3']
|
||||
* @uses $GLOBALS['strSearchOption4']
|
||||
* @uses $GLOBALS['strSearchResultsFor']
|
||||
* @uses $GLOBALS['strNumSearchResultsInTable']
|
||||
* @uses $GLOBALS['strBrowse']
|
||||
* @uses $GLOBALS['strDelete']
|
||||
* @uses $GLOBALS['strNumSearchResultsTotal']
|
||||
* @uses $GLOBALS['strSearchFormTitle']
|
||||
* @uses $GLOBALS['strSearchNeedle']
|
||||
* @uses $GLOBALS['strSearchType']
|
||||
* @uses $GLOBALS['strSplitWordsWithSpace']
|
||||
* @uses $GLOBALS['strSearchInTables']
|
||||
* @uses $GLOBALS['strUnselectAll']
|
||||
* @uses $GLOBALS['strSelectAll']
|
||||
* @uses PMA_DBI_get_tables()
|
||||
* @uses PMA_sqlAddslashes()
|
||||
* @uses PMA_getSearchSqls()
|
||||
* @uses PMA_DBI_fetch_value()
|
||||
* @uses PMA_linkOrButton()
|
||||
* @uses PMA_generate_common_url()
|
||||
* @uses PMA_generate_common_hidden_inputs()
|
||||
* @uses PMA_showMySQLDocu()
|
||||
* @uses $_REQUEST['search_str']
|
||||
* @uses $_REQUEST['submit_search']
|
||||
* @uses $_REQUEST['search_option']
|
||||
* @uses $_REQUEST['table_select']
|
||||
* @uses $_REQUEST['unselectall']
|
||||
* @uses $_REQUEST['selectall']
|
||||
* @uses $_REQUEST['field_str']
|
||||
* @uses is_string()
|
||||
* @uses htmlspecialchars()
|
||||
* @uses array_key_exists()
|
||||
* @uses is_array()
|
||||
* @uses array_intersect()
|
||||
* @uses sprintf()
|
||||
* @uses in_array()
|
||||
* @version $Id$
|
||||
* @author Thomas Chaumeny <chaume92 at aol.com>
|
||||
* @package phpMyAdmin
|
||||
*/
|
||||
|
||||
/**
|
||||
*
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
|
||||
/**
|
||||
* Gets some core libraries and send headers
|
||||
*/
|
||||
require './libraries/db_common.inc.php';
|
||||
|
||||
/**
|
||||
* init
|
||||
*/
|
||||
// If config variable $GLOBALS['cfg']['Usedbsearch'] is on false : exit.
|
||||
if (! $GLOBALS['cfg']['UseDbSearch']) {
|
||||
PMA_mysqlDie($GLOBALS['strAccessDenied'], '', false, $err_url);
|
||||
} // end if
|
||||
$url_query .= '&goto=db_search.php';
|
||||
$url_params['goto'] = 'db_search.php';
|
||||
|
||||
/**
|
||||
* @global array list of tables from the current database
|
||||
* but do not clash with $tables coming from db_info.inc.php
|
||||
*/
|
||||
$tables_names_only = PMA_DBI_get_tables($GLOBALS['db']);
|
||||
|
||||
$search_options = array(
|
||||
'1' => $GLOBALS['strSearchOption1'],
|
||||
'2' => $GLOBALS['strSearchOption2'],
|
||||
'3' => $GLOBALS['strSearchOption3'],
|
||||
'4' => $GLOBALS['strSearchOption4'],
|
||||
);
|
||||
|
||||
if (empty($_REQUEST['search_option']) || ! is_string($_REQUEST['search_option'])
|
||||
|| ! array_key_exists($_REQUEST['search_option'], $search_options)) {
|
||||
$search_option = 1;
|
||||
unset($_REQUEST['submit_search']);
|
||||
} else {
|
||||
$search_option = (int) $_REQUEST['search_option'];
|
||||
$option_str = $search_options[$_REQUEST['search_option']];
|
||||
}
|
||||
|
||||
if (empty($_REQUEST['search_str']) || ! is_string($_REQUEST['search_str'])) {
|
||||
unset($_REQUEST['submit_search']);
|
||||
$searched = '';
|
||||
} else {
|
||||
$searched = htmlspecialchars($_REQUEST['search_str']);
|
||||
// For "as regular expression" (search option 4), we should not treat
|
||||
// this as an expression that contains a LIKE (second parameter of
|
||||
// PMA_sqlAddslashes()).
|
||||
//
|
||||
// Usage example: If user is seaching for a literal $ in a regexp search,
|
||||
// he should enter \$ as the value.
|
||||
$search_str = PMA_sqlAddslashes($_REQUEST['search_str'], ($search_option == 4 ? false : true));
|
||||
}
|
||||
|
||||
$tables_selected = array();
|
||||
if (empty($_REQUEST['table_select']) || ! is_array($_REQUEST['table_select'])) {
|
||||
unset($_REQUEST['submit_search']);
|
||||
} elseif (! isset($_REQUEST['selectall']) && ! isset($_REQUEST['unselectall'])) {
|
||||
$tables_selected = array_intersect($_REQUEST['table_select'], $tables_names_only);
|
||||
}
|
||||
|
||||
if (isset($_REQUEST['selectall'])) {
|
||||
$tables_selected = $tables_names_only;
|
||||
} elseif (isset($_REQUEST['unselectall'])) {
|
||||
$tables_selected = array();
|
||||
}
|
||||
|
||||
if (empty($_REQUEST['field_str']) || ! is_string($_REQUEST['field_str'])) {
|
||||
unset($field_str);
|
||||
} else {
|
||||
$field_str = PMA_sqlAddslashes($_REQUEST['field_str'], true);
|
||||
}
|
||||
|
||||
/**
|
||||
* Displays top links
|
||||
*/
|
||||
$sub_part = '';
|
||||
require './libraries/db_info.inc.php';
|
||||
|
||||
|
||||
/**
|
||||
* 1. Main search form has been submitted
|
||||
*/
|
||||
if (isset($_REQUEST['submit_search'])) {
|
||||
|
||||
/**
|
||||
* Builds the SQL search query
|
||||
*
|
||||
* @todo can we make use of fulltextsearch IN BOOLEAN MODE for this?
|
||||
* @uses PMA_DBI_query
|
||||
* PMA_backquote
|
||||
* PMA_DBI_free_result
|
||||
* PMA_DBI_fetch_assoc
|
||||
* $GLOBALS['db']
|
||||
* explode
|
||||
* count
|
||||
* strlen
|
||||
* @param string the table name
|
||||
* @param string restrict the search to this field
|
||||
* @param string the string to search
|
||||
* @param integer type of search (1 -> 1 word at least, 2 -> all words,
|
||||
* 3 -> exact string, 4 -> regexp)
|
||||
*
|
||||
* @return array 3 SQL querys (for count, display and delete results)
|
||||
*
|
||||
* @global string the url to return to in case of errors
|
||||
* @global string charset connection
|
||||
*/
|
||||
function PMA_getSearchSqls($table, $field, $search_str, $search_option)
|
||||
{
|
||||
global $err_url;
|
||||
|
||||
// Statement types
|
||||
$sqlstr_select = 'SELECT';
|
||||
$sqlstr_delete = 'DELETE';
|
||||
|
||||
// Fields to select
|
||||
$tblfields = PMA_DBI_fetch_result('SHOW FIELDS FROM ' . PMA_backquote($table) . ' FROM ' . PMA_backquote($GLOBALS['db']),
|
||||
null, 'Field');
|
||||
|
||||
// Table to use
|
||||
$sqlstr_from = ' FROM ' . PMA_backquote($GLOBALS['db']) . '.' . PMA_backquote($table);
|
||||
|
||||
$search_words = (($search_option > 2) ? array($search_str) : explode(' ', $search_str));
|
||||
$search_wds_cnt = count($search_words);
|
||||
|
||||
$like_or_regex = (($search_option == 4) ? 'REGEXP' : 'LIKE');
|
||||
$automatic_wildcard = (($search_option < 3) ? '%' : '');
|
||||
|
||||
$fieldslikevalues = array();
|
||||
foreach ($search_words as $search_word) {
|
||||
// Eliminates empty values
|
||||
if (strlen($search_word) === 0) {
|
||||
continue;
|
||||
}
|
||||
|
||||
$thefieldlikevalue = array();
|
||||
foreach ($tblfields as $tblfield) {
|
||||
if (! isset($field) || strlen($field) == 0 || $tblfield == $field) {
|
||||
$thefieldlikevalue[] = PMA_backquote($tblfield)
|
||||
. ' ' . $like_or_regex . ' '
|
||||
. "'" . $automatic_wildcard
|
||||
. $search_word
|
||||
. $automatic_wildcard . "'";
|
||||
}
|
||||
} // end for
|
||||
|
||||
if (count($thefieldlikevalue) > 0) {
|
||||
$fieldslikevalues[] = implode(' OR ', $thefieldlikevalue);
|
||||
}
|
||||
} // end for
|
||||
|
||||
$implode_str = ($search_option == 1 ? ' OR ' : ' AND ');
|
||||
if ( empty($fieldslikevalues)) {
|
||||
// this could happen when the "inside field" does not exist
|
||||
// in any selected tables
|
||||
$sqlstr_where = ' WHERE FALSE';
|
||||
} else {
|
||||
$sqlstr_where = ' WHERE (' . implode(') ' . $implode_str . ' (', $fieldslikevalues) . ')';
|
||||
}
|
||||
unset($fieldslikevalues);
|
||||
|
||||
// Builds complete queries
|
||||
$sql['select_fields'] = $sqlstr_select . ' * ' . $sqlstr_from . $sqlstr_where;
|
||||
// here, I think we need to still use the COUNT clause, even for
|
||||
// VIEWs, anyway we have a WHERE clause that should limit results
|
||||
$sql['select_count'] = $sqlstr_select . ' COUNT(*) AS `count`' . $sqlstr_from . $sqlstr_where;
|
||||
$sql['delete'] = $sqlstr_delete . $sqlstr_from . $sqlstr_where;
|
||||
|
||||
return $sql;
|
||||
} // end of the "PMA_getSearchSqls()" function
|
||||
|
||||
|
||||
/**
|
||||
* Displays the results
|
||||
*/
|
||||
$this_url_params = array(
|
||||
'db' => $GLOBALS['db'],
|
||||
'goto' => 'db_sql.php',
|
||||
'pos' => 0,
|
||||
'is_js_confirmed' => 0,
|
||||
);
|
||||
|
||||
// Displays search string
|
||||
echo '<br />' . "\n"
|
||||
.'<table class="data">' . "\n"
|
||||
.'<caption class="tblHeaders">' . "\n"
|
||||
.sprintf($GLOBALS['strSearchResultsFor'],
|
||||
$searched, $option_str) . "\n"
|
||||
.'</caption>' . "\n";
|
||||
|
||||
$num_search_result_total = 0;
|
||||
$odd_row = true;
|
||||
|
||||
foreach ($tables_selected as $each_table) {
|
||||
// Gets the SQL statements
|
||||
$newsearchsqls = PMA_getSearchSqls($each_table, (! empty($field_str) ? $field_str : ''), $search_str, $search_option);
|
||||
|
||||
// Executes the "COUNT" statement
|
||||
$res_cnt = PMA_DBI_fetch_value($newsearchsqls['select_count']);
|
||||
$num_search_result_total += $res_cnt;
|
||||
|
||||
$sql_query .= $newsearchsqls['select_count'];
|
||||
|
||||
echo '<tr class="' . ($odd_row ? 'odd' : 'even') . '">'
|
||||
.'<td>' . sprintf($GLOBALS['strNumSearchResultsInTable'], $res_cnt,
|
||||
htmlspecialchars($each_table)) . "</td>\n";
|
||||
|
||||
if ($res_cnt > 0) {
|
||||
$this_url_params['sql_query'] = $newsearchsqls['select_fields'];
|
||||
echo '<td>' . PMA_linkOrButton(
|
||||
'sql.php' . PMA_generate_common_url($this_url_params),
|
||||
$GLOBALS['strBrowse'], '') . "</td>\n";
|
||||
|
||||
$this_url_params['sql_query'] = $newsearchsqls['delete'];
|
||||
echo '<td>' . PMA_linkOrButton(
|
||||
'sql.php' . PMA_generate_common_url($this_url_params),
|
||||
$GLOBALS['strDelete'], $newsearchsqls['delete']) . "</td>\n";
|
||||
|
||||
} else {
|
||||
echo '<td> </td>' . "\n"
|
||||
.'<td> </td>' . "\n";
|
||||
}// end if else
|
||||
$odd_row = ! $odd_row;
|
||||
echo '</tr>' . "\n";
|
||||
} // end for
|
||||
|
||||
echo '</table>' . "\n";
|
||||
|
||||
if (count($tables_selected) > 1) {
|
||||
echo '<p>' . sprintf($GLOBALS['strNumSearchResultsTotal'],
|
||||
$num_search_result_total) . '</p>' . "\n";
|
||||
}
|
||||
} // end 1.
|
||||
|
||||
|
||||
/**
|
||||
* 2. Displays the main search form
|
||||
*/
|
||||
?>
|
||||
<a name="db_search"></a>
|
||||
<form method="post" action="db_search.php" name="db_search">
|
||||
<?php echo PMA_generate_common_hidden_inputs($GLOBALS['db']); ?>
|
||||
<fieldset>
|
||||
<legend><?php echo $GLOBALS['strSearchFormTitle']; ?></legend>
|
||||
|
||||
<table class="formlayout">
|
||||
<tr><td><?php echo $GLOBALS['strSearchNeedle']; ?></td>
|
||||
<td><input type="text" name="search_str" size="60"
|
||||
value="<?php echo $searched; ?>" /></td>
|
||||
</tr>
|
||||
<tr><td align="right" valign="top">
|
||||
<?php echo $GLOBALS['strSearchType']; ?></td>
|
||||
<td><?php
|
||||
|
||||
$choices = array(
|
||||
'1' => $GLOBALS['strSearchOption1'] . PMA_showHint($GLOBALS['strSplitWordsWithSpace']),
|
||||
'2' => $GLOBALS['strSearchOption2'] . PMA_showHint($GLOBALS['strSplitWordsWithSpace']),
|
||||
'3' => $GLOBALS['strSearchOption3'],
|
||||
'4' => $GLOBALS['strSearchOption4'] . ' ' . PMA_showMySQLDocu('Regexp', 'Regexp')
|
||||
);
|
||||
// 4th parameter set to true to add line breaks
|
||||
// 5th parameter set to false to avoid htmlspecialchars() escaping in the label
|
||||
// since we have some HTML in some labels
|
||||
PMA_display_html_radio('search_option', $choices, $search_option, true, false);
|
||||
unset($choices);
|
||||
?>
|
||||
</td>
|
||||
</tr>
|
||||
<tr><td align="right" valign="top">
|
||||
<?php echo $GLOBALS['strSearchInTables']; ?></td>
|
||||
<td rowspan="2">
|
||||
<?php
|
||||
echo ' <select name="table_select[]" size="6" multiple="multiple">' . "\n";
|
||||
foreach ($tables_names_only as $each_table) {
|
||||
if (in_array($each_table, $tables_selected)) {
|
||||
$is_selected = ' selected="selected"';
|
||||
} else {
|
||||
$is_selected = '';
|
||||
}
|
||||
|
||||
echo ' <option value="' . htmlspecialchars($each_table) . '"'
|
||||
. $is_selected . '>'
|
||||
. str_replace(' ', ' ', htmlspecialchars($each_table)) . '</option>' . "\n";
|
||||
} // end while
|
||||
|
||||
echo ' </select>' . "\n";
|
||||
$alter_select =
|
||||
'<a href="db_search.php' . PMA_generate_common_url(array_merge($url_params, array('selectall' => 1))) . '#db_search"'
|
||||
. ' onclick="setSelectOptions(\'db_search\', \'table_select[]\', true); return false;">' . $GLOBALS['strSelectAll'] . '</a>'
|
||||
. ' / '
|
||||
. '<a href="db_search.php' . PMA_generate_common_url(array_merge($url_params, array('unselectall' => 1))) . '#db_search"'
|
||||
. ' onclick="setSelectOptions(\'db_search\', \'table_select[]\', false); return false;">' . $GLOBALS['strUnselectAll'] . '</a>';
|
||||
?>
|
||||
</td>
|
||||
</tr>
|
||||
<tr><td align="right" valign="bottom">
|
||||
<?php echo $alter_select; ?></td>
|
||||
</tr>
|
||||
<tr><td align="right">
|
||||
<?php echo $GLOBALS['strSearchInField']; ?></td>
|
||||
<td><input type="text" name="field_str" size="60"
|
||||
value="<?php echo ! empty($field_str) ? $field_str : ''; ?>" /></td>
|
||||
</tr>
|
||||
</table>
|
||||
</fieldset>
|
||||
<fieldset class="tblFooters">
|
||||
<input type="submit" name="submit_search" value="<?php echo $GLOBALS['strGo']; ?>"
|
||||
id="buttonGo" />
|
||||
</fieldset>
|
||||
</form>
|
||||
|
||||
<?php
|
||||
/**
|
||||
* Displays the footer
|
||||
*/
|
||||
require_once './libraries/footer.inc.php';
|
||||
?>
|
||||
46
db_sql.php
46
db_sql.php
@@ -1,46 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
*
|
||||
* @version $Id$
|
||||
* @package phpMyAdmin
|
||||
*/
|
||||
|
||||
/**
|
||||
*
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
|
||||
/**
|
||||
* Runs common work
|
||||
*/
|
||||
require './libraries/db_common.inc.php';
|
||||
require_once './libraries/sql_query_form.lib.php';
|
||||
|
||||
// After a syntax error, we return to this script
|
||||
// with the typed query in the textarea.
|
||||
$goto = 'db_sql.php';
|
||||
$back = 'db_sql.php';
|
||||
|
||||
/**
|
||||
* Gets informations about the database and, if it is empty, move to the
|
||||
* "db_structure.php" script where table can be created
|
||||
*/
|
||||
require './libraries/db_info.inc.php';
|
||||
if ($num_tables == 0 && empty($db_query_force)) {
|
||||
$sub_part = '';
|
||||
$is_info = TRUE;
|
||||
require './db_structure.php';
|
||||
exit();
|
||||
}
|
||||
|
||||
/**
|
||||
* Query box, bookmark, insert data from textfile
|
||||
*/
|
||||
PMA_sqlQueryForm(true, false, isset($_REQUEST['delimiter']) ? $_REQUEST['delimiter'] : ';');
|
||||
|
||||
/**
|
||||
* Displays the footer
|
||||
*/
|
||||
require_once './libraries/footer.inc.php';
|
||||
?>
|
||||
610
db_structure.php
610
db_structure.php
@@ -1,610 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
*
|
||||
* @version $Id$
|
||||
* @package phpMyAdmin
|
||||
*/
|
||||
|
||||
/**
|
||||
*
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
require_once './libraries/Table.class.php';
|
||||
|
||||
$GLOBALS['js_include'][] = 'mootools.js';
|
||||
|
||||
/**
|
||||
* Prepares the tables list if the user where not redirected to this script
|
||||
* because there is no table in the database ($is_info is true)
|
||||
*/
|
||||
if (empty($is_info)) {
|
||||
// Drops/deletes/etc. multiple tables if required
|
||||
if ((!empty($submit_mult) && isset($selected_tbl))
|
||||
|| isset($mult_btn)) {
|
||||
$action = 'db_structure.php';
|
||||
$err_url = 'db_structure.php?'. PMA_generate_common_url($db);
|
||||
|
||||
// see bug #2794840; in this case, code path is:
|
||||
// db_structure.php -> libraries/mult_submits.inc.php -> sql.php
|
||||
// -> db_structure.php and if we got an error on the multi submit,
|
||||
// we must display it here and not call again mult_submits.inc.php
|
||||
if (! isset($error) || FALSE === $error) {
|
||||
require './libraries/mult_submits.inc.php';
|
||||
}
|
||||
if (empty($message)) {
|
||||
$message = PMA_Message::success();
|
||||
}
|
||||
}
|
||||
require './libraries/db_common.inc.php';
|
||||
$url_query .= '&goto=db_structure.php';
|
||||
|
||||
// Gets the database structure
|
||||
$sub_part = '_structure';
|
||||
require './libraries/db_info.inc.php';
|
||||
|
||||
require_once './libraries/replication.inc.php';
|
||||
}
|
||||
|
||||
// 1. No tables
|
||||
if ($num_tables == 0) {
|
||||
echo '<p>' . $strNoTablesFound . '</p>' . "\n";
|
||||
|
||||
if (empty($db_is_information_schema)) {
|
||||
require './libraries/display_create_table.lib.php';
|
||||
} // end if (Create Table dialog)
|
||||
|
||||
/**
|
||||
* Displays the footer
|
||||
*/
|
||||
require_once './libraries/footer.inc.php';
|
||||
exit;
|
||||
}
|
||||
|
||||
// else
|
||||
// 2. Shows table informations - staybyte - 11 June 2001
|
||||
|
||||
require_once './libraries/bookmark.lib.php';
|
||||
|
||||
require_once './libraries/mysql_charsets.lib.php';
|
||||
$db_collation = PMA_getDbCollation($db);
|
||||
|
||||
// in a separate file to avoid redeclaration of functions in some code paths
|
||||
require_once './libraries/db_structure.lib.php';
|
||||
|
||||
$titles = array();
|
||||
if (true == $cfg['PropertiesIconic']) {
|
||||
$titles['Browse'] = '<img class="icon" width="16" height="16" src="' .$pmaThemeImage . 'b_browse.png" alt="' . $strBrowse . '" title="' . $strBrowse . '" />';
|
||||
$titles['NoBrowse'] = '<img class="icon" width="16" height="16" src="' .$pmaThemeImage . 'bd_browse.png" alt="' . $strBrowse . '" title="' . $strBrowse . '" />';
|
||||
$titles['Search'] = '<img class="icon" width="16" height="16" src="' .$pmaThemeImage . 'b_select.png" alt="' . $strSearch . '" title="' . $strSearch . '" />';
|
||||
$titles['NoSearch'] = '<img class="icon" width="16" height="16" src="' .$pmaThemeImage . 'bd_select.png" alt="' . $strSearch . '" title="' . $strSearch . '" />';
|
||||
$titles['Insert'] = '<img class="icon" width="16" height="16" src="' .$pmaThemeImage . 'b_insrow.png" alt="' . $strInsert . '" title="' . $strInsert . '" />';
|
||||
$titles['NoInsert'] = '<img class="icon" width="16" height="16" src="' .$pmaThemeImage . 'bd_insrow.png" alt="' . $strInsert . '" title="' . $strInsert . '" />';
|
||||
$titles['Structure'] = '<img class="icon" width="16" height="16" src="' .$pmaThemeImage . 'b_props.png" alt="' . $strStructure . '" title="' . $strStructure . '" />';
|
||||
$titles['Drop'] = '<img class="icon" width="16" height="16" src="' .$pmaThemeImage . 'b_drop.png" alt="' . $strDrop . '" title="' . $strDrop . '" />';
|
||||
$titles['NoDrop'] = '<img class="icon" width="16" height="16" src="' .$pmaThemeImage . 'bd_drop.png" alt="' . $strDrop . '" title="' . $strDrop . '" />';
|
||||
$titles['Empty'] = '<img class="icon" width="16" height="16" src="' .$pmaThemeImage . 'b_empty.png" alt="' . $strEmpty . '" title="' . $strEmpty . '" />';
|
||||
$titles['NoEmpty'] = '<img class="icon" width="16" height="16" src="' .$pmaThemeImage . 'bd_empty.png" alt="' . $strEmpty . '" title="' . $strEmpty . '" />';
|
||||
|
||||
if ('both' === $cfg['PropertiesIconic']) {
|
||||
$titles['Browse'] .= $strBrowse;
|
||||
$titles['Search'] .= $strSearch;
|
||||
$titles['NoBrowse'] .= $strBrowse;
|
||||
$titles['NoSearch'] .= $strSearch;
|
||||
$titles['Insert'] .= $strInsert;
|
||||
$titles['NoInsert'] .= $strInsert;
|
||||
$titles['Structure'] .= $strStructure;
|
||||
$titles['Drop'] .= $strDrop;
|
||||
$titles['NoDrop'] .= $strDrop;
|
||||
$titles['Empty'] .= $strEmpty;
|
||||
$titles['NoEmpty'] .= $strEmpty;
|
||||
}
|
||||
} else {
|
||||
$titles['Browse'] = $strBrowse;
|
||||
$titles['Search'] = $strSearch;
|
||||
$titles['NoBrowse'] = $strBrowse;
|
||||
$titles['NoSearch'] = $strSearch;
|
||||
$titles['Insert'] = $strInsert;
|
||||
$titles['NoInsert'] = $strInsert;
|
||||
$titles['Structure'] = $strStructure;
|
||||
$titles['Drop'] = $strDrop;
|
||||
$titles['NoDrop'] = $strDrop;
|
||||
$titles['Empty'] = $strEmpty;
|
||||
$titles['NoEmpty'] = $strEmpty;
|
||||
}
|
||||
|
||||
/**
|
||||
* Displays the tables list
|
||||
*/
|
||||
$_url_params = array(
|
||||
'pos' => $pos,
|
||||
'db' => $db);
|
||||
|
||||
// Add the sort options if they exists
|
||||
if (isset($_REQUEST['sort'])) {
|
||||
$_url_params['sort'] = $_REQUEST['sort'];
|
||||
}
|
||||
|
||||
if (isset($_REQUEST['sort_order'])) {
|
||||
$_url_params['sort_order'] = $_REQUEST['sort_order'];
|
||||
}
|
||||
|
||||
PMA_listNavigator($total_num_tables, $pos, $_url_params, 'db_structure.php', 'frame_content', $GLOBALS['cfg']['MaxTableList']);
|
||||
|
||||
?>
|
||||
<form method="post" action="db_structure.php" name="tablesForm" id="tablesForm">
|
||||
<?php
|
||||
echo PMA_generate_common_hidden_inputs($db);
|
||||
|
||||
PMA_TableHeader($db_is_information_schema, $server_slave_status);
|
||||
|
||||
$i = $sum_entries = 0;
|
||||
$sum_size = (double) 0;
|
||||
$overhead_size = (double) 0;
|
||||
$overhead_check = '';
|
||||
$checked = !empty($checkall) ? ' checked="checked"' : '';
|
||||
$num_columns = $cfg['PropertiesNumColumns'] > 1 ? ceil($num_tables / $cfg['PropertiesNumColumns']) + 1 : 0;
|
||||
$row_count = 0;
|
||||
|
||||
|
||||
$hidden_fields = array();
|
||||
$odd_row = true;
|
||||
$sum_row_count_pre = '';
|
||||
|
||||
// added by rajk - for blobstreaming
|
||||
$PMA_Config = $_SESSION['PMA_Config'];
|
||||
|
||||
if (!empty($PMA_Config))
|
||||
$session_bs_tables = $PMA_Config->get('BLOBSTREAMING_TABLES'); // list of blobstreaming tables
|
||||
|
||||
$tableReductionCount = 0; // the amount to reduce the table count by
|
||||
|
||||
foreach ($tables as $keyname => $each_table) {
|
||||
if (isset($session_bs_tables))
|
||||
{
|
||||
// compare table name against blobstreaming tables
|
||||
foreach ($session_bs_tables as $table_key=>$table_val)
|
||||
// if the table is a blobstreaming table, reduce table count and skip outer foreach loop
|
||||
if ($table_key == $keyname)
|
||||
{
|
||||
$tableReductionCount++;
|
||||
continue 2;
|
||||
}
|
||||
}
|
||||
|
||||
// loic1: Patch from Joshua Nye <josh at boxcarmedia.com> to get valid
|
||||
// statistics whatever is the table type
|
||||
|
||||
$table_is_view = false;
|
||||
$table_encoded = urlencode($each_table['TABLE_NAME']);
|
||||
// Sets parameters for links
|
||||
$tbl_url_query = $url_query . '&table=' . $table_encoded;
|
||||
// do not list the previous table's size info for a view
|
||||
$formatted_size = '-';
|
||||
$unit = '';
|
||||
|
||||
switch ( $each_table['ENGINE']) {
|
||||
// MyISAM, ISAM or Heap table: Row count, data size and index size
|
||||
// are accurate; data size is accurate for ARCHIVE
|
||||
case 'MyISAM' :
|
||||
case 'ISAM' :
|
||||
case 'HEAP' :
|
||||
case 'MEMORY' :
|
||||
case 'ARCHIVE' :
|
||||
if ($db_is_information_schema) {
|
||||
$each_table['Rows'] = PMA_Table::countRecords($db,
|
||||
$each_table['Name']);
|
||||
}
|
||||
|
||||
if ($is_show_stats) {
|
||||
$tblsize = doubleval($each_table['Data_length']) + doubleval($each_table['Index_length']);
|
||||
$sum_size += $tblsize;
|
||||
list($formatted_size, $unit) = PMA_formatByteDown($tblsize, 3, ($tblsize > 0) ? 1 : 0);
|
||||
if (isset($each_table['Data_free']) && $each_table['Data_free'] > 0) {
|
||||
list($formatted_overhead, $overhead_unit) = PMA_formatByteDown($each_table['Data_free'], 3, ($each_table['Data_free'] > 0) ? 1 : 0);
|
||||
$overhead_size += $each_table['Data_free'];
|
||||
}
|
||||
}
|
||||
break;
|
||||
case 'InnoDB' :
|
||||
// InnoDB table: Row count is not accurate but data and index
|
||||
// sizes are.
|
||||
|
||||
if ($each_table['TABLE_ROWS'] < $GLOBALS['cfg']['MaxExactCount']) {
|
||||
$each_table['COUNTED'] = true;
|
||||
$each_table['TABLE_ROWS'] = PMA_Table::countRecords($db,
|
||||
$each_table['TABLE_NAME'], $force_exact = true,
|
||||
$is_view = false);
|
||||
} else {
|
||||
$each_table['COUNTED'] = false;
|
||||
}
|
||||
|
||||
if ($is_show_stats) {
|
||||
$tblsize = $each_table['Data_length'] + $each_table['Index_length'];
|
||||
$sum_size += $tblsize;
|
||||
list($formatted_size, $unit) = PMA_formatByteDown($tblsize, 3, ($tblsize > 0) ? 1 : 0);
|
||||
}
|
||||
//$display_rows = ' - ';
|
||||
break;
|
||||
case 'MRG_MyISAM' :
|
||||
case 'BerkeleyDB' :
|
||||
// Merge or BerkleyDB table: Only row count is accurate.
|
||||
if ($is_show_stats) {
|
||||
$formatted_size = ' - ';
|
||||
$unit = '';
|
||||
}
|
||||
break;
|
||||
// for a view, the ENGINE is sometimes reported as null,
|
||||
// or on some servers it's reported as "SYSTEM VIEW"
|
||||
case null :
|
||||
case 'SYSTEM VIEW' :
|
||||
// if table is broken, Engine is reported as null, so one more test
|
||||
if ($each_table['TABLE_TYPE'] == 'VIEW') {
|
||||
// countRecords() takes care of $cfg['MaxExactCountViews']
|
||||
$each_table['TABLE_ROWS'] = PMA_Table::countRecords($db,
|
||||
$each_table['TABLE_NAME'], $force_exact = true,
|
||||
$is_view = true);
|
||||
$table_is_view = true;
|
||||
}
|
||||
break;
|
||||
default :
|
||||
// Unknown table type.
|
||||
if ($is_show_stats) {
|
||||
$formatted_size = 'unknown';
|
||||
$unit = '';
|
||||
}
|
||||
} // end switch
|
||||
$sum_entries += $each_table['TABLE_ROWS'];
|
||||
|
||||
if (isset($each_table['Collation'])) {
|
||||
$collation = '<dfn title="'
|
||||
. PMA_getCollationDescr($each_table['Collation']) . '">'
|
||||
. $each_table['Collation'] . '</dfn>';
|
||||
} else {
|
||||
$collation = '---';
|
||||
}
|
||||
|
||||
if ($is_show_stats) {
|
||||
if (isset($formatted_overhead)) {
|
||||
$overhead = '<a href="tbl_structure.php?'
|
||||
. $tbl_url_query . '#showusage">' . $formatted_overhead
|
||||
. ' ' . $overhead_unit . '</a>' . "\n";
|
||||
unset($formatted_overhead);
|
||||
$overhead_check .=
|
||||
"document.getElementById('checkbox_tbl_" . ($i + 1) . "').checked = true;";
|
||||
} else {
|
||||
$overhead = '-';
|
||||
}
|
||||
} // end if
|
||||
|
||||
$alias = (!empty($tooltip_aliasname) && isset($tooltip_aliasname[$each_table['TABLE_NAME']]))
|
||||
? str_replace(' ', ' ', htmlspecialchars($tooltip_truename[$each_table['TABLE_NAME']]))
|
||||
: str_replace(' ', ' ', htmlspecialchars($each_table['TABLE_NAME']));
|
||||
$truename = (!empty($tooltip_truename) && isset($tooltip_truename[$each_table['TABLE_NAME']]))
|
||||
? str_replace(' ', ' ', htmlspecialchars($tooltip_truename[$each_table['TABLE_NAME']]))
|
||||
: str_replace(' ', ' ', htmlspecialchars($each_table['TABLE_NAME']));
|
||||
|
||||
$i++;
|
||||
|
||||
$row_count++;
|
||||
if ($table_is_view) {
|
||||
$hidden_fields[] = '<input type="hidden" name="views[]" value="' . htmlspecialchars($each_table['TABLE_NAME']) . '" />';
|
||||
}
|
||||
|
||||
if ($each_table['TABLE_ROWS'] > 0) {
|
||||
$browse_table = '<a href="sql.php?' . $tbl_url_query . '&pos=0">' . $titles['Browse'] . '</a>';
|
||||
$search_table = '<a href="tbl_select.php?' . $tbl_url_query . '">' . $titles['Search'] . '</a>';
|
||||
} else {
|
||||
$browse_table = $titles['NoBrowse'];
|
||||
$search_table = $titles['NoSearch'];
|
||||
}
|
||||
|
||||
if (! $db_is_information_schema) {
|
||||
if (! empty($each_table['TABLE_ROWS'])) {
|
||||
$empty_table = '<a href="sql.php?' . $tbl_url_query
|
||||
. '&sql_query=';
|
||||
$empty_table .= urlencode('TRUNCATE ' . PMA_backquote($each_table['TABLE_NAME']))
|
||||
. '&zero_rows='
|
||||
. urlencode(sprintf($strTableHasBeenEmptied, htmlspecialchars($each_table['TABLE_NAME'])))
|
||||
. '" onclick="return confirmLink(this, \'TRUNCATE ';
|
||||
$empty_table .= PMA_jsFormat($each_table['TABLE_NAME']) . '\')">' . $titles['Empty'] . '</a>';
|
||||
} else {
|
||||
$empty_table = $titles['NoEmpty'];
|
||||
}
|
||||
$drop_query = 'DROP '
|
||||
. ($table_is_view ? 'VIEW' : 'TABLE')
|
||||
. ' ' . PMA_backquote($each_table['TABLE_NAME']);
|
||||
$drop_message = sprintf(
|
||||
$table_is_view ? $strViewHasBeenDropped : $strTableHasBeenDropped,
|
||||
str_replace(' ', ' ', htmlspecialchars($each_table['TABLE_NAME'])));
|
||||
}
|
||||
|
||||
$tracking_icon = '';
|
||||
if (PMA_Tracker::isActive()) {
|
||||
if (PMA_Tracker::isTracked($GLOBALS["db"], $truename)) {
|
||||
$tracking_icon = '<a href="tbl_tracking.php?' . $url_query.'&table=' . $truename . '"><img class="icon" width="14" height="14" src="' . $pmaThemeImage . 'eye.png" alt="' . $strTrackingIsActive . '" title="' . $strTrackingIsActive . '" /></a>';
|
||||
} elseif (PMA_Tracker::getVersion($GLOBALS["db"], $truename) > 0) {
|
||||
$tracking_icon = '<a href="tbl_tracking.php?' . $url_query . '&table=' . $truename . '"><img class="icon" width="14" height="14" src="' . $pmaThemeImage . 'eye_grey.png" alt="' . $strTrackingIsNotActive . '" title="' . $strTrackingIsNotActive . '" /></a>';
|
||||
}
|
||||
}
|
||||
|
||||
if ($num_columns > 0 && $num_tables > $num_columns
|
||||
&& (($row_count % $num_columns) == 0)) {
|
||||
$row_count = 1;
|
||||
$odd_row = true;
|
||||
?>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
<?php
|
||||
PMA_TableHeader(false, $server_slave_status);
|
||||
}
|
||||
|
||||
$ignored = false;
|
||||
$do = false;
|
||||
|
||||
if ($server_slave_status) {
|
||||
////////////////////////////////////////////////////////////////
|
||||
|
||||
if ((strlen(array_search($truename, $server_slave_Do_Table)) > 0)
|
||||
|| (strlen(array_search($db, $server_slave_Do_DB))>0)
|
||||
|| (count($server_slave_Do_DB)==1 && count($server_slave_Ignore_DB)==1)
|
||||
) {
|
||||
$do = true;
|
||||
}
|
||||
foreach ($server_slave_Wild_Do_Table as $table) {
|
||||
if (($db == PMA_replication_strout($table)) && (ereg("^".substr(PMA_replication_strout($table, true), 0, strlen(PMA_replication_strout($table, true))-1), $truename)))
|
||||
$do = true;
|
||||
}
|
||||
////////////////////////////////////////////////////////////////////
|
||||
if ((strlen(array_search($truename, $server_slave_Ignore_Table))>0) || (strlen(array_search($db, $server_slave_Ignore_DB))>0)) {
|
||||
$ignored = true;
|
||||
}
|
||||
foreach ($server_slave_Wild_Ignore_Table as $table) {
|
||||
if (($db == PMA_replication_strout($table)) && (ereg("^".substr(PMA_replication_strout($table, true), 0, strlen(PMA_replication_strout($table, true))-1), $truename)))
|
||||
$ignored = true;
|
||||
}
|
||||
}/* elseif ($server_master_status) {
|
||||
if ((strlen(array_search($db, $server_master_Do_DB))>0) || count($server_master_Do_DB)==1)
|
||||
$do = true;
|
||||
elseif ((strlen(array_search($db, $server_master_Ignore_DB))>0) || count($server_master_Ignore_DB)==1)
|
||||
$ignored = true;
|
||||
}*/
|
||||
?>
|
||||
<tr class="<?php echo $odd_row ? 'odd' : 'even'; $odd_row = ! $odd_row; ?>">
|
||||
<td align="center">
|
||||
<input type="checkbox" name="selected_tbl[]"
|
||||
value="<?php echo htmlspecialchars($each_table['TABLE_NAME']); ?>"
|
||||
id="checkbox_tbl_<?php echo $i; ?>"<?php echo $checked; ?> /></td>
|
||||
<th><label for="checkbox_tbl_<?php echo $i; ?>"
|
||||
title="<?php echo $alias; ?>" style="<?php echo $ignored ? ' ignored' : ''; ?>"><?php echo $truename; ?></label>
|
||||
<label><?php echo $tracking_icon; ?></label>
|
||||
</th>
|
||||
<?php if ($server_slave_status) { ?><td align="center"><?php echo $ignored ? ' <img class="icon" src="' . $pmaThemeImage . 's_cancel.png" width="16" height="16" alt="NOT REPLICATED" />' : ''. $do ? ' <img class="icon" src="' . $pmaThemeImage . 's_success.png" width="16" height="16" alt="REPLICATED" />' : ''; ?></td><?php } ?>
|
||||
<td align="center"><?php echo $browse_table; ?></td>
|
||||
<td align="center">
|
||||
<a href="tbl_structure.php?<?php echo $tbl_url_query; ?>">
|
||||
<?php echo $titles['Structure']; ?></a></td>
|
||||
<td align="center"><?php echo $search_table; ?></td>
|
||||
<?php if (! $db_is_information_schema) { ?>
|
||||
<td align="center">
|
||||
<a href="tbl_change.php?<?php echo $tbl_url_query; ?>">
|
||||
<?php echo $titles['Insert']; ?></a></td>
|
||||
<td align="center"><?php echo $empty_table; ?></td>
|
||||
<td align="center">
|
||||
<a href="sql.php?<?php echo $tbl_url_query;
|
||||
?>&reload=1&purge=1&sql_query=<?php
|
||||
echo urlencode($drop_query); ?>&zero_rows=<?php
|
||||
echo urlencode($drop_message); ?>"
|
||||
onclick="return confirmLink(this, '<?php echo PMA_jsFormat($drop_query, false); ?>')">
|
||||
<?php echo $titles['Drop']; ?></a></td>
|
||||
<?php } // end if (! $db_is_information_schema)
|
||||
|
||||
// there is a null value in the ENGINE
|
||||
// - when the table needs to be repaired, or
|
||||
// - when it's a view
|
||||
// so ensure that we'll display "in use" below for a table
|
||||
// that needs to be repaired
|
||||
if (isset($each_table['TABLE_ROWS']) && ($each_table['ENGINE'] != null || $table_is_view)) {
|
||||
if ($table_is_view) {
|
||||
if ($each_table['TABLE_ROWS'] >= $GLOBALS['cfg']['MaxExactCountViews']){
|
||||
$row_count_pre = '~';
|
||||
$sum_row_count_pre = '~';
|
||||
$show_superscript = PMA_showHint(PMA_sanitize(sprintf($strViewHasAtLeast, '[a@./Documentation.html#cfg_MaxExactCountViews@_blank]', '[/a]')));
|
||||
}
|
||||
} elseif($each_table['ENGINE'] == 'InnoDB' && (! $each_table['COUNTED'])) {
|
||||
// InnoDB table: we did not get an accurate row count
|
||||
$row_count_pre = '~';
|
||||
$sum_row_count_pre = '~';
|
||||
$show_superscript = '';
|
||||
} else {
|
||||
$row_count_pre = '';
|
||||
$show_superscript = '';
|
||||
}
|
||||
?>
|
||||
<td class="value"><?php echo $row_count_pre . PMA_formatNumber($each_table['TABLE_ROWS'], 0) . $show_superscript; ?></td>
|
||||
<?php if (!($cfg['PropertiesNumColumns'] > 1)) { ?>
|
||||
<td nowrap="nowrap"><?php echo ($table_is_view ? $strView : $each_table['ENGINE']); ?></td>
|
||||
<?php if (isset($collation)) { ?>
|
||||
<td nowrap="nowrap"><?php echo $collation ?></td>
|
||||
<?php } ?>
|
||||
<?php } ?>
|
||||
|
||||
<?php if ($is_show_stats) { ?>
|
||||
<td class="value"><a
|
||||
href="tbl_structure.php?<?php echo $tbl_url_query; ?>#showusage"
|
||||
><?php echo $formatted_size . ' ' . $unit; ?></a></td>
|
||||
<td class="value"><?php echo $overhead; ?></td>
|
||||
<?php } // end if ?>
|
||||
<?php } elseif ($table_is_view) { ?>
|
||||
<td class="value">-</td>
|
||||
<td><?php echo $strView; ?></td>
|
||||
<td>---</td>
|
||||
<?php if ($is_show_stats) { ?>
|
||||
<td class="value">-</td>
|
||||
<td class="value">-</td>
|
||||
<?php } ?>
|
||||
<?php } else { ?>
|
||||
<td colspan="<?php echo ($structure_tbl_col_cnt - ($db_is_information_schema ? 5 : 8)) ?>"
|
||||
align="center">
|
||||
<?php echo $strInUse; ?></td>
|
||||
<?php } // end if (isset($each_table['TABLE_ROWS'])) else ?>
|
||||
</tr>
|
||||
<?php
|
||||
} // end foreach
|
||||
|
||||
// Show Summary
|
||||
if ($is_show_stats) {
|
||||
list($sum_formatted, $unit) = PMA_formatByteDown($sum_size, 3, 1);
|
||||
list($overhead_formatted, $overhead_unit) =
|
||||
PMA_formatByteDown($overhead_size, 3, 1);
|
||||
}
|
||||
?>
|
||||
</tbody>
|
||||
<tbody>
|
||||
<tr><th></th>
|
||||
<th align="center" nowrap="nowrap">
|
||||
<?php
|
||||
// for blobstreaming - if the number of tables is 0, set tableReductionCount to 0
|
||||
// (we don't want negative numbers here) - rajk
|
||||
if ($num_tables == 0)
|
||||
$tableReductionCount = 0;
|
||||
|
||||
echo sprintf($strTables, PMA_formatNumber($num_tables - $tableReductionCount, 0));
|
||||
?>
|
||||
</th>
|
||||
<?php
|
||||
if ($server_slave_status) {
|
||||
echo ' <th>' . $GLOBALS['strReplication'] . '</th>' . "\n";
|
||||
}
|
||||
?>
|
||||
<th colspan="<?php echo ($db_is_information_schema ? 3 : 6) ?>" align="center">
|
||||
<?php echo $strSum; ?></th>
|
||||
<th class="value"><?php echo $sum_row_count_pre . PMA_formatNumber($sum_entries, 0); ?></th>
|
||||
<?php
|
||||
if (!($cfg['PropertiesNumColumns'] > 1)) {
|
||||
$default_engine = PMA_DBI_get_default_engine();
|
||||
echo ' <th align="center">' . "\n"
|
||||
. ' <dfn title="'
|
||||
. sprintf($strDefaultEngine, $default_engine) . '">' .$default_engine . '</dfn></th>' . "\n";
|
||||
// we got a case where $db_collation was empty
|
||||
echo ' <th align="center">' . "\n";
|
||||
if (! empty($db_collation)) {
|
||||
echo ' <dfn title="'
|
||||
. PMA_getCollationDescr($db_collation) . ' (' . $strDefault . ')">' . $db_collation
|
||||
. '</dfn>';
|
||||
}
|
||||
echo '</th>';
|
||||
}
|
||||
|
||||
if ($is_show_stats) {
|
||||
?>
|
||||
<th class="value"><?php echo $sum_formatted . ' ' . $unit; ?></th>
|
||||
<th class="value"><?php echo $overhead_formatted . ' ' . $overhead_unit; ?></th>
|
||||
<?php
|
||||
}
|
||||
?>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
|
||||
<div class="clearfloat">
|
||||
<?php
|
||||
// Check all tables url
|
||||
$checkall_url = 'db_structure.php?' . PMA_generate_common_url($db);
|
||||
?>
|
||||
<img class="selectallarrow" src="<?php echo $pmaThemeImage .'arrow_'.$text_dir.'.png'; ?>"
|
||||
width="38" height="22" alt="<?php echo $strWithChecked; ?>" />
|
||||
<a href="<?php echo $checkall_url; ?>&checkall=1"
|
||||
onclick="if (markAllRows('tablesForm')) return false;">
|
||||
<?php echo $strCheckAll; ?></a>
|
||||
/
|
||||
<a href="<?php echo $checkall_url; ?>"
|
||||
onclick="if (unMarkAllRows('tablesForm')) return false;">
|
||||
<?php echo $strUncheckAll; ?></a>
|
||||
<?php if ($overhead_check != '') { ?>
|
||||
/
|
||||
<a href="#" onclick="unMarkAllRows('tablesForm');
|
||||
<?php echo $overhead_check; ?> return false;">
|
||||
<?php echo $strCheckOverhead; ?></a>
|
||||
<?php } ?>
|
||||
|
||||
<select name="submit_mult" onchange="this.form.submit();" style="margin: 0 3em 0 3em;">
|
||||
<?php
|
||||
echo ' <option value="' . $strWithChecked . '" selected="selected">'
|
||||
. $strWithChecked . '</option>' . "\n";
|
||||
echo ' <option value="' . $strEmpty . '" >'
|
||||
. $strEmpty . '</option>' . "\n";
|
||||
echo ' <option value="' . $strDrop . '" >'
|
||||
. $strDrop . '</option>' . "\n";
|
||||
echo ' <option value="' . $strPrintView . '" >'
|
||||
. $strPrintView . '</option>' . "\n";
|
||||
echo ' <option value="' . $strCheckTable . '" >'
|
||||
. $strCheckTable . '</option>' . "\n";
|
||||
echo ' <option value="' . $strOptimizeTable . '" >'
|
||||
. $strOptimizeTable . '</option>' . "\n";
|
||||
echo ' <option value="' . $strRepairTable . '" >'
|
||||
. $strRepairTable . '</option>' . "\n";
|
||||
echo ' <option value="' . $strAnalyzeTable . '" >'
|
||||
. $strAnalyzeTable . '</option>' . "\n";
|
||||
echo ' <option value="' . $strExport . '" >'
|
||||
. $strExport . '</option>' . "\n";
|
||||
?>
|
||||
</select>
|
||||
<script type="text/javascript">
|
||||
<!--
|
||||
// Fake js to allow the use of the <noscript> tag
|
||||
//-->
|
||||
</script>
|
||||
<noscript>
|
||||
<input type="submit" value="<?php echo $strGo; ?>" />
|
||||
</noscript>
|
||||
<?php echo implode("\n", $hidden_fields) . "\n"; ?>
|
||||
</div>
|
||||
</form>
|
||||
<?php
|
||||
// display again the table list navigator
|
||||
PMA_listNavigator($total_num_tables, $pos, $_url_params, 'db_structure.php', 'frame_content', $GLOBALS['cfg']['MaxTableList']);
|
||||
?>
|
||||
<hr />
|
||||
|
||||
<?php
|
||||
// Routines
|
||||
require './libraries/db_routines.inc.php';
|
||||
|
||||
// Events
|
||||
if (PMA_MYSQL_INT_VERSION > 50100) {
|
||||
require './libraries/db_events.inc.php';
|
||||
}
|
||||
|
||||
/**
|
||||
* Work on the database
|
||||
* redesigned 2004-05-08 by mkkeck
|
||||
*/
|
||||
/* DATABASE WORK */
|
||||
/* Printable view of a table */
|
||||
echo '<p>';
|
||||
echo '<a href="db_printview.php?' . $url_query . '">';
|
||||
if ($cfg['PropertiesIconic']) {
|
||||
echo '<img class="icon" src="' . $pmaThemeImage
|
||||
.'b_print.png" width="16" height="16" alt="" />';
|
||||
}
|
||||
echo $strPrintView . '</a> ';
|
||||
|
||||
echo '<a href="./db_datadict.php?' . $url_query . '">';
|
||||
if ($cfg['PropertiesIconic']) {
|
||||
echo '<img class="icon" src="' . $pmaThemeImage
|
||||
.'b_tblanalyse.png" width="16" height="16" alt="" />';
|
||||
}
|
||||
echo $strDataDict . '</a>';
|
||||
echo '</p>';
|
||||
|
||||
if (empty($db_is_information_schema)) {
|
||||
require './libraries/display_create_table.lib.php';
|
||||
} // end if (Create Table dialog)
|
||||
|
||||
/**
|
||||
* Displays the footer
|
||||
*/
|
||||
require_once './libraries/footer.inc.php';
|
||||
?>
|
||||
206
db_tracking.php
206
db_tracking.php
@@ -1,206 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* @version $Id$
|
||||
* @author Alexander Rutkowski
|
||||
* @package phpMyAdmin
|
||||
*/
|
||||
|
||||
// Run common work
|
||||
require_once './libraries/common.inc.php';
|
||||
require_once './libraries/Table.class.php';
|
||||
|
||||
require './libraries/db_common.inc.php';
|
||||
$url_query .= '&goto=tbl_tracking.php&back=db_tracking.php';
|
||||
|
||||
// Get the database structure
|
||||
$sub_part = '_structure';
|
||||
require './libraries/db_info.inc.php';
|
||||
|
||||
// Get relation settings
|
||||
require_once './libraries/relation.lib.php';
|
||||
|
||||
// Work to do?
|
||||
// (here, do not use $_REQUEST['db] as it can be crafted)
|
||||
if (isset($_REQUEST['delete_tracking']) && isset($_REQUEST['table'])) {
|
||||
PMA_Tracker::deleteTracking($GLOBALS['db'], $_REQUEST['table']);
|
||||
}
|
||||
|
||||
// Get tracked data about the database
|
||||
$data = PMA_Tracker::getTrackedData($_REQUEST['db'], '', '1');
|
||||
|
||||
// No tables present and no log exist
|
||||
if ($num_tables == 0 && count($data['ddlog']) == 0) {
|
||||
echo '<p>' . $strNoTablesFound . '</p>' . "\n";
|
||||
|
||||
if (empty($db_is_information_schema)) {
|
||||
require './libraries/display_create_table.lib.php';
|
||||
}
|
||||
|
||||
// Display the footer
|
||||
require_once './libraries/footer.inc.php';
|
||||
exit;
|
||||
}
|
||||
|
||||
// ---------------------------------------------------------------------------
|
||||
|
||||
/*
|
||||
* Display top menu links
|
||||
*/
|
||||
require_once './libraries/db_links.inc.php';
|
||||
|
||||
// Prepare statement to get HEAD version
|
||||
$all_tables_query = ' SELECT table_name, MAX(version) as version FROM ' .
|
||||
PMA_backquote($GLOBALS['cfg']['Server']['pmadb']) . '.' .
|
||||
PMA_backquote($GLOBALS['cfg']['Server']['tracking']) .
|
||||
' WHERE ' . PMA_backquote('db_name') . ' = \'' . PMA_sqlAddslashes($_REQUEST['db']) . '\' ' .
|
||||
' GROUP BY '. PMA_backquote('table_name') .
|
||||
' ORDER BY '. PMA_backquote('table_name') .' ASC';
|
||||
|
||||
$all_tables_result = PMA_query_as_controluser($all_tables_query);
|
||||
|
||||
// If a HEAD version exists
|
||||
if (PMA_DBI_num_rows($all_tables_result) > 0) {
|
||||
?>
|
||||
<h3><?php echo $strTrackingTrackedTables;?></h3>
|
||||
|
||||
<table id="versions" class="data">
|
||||
<thead>
|
||||
<tr>
|
||||
<th><?php echo $strDatabase;?></th>
|
||||
<th><?php echo $strTable;?></th>
|
||||
<th><?php echo $strTrackingThLastVersion;?></th>
|
||||
<th><?php echo $strTrackingThCreated;?></th>
|
||||
<th><?php echo $strTrackingThUpdated;?></th>
|
||||
<th><?php echo $strStatus;?></th>
|
||||
<th><?php echo $strAction;?></th>
|
||||
<th><?php echo $strShow;?></th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
<?php
|
||||
|
||||
// Print out information about versions
|
||||
|
||||
$drop_image_or_text = '';
|
||||
if (true == $GLOBALS['cfg']['PropertiesIconic']) {
|
||||
$drop_image_or_text .= '<img class="icon" width="16" height="16" src="' . $pmaThemeImage . 'b_drop.png" alt="' . $strDeleteTrackingData . '" title="' . $strDeleteTrackingData . '" />';
|
||||
}
|
||||
if ('both' === $GLOBALS['cfg']['PropertiesIconic'] || false === $GLOBALS['cfg']['PropertiesIconic']) {
|
||||
$drop_image_or_text .= $strDrop;
|
||||
}
|
||||
|
||||
$style = 'odd';
|
||||
while ($one_result = PMA_DBI_fetch_array($all_tables_result)) {
|
||||
list($table_name, $version_number) = $one_result;
|
||||
$table_query = ' SELECT * FROM ' .
|
||||
PMA_backquote($GLOBALS['cfg']['Server']['pmadb']) . '.' .
|
||||
PMA_backquote($GLOBALS['cfg']['Server']['tracking']) .
|
||||
' WHERE `db_name` = \'' . PMA_sqlAddslashes($_REQUEST['db']) . '\' AND `table_name` = \'' . PMA_sqlAddslashes($table_name) . '\' AND `version` = \'' . $version_number . '\'';
|
||||
|
||||
$table_result = PMA_query_as_controluser($table_query);
|
||||
$version_data = PMA_DBI_fetch_array($table_result);
|
||||
|
||||
if ($version_data['tracking_active'] == 1) {
|
||||
$version_status = $strTrackingStatusActive;
|
||||
} else {
|
||||
$version_status = $strTrackingStatusNotActive;
|
||||
}
|
||||
$tmp_link = 'tbl_tracking.php?' . $url_query . '&table=' . htmlspecialchars($version_data['table_name']);
|
||||
$delete_link = 'db_tracking.php?' . $url_query . '&table=' . htmlspecialchars($version_data['table_name']) . '&delete_tracking=true&';
|
||||
?>
|
||||
<tr class="<?php echo $style;?>">
|
||||
<td><?php echo htmlspecialchars($version_data['db_name']);?></td>
|
||||
<td><?php echo htmlspecialchars($version_data['table_name']);?></td>
|
||||
<td><?php echo $version_data['version'];?></td>
|
||||
<td><?php echo $version_data['date_created'];?></td>
|
||||
<td><?php echo $version_data['date_updated'];?></td>
|
||||
<td><?php echo $version_status;?></td>
|
||||
<td><a href="<?php echo $delete_link;?>" onclick="return confirmLink(this, '<?php echo PMA_jsFormat($strDeleteTrackingData, false); ?>')"><?php echo $drop_image_or_text; ?></a></td>
|
||||
<td> <a href="<?php echo $tmp_link; ?>"><?php echo $strTrackingVersions;?></a>
|
||||
| <a href="<?php echo $tmp_link; ?>&report=true&version=<?php echo $version_data['version'];?>"><?php echo $strTrackingReport;?></a>
|
||||
| <a href="<?php echo $tmp_link; ?>&snapshot=true&version=<?php echo $version_data['version'];?>"><?php echo $strTrackingStructureSnapshot;?></a></td>
|
||||
</tr>
|
||||
<?php
|
||||
if ($style == 'even') {
|
||||
$style = 'odd';
|
||||
} else {
|
||||
$style = 'even';
|
||||
}
|
||||
}
|
||||
unset($tmp_link);
|
||||
?>
|
||||
</tbody>
|
||||
</table>
|
||||
<?php
|
||||
}
|
||||
|
||||
// Get list of tables
|
||||
$table_list = PMA_getTableList($GLOBALS['db']);
|
||||
|
||||
// For each table try to get the tracking version
|
||||
foreach ($table_list as $key => $value) {
|
||||
if (PMA_Tracker::getVersion($GLOBALS['db'], $value['Name']) == -1) {
|
||||
$my_tables[] = $value['Name'];
|
||||
}
|
||||
}
|
||||
|
||||
// If untracked tables exist
|
||||
if (isset($my_tables)) {
|
||||
?>
|
||||
<h3><?php echo $strTrackingUntrackedTables;?></h3>
|
||||
|
||||
<table id="noversions" class="data">
|
||||
<thead>
|
||||
<tr>
|
||||
<th width="300"><?php echo $strTable;?></th>
|
||||
<th></th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
<?php
|
||||
// Print out list of untracked tables
|
||||
|
||||
$style = 'odd';
|
||||
|
||||
foreach ($my_tables as $key => $tablename) {
|
||||
if (PMA_Tracker::getVersion($GLOBALS['db'], $tablename) == -1) {
|
||||
$my_link = '<a href="tbl_tracking.php?' . $url_query . '&table=' . htmlspecialchars($tablename) .'">';
|
||||
|
||||
if ($cfg['PropertiesIconic']) {
|
||||
$my_link .= '<img class="icon" src="' . $pmaThemeImage . 'eye.png" width="16" height="16" alt="' . $strTrackingTrackTable . '" /> ';
|
||||
}
|
||||
$my_link .= $strTrackingTrackTable . '</a>';
|
||||
?>
|
||||
<tr class="<?php echo $style;?>">
|
||||
<td><?php echo htmlspecialchars($tablename);?></td>
|
||||
<td><?php echo $my_link;?></td>
|
||||
</tr>
|
||||
<?php
|
||||
if ($style == 'even') {
|
||||
$style = 'odd';
|
||||
} else {
|
||||
$style = 'even';
|
||||
}
|
||||
}
|
||||
}
|
||||
?>
|
||||
</tbody>
|
||||
</table>
|
||||
|
||||
<?php
|
||||
}
|
||||
// If available print out database log
|
||||
if (count($data['ddlog']) > 0) {
|
||||
$log = '';
|
||||
foreach ($data['ddlog'] as $entry) {
|
||||
$log .= '# ' . $entry['date'] . ' ' . $entry['username'] . "\n" . $entry['statement'] . "\n";
|
||||
}
|
||||
PMA_showMessage($strTrackingDatabaseLog, $log);
|
||||
}
|
||||
|
||||
/**
|
||||
* Display the footer
|
||||
*/
|
||||
require_once './libraries/footer.inc.php';
|
||||
?>
|
||||
256
docs.css
256
docs.css
@@ -1,256 +0,0 @@
|
||||
/* $Id$ */
|
||||
/* Stylesheet for phpMyAdmin documentation */
|
||||
/* vim: expandtab ts=4 sw=4 sts=4 tw=78
|
||||
*/
|
||||
|
||||
body {
|
||||
background-color: #ffffff;
|
||||
font-family: sans-serif;
|
||||
color: #000000;
|
||||
margin: 0;
|
||||
padding: 0;
|
||||
background: url('themes/original/img/logo_right.png') no-repeat fixed bottom right;
|
||||
}
|
||||
|
||||
img {
|
||||
border: 0;
|
||||
}
|
||||
|
||||
#header {
|
||||
margin: 0px;
|
||||
padding: 1em 0.5em 0.5em 1em;
|
||||
background: #036;
|
||||
border: 0px;
|
||||
border-bottom: 1px solid black;
|
||||
}
|
||||
|
||||
#header h1 {
|
||||
padding: 0;
|
||||
margin: 0;
|
||||
margin-right: 1em;
|
||||
color: white;
|
||||
}
|
||||
|
||||
#header h1 a {
|
||||
color: #7584b3;
|
||||
}
|
||||
|
||||
#header h1 a .myadmin {
|
||||
color: #ffad17;
|
||||
}
|
||||
|
||||
#body {
|
||||
margin: 2em 1em 1em 1em;
|
||||
padding: 0px;
|
||||
padding-right: 13em;
|
||||
}
|
||||
|
||||
ul#footer {
|
||||
padding: 0;
|
||||
margin: 0;
|
||||
max-width: 100%;
|
||||
}
|
||||
|
||||
#footer li {
|
||||
font-size: smaller;
|
||||
list-style: none;
|
||||
float: left;
|
||||
padding: 1em;
|
||||
color: gray;
|
||||
border: none;
|
||||
}
|
||||
|
||||
#footer li.logo {
|
||||
padding: 0.5em;
|
||||
}
|
||||
|
||||
#footer a {
|
||||
color: #c19e66;
|
||||
}
|
||||
|
||||
abbr, acronym {
|
||||
border-bottom: 1px dotted;
|
||||
}
|
||||
|
||||
abbr, acronym {
|
||||
cursor: help;
|
||||
}
|
||||
|
||||
a {
|
||||
text-decoration: none;
|
||||
color: #c17d11;
|
||||
}
|
||||
|
||||
a:hover {
|
||||
text-decoration: underline;
|
||||
color: #8f5902;
|
||||
}
|
||||
|
||||
sup {
|
||||
font-size: 0.7em;
|
||||
}
|
||||
|
||||
sup:before {
|
||||
content: ' [';
|
||||
}
|
||||
|
||||
sup:after {
|
||||
content: ']';
|
||||
}
|
||||
|
||||
|
||||
ul.header {
|
||||
background: url(themes/original/img/docs_menu_bg.png) transparent fixed;
|
||||
position: fixed;
|
||||
top: 3em;
|
||||
left: auto;
|
||||
width: 8.5em;
|
||||
right: 2em;
|
||||
text-align: center;
|
||||
margin: 1em;
|
||||
padding: 1em;
|
||||
border: 1px solid black;
|
||||
}
|
||||
|
||||
ul.header li {
|
||||
margin: 0;
|
||||
padding: 0;
|
||||
display: block;
|
||||
}
|
||||
|
||||
ul.header a {
|
||||
text-decoration: none;
|
||||
font-size: medium;
|
||||
color: #036;
|
||||
background-color: transparent;
|
||||
font-weight: bolder;
|
||||
display: block;
|
||||
}
|
||||
|
||||
ul.header a:hover {
|
||||
color: #000099;
|
||||
background-color: #99CCFF;
|
||||
}
|
||||
|
||||
h2 {
|
||||
color: #727e0a;
|
||||
max-width: 70em;
|
||||
}
|
||||
|
||||
h3 {
|
||||
color: #727e0a;
|
||||
max-width: 70em;
|
||||
}
|
||||
|
||||
h4, h5 {
|
||||
color: #727e0a;
|
||||
max-width: 70em;
|
||||
}
|
||||
|
||||
h4 a {
|
||||
color: #727e0a;
|
||||
}
|
||||
|
||||
p {
|
||||
max-width: 70em;
|
||||
margin: 1em;
|
||||
}
|
||||
|
||||
table {
|
||||
margin: 1em;
|
||||
border: none;
|
||||
}
|
||||
|
||||
table tr,table td,table th {
|
||||
border: none;
|
||||
}
|
||||
|
||||
table.translators {
|
||||
text-align: center;
|
||||
display: table; margin-left: auto; margin-right: auto;
|
||||
border-collapse: collapse;
|
||||
}
|
||||
|
||||
table.translators th {
|
||||
color: #000000;
|
||||
background-color: #d3dce3;
|
||||
}
|
||||
|
||||
table.translators td, table.translators th {
|
||||
border: 1px solid #000000;
|
||||
padding: 5px;
|
||||
}
|
||||
|
||||
ul, dl, ol {
|
||||
margin: 1em;
|
||||
max-width: 70em;
|
||||
}
|
||||
|
||||
ul ul, ol ul {
|
||||
margin-bottom: 0;
|
||||
}
|
||||
|
||||
li {
|
||||
margin-top: 0.5em;
|
||||
}
|
||||
|
||||
pre {
|
||||
margin: 1em;
|
||||
border: 1px solid silver;
|
||||
color: #000000;
|
||||
background-color: #eeeeee;
|
||||
padding: 0.5em;
|
||||
max-width: 70em;
|
||||
}
|
||||
|
||||
/* no more intend inside li */
|
||||
li pre {
|
||||
margin: 1em 0 1em 0;
|
||||
}
|
||||
|
||||
pre.wrap {
|
||||
white-space: normal;
|
||||
}
|
||||
|
||||
dt {
|
||||
font-weight: bold;
|
||||
margin-left: 2em;
|
||||
}
|
||||
|
||||
dd {
|
||||
margin-left: 4em;
|
||||
margin-bottom: 1em;
|
||||
}
|
||||
|
||||
.configrule {
|
||||
font-family: monospace;
|
||||
}
|
||||
|
||||
dt.configrule {
|
||||
font-weight: bold;
|
||||
}
|
||||
|
||||
.important {
|
||||
color: #bb0000;
|
||||
background-color: #ffeeee;
|
||||
padding: 0 0.5em 0 0.5em;
|
||||
}
|
||||
|
||||
p.important {
|
||||
border: 1px dotted #ff0000;
|
||||
padding: 0.5em;
|
||||
}
|
||||
|
||||
p.footnote {
|
||||
margin: 0 5% 2px 7%;
|
||||
padding-top: 3em;
|
||||
}
|
||||
|
||||
p.footnote:first-line {
|
||||
margin-left: -2%;
|
||||
}
|
||||
|
||||
/* Block to mark separate translation string */
|
||||
div.l10n {
|
||||
display: inline;
|
||||
}
|
||||
@@ -1,357 +0,0 @@
|
||||
<html>
|
||||
|
||||
<head>
|
||||
<meta http-equiv=Content-Type content="text/html; charset=windows-1252">
|
||||
<meta name=Generator content="Microsoft Word 11 (filtered)">
|
||||
<title> <20>Synchronize<7A> feature in </title>
|
||||
<style>
|
||||
<!--
|
||||
/* Font Definitions */
|
||||
@font-face
|
||||
{font-family:Tahoma;
|
||||
panose-1:2 11 6 4 3 5 4 4 2 4;}
|
||||
@font-face
|
||||
{font-family:Cambria;
|
||||
panose-1:2 4 5 3 5 4 6 3 2 4;}
|
||||
@font-face
|
||||
{font-family:Calibri;
|
||||
panose-1:2 15 5 2 2 2 4 3 2 4;}
|
||||
/* Style Definitions */
|
||||
p.MsoNormal, li.MsoNormal, div.MsoNormal
|
||||
{margin-top:0in;
|
||||
margin-right:0in;
|
||||
margin-bottom:10.0pt;
|
||||
margin-left:0in;
|
||||
line-height:115%;
|
||||
font-size:11.0pt;
|
||||
font-family:Calibri;}
|
||||
h1
|
||||
{margin-top:24.0pt;
|
||||
margin-right:0in;
|
||||
margin-bottom:0in;
|
||||
margin-left:0in;
|
||||
margin-bottom:.0001pt;
|
||||
line-height:115%;
|
||||
page-break-after:avoid;
|
||||
font-size:14.0pt;
|
||||
font-family:Cambria;
|
||||
color:#365F91;}
|
||||
h2
|
||||
{margin-top:10.0pt;
|
||||
margin-right:0in;
|
||||
margin-bottom:0in;
|
||||
margin-left:0in;
|
||||
margin-bottom:.0001pt;
|
||||
line-height:115%;
|
||||
page-break-after:avoid;
|
||||
font-size:13.0pt;
|
||||
font-family:Cambria;
|
||||
color:#4F81BD;}
|
||||
h3
|
||||
{margin-right:0in;
|
||||
margin-left:0in;
|
||||
font-size:13.5pt;
|
||||
font-family:"Times New Roman";}
|
||||
strong
|
||||
{font-family:"Times New Roman";}
|
||||
p.MsoAcetate, li.MsoAcetate, div.MsoAcetate
|
||||
{margin:0in;
|
||||
margin-bottom:.0001pt;
|
||||
font-size:8.0pt;
|
||||
font-family:Tahoma;}
|
||||
span.Heading3Char
|
||||
{font-family:"Times New Roman";
|
||||
font-weight:bold;}
|
||||
span.BalloonTextChar
|
||||
{font-family:Tahoma;}
|
||||
span.Heading1Char
|
||||
{font-family:Cambria;
|
||||
color:#365F91;
|
||||
font-weight:bold;}
|
||||
p.NoSpacing, li.NoSpacing, div.NoSpacing
|
||||
{margin:0in;
|
||||
margin-bottom:.0001pt;
|
||||
font-size:11.0pt;
|
||||
font-family:Calibri;}
|
||||
span.IntenseEmphasis
|
||||
{font-family:"Times New Roman";
|
||||
color:#4F81BD;
|
||||
font-weight:bold;
|
||||
font-style:italic;}
|
||||
span.Heading2Char
|
||||
{font-family:Cambria;
|
||||
color:#4F81BD;
|
||||
font-weight:bold;}
|
||||
@page Section1
|
||||
{size:8.5in 11.0in;
|
||||
margin:1.0in 1.0in 1.0in 1.0in;}
|
||||
div.Section1
|
||||
{page:Section1;}
|
||||
-->
|
||||
</style>
|
||||
|
||||
</head>
|
||||
|
||||
<body lang=EN-US>
|
||||
|
||||
<div class=Section1>
|
||||
|
||||
<p class=MsoNormal><b><span style='font-size:13.0pt;line-height:115%;
|
||||
font-family:Cambria;color:#4F81BD'><img width=22 height=21 id="Picture 45"
|
||||
src="Synchronization_User%20Manual_files/image001.jpg"
|
||||
alt="C:\xampp\htdocs\Branch\zahra\themes\original\img\s_sync.png"></span></b><span
|
||||
class=Heading2Char><span style='font-size:13.0pt;line-height:115%'><EFBFBD><EFBFBD>Synchronize<EFBFBD></span></span>
|
||||
feature in <img width=134 height=23 id="Picture 44"
|
||||
src="Synchronization_User%20Manual_files/image002.gif"
|
||||
alt="C:\xampp\htdocs\Branch\zahra\themes\original\img\logo_left.png"></p>
|
||||
|
||||
This feature is helpful for developers who need to replicate their databases<65> structure as well as data.
|
||||
Moreover, this feature not only helps replication but also facilitates the user to keep his/her database in sync with another database. Other than the full database, certain tables of the databases can also be synchronized.
|
||||
|
||||
<h3><span class=IntenseEmphasis><span style='font-size:12.0pt;font-weight:normal;
|
||||
font-style:normal'><strong>How to Synchronize:</strong></span></span></h3>
|
||||
The synchronize tab is visible upfront in the right pane, the last link on the top of the home page.
|
||||
|
||||
<p class=MsoNormal><img width=682 height=421 id="Picture 1"
|
||||
src="Synchronization_User%20Manual_files/image003.gif"></p>
|
||||
|
||||
<p class=MsoNormal>Press on the Synchronize tab and a form will be displayed.</p>
|
||||
|
||||
<p class=MsoNormal><img width=666 height=398 id="Picture 46"
|
||||
src="Synchronization_User%20Manual_files/image004.jpg"></p>
|
||||
<p class=MsoNormal><EFBFBD><span
|
||||
class=Heading2Char><span style='font-size:13.0pt;line-height:115%'>Db Authentication Form?</span></span></p>
|
||||
<p class=MsoNormal> You need to fill in the host name of the server, the
|
||||
username and password of an user account already there in MySQL. Port is by default populated with 3306 (MySQL default port). Then the name of the
|
||||
database should be mentioned at the end.All the information other than the port needs to be filled explicitly for the source as well as target servers.</p>
|
||||
|
||||
<p class=MsoNormal>A filled form is displayed underneath:</p>
|
||||
|
||||
<p class=MsoNormal><img width=653 height=394 id="Picture 7"
|
||||
src="Synchronization_User%20Manual_files/image005.jpg"><span
|
||||
class=Heading2Char><span style='font-size:13.0pt;line-height:115%'><EFBFBD></span></span></p>
|
||||
<p class=MsoNormal><span
|
||||
class=Heading2Char><span style='font-size:13.0pt;line-height:115%'>Invalid entries
|
||||
during DB Authentication:</span></span></p>
|
||||
<p class=MsoNormal>The user will not be allowed to by pass this page if any of
|
||||
the values like Host name, Username and Database name remain unfilled and the
|
||||
user presses <20>Go<47> button. An alert<72> would occur as follows, not allowing the user to
|
||||
move to the next page. On the other hand, the password field can remain empty.
|
||||
</p>
|
||||
|
||||
<p class=MsoNormal><img width=640 height=384 id="Picture 10"
|
||||
src="Synchronization_User%20Manual_files/image006.jpg"></p>
|
||||
|
||||
<p class=MsoNormal>If any wrong information is provided by the user like wrong
|
||||
password, username or hostname then the connection is not established with the
|
||||
corresponding database and an error message is seen as follows.</p>
|
||||
|
||||
<p class=MsoNormal><img width=653 height=394 id="Picture 13"
|
||||
src="Synchronization_User%20Manual_files/image007.jpg"></p>
|
||||
|
||||
<p class=MsoNormal>If the user enters a database name that does not exist, then
|
||||
even an error message occurs as follows and the user needs to re-enter all the
|
||||
information.</p>
|
||||
|
||||
<p class=MsoNormal><img width=653 height=391 id="Picture 16"
|
||||
src="Synchronization_User%20Manual_files/image008.jpg"></p>
|
||||
|
||||
<p class=MsoNormal></p>
|
||||
|
||||
<h2>After passing DB Authentication:</h2>
|
||||
|
||||
<p class=MsoNormal>After successfully by passing authentication phase, the source and
|
||||
target database table names will be displayed. It will be a tabular
|
||||
representation like this.</p>
|
||||
|
||||
<p class=MsoNormal><img width=614 height=368 id="Picture 19"
|
||||
src="Synchronization_User%20Manual_files/image009.jpg"></p>
|
||||
|
||||
<h2>Left Column:<3A>Source Database<73></h2>
|
||||
|
||||
<p class=MsoNormal>On the left, are listed the source database table names.<2E>
|
||||
Some of the names have a <20>+<2B> plus sign preceding them. This shows that these
|
||||
tables are only present in source database and they need to be added to the
|
||||
target database in order to synchronize the target database.While those table name that are not preceded by a <20>+<2B> sign
|
||||
are also present in target database.</p>
|
||||
|
||||
<h2><EFBFBD>Middle Column:<3A>Difference<63></h2>
|
||||
The column in the middle shows the difference between the source and target corresponding tables.The difference is depicted by the red and green buttons.
|
||||
|
||||
<p class=MsoNormal><img width=35 height=35 id="Picture 26"
|
||||
src="Synchronization_User%20Manual_files/image010.gif"
|
||||
alt="C:\xampp\htdocs\Branch\zahra\themes\original\img\new_struct.jpg">The
|
||||
presence of this button against any source table name shows that there is a
|
||||
structure difference between the corresponding source and the target tables. If
|
||||
at the same time, the source table name is preceded by a <20>+<2B>plus, then the
|
||||
presence of this button shows that the table needs to be created in target
|
||||
database.<2E> </p>
|
||||
|
||||
<p class=MsoNormal><img width=35 height=35 id="Picture 24"
|
||||
src="Synchronization_User%20Manual_files/image011.jpg"
|
||||
alt="C:\xampp\htdocs\Branch\zahra\themes\original\img\new_data.jpg"><EFBFBD>The
|
||||
presence of this button against any source table name shows that there is a
|
||||
data difference between the corresponding source and target table. If at the
|
||||
same time, the source table name is preceded by a <20>+<2B>plus, then the presence of
|
||||
this button shows that the table needs to be created and populated in target
|
||||
database.<2E> </p>
|
||||
|
||||
<p class=MsoNormal> </p>
|
||||
|
||||
<p class=MsoNormal><img width=33 height=31 id="Picture 27"
|
||||
src="Synchronization_User%20Manual_files/image012.jpg"
|
||||
alt="C:\xampp\htdocs\Branch\zahra\themes\original\img\new_struct_selected.jpg"><EFBFBD>After
|
||||
clicking the red button with S printed on, it turns to grey showing that the structure difference
|
||||
of that particular table has been selected by the user.</p>
|
||||
|
||||
<p class=MsoNormal><img width=33 height=31 id="Picture 25"
|
||||
src="Synchronization_User%20Manual_files/image013.jpg"
|
||||
alt="C:\xampp\htdocs\Branch\zahra\themes\original\img\new_data_selected.jpg"><EFBFBD>After
|
||||
clicking the red button with a D printed on, it turns to grey showing that the data difference of
|
||||
that particular table has been selected by the user.</p>
|
||||
|
||||
<h2>Right Column: <20>Target Database<73></h2>
|
||||
|
||||
<p class=MsoNormal>On the right, are listed the target database table names.
|
||||
There are few table names that have <20>(not present)<29> appended after their names.
|
||||
This means that these tables are to be created in target database in order to
|
||||
synchronize target database with source database. Some tables<65> names have a <20>-<2D>
|
||||
minus sign preceding them. This shows that these tables are only present in
|
||||
target database and they will remain unchanged in the target database. </p>
|
||||
|
||||
<p class=MsoNormal>While those table names that are not preceded by any sign,
|
||||
or do not have <20>(not present)<29> appended after them are already synchronized.</p>
|
||||
|
||||
<p class=MsoNormal><img width=678 height=408 id="Picture 28"
|
||||
src="Synchronization_User%20Manual_files/image014.jpg"></p>
|
||||
|
||||
<h2>Detailed Difference Table:</h2>
|
||||
|
||||
<p class=MsoNormal><EFBFBD>The above view shows that for those tables whose structure
|
||||
or data differences have been selected (depicted by grey buttons <img width=18
|
||||
height=17 src="Synchronization_User%20Manual_files/image015.jpg"
|
||||
alt="C:\xampp\htdocs\Branch\zahra\themes\original\img\new_struct_selected.jpg"><EFBFBD>or
|
||||
<img width=17 height=16 src="Synchronization_User%20Manual_files/image016.jpg"
|
||||
alt="C:\xampp\htdocs\Branch\zahra\themes\original\img\new_data_selected.jpg">),<2C>
|
||||
there exists a description in the second table underneath the table showing
|
||||
source and target database table names.<2E> The description becomes visible only
|
||||
when a red or green button against any table is pressed.</p>
|
||||
|
||||
<h2>Table:</h2>
|
||||
|
||||
<p class=MsoNormal>Displays the <b>Table Name</b> column only to show the name
|
||||
of the table.</p>
|
||||
|
||||
<h2>Structure Difference:</h2>
|
||||
|
||||
<p class=MsoNormal><EFBFBD>It elaborates the difference in structure like</p>
|
||||
|
||||
<p class=MsoNormal><b>Create Table: </b>When the table needs to be created in
|
||||
the target database, then only a <img width=16 height=16 id="Picture 31"
|
||||
src="Synchronization_User%20Manual_files/image017.gif"
|
||||
alt="C:\xampp\htdocs\Branch\zahra\themes\original\img\s_success.png"><EFBFBD>tick is
|
||||
seen in the create table column of the description table.<2E> </p>
|
||||
|
||||
<p class=MsoNormal><b>Add Column(s):</b><EFBFBD> Shows the number of columns to be
|
||||
added.</p>
|
||||
|
||||
<p class=MsoNormal><b>Remove Column(s):</b> Shows the number of columns to be
|
||||
removed.</p>
|
||||
|
||||
<p class=MsoNormal><b>Alter Column(s):<3A> </b>Shows the number of columns to be
|
||||
altered.</p>
|
||||
|
||||
<p class=MsoNormal><b>Apply Index(s): </b><EFBFBD>Shows the number of indexes to be
|
||||
applied.</p>
|
||||
|
||||
<p class=MsoNormal><b>Remove Index(s):</b><EFBFBD> Shows the number of indexes to be
|
||||
removed.</p>
|
||||
|
||||
<h2>Data Difference:</h2>
|
||||
|
||||
<p class=MsoNormal>It elaborates the difference in data like </p>
|
||||
|
||||
<p class=MsoNormal><b>Update Row(s):</b> Shows the number of rows to be
|
||||
updated.</p>
|
||||
|
||||
<p class=MsoNormal><b>Insert Row(s): </b>Shows the number of rows to be
|
||||
inserted. </p>
|
||||
|
||||
<p class=MsoNormal>When the selected buttons (depicted by grey buttons <img
|
||||
width=18 height=17 src="Synchronization_User%20Manual_files/image015.jpg"
|
||||
alt="C:\xampp\htdocs\Branch\zahra\themes\original\img\new_struct_selected.jpg"><EFBFBD>or<img
|
||||
width=17 height=16 src="Synchronization_User%20Manual_files/image016.jpg"
|
||||
alt="C:\xampp\htdocs\Branch\zahra\themes\original\img\new_data_selected.jpg">)
|
||||
are pressed again, the buttons become deselected (depicted by colored buttons <img
|
||||
width=23 height=23 src="Synchronization_User%20Manual_files/image019.jpg"
|
||||
alt="C:\xampp\htdocs\Branch\zahra\themes\original\img\new_struct.jpg"><EFBFBD>or<img
|
||||
width=23 height=23 src="Synchronization_User%20Manual_files/image020.jpg"
|
||||
alt="C:\xampp\htdocs\Branch\zahra\themes\original\img\new_data.jpg">) and the
|
||||
description from the second table regarding those table has been removed.</p>
|
||||
|
||||
<h2><span style='font-weight:normal'><img width=666 height=416 id="Picture 41"
|
||||
src="Synchronization_User%20Manual_files/image021.jpg"></span></h2>
|
||||
|
||||
<h2>Check Box in Footer:</h2>
|
||||
|
||||
<p class=MsoNormal>A checkbox is also visible in the above view. It has a <20><b>Would
|
||||
you like to delete all the previous rows from the target tables?</b><EFBFBD></p>
|
||||
|
||||
<p class=MsoNormal>By checking this check box, the user assures the deletion of
|
||||
any previous rows residing in the target tables that are to be synchronized.
|
||||
This means that before any value gets inserted or updated in the target tables,
|
||||
any previously residing rows will be deleted.</p>
|
||||
|
||||
<h2>Apply Selected Changes Button in Footer: </h2>
|
||||
|
||||
<p class=MsoNormal>The <20>Apply Selected Changes<65> button, as it is clear from the
|
||||
name, applies only selected tables<65> changes i.e. it allows user to synchronize
|
||||
selective tables between the source and the target databases.</p>
|
||||
|
||||
<p class=MsoNormal>After pressing <20>Apply Selected Changes<65> button, the view
|
||||
becomes<EFBFBD> </p>
|
||||
|
||||
<p class=MsoNormal><img width=666 height=401 id="Picture 35"
|
||||
src="Synchronization_User%20Manual_files/image022.jpg"></p>
|
||||
|
||||
<p class=MsoNormal>The <20>course<73> table in the above view, now only shows data
|
||||
difference depicted by<img width=23 height=23
|
||||
src="Synchronization_User%20Manual_files/image020.jpg"
|
||||
alt="C:\xampp\htdocs\Branch\zahra\themes\original\img\new_data.jpg">. This
|
||||
shows that the previously selected structure difference in that table has been
|
||||
applied in target database table <20>course<73> because we pressed the <20>Apply
|
||||
Selected Changes<65> button after selection. </p>
|
||||
|
||||
<p class=MsoNormal><EFBFBD>Apply Selected Changes<65> button allows the user to synchronize
|
||||
tables<EFBFBD> data and structure according to his/her requirement or desire.</p>
|
||||
|
||||
<p class=MsoNormal>Whenever <20>Apply Selected Changes<65> button is pressed and the
|
||||
page is reloaded, the checkbox becomes unchecked. This means that the user gets
|
||||
a choice to delete the previous rows of a certain set of tables and not from
|
||||
all the tables. </p>
|
||||
|
||||
<h2>Synchronize databases button in Footer:</h2>
|
||||
|
||||
<p class=MsoNormal><EFBFBD>Synchronize databases<65> button in the footer completely
|
||||
synchronizes the target database with the source database irrespective of which
|
||||
tables are selected for which type of synchronization.</p>
|
||||
|
||||
<p class=MsoNormal><EFBFBD><EFBFBD>Synchronize databases<65> button if pressed after <20>Apply
|
||||
Selected Changes<65> button has been pressed once or twice or several times, will
|
||||
apply all the remaining changes that have not been selected earlier.</p>
|
||||
|
||||
<p class=MsoNormal>The view after <20>Synchronize databases<65> button has been
|
||||
pressed look like this:</p>
|
||||
|
||||
<p class=MsoNormal><img width=666 height=399 id="Picture 49"
|
||||
src="Synchronization_User%20Manual_files/image023.jpg"></p>
|
||||
|
||||
<p class=MsoNormal>The lower half of the page displays the list of queries that
|
||||
have been executed in order to synchronize the databases while the upper half
|
||||
displays the source and target database table names.</p>
|
||||
|
||||
</div>
|
||||
|
||||
</body>
|
||||
|
||||
</html>
|
||||
Binary file not shown.
|
Before Width: | Height: | Size: 863 B |
Binary file not shown.
|
Before Width: | Height: | Size: 1.8 KiB |
Binary file not shown.
|
Before Width: | Height: | Size: 47 KiB |
Binary file not shown.
|
Before Width: | Height: | Size: 31 KiB |
Binary file not shown.
|
Before Width: | Height: | Size: 33 KiB |
Binary file not shown.
|
Before Width: | Height: | Size: 29 KiB |
Binary file not shown.
|
Before Width: | Height: | Size: 33 KiB |
Binary file not shown.
|
Before Width: | Height: | Size: 33 KiB |
Binary file not shown.
|
Before Width: | Height: | Size: 36 KiB |
Binary file not shown.
|
Before Width: | Height: | Size: 1.2 KiB |
Binary file not shown.
|
Before Width: | Height: | Size: 1.9 KiB |
Binary file not shown.
|
Before Width: | Height: | Size: 1.4 KiB |
Binary file not shown.
|
Before Width: | Height: | Size: 1.4 KiB |
Binary file not shown.
|
Before Width: | Height: | Size: 45 KiB |
Binary file not shown.
|
Before Width: | Height: | Size: 780 B |
Binary file not shown.
|
Before Width: | Height: | Size: 738 B |
Binary file not shown.
|
Before Width: | Height: | Size: 550 B |
Binary file not shown.
|
Before Width: | Height: | Size: 42 KiB |
Binary file not shown.
|
Before Width: | Height: | Size: 916 B |
Binary file not shown.
|
Before Width: | Height: | Size: 888 B |
Binary file not shown.
|
Before Width: | Height: | Size: 50 KiB |
Binary file not shown.
|
Before Width: | Height: | Size: 46 KiB |
Binary file not shown.
|
Before Width: | Height: | Size: 43 KiB |
86
error.php
86
error.php
@@ -1,86 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* phpMyAdmin fatal error display page
|
||||
*
|
||||
* @version $Id$
|
||||
* @package phpMyAdmin
|
||||
*/
|
||||
|
||||
/**
|
||||
* Input sanitizing.
|
||||
*/
|
||||
require_once './libraries/sanitizing.lib.php';
|
||||
|
||||
/* Get variables */
|
||||
if (! empty($_REQUEST['lang']) && is_string($_REQUEST['lang'])) {
|
||||
$lang = htmlspecialchars($_REQUEST['lang']);
|
||||
} else {
|
||||
$lang = 'en';
|
||||
}
|
||||
|
||||
if (! empty($_REQUEST['dir']) && is_string($_REQUEST['dir'])) {
|
||||
$dir = htmlspecialchars($_REQUEST['dir']);
|
||||
} else {
|
||||
$dir = 'ltr';
|
||||
}
|
||||
|
||||
if (! empty($_REQUEST['type']) && is_string($_REQUEST['type'])) {
|
||||
$type = htmlspecialchars($_REQUEST['type']);
|
||||
} else {
|
||||
$type = 'error';
|
||||
}
|
||||
|
||||
// force utf-8 to avoid XSS with crafted URL and utf-7 in charset parameter
|
||||
$charset = 'utf-8';
|
||||
|
||||
header('Content-Type: text/html; charset=' . $charset);
|
||||
?>
|
||||
<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
|
||||
<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="<?php echo $lang; ?>" dir="<?php echo $dir; ?>">
|
||||
<head>
|
||||
<link rel="icon" href="./favicon.ico" type="image/x-icon" />
|
||||
<link rel="shortcut icon" href="./favicon.ico" type="image/x-icon" />
|
||||
<title>phpMyAdmin</title>
|
||||
<meta http-equiv="Content-Type" content="text/html; charset=<?php echo $charset; ?>" />
|
||||
<style type="text/css">
|
||||
<!--
|
||||
html {
|
||||
padding: 0;
|
||||
margin: 0;
|
||||
}
|
||||
body {
|
||||
font-family: sans-serif;
|
||||
font-size: small;
|
||||
color: #000000;
|
||||
background-color: #F5F5F5;
|
||||
margin: 1em;
|
||||
}
|
||||
h1 {
|
||||
margin: 0;
|
||||
padding: 0.3em;
|
||||
font-size: 1.4em;
|
||||
font-weight: bold;
|
||||
color: #ffffff;
|
||||
background-color: #ff0000;
|
||||
}
|
||||
p {
|
||||
margin: 0;
|
||||
padding: 0.5em;
|
||||
border: 0.1em solid red;
|
||||
background-color: #ffeeee;
|
||||
}
|
||||
//-->
|
||||
</style>
|
||||
</head>
|
||||
<body>
|
||||
<h1>phpMyAdmin - <?php echo $type; ?></h1>
|
||||
<p><?php
|
||||
if (function_exists('get_magic_quotes_gpc') && get_magic_quotes_gpc()) {
|
||||
echo PMA_sanitize(stripslashes($_REQUEST['error']));
|
||||
} else {
|
||||
echo PMA_sanitize($_REQUEST['error']);
|
||||
}
|
||||
?></p>
|
||||
</body>
|
||||
</html>
|
||||
682
export.php
682
export.php
@@ -1,682 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* @todo too much die here, or?
|
||||
* @version $Id$
|
||||
* @package phpMyAdmin
|
||||
*/
|
||||
|
||||
/**
|
||||
* Get the variables sent or posted to this script and a core script
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
require_once './libraries/zip.lib.php';
|
||||
require_once './libraries/plugin_interface.lib.php';
|
||||
|
||||
PMA_checkParameters(array('what', 'export_type'));
|
||||
|
||||
// Scan plugins
|
||||
$export_list = PMA_getPlugins('./libraries/export/', array('export_type' => $export_type, 'single_table' => isset($single_table)));
|
||||
|
||||
// Backward compatbility
|
||||
$type = $what;
|
||||
|
||||
// Check export type
|
||||
if (!isset($export_list[$type])) {
|
||||
die('Bad type!');
|
||||
}
|
||||
|
||||
/**
|
||||
* valid compression methods
|
||||
*/
|
||||
$compression_methods = array(
|
||||
'zip',
|
||||
'gzip',
|
||||
'bzip',
|
||||
);
|
||||
|
||||
/**
|
||||
* init and variable checking
|
||||
*/
|
||||
$compression = false;
|
||||
$onserver = false;
|
||||
$save_on_server = false;
|
||||
$buffer_needed = false;
|
||||
if (empty($_REQUEST['asfile'])) {
|
||||
$asfile = false;
|
||||
} else {
|
||||
$asfile = true;
|
||||
if (in_array($_REQUEST['compression'], $compression_methods)) {
|
||||
$compression = $_REQUEST['compression'];
|
||||
$buffer_needed = true;
|
||||
}
|
||||
if (!empty($_REQUEST['onserver'])) {
|
||||
$onserver = $_REQUEST['onserver'];
|
||||
// Will we save dump on server?
|
||||
$save_on_server = ! empty($cfg['SaveDir']) && $onserver;
|
||||
}
|
||||
}
|
||||
|
||||
// Does export require to be into file?
|
||||
if (isset($export_list[$type]['force_file']) && ! $asfile) {
|
||||
$message = PMA_Message::error('strExportMustBeFile');
|
||||
$GLOBALS['js_include'][] = 'functions.js';
|
||||
require_once './libraries/header.inc.php';
|
||||
if ($export_type == 'server') {
|
||||
$active_page = 'server_export.php';
|
||||
require './server_export.php';
|
||||
} elseif ($export_type == 'database') {
|
||||
$active_page = 'db_export.php';
|
||||
require './db_export.php';
|
||||
} else {
|
||||
$active_page = 'tbl_export.php';
|
||||
require './tbl_export.php';
|
||||
}
|
||||
exit();
|
||||
}
|
||||
|
||||
// Generate error url and check for needed variables
|
||||
if ($export_type == 'server') {
|
||||
$err_url = 'server_export.php?' . PMA_generate_common_url();
|
||||
} elseif ($export_type == 'database' && strlen($db)) {
|
||||
$err_url = 'db_export.php?' . PMA_generate_common_url($db);
|
||||
// Check if we have something to export
|
||||
if (isset($table_select)) {
|
||||
$tables = $table_select;
|
||||
} else {
|
||||
$tables = array();
|
||||
}
|
||||
} elseif ($export_type == 'table' && strlen($db) && strlen($table)) {
|
||||
$err_url = 'tbl_export.php?' . PMA_generate_common_url($db, $table);
|
||||
} else {
|
||||
die('Bad parameters!');
|
||||
}
|
||||
|
||||
// Get the functions specific to the export type
|
||||
require './libraries/export/' . PMA_securePath($type) . '.php';
|
||||
|
||||
/**
|
||||
* Increase time limit for script execution and initializes some variables
|
||||
*/
|
||||
@set_time_limit($cfg['ExecTimeLimit']);
|
||||
if (!empty($cfg['MemoryLimit'])) {
|
||||
@ini_set('memory_limit', $cfg['MemoryLimit']);
|
||||
}
|
||||
|
||||
// Start with empty buffer
|
||||
$dump_buffer = '';
|
||||
$dump_buffer_len = 0;
|
||||
|
||||
// We send fake headers to avoid browser timeout when buffering
|
||||
$time_start = time();
|
||||
|
||||
|
||||
/**
|
||||
* Output handler for all exports, if needed buffering, it stores data into
|
||||
* $dump_buffer, otherwise it prints thems out.
|
||||
*
|
||||
* @param string the insert statement
|
||||
*
|
||||
* @return bool Whether output suceeded
|
||||
*/
|
||||
function PMA_exportOutputHandler($line)
|
||||
{
|
||||
global $time_start, $dump_buffer, $dump_buffer_len, $save_filename;
|
||||
|
||||
// Kanji encoding convert feature
|
||||
if ($GLOBALS['output_kanji_conversion']) {
|
||||
$line = PMA_kanji_str_conv($line, $GLOBALS['knjenc'], isset($GLOBALS['xkana']) ? $GLOBALS['xkana'] : '');
|
||||
}
|
||||
// If we have to buffer data, we will perform everything at once at the end
|
||||
if ($GLOBALS['buffer_needed']) {
|
||||
|
||||
$dump_buffer .= $line;
|
||||
if ($GLOBALS['onfly_compression']) {
|
||||
|
||||
$dump_buffer_len += strlen($line);
|
||||
|
||||
if ($dump_buffer_len > $GLOBALS['memory_limit']) {
|
||||
if ($GLOBALS['output_charset_conversion']) {
|
||||
$dump_buffer = PMA_convert_string($GLOBALS['charset'], $GLOBALS['charset_of_file'], $dump_buffer);
|
||||
}
|
||||
// as bzipped
|
||||
if ($GLOBALS['compression'] == 'bzip' && @function_exists('bzcompress')) {
|
||||
$dump_buffer = bzcompress($dump_buffer);
|
||||
}
|
||||
// as a gzipped file
|
||||
elseif ($GLOBALS['compression'] == 'gzip' && @function_exists('gzencode')) {
|
||||
// without the optional parameter level because it bug
|
||||
$dump_buffer = gzencode($dump_buffer);
|
||||
}
|
||||
if ($GLOBALS['save_on_server']) {
|
||||
$write_result = @fwrite($GLOBALS['file_handle'], $dump_buffer);
|
||||
if (!$write_result || ($write_result != strlen($dump_buffer))) {
|
||||
$GLOBALS['message'] = PMA_Message::error('strNoSpace');
|
||||
$GLOBALS['message']->addParam($save_filename);
|
||||
return false;
|
||||
}
|
||||
} else {
|
||||
echo $dump_buffer;
|
||||
}
|
||||
$dump_buffer = '';
|
||||
$dump_buffer_len = 0;
|
||||
}
|
||||
} else {
|
||||
$time_now = time();
|
||||
if ($time_start >= $time_now + 30) {
|
||||
$time_start = $time_now;
|
||||
header('X-pmaPing: Pong');
|
||||
} // end if
|
||||
}
|
||||
} else {
|
||||
if ($GLOBALS['asfile']) {
|
||||
if ($GLOBALS['output_charset_conversion']) {
|
||||
$line = PMA_convert_string($GLOBALS['charset'], $GLOBALS['charset_of_file'], $line);
|
||||
}
|
||||
if ($GLOBALS['save_on_server'] && strlen($line) > 0) {
|
||||
$write_result = @fwrite($GLOBALS['file_handle'], $line);
|
||||
if (!$write_result || ($write_result != strlen($line))) {
|
||||
$GLOBALS['message'] = PMA_Message::error('strNoSpace');
|
||||
$GLOBALS['message']->addParam($save_filename);
|
||||
return false;
|
||||
}
|
||||
$time_now = time();
|
||||
if ($time_start >= $time_now + 30) {
|
||||
$time_start = $time_now;
|
||||
header('X-pmaPing: Pong');
|
||||
} // end if
|
||||
} else {
|
||||
// We export as file - output normally
|
||||
echo $line;
|
||||
}
|
||||
} else {
|
||||
// We export as html - replace special chars
|
||||
echo htmlspecialchars($line);
|
||||
}
|
||||
}
|
||||
return true;
|
||||
} // end of the 'PMA_exportOutputHandler()' function
|
||||
|
||||
// Defines the default <CR><LF> format. For SQL always use \n as MySQL wants this on all platforms.
|
||||
if ($what == 'sql') {
|
||||
$crlf = "\n";
|
||||
} else {
|
||||
$crlf = PMA_whichCrlf();
|
||||
}
|
||||
|
||||
$output_kanji_conversion = function_exists('PMA_kanji_str_conv') && $type != 'xls';
|
||||
|
||||
// Do we need to convert charset?
|
||||
$output_charset_conversion = $asfile && $cfg['AllowAnywhereRecoding']
|
||||
&& isset($charset_of_file) && $charset_of_file != $charset
|
||||
&& $type != 'xls';
|
||||
|
||||
// Use on the fly compression?
|
||||
$onfly_compression = $GLOBALS['cfg']['CompressOnFly'] && ($compression == 'gzip' || $compression == 'bzip');
|
||||
if ($onfly_compression) {
|
||||
$memory_limit = trim(@ini_get('memory_limit'));
|
||||
// 2 MB as default
|
||||
if (empty($memory_limit)) {
|
||||
$memory_limit = 2 * 1024 * 1024;
|
||||
}
|
||||
|
||||
if (strtolower(substr($memory_limit, -1)) == 'm') {
|
||||
$memory_limit = (int)substr($memory_limit, 0, -1) * 1024 * 1024;
|
||||
} elseif (strtolower(substr($memory_limit, -1)) == 'k') {
|
||||
$memory_limit = (int)substr($memory_limit, 0, -1) * 1024;
|
||||
} elseif (strtolower(substr($memory_limit, -1)) == 'g') {
|
||||
$memory_limit = (int)substr($memory_limit, 0, -1) * 1024 * 1024 * 1024;
|
||||
} else {
|
||||
$memory_limit = (int)$memory_limit;
|
||||
}
|
||||
|
||||
// Some of memory is needed for other thins and as treshold.
|
||||
// Nijel: During export I had allocated (see memory_get_usage function)
|
||||
// approx 1.2MB so this comes from that.
|
||||
if ($memory_limit > 1500000) {
|
||||
$memory_limit -= 1500000;
|
||||
}
|
||||
|
||||
// Some memory is needed for compression, assume 1/3
|
||||
$memory_limit /= 8;
|
||||
}
|
||||
|
||||
// Generate filename and mime type if needed
|
||||
if ($asfile) {
|
||||
$pma_uri_parts = parse_url($cfg['PmaAbsoluteUri']);
|
||||
if ($export_type == 'server') {
|
||||
if (isset($remember_template)) {
|
||||
PMA_setCookie('pma_server_filename_template', $filename_template);
|
||||
}
|
||||
$filename = str_replace('__SERVER__', $GLOBALS['cfg']['Server']['host'], strftime($filename_template));
|
||||
} elseif ($export_type == 'database') {
|
||||
if (isset($remember_template)) {
|
||||
PMA_setCookie('pma_db_filename_template', $filename_template);
|
||||
}
|
||||
$filename = str_replace('__DB__', $db, str_replace('__SERVER__', $GLOBALS['cfg']['Server']['host'], strftime($filename_template)));
|
||||
} else {
|
||||
if (isset($remember_template)) {
|
||||
PMA_setCookie('pma_table_filename_template', $filename_template);
|
||||
}
|
||||
$filename = str_replace('__TABLE__', $table, str_replace('__DB__', $db, str_replace('__SERVER__', $GLOBALS['cfg']['Server']['host'], strftime($filename_template))));
|
||||
}
|
||||
|
||||
// convert filename to iso-8859-1, it is safer
|
||||
if (!(isset($cfg['AllowAnywhereRecoding']) && $cfg['AllowAnywhereRecoding'] )) {
|
||||
$filename = PMA_convert_string($charset, 'iso-8859-1', $filename);
|
||||
} else {
|
||||
$filename = PMA_convert_string($convcharset, 'iso-8859-1', $filename);
|
||||
}
|
||||
|
||||
// Grab basic dump extension and mime type
|
||||
$filename .= '.' . $export_list[$type]['extension'];
|
||||
$mime_type = $export_list[$type]['mime_type'];
|
||||
|
||||
// If dump is going to be compressed, set correct mime_type and add
|
||||
// compression to extension
|
||||
if ($compression == 'bzip') {
|
||||
$filename .= '.bz2';
|
||||
$mime_type = 'application/x-bzip2';
|
||||
} elseif ($compression == 'gzip') {
|
||||
$filename .= '.gz';
|
||||
$mime_type = 'application/x-gzip';
|
||||
} elseif ($compression == 'zip') {
|
||||
$filename .= '.zip';
|
||||
$mime_type = 'application/zip';
|
||||
}
|
||||
}
|
||||
|
||||
// Open file on server if needed
|
||||
if ($save_on_server) {
|
||||
$save_filename = PMA_userDir($cfg['SaveDir']) . preg_replace('@[/\\\\]@', '_', $filename);
|
||||
unset($message);
|
||||
if (file_exists($save_filename) && empty($onserverover)) {
|
||||
$message = PMA_Message::error('strFileAlreadyExists');
|
||||
$message->addParam($save_filename);
|
||||
} else {
|
||||
if (is_file($save_filename) && !is_writable($save_filename)) {
|
||||
$message = PMA_Message::error('strNoPermission');
|
||||
$message->addParam($save_filename);
|
||||
} else {
|
||||
if (!$file_handle = @fopen($save_filename, 'w')) {
|
||||
$message = PMA_Message::error('strNoPermission');
|
||||
$message->addParam($save_filename);
|
||||
}
|
||||
}
|
||||
}
|
||||
if (isset($message)) {
|
||||
$GLOBALS['js_include'][] = 'functions.js';
|
||||
require_once './libraries/header.inc.php';
|
||||
if ($export_type == 'server') {
|
||||
$active_page = 'server_export.php';
|
||||
require './server_export.php';
|
||||
} elseif ($export_type == 'database') {
|
||||
$active_page = 'db_export.php';
|
||||
require './db_export.php';
|
||||
} else {
|
||||
$active_page = 'tbl_export.php';
|
||||
require './tbl_export.php';
|
||||
}
|
||||
exit();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Send headers depending on whether the user chose to download a dump file
|
||||
* or not
|
||||
*/
|
||||
if (!$save_on_server) {
|
||||
if ($asfile) {
|
||||
// Download
|
||||
// (avoid rewriting data containing HTML with anchors and forms;
|
||||
// this was reported to happen under Plesk)
|
||||
@ini_set('url_rewriter.tags','');
|
||||
|
||||
header('Content-Type: ' . $mime_type);
|
||||
header('Expires: ' . gmdate('D, d M Y H:i:s') . ' GMT');
|
||||
// lem9: Tested behavior of
|
||||
// IE 5.50.4807.2300
|
||||
// IE 6.0.2800.1106 (small glitch, asks twice when I click Open)
|
||||
// IE 6.0.2900.2180
|
||||
// Firefox 1.0.6
|
||||
// in http and https
|
||||
header('Content-Disposition: attachment; filename="' . $filename . '"');
|
||||
if (PMA_USR_BROWSER_AGENT == 'IE') {
|
||||
header('Cache-Control: must-revalidate, post-check=0, pre-check=0');
|
||||
header('Pragma: public');
|
||||
} else {
|
||||
header('Pragma: no-cache');
|
||||
// test case: exporting a database into a .gz file with Safari
|
||||
// would produce files not having the current time
|
||||
// (added this header for Safari but should not harm other browsers)
|
||||
header('Last-Modified: ' . gmdate('D, d M Y H:i:s') . ' GMT');
|
||||
}
|
||||
} else {
|
||||
// HTML
|
||||
if ($export_type == 'database') {
|
||||
$num_tables = count($tables);
|
||||
if ($num_tables == 0) {
|
||||
$message = PMA_Message::error('strNoTablesFound');
|
||||
$GLOBALS['js_include'][] = 'functions.js';
|
||||
require_once './libraries/header.inc.php';
|
||||
$active_page = 'db_export.php';
|
||||
require './db_export.php';
|
||||
exit();
|
||||
}
|
||||
}
|
||||
$backup_cfgServer = $cfg['Server'];
|
||||
require_once './libraries/header.inc.php';
|
||||
$cfg['Server'] = $backup_cfgServer;
|
||||
unset($backup_cfgServer);
|
||||
echo "\n" . '<div align="' . $cell_align_left . '">' . "\n";
|
||||
//echo ' <pre>' . "\n";
|
||||
echo ' <form name="nofunction">' . "\n"
|
||||
// remove auto-select for now: there is no way to select
|
||||
// only a part of the text; anyway, it should obey
|
||||
// $cfg['TextareaAutoSelect']
|
||||
//. ' <textarea name="sqldump" cols="50" rows="30" onclick="this.select();" id="textSQLDUMP" wrap="OFF">' . "\n";
|
||||
. ' <textarea name="sqldump" cols="50" rows="30" id="textSQLDUMP" wrap="OFF">' . "\n";
|
||||
} // end download
|
||||
}
|
||||
|
||||
// Fake loop just to allow skip of remain of this code by break, I'd really
|
||||
// need exceptions here :-)
|
||||
do {
|
||||
|
||||
// Add possibly some comments to export
|
||||
if (!PMA_exportHeader()) {
|
||||
break;
|
||||
}
|
||||
|
||||
// Will we need relation & co. setup?
|
||||
$do_relation = isset($GLOBALS[$what . '_relation']);
|
||||
$do_comments = isset($GLOBALS[$what . '_comments']);
|
||||
$do_mime = isset($GLOBALS[$what . '_mime']);
|
||||
if ($do_relation || $do_comments || $do_mime) {
|
||||
require_once './libraries/relation.lib.php';
|
||||
$cfgRelation = PMA_getRelationsParam();
|
||||
}
|
||||
if ($do_mime) {
|
||||
require_once './libraries/transformations.lib.php';
|
||||
}
|
||||
|
||||
// Include dates in export?
|
||||
$do_dates = isset($GLOBALS[$what . '_dates']);
|
||||
|
||||
/**
|
||||
* Builds the dump
|
||||
*/
|
||||
// Gets the number of tables if a dump of a database has been required
|
||||
if ($export_type == 'server') {
|
||||
if (isset($db_select)) {
|
||||
$tmp_select = implode($db_select, '|');
|
||||
$tmp_select = '|' . $tmp_select . '|';
|
||||
}
|
||||
// Walk over databases
|
||||
foreach ($GLOBALS['pma']->databases as $current_db) {
|
||||
if ((isset($tmp_select) && strpos(' ' . $tmp_select, '|' . $current_db . '|'))
|
||||
|| !isset($tmp_select)) {
|
||||
if (!PMA_exportDBHeader($current_db)) {
|
||||
break 2;
|
||||
}
|
||||
if (!PMA_exportDBCreate($current_db)) {
|
||||
break 2;
|
||||
}
|
||||
$tables = PMA_DBI_get_tables($current_db);
|
||||
$views = array();
|
||||
foreach ($tables as $table) {
|
||||
// if this is a view, collect it for later; views must be exported
|
||||
// after the tables
|
||||
$is_view = PMA_Table::isView($current_db, $table);
|
||||
if ($is_view) {
|
||||
$views[] = $table;
|
||||
}
|
||||
if (isset($GLOBALS[$what . '_structure'])) {
|
||||
// for a view, export a stand-in definition of the table
|
||||
// to resolve view dependencies
|
||||
if (!PMA_exportStructure($current_db, $table, $crlf, $err_url, $do_relation, $do_comments, $do_mime, $do_dates, $is_view ? 'stand_in' : 'create_table', $export_type)) {
|
||||
break 3;
|
||||
}
|
||||
}
|
||||
if (isset($GLOBALS[$what . '_data']) && ! $is_view) {
|
||||
$local_query = 'SELECT * FROM ' . PMA_backquote($current_db) . '.' . PMA_backquote($table);
|
||||
if (!PMA_exportData($current_db, $table, $crlf, $err_url, $local_query)) {
|
||||
break 3;
|
||||
}
|
||||
}
|
||||
// now export the triggers (needs to be done after the data because
|
||||
// triggers can modify already imported tables)
|
||||
if (isset($GLOBALS[$what . '_structure'])) {
|
||||
if (!PMA_exportStructure($current_db, $table, $crlf, $err_url, $do_relation, $do_comments, $do_mime, $do_dates, 'triggers', $export_type)) {
|
||||
break 2;
|
||||
}
|
||||
}
|
||||
}
|
||||
foreach($views as $view) {
|
||||
// no data export for a view
|
||||
if (isset($GLOBALS[$what . '_structure'])) {
|
||||
if (!PMA_exportStructure($current_db, $view, $crlf, $err_url, $do_relation, $do_comments, $do_mime, $do_dates, 'create_view', $export_type)) {
|
||||
break 3;
|
||||
}
|
||||
}
|
||||
}
|
||||
if (!PMA_exportDBFooter($current_db)) {
|
||||
break 2;
|
||||
}
|
||||
}
|
||||
}
|
||||
} elseif ($export_type == 'database') {
|
||||
if (!PMA_exportDBHeader($db)) {
|
||||
break;
|
||||
}
|
||||
$i = 0;
|
||||
$views = array();
|
||||
// $tables contains the choices from the user (via $table_select)
|
||||
foreach ($tables as $table) {
|
||||
// if this is a view, collect it for later; views must be exported after
|
||||
// the tables
|
||||
$is_view = PMA_Table::isView($db, $table);
|
||||
if ($is_view) {
|
||||
$views[] = $table;
|
||||
}
|
||||
if (isset($GLOBALS[$what . '_structure'])) {
|
||||
// for a view, export a stand-in definition of the table
|
||||
// to resolve view dependencies
|
||||
if (!PMA_exportStructure($db, $table, $crlf, $err_url, $do_relation, $do_comments, $do_mime, $do_dates, $is_view ? 'stand_in' : 'create_table', $export_type)) {
|
||||
break 2;
|
||||
}
|
||||
}
|
||||
if (isset($GLOBALS[$what . '_data']) && ! $is_view) {
|
||||
$local_query = 'SELECT * FROM ' . PMA_backquote($db) . '.' . PMA_backquote($table);
|
||||
if (!PMA_exportData($db, $table, $crlf, $err_url, $local_query)) {
|
||||
break 2;
|
||||
}
|
||||
}
|
||||
// now export the triggers (needs to be done after the data because
|
||||
// triggers can modify already imported tables)
|
||||
if (isset($GLOBALS[$what . '_structure'])) {
|
||||
if (!PMA_exportStructure($db, $table, $crlf, $err_url, $do_relation, $do_comments, $do_mime, $do_dates, 'triggers', $export_type)) {
|
||||
break 2;
|
||||
}
|
||||
}
|
||||
}
|
||||
foreach ($views as $view) {
|
||||
// no data export for a view
|
||||
if (isset($GLOBALS[$what . '_structure'])) {
|
||||
if (!PMA_exportStructure($db, $view, $crlf, $err_url, $do_relation, $do_comments, $do_mime, $do_dates, 'create_view', $export_type)) {
|
||||
break 2;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if (!PMA_exportDBFooter($db)) {
|
||||
break;
|
||||
}
|
||||
} else {
|
||||
if (!PMA_exportDBHeader($db)) {
|
||||
break;
|
||||
}
|
||||
// We export just one table
|
||||
// $allrows comes from the form when "Dump all rows" has been selected
|
||||
if ($allrows == '0' && $limit_to > 0 && $limit_from >= 0) {
|
||||
$add_query = ' LIMIT '
|
||||
. (($limit_from > 0) ? $limit_from . ', ' : '')
|
||||
. $limit_to;
|
||||
} else {
|
||||
$add_query = '';
|
||||
}
|
||||
|
||||
$is_view = PMA_Table::isView($db, $table);
|
||||
if (isset($GLOBALS[$what . '_structure'])) {
|
||||
if (!PMA_exportStructure($db, $table, $crlf, $err_url, $do_relation, $do_comments, $do_mime, $do_dates, $is_view ? 'create_view' : 'create_table', $export_type)) {
|
||||
break;
|
||||
}
|
||||
}
|
||||
// If this is an export of a single view, we have to export data;
|
||||
// for example, a PDF report
|
||||
if (isset($GLOBALS[$what . '_data'])) {
|
||||
if (!empty($sql_query)) {
|
||||
// only preg_replace if needed
|
||||
if (!empty($add_query)) {
|
||||
// remove trailing semicolon before adding a LIMIT
|
||||
$sql_query = preg_replace('%;\s*$%', '', $sql_query);
|
||||
}
|
||||
$local_query = $sql_query . $add_query;
|
||||
PMA_DBI_select_db($db);
|
||||
} else {
|
||||
$local_query = 'SELECT * FROM ' . PMA_backquote($db) . '.' . PMA_backquote($table) . $add_query;
|
||||
}
|
||||
if (!PMA_exportData($db, $table, $crlf, $err_url, $local_query)) {
|
||||
break;
|
||||
}
|
||||
}
|
||||
// now export the triggers (needs to be done after the data because
|
||||
// triggers can modify already imported tables)
|
||||
if (isset($GLOBALS[$what . '_structure'])) {
|
||||
if (!PMA_exportStructure($db, $table, $crlf, $err_url, $do_relation, $do_comments, $do_mime, $do_dates, 'triggers', $export_type)) {
|
||||
break 2;
|
||||
}
|
||||
}
|
||||
if (!PMA_exportDBFooter($db)) {
|
||||
break;
|
||||
}
|
||||
}
|
||||
if (!PMA_exportFooter()) {
|
||||
break;
|
||||
}
|
||||
|
||||
} while (false);
|
||||
// End of fake loop
|
||||
|
||||
if ($save_on_server && isset($message)) {
|
||||
$GLOBALS['js_include'][] = 'functions.js';
|
||||
require_once './libraries/header.inc.php';
|
||||
if ($export_type == 'server') {
|
||||
$active_page = 'server_export.php';
|
||||
require './server_export.php';
|
||||
} elseif ($export_type == 'database') {
|
||||
$active_page = 'db_export.php';
|
||||
require './db_export.php';
|
||||
} else {
|
||||
$active_page = 'tbl_export.php';
|
||||
require './tbl_export.php';
|
||||
}
|
||||
exit();
|
||||
}
|
||||
|
||||
/**
|
||||
* Send the dump as a file...
|
||||
*/
|
||||
if (!empty($asfile)) {
|
||||
// Convert the charset if required.
|
||||
if ($output_charset_conversion) {
|
||||
$dump_buffer = PMA_convert_string($GLOBALS['charset'], $GLOBALS['charset_of_file'], $dump_buffer);
|
||||
}
|
||||
|
||||
// Do the compression
|
||||
// 1. as a zipped file
|
||||
if ($compression == 'zip') {
|
||||
if (@function_exists('gzcompress')) {
|
||||
$zipfile = new zipfile();
|
||||
$zipfile -> addFile($dump_buffer, substr($filename, 0, -4));
|
||||
$dump_buffer = $zipfile -> file();
|
||||
}
|
||||
}
|
||||
// 2. as a bzipped file
|
||||
elseif ($compression == 'bzip') {
|
||||
if (@function_exists('bzcompress')) {
|
||||
$dump_buffer = bzcompress($dump_buffer);
|
||||
}
|
||||
}
|
||||
// 3. as a gzipped file
|
||||
elseif ($compression == 'gzip') {
|
||||
if (@function_exists('gzencode') && !@ini_get('zlib.output_compression')) {
|
||||
// without the optional parameter level because it bug
|
||||
$dump_buffer = gzencode($dump_buffer);
|
||||
}
|
||||
}
|
||||
|
||||
/* If ve saved on server, we have to close file now */
|
||||
if ($save_on_server) {
|
||||
$write_result = @fwrite($file_handle, $dump_buffer);
|
||||
fclose($file_handle);
|
||||
if (strlen($dump_buffer) !=0 && (!$write_result || ($write_result != strlen($dump_buffer)))) {
|
||||
$message = new PMA_Message('strNoSpace', PMA_Message::ERROR, $save_filename);
|
||||
} else {
|
||||
$message = new PMA_Message('strDumpSaved', PMA_Message::SUCCESS, $save_filename);
|
||||
}
|
||||
|
||||
$GLOBALS['js_include'][] = 'functions.js';
|
||||
require_once './libraries/header.inc.php';
|
||||
if ($export_type == 'server') {
|
||||
$active_page = 'server_export.php';
|
||||
require_once './server_export.php';
|
||||
} elseif ($export_type == 'database') {
|
||||
$active_page = 'db_export.php';
|
||||
require_once './db_export.php';
|
||||
} else {
|
||||
$active_page = 'tbl_export.php';
|
||||
require_once './tbl_export.php';
|
||||
}
|
||||
exit();
|
||||
} else {
|
||||
echo $dump_buffer;
|
||||
}
|
||||
}
|
||||
/**
|
||||
* Displays the dump...
|
||||
*/
|
||||
else {
|
||||
/**
|
||||
* Close the html tags and add the footers in dump is displayed on screen
|
||||
*/
|
||||
//echo ' </pre>' . "\n";
|
||||
echo '</textarea>' . "\n"
|
||||
. ' </form>' . "\n";
|
||||
echo '</div>' . "\n";
|
||||
echo "\n";
|
||||
?>
|
||||
<script type="text/javascript">
|
||||
//<![CDATA[
|
||||
var bodyWidth=null; var bodyHeight=null;
|
||||
if (document.getElementById('textSQLDUMP')) {
|
||||
bodyWidth = self.innerWidth;
|
||||
bodyHeight = self.innerHeight;
|
||||
if (!bodyWidth && !bodyHeight) {
|
||||
if (document.compatMode && document.compatMode == "BackCompat") {
|
||||
bodyWidth = document.body.clientWidth;
|
||||
bodyHeight = document.body.clientHeight;
|
||||
} else if (document.compatMode && document.compatMode == "CSS1Compat") {
|
||||
bodyWidth = document.documentElement.clientWidth;
|
||||
bodyHeight = document.documentElement.clientHeight;
|
||||
}
|
||||
}
|
||||
document.getElementById('textSQLDUMP').style.width=(bodyWidth-50) + 'px';
|
||||
document.getElementById('textSQLDUMP').style.height=(bodyHeight-100) + 'px';
|
||||
}
|
||||
//]]>
|
||||
</script>
|
||||
<?php
|
||||
require_once './libraries/footer.inc.php';
|
||||
} // end if
|
||||
?>
|
||||
BIN
favicon.ico
BIN
favicon.ico
Binary file not shown.
|
Before Width: | Height: | Size: 18 KiB |
452
import.php
452
import.php
@@ -1,452 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* Core script for import, this is just the glue around all other stuff
|
||||
*
|
||||
* @uses PMA_Bookmark_getList()
|
||||
* @version $Id$
|
||||
* @package phpMyAdmin
|
||||
*/
|
||||
|
||||
/**
|
||||
* Get the variables sent or posted to this script and a core script
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
//require_once './libraries/display_import_functions.lib.php';
|
||||
$GLOBALS['js_include'][] = 'functions.js';
|
||||
$GLOBALS['js_include'][] = 'mootools.js';
|
||||
|
||||
// reset import messages for ajax request
|
||||
$_SESSION['Import_message']['message'] = null;
|
||||
$_SESSION['Import_message']['go_back_url'] = null;
|
||||
// default values
|
||||
$GLOBALS['reload'] = false;
|
||||
|
||||
// Are we just executing plain query or sql file? (eg. non import, but query box/window run)
|
||||
if (!empty($sql_query)) {
|
||||
// run SQL query
|
||||
$import_text = $sql_query;
|
||||
$import_type = 'query';
|
||||
$format = 'sql';
|
||||
|
||||
// refresh left frame on changes in table or db structure
|
||||
if (preg_match('/^(CREATE|ALTER|DROP)\s+(VIEW|TABLE|DATABASE|SCHEMA)\s+/i', $sql_query)) {
|
||||
$GLOBALS['reload'] = true;
|
||||
}
|
||||
|
||||
$sql_query = '';
|
||||
} elseif (!empty($sql_localfile)) {
|
||||
// run SQL file on server
|
||||
$local_import_file = $sql_localfile;
|
||||
$import_type = 'queryfile';
|
||||
$format = 'sql';
|
||||
unset($sql_localfile);
|
||||
} elseif (!empty($sql_file)) {
|
||||
// run uploaded SQL file
|
||||
$import_file = $sql_file;
|
||||
$import_type = 'queryfile';
|
||||
$format = 'sql';
|
||||
unset($sql_file);
|
||||
} elseif (!empty($id_bookmark)) {
|
||||
// run bookmark
|
||||
$import_type = 'query';
|
||||
$format = 'sql';
|
||||
}
|
||||
|
||||
// If we didn't get any parameters, either user called this directly, or
|
||||
// upload limit has been reached, let's assume the second possibility.
|
||||
;
|
||||
if ($_POST == array() && $_GET == array()) {
|
||||
require_once './libraries/header.inc.php';
|
||||
$message = PMA_Message::error('strUploadLimit');
|
||||
$message->addParam('[a@./Documentation.html#faq1_16@_blank]');
|
||||
$message->addParam('[/a]');
|
||||
|
||||
// so we can obtain the message
|
||||
$_SESSION['Import_message']['message'] = $message->getDisplay();
|
||||
$_SESSION['Import_message']['go_back_url'] = $goto;
|
||||
|
||||
$message->display();
|
||||
require './libraries/footer.inc.php';
|
||||
}
|
||||
|
||||
// Check needed parameters
|
||||
PMA_checkParameters(array('import_type', 'format'));
|
||||
|
||||
// We don't want anything special in format
|
||||
$format = PMA_securePath($format);
|
||||
|
||||
// Import functions
|
||||
require_once './libraries/import.lib.php';
|
||||
|
||||
// Create error and goto url
|
||||
if ($import_type == 'table') {
|
||||
$err_url = 'tbl_import.php?' . PMA_generate_common_url($db, $table);
|
||||
$_SESSION['Import_message']['go_back_url'] = $err_url;
|
||||
$goto = 'tbl_import.php';
|
||||
} elseif ($import_type == 'database') {
|
||||
$err_url = 'db_import.php?' . PMA_generate_common_url($db);
|
||||
$_SESSION['Import_message']['go_back_url'] = $err_url;
|
||||
$goto = 'db_import.php';
|
||||
} elseif ($import_type == 'server') {
|
||||
$err_url = 'server_import.php?' . PMA_generate_common_url();
|
||||
$_SESSION['Import_message']['go_back_url'] = $err_url;
|
||||
$goto = 'server_import.php';
|
||||
} else {
|
||||
if (empty($goto) || !preg_match('@^(server|db|tbl)(_[a-z]*)*\.php$@i', $goto)) {
|
||||
if (strlen($table) && strlen($db)) {
|
||||
$goto = 'tbl_structure.php';
|
||||
} elseif (strlen($db)) {
|
||||
$goto = 'db_structure.php';
|
||||
} else {
|
||||
$goto = 'server_sql.php';
|
||||
}
|
||||
}
|
||||
if (strlen($table) && strlen($db)) {
|
||||
$common = PMA_generate_common_url($db, $table);
|
||||
} elseif (strlen($db)) {
|
||||
$common = PMA_generate_common_url($db);
|
||||
} else {
|
||||
$common = PMA_generate_common_url();
|
||||
}
|
||||
$err_url = $goto
|
||||
. '?' . $common
|
||||
. (preg_match('@^tbl_[a-z]*\.php$@', $goto) ? '&table=' . urlencode($table) : '');
|
||||
$_SESSION['Import_message']['go_back_url'] = $err_url;
|
||||
}
|
||||
|
||||
|
||||
if (strlen($db)) {
|
||||
PMA_DBI_select_db($db);
|
||||
}
|
||||
|
||||
@set_time_limit($cfg['ExecTimeLimit']);
|
||||
if (!empty($cfg['MemoryLimit'])) {
|
||||
@ini_set('memory_limit', $cfg['MemoryLimit']);
|
||||
}
|
||||
|
||||
$timestamp = time();
|
||||
if (isset($allow_interrupt)) {
|
||||
$maximum_time = ini_get('max_execution_time');
|
||||
} else {
|
||||
$maximum_time = 0;
|
||||
}
|
||||
|
||||
// set default values
|
||||
$timeout_passed = FALSE;
|
||||
$error = FALSE;
|
||||
$read_multiply = 1;
|
||||
$finished = FALSE;
|
||||
$offset = 0;
|
||||
$max_sql_len = 0;
|
||||
$file_to_unlink = '';
|
||||
$sql_query = '';
|
||||
$sql_query_disabled = FALSE;
|
||||
$go_sql = FALSE;
|
||||
$executed_queries = 0;
|
||||
$run_query = TRUE;
|
||||
$charset_conversion = FALSE;
|
||||
$reset_charset = FALSE;
|
||||
$bookmark_created = FALSE;
|
||||
|
||||
// Bookmark Support: get a query back from bookmark if required
|
||||
if (!empty($id_bookmark)) {
|
||||
require_once './libraries/bookmark.lib.php';
|
||||
switch ($action_bookmark) {
|
||||
case 0: // bookmarked query that have to be run
|
||||
$import_text = PMA_Bookmark_get($db, $id_bookmark, 'id', isset($action_bookmark_all));
|
||||
if (isset($bookmark_variable) && !empty($bookmark_variable)) {
|
||||
$import_text = preg_replace('|/\*(.*)\[VARIABLE\](.*)\*/|imsU', '${1}' . PMA_sqlAddslashes($bookmark_variable) . '${2}', $import_text);
|
||||
}
|
||||
|
||||
// refresh left frame on changes in table or db structure
|
||||
if (preg_match('/^(CREATE|ALTER|DROP)\s+(VIEW|TABLE|DATABASE|SCHEMA)\s+/i', $import_text)) {
|
||||
$GLOBALS['reload'] = true;
|
||||
}
|
||||
|
||||
break;
|
||||
case 1: // bookmarked query that have to be displayed
|
||||
$import_text = PMA_Bookmark_get($db, $id_bookmark);
|
||||
$run_query = FALSE;
|
||||
break;
|
||||
case 2: // bookmarked query that have to be deleted
|
||||
$import_text = PMA_Bookmark_get($db, $id_bookmark);
|
||||
PMA_Bookmark_delete($db, $id_bookmark);
|
||||
$run_query = FALSE;
|
||||
$error = TRUE; // this is kind of hack to skip processing the query
|
||||
break;
|
||||
}
|
||||
} // end bookmarks reading
|
||||
|
||||
// Do no run query if we show PHP code
|
||||
if (isset($GLOBALS['show_as_php'])) {
|
||||
$run_query = FALSE;
|
||||
$go_sql = TRUE;
|
||||
}
|
||||
|
||||
// Store the query as a bookmark before executing it if bookmarklabel was given
|
||||
if (!empty($bkm_label) && !empty($import_text)) {
|
||||
require_once './libraries/bookmark.lib.php';
|
||||
$bfields = array(
|
||||
'dbase' => $db,
|
||||
'user' => $cfg['Bookmark']['user'],
|
||||
'query' => urlencode($import_text),
|
||||
'label' => $bkm_label
|
||||
);
|
||||
|
||||
// Should we replace bookmark?
|
||||
if (isset($bkm_replace)) {
|
||||
$bookmarks = PMA_Bookmark_getList($db);
|
||||
foreach ($bookmarks as $key => $val) {
|
||||
if ($val == $bkm_label) {
|
||||
PMA_Bookmark_delete($db, $key);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
PMA_Bookmark_save($bfields, isset($bkm_all_users));
|
||||
|
||||
$bookmark_created = TRUE;
|
||||
} // end store bookmarks
|
||||
|
||||
// We can not read all at once, otherwise we can run out of memory
|
||||
$memory_limit = trim(@ini_get('memory_limit'));
|
||||
// 2 MB as default
|
||||
if (empty($memory_limit)) {
|
||||
$memory_limit = 2 * 1024 * 1024;
|
||||
}
|
||||
// In case no memory limit we work on 10MB chunks
|
||||
if ($memory_limit == -1) {
|
||||
$memory_limit = 10 * 1024 * 1024;
|
||||
}
|
||||
|
||||
// Calculate value of the limit
|
||||
if (strtolower(substr($memory_limit, -1)) == 'm') {
|
||||
$memory_limit = (int)substr($memory_limit, 0, -1) * 1024 * 1024;
|
||||
} elseif (strtolower(substr($memory_limit, -1)) == 'k') {
|
||||
$memory_limit = (int)substr($memory_limit, 0, -1) * 1024;
|
||||
} elseif (strtolower(substr($memory_limit, -1)) == 'g') {
|
||||
$memory_limit = (int)substr($memory_limit, 0, -1) * 1024 * 1024 * 1024;
|
||||
} else {
|
||||
$memory_limit = (int)$memory_limit;
|
||||
}
|
||||
|
||||
$read_limit = $memory_limit / 8; // Just to be sure, there might be lot of memory needed for uncompression
|
||||
|
||||
// handle filenames
|
||||
if (!empty($local_import_file) && !empty($cfg['UploadDir'])) {
|
||||
|
||||
// sanitize $local_import_file as it comes from a POST
|
||||
$local_import_file = PMA_securePath($local_import_file);
|
||||
|
||||
$import_file = PMA_userDir($cfg['UploadDir']) . $local_import_file;
|
||||
} elseif (empty($import_file) || !is_uploaded_file($import_file)) {
|
||||
$import_file = 'none';
|
||||
}
|
||||
|
||||
// Do we have file to import?
|
||||
|
||||
if ($import_file != 'none' && !$error) {
|
||||
// work around open_basedir and other limitations
|
||||
$open_basedir = @ini_get('open_basedir');
|
||||
|
||||
// If we are on a server with open_basedir, we must move the file
|
||||
// before opening it. The doc explains how to create the "./tmp"
|
||||
// directory
|
||||
|
||||
if (!empty($open_basedir)) {
|
||||
|
||||
$tmp_subdir = (PMA_IS_WINDOWS ? '.\\tmp\\' : './tmp/');
|
||||
|
||||
if (is_writable($tmp_subdir)) {
|
||||
|
||||
|
||||
$import_file_new = $tmp_subdir . basename($import_file);
|
||||
if (move_uploaded_file($import_file, $import_file_new)) {
|
||||
$import_file = $import_file_new;
|
||||
$file_to_unlink = $import_file_new;
|
||||
}
|
||||
|
||||
$size = filesize($import_file);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Handle file compression
|
||||
* @todo duplicate code exists in File.class.php
|
||||
*/
|
||||
$compression = PMA_detectCompression($import_file);
|
||||
if ($compression === FALSE) {
|
||||
$message = PMA_Message::error('strFileCouldNotBeRead');
|
||||
$error = TRUE;
|
||||
} else {
|
||||
switch ($compression) {
|
||||
case 'application/bzip2':
|
||||
if ($cfg['BZipDump'] && @function_exists('bzopen')) {
|
||||
$import_handle = @bzopen($import_file, 'r');
|
||||
} else {
|
||||
$message = PMA_Message::error('strUnsupportedCompressionDetected');
|
||||
$message->addParam($compression);
|
||||
$error = TRUE;
|
||||
}
|
||||
break;
|
||||
case 'application/gzip':
|
||||
if ($cfg['GZipDump'] && @function_exists('gzopen')) {
|
||||
$import_handle = @gzopen($import_file, 'r');
|
||||
} else {
|
||||
$message = PMA_Message::error('strUnsupportedCompressionDetected');
|
||||
$message->addParam($compression);
|
||||
$error = TRUE;
|
||||
}
|
||||
break;
|
||||
case 'application/zip':
|
||||
if ($cfg['ZipDump'] && @function_exists('zip_open')) {
|
||||
/**
|
||||
* Load interface for zip extension.
|
||||
*/
|
||||
include_once './libraries/zip_extension.lib.php';
|
||||
$result = PMA_getZipContents($import_file);
|
||||
if (! empty($result['error'])) {
|
||||
$message = PMA_Message::rawError($result['error']);
|
||||
$error = TRUE;
|
||||
} else {
|
||||
$import_text = $result['data'];
|
||||
}
|
||||
} else {
|
||||
$message = PMA_Message::error('strUnsupportedCompressionDetected');
|
||||
$message->addParam($compression);
|
||||
$error = TRUE;
|
||||
}
|
||||
break;
|
||||
case 'none':
|
||||
$import_handle = @fopen($import_file, 'r');
|
||||
break;
|
||||
default:
|
||||
$message = PMA_Message::error('strUnsupportedCompressionDetected');
|
||||
$message->addParam($compression);
|
||||
$error = TRUE;
|
||||
break;
|
||||
}
|
||||
}
|
||||
// use isset() because zip compression type does not use a handle
|
||||
if (!$error && isset($import_handle) && $import_handle === FALSE) {
|
||||
$message = PMA_Message::error('strFileCouldNotBeRead');
|
||||
$error = TRUE;
|
||||
}
|
||||
} elseif (!$error) {
|
||||
if (!isset($import_text) || empty($import_text)) {
|
||||
$message = PMA_Message::error('strNoDataReceived');
|
||||
$error = TRUE;
|
||||
}
|
||||
}
|
||||
|
||||
// so we can obtain the message
|
||||
//$_SESSION['Import_message'] = $message->getDisplay();
|
||||
|
||||
// Convert the file's charset if necessary
|
||||
if ($cfg['AllowAnywhereRecoding'] && isset($charset_of_file)) {
|
||||
if ($charset_of_file != $charset) {
|
||||
$charset_conversion = TRUE;
|
||||
}
|
||||
} elseif (isset($charset_of_file) && $charset_of_file != 'utf8') {
|
||||
PMA_DBI_query('SET NAMES \'' . $charset_of_file . '\'');
|
||||
// We can not show query in this case, it is in different charset
|
||||
$sql_query_disabled = TRUE;
|
||||
$reset_charset = TRUE;
|
||||
}
|
||||
|
||||
// Something to skip?
|
||||
if (!$error && isset($skip)) {
|
||||
$original_skip = $skip;
|
||||
while ($skip > 0) {
|
||||
PMA_importGetNextChunk($skip < $read_limit ? $skip : $read_limit);
|
||||
$read_multiply = 1; // Disable read progresivity, otherwise we eat all memory!
|
||||
$skip -= $read_limit;
|
||||
}
|
||||
unset($skip);
|
||||
}
|
||||
|
||||
if (!$error) {
|
||||
// Check for file existance
|
||||
if (!file_exists('./libraries/import/' . $format . '.php')) {
|
||||
$error = TRUE;
|
||||
$message = PMA_Message::error('strCanNotLoadImportPlugins');
|
||||
} else {
|
||||
// Do the real import
|
||||
$plugin_param = $import_type;
|
||||
require './libraries/import/' . $format . '.php';
|
||||
}
|
||||
}
|
||||
|
||||
if (! $error && FALSE !== $import_handle && NULL !== $import_handle) {
|
||||
fclose($import_handle);
|
||||
}
|
||||
|
||||
// Cleanup temporary file
|
||||
if ($file_to_unlink != '') {
|
||||
unlink($file_to_unlink);
|
||||
}
|
||||
|
||||
// Reset charset back, if we did some changes
|
||||
if ($reset_charset) {
|
||||
PMA_DBI_query('SET CHARACTER SET utf8');
|
||||
PMA_DBI_query('SET SESSION collation_connection =\'' . $collation_connection . '\'');
|
||||
}
|
||||
|
||||
// Show correct message
|
||||
if (!empty($id_bookmark) && $action_bookmark == 2) {
|
||||
$message = PMA_Message::success('strBookmarkDeleted');
|
||||
$display_query = $import_text;
|
||||
$error = FALSE; // unset error marker, it was used just to skip processing
|
||||
} elseif (!empty($id_bookmark) && $action_bookmark == 1) {
|
||||
$message = PMA_Message::notice('strShowingBookmark');
|
||||
} elseif ($bookmark_created) {
|
||||
$special_message = '[br]' . sprintf($strBookmarkCreated, htmlspecialchars($bkm_label));
|
||||
} elseif ($finished && !$error) {
|
||||
if ($import_type == 'query') {
|
||||
$message = PMA_Message::success();
|
||||
} else {
|
||||
if ($import_notice) {
|
||||
$message = PMA_Message::success('<em>'.$GLOBALS['strImportSuccessfullyFinished'].'</em>');
|
||||
$message->addParam($executed_queries);
|
||||
|
||||
$message->addString($import_notice);
|
||||
} else {
|
||||
$message = PMA_Message::success('strImportSuccessfullyFinished');
|
||||
$message->addParam($executed_queries);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Did we hit timeout? Tell it user.
|
||||
if ($timeout_passed) {
|
||||
$message = PMA_Message::error('strTimeoutPassed');
|
||||
if ($offset == 0 || (isset($original_skip) && $original_skip == $offset)) {
|
||||
$message->addString('strTimeoutNothingParsed');
|
||||
}
|
||||
}
|
||||
|
||||
// if there is any message, copy it into $_SESSION as well, so we can obtain it by AJAX call
|
||||
if (isset($message)) {
|
||||
$_SESSION['Import_message']['message'] = $message->getDisplay();
|
||||
// $_SESSION['Import_message']['go_back_url'] = $goto.'?'. PMA_generate_common_url();
|
||||
}
|
||||
// Parse and analyze the query, for correct db and table name
|
||||
// in case of a query typed in the query window
|
||||
require_once './libraries/parse_analyze.lib.php';
|
||||
|
||||
// There was an error?
|
||||
if (isset($my_die)) {
|
||||
foreach ($my_die AS $key => $die) {
|
||||
PMA_mysqlDie($die['error'], $die['sql'], '', $err_url, $error);
|
||||
}
|
||||
}
|
||||
|
||||
if ($go_sql) {
|
||||
require './sql.php';
|
||||
} else {
|
||||
$active_page = $goto;
|
||||
require './' . $goto;
|
||||
}
|
||||
exit();
|
||||
?>
|
||||
@@ -1,33 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
*
|
||||
* @version $Id$
|
||||
* @package phpMyAdmin
|
||||
*/
|
||||
|
||||
require_once './libraries/common.inc.php';
|
||||
require_once './libraries/display_import_ajax.lib.php';
|
||||
|
||||
// AJAX requests can't be cached!
|
||||
header("Cache-Control: no-cache, must-revalidate"); // HTTP/1.1
|
||||
header("Expires: Sat, 11 Jan 1991 06:30:00 GMT"); // Date in the past
|
||||
|
||||
// $GLOBALS["message"] is used for asking for an import message
|
||||
if (isset($GLOBALS["message"]) && $GLOBALS["message"]) {
|
||||
|
||||
header('Content-type: text/html');
|
||||
|
||||
while ($_SESSION['Import_message']['message'] == null) { // wait until message is available
|
||||
usleep(250000); // 0.25 sec
|
||||
}
|
||||
|
||||
echo $_SESSION['Import_message']['message'];
|
||||
echo '<fieldset class="tblFooters">' . "\n";
|
||||
echo ' [ <a href="' . $_SESSION['Import_message']['go_back_url'] . '">' . $GLOBALS["strBack"] . '</a> ]' . "\n";
|
||||
echo '</fieldset>'."\n";
|
||||
|
||||
} else {
|
||||
PMA_importAjaxStatus($GLOBALS["id"]);
|
||||
}
|
||||
?>
|
||||
192
index.php
192
index.php
@@ -1,192 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* forms frameset
|
||||
*
|
||||
* @version $Id$
|
||||
* @uses $GLOBALS['strNoFrames']
|
||||
* @uses $GLOBALS['cfg']['QueryHistoryDB']
|
||||
* @uses $GLOBALS['cfg']['Server']['user']
|
||||
* @uses $GLOBALS['cfg']['DefaultTabServer'] as src for the mainframe
|
||||
* @uses $GLOBALS['cfg']['DefaultTabDatabase'] as src for the mainframe
|
||||
* @uses $GLOBALS['cfg']['NaviWidth'] for navi frame width
|
||||
* @uses $GLOBALS['collation_connection'] from $_REQUEST (grab_globals.lib.php)
|
||||
* or common.inc.php
|
||||
* @uses $GLOBALS['available_languages'] from common.inc.php (select_lang.lib.php)
|
||||
* @uses $GLOBALS['db']
|
||||
* @uses $GLOBALS['charset']
|
||||
* @uses $GLOBALS['lang']
|
||||
* @uses $GLOBALS['text_dir']
|
||||
* @uses $_ENV['HTTP_HOST']
|
||||
* @uses PMA_getRelationsParam()
|
||||
* @uses PMA_purgeHistory()
|
||||
* @uses PMA_generate_common_url()
|
||||
* @uses PMA_VERSION
|
||||
* @uses session_write_close()
|
||||
* @uses time()
|
||||
* @uses PMA_getenv()
|
||||
* @uses header() to send charset
|
||||
* @package phpMyAdmin
|
||||
*/
|
||||
|
||||
/**
|
||||
* Gets core libraries and defines some variables
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
|
||||
/**
|
||||
* Includes the ThemeManager if it hasn't been included yet
|
||||
*/
|
||||
require_once './libraries/relation.lib.php';
|
||||
|
||||
// free the session file, for the other frames to be loaded
|
||||
session_write_close();
|
||||
|
||||
// Gets the host name
|
||||
if (empty($HTTP_HOST)) {
|
||||
if (PMA_getenv('HTTP_HOST')) {
|
||||
$HTTP_HOST = PMA_getenv('HTTP_HOST');
|
||||
} else {
|
||||
$HTTP_HOST = '';
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
// purge querywindow history
|
||||
$cfgRelation = PMA_getRelationsParam();
|
||||
if ($GLOBALS['cfg']['QueryHistoryDB'] && $cfgRelation['historywork']) {
|
||||
PMA_purgeHistory($GLOBALS['cfg']['Server']['user']);
|
||||
}
|
||||
unset($cfgRelation);
|
||||
|
||||
|
||||
/**
|
||||
* pass variables to child pages
|
||||
*/
|
||||
$drops = array('lang', 'server', 'convcharset', 'collation_connection',
|
||||
'db', 'table');
|
||||
|
||||
foreach ($drops as $each_drop) {
|
||||
if (array_key_exists($each_drop, $_GET)) {
|
||||
unset($_GET[$each_drop]);
|
||||
}
|
||||
}
|
||||
unset($drops, $each_drop);
|
||||
|
||||
if (! strlen($GLOBALS['db'])) {
|
||||
$main_target = $GLOBALS['cfg']['DefaultTabServer'];
|
||||
} elseif (! strlen($GLOBALS['table'])) {
|
||||
$_GET['db'] = $GLOBALS['db'];
|
||||
$main_target = $GLOBALS['cfg']['DefaultTabDatabase'];
|
||||
} else {
|
||||
$_GET['db'] = $GLOBALS['db'];
|
||||
$_GET['table'] = $GLOBALS['table'];
|
||||
$main_target = $GLOBALS['cfg']['DefaultTabTable'];
|
||||
}
|
||||
|
||||
$url_query = PMA_generate_common_url($_GET);
|
||||
|
||||
if (isset($GLOBALS['target']) && is_string($GLOBALS['target']) && !empty($GLOBALS['target']) && in_array($GLOBALS['target'], $goto_whitelist)) {
|
||||
$main_target = $GLOBALS['target'];
|
||||
}
|
||||
|
||||
$main_target .= $url_query;
|
||||
|
||||
$lang_iso_code = $GLOBALS['available_languages'][$GLOBALS['lang']][2];
|
||||
|
||||
|
||||
// start output
|
||||
header('Content-Type: text/html; charset=' . $GLOBALS['charset']);
|
||||
?>
|
||||
<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Frameset//EN"
|
||||
"http://www.w3.org/TR/xhtml1/DTD/xhtml1-frameset.dtd">
|
||||
<html xmlns="http://www.w3.org/1999/xhtml"
|
||||
xml:lang="<?php echo $lang_iso_code; ?>"
|
||||
lang="<?php echo $lang_iso_code; ?>"
|
||||
dir="<?php echo $GLOBALS['text_dir']; ?>">
|
||||
<head>
|
||||
<link rel="icon" href="./favicon.ico" type="image/x-icon" />
|
||||
<link rel="shortcut icon" href="./favicon.ico" type="image/x-icon" />
|
||||
<title>phpMyAdmin <?php echo PMA_VERSION; ?> -
|
||||
<?php echo htmlspecialchars($HTTP_HOST); ?></title>
|
||||
<meta http-equiv="Content-Type"
|
||||
content="text/html; charset=<?php echo $GLOBALS['charset']; ?>" />
|
||||
<meta name="robots" content="noindex,nofollow" />
|
||||
<script type="text/javascript">
|
||||
// <![CDATA[
|
||||
// definitions used in common.js
|
||||
var common_query = '<?php echo PMA_escapeJsString(PMA_generate_common_url('', '', '&'));?>';
|
||||
var opendb_url = '<?php echo PMA_escapeJsString($GLOBALS['cfg']['DefaultTabDatabase']); ?>';
|
||||
var safari_browser = <?php echo PMA_USR_BROWSER_AGENT == 'SAFARI' ? 'true' : 'false' ?>;
|
||||
var querywindow_height = <?php echo PMA_escapeJsString($GLOBALS['cfg']['QueryWindowHeight']); ?>;
|
||||
var querywindow_width = <?php echo PMA_escapeJsString($GLOBALS['cfg']['QueryWindowWidth']); ?>;
|
||||
var collation_connection = '<?php echo PMA_escapeJsString($GLOBALS['collation_connection']); ?>';
|
||||
var lang = '<?php echo PMA_escapeJsString($GLOBALS['lang']); ?>';
|
||||
var server = '<?php echo PMA_escapeJsString($GLOBALS['server']); ?>';
|
||||
var table = '<?php echo PMA_escapeJsString($GLOBALS['table']); ?>';
|
||||
var db = '<?php echo PMA_escapeJsString($GLOBALS['db']); ?>';
|
||||
var token = '<?php echo PMA_escapeJsString($_SESSION[' PMA_token ']); ?>';
|
||||
var text_dir = '<?php echo PMA_escapeJsString($GLOBALS['text_dir']); ?>';
|
||||
var pma_absolute_uri = '<?php echo PMA_escapeJsString($GLOBALS['cfg']['PmaAbsoluteUri']); ?>';
|
||||
var pma_text_default_tab = '<?php echo PMA_escapeJsString(PMA_getTitleForTarget($GLOBALS['cfg']['DefaultTabTable'])); ?>';
|
||||
var pma_text_left_default_tab = '<?php echo PMA_escapeJsString(PMA_getTitleForTarget($GLOBALS['cfg']['LeftDefaultTabTable'])); ?>';
|
||||
|
||||
// for content and navigation frames
|
||||
|
||||
var frame_content = 0;
|
||||
var frame_navigation = 0;
|
||||
function getFrames() {
|
||||
<?php if ($GLOBALS['text_dir'] === 'ltr') { ?>
|
||||
frame_content = window.frames[1];
|
||||
frame_navigation = window.frames[0];
|
||||
<?php } else { ?>
|
||||
frame_content = window.frames[0];
|
||||
frame_navigation = window.frames[1];
|
||||
<?php } ?>
|
||||
}
|
||||
var onloadCnt = 0;
|
||||
var onLoadHandler = window.onload;
|
||||
window.onload = function() {
|
||||
if (onloadCnt == 0) {
|
||||
if (typeof(onLoadHandler) == "function") {
|
||||
onLoadHandler();
|
||||
}
|
||||
if (typeof(getFrames) != 'undefined' && typeof(getFrames) == 'function') {
|
||||
getFrames();
|
||||
}
|
||||
onloadCnt++;
|
||||
}
|
||||
};
|
||||
// ]]>
|
||||
</script>
|
||||
<script src="./js/common.js" type="text/javascript"></script>
|
||||
</head>
|
||||
<frameset cols="<?php
|
||||
if ($GLOBALS['text_dir'] === 'rtl') {
|
||||
echo '*,';
|
||||
}
|
||||
echo $GLOBALS['cfg']['NaviWidth'];
|
||||
if ($GLOBALS['text_dir'] === 'ltr') {
|
||||
echo ',*';
|
||||
}
|
||||
?>" rows="*" id="mainFrameset">
|
||||
<?php if ($GLOBALS['text_dir'] === 'ltr') { ?>
|
||||
<frame frameborder="0" id="frame_navigation"
|
||||
src="navigation.php<?php echo $url_query; ?>"
|
||||
name="frame_navigation" />
|
||||
<?php } ?>
|
||||
<frame frameborder="0" id="frame_content"
|
||||
src="<?php echo $main_target; ?>"
|
||||
name="frame_content" />
|
||||
<?php if ($GLOBALS['text_dir'] === 'rtl') { ?>
|
||||
<frame frameborder="0" id="frame_navigation"
|
||||
src="navigation.php<?php echo $url_query; ?>"
|
||||
name="frame_navigation" />
|
||||
<?php } ?>
|
||||
<noframes>
|
||||
<body>
|
||||
<p><?php echo $GLOBALS['strNoFrames']; ?></p>
|
||||
</body>
|
||||
</noframes>
|
||||
</frameset>
|
||||
</html>
|
||||
453
js/common.js
453
js/common.js
@@ -1,453 +0,0 @@
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* common functions used for communicating between main, navigation and querywindow
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
* holds the browser query window
|
||||
*/
|
||||
var querywindow = '';
|
||||
|
||||
/**
|
||||
* holds the query to be load from a new query window
|
||||
*/
|
||||
var query_to_load = '';
|
||||
|
||||
/**
|
||||
* attach a function to object event
|
||||
*
|
||||
* <code>
|
||||
* addEvent(window, 'load', PMA_initPage);
|
||||
* </code>
|
||||
* @param object or id
|
||||
* @param string event type (load, mouseover, focus, ...)
|
||||
* @param function to be attached
|
||||
*/
|
||||
function addEvent(obj, type, fn)
|
||||
{
|
||||
if (obj.attachEvent) {
|
||||
obj['e' + type + fn] = fn;
|
||||
obj[type + fn] = function() {obj['e' + type + fn](window.event);}
|
||||
obj.attachEvent('on' + type, obj[type + fn]);
|
||||
} else {
|
||||
obj.addEventListener(type, fn, false);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* detach/remove a function from an object event
|
||||
*
|
||||
* @param object or id
|
||||
* @param event type (load, mouseover, focus, ...)
|
||||
* @param function naem of function to be attached
|
||||
*/
|
||||
function removeEvent(obj, type, fn)
|
||||
{
|
||||
if (obj.detachEvent) {
|
||||
obj.detachEvent('on' + type, obj[type + fn]);
|
||||
obj[type + fn] = null;
|
||||
} else {
|
||||
obj.removeEventListener(type, fn, false);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* get DOM elements by html class
|
||||
*
|
||||
* @param string class_name - name of class
|
||||
* @param node node - search only sub nodes of this node (optional)
|
||||
* @param string tag - search only these tags (optional)
|
||||
*/
|
||||
function getElementsByClassName(class_name, node, tag)
|
||||
{
|
||||
var classElements = new Array();
|
||||
|
||||
if (node == null) {
|
||||
node = document;
|
||||
}
|
||||
if (tag == null) {
|
||||
tag = '*';
|
||||
}
|
||||
|
||||
var j = 0, teststr;
|
||||
var els = node.getElementsByTagName(tag);
|
||||
var elsLen = els.length;
|
||||
|
||||
for (i = 0; i < elsLen; i++) {
|
||||
if (els[i].className.indexOf(class_name) != -1) {
|
||||
teststr = "," + els[i].className.split(" ").join(",") + ",";
|
||||
if (teststr.indexOf("," + class_name + ",") != -1) {
|
||||
classElements[j] = els[i];
|
||||
j++;
|
||||
}
|
||||
}
|
||||
}
|
||||
return classElements;
|
||||
}
|
||||
|
||||
/**
|
||||
* sets current selected db
|
||||
*
|
||||
* @param string db name
|
||||
*/
|
||||
function setDb(new_db) {
|
||||
//alert('setDb(' + new_db + ')');
|
||||
if (new_db != db) {
|
||||
// db has changed
|
||||
//alert( new_db + '(' + new_db.length + ') : ' + db );
|
||||
|
||||
var old_db = db;
|
||||
db = new_db;
|
||||
|
||||
if (window.frame_navigation.document.getElementById(db) == null) {
|
||||
// db is unknown, reload complete left frame
|
||||
refreshNavigation();
|
||||
} else {
|
||||
unmarkDbTable(old_db);
|
||||
markDbTable(db);
|
||||
}
|
||||
|
||||
// TODO: add code to expand db in lightview mode
|
||||
|
||||
// refresh querywindow
|
||||
refreshQuerywindow();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* sets current selected table (called from navigation.php)
|
||||
*
|
||||
* @param string table name
|
||||
*/
|
||||
function setTable(new_table) {
|
||||
//alert('setTable(' + new_table + ')');
|
||||
if (new_table != table) {
|
||||
// table has changed
|
||||
//alert( new_table + '(' + new_table.length + ') : ' + table );
|
||||
|
||||
table = new_table;
|
||||
|
||||
if (window.frame_navigation.document.getElementById(db + '.' + table) == null
|
||||
&& table != '') {
|
||||
// table is unknown, reload complete left frame
|
||||
refreshNavigation();
|
||||
|
||||
}
|
||||
// TODO: add code to expand table in lightview mode
|
||||
|
||||
// refresh querywindow
|
||||
refreshQuerywindow();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* reloads main frame
|
||||
*
|
||||
* @uses goTo()
|
||||
* @uses opendb_url
|
||||
* @uses token
|
||||
* @uses db
|
||||
* @uses server
|
||||
* @uses table
|
||||
* @uses lang
|
||||
* @uses collation_connection
|
||||
* @uses encodeURIComponent()
|
||||
* @param string url name of page to be loaded
|
||||
*/
|
||||
function refreshMain(url) {
|
||||
if (! url) {
|
||||
if (db) {
|
||||
url = opendb_url;
|
||||
} else {
|
||||
url = 'main.php';
|
||||
}
|
||||
}
|
||||
//alert(db);
|
||||
goTo(url + '?server=' + encodeURIComponent(server) +
|
||||
'&token=' + encodeURIComponent(token) +
|
||||
'&db=' + encodeURIComponent(db) +
|
||||
'&table=' + encodeURIComponent(table) +
|
||||
'&lang=' + encodeURIComponent(lang) +
|
||||
'&collation_connection=' + encodeURIComponent(collation_connection),
|
||||
'main');
|
||||
}
|
||||
|
||||
/**
|
||||
* reloads navigation frame
|
||||
*
|
||||
* @uses goTo()
|
||||
* @uses token
|
||||
* @uses db
|
||||
* @uses server
|
||||
* @uses table
|
||||
* @uses lang
|
||||
* @uses collation_connection
|
||||
* @uses encodeURIComponent()
|
||||
*/
|
||||
function refreshNavigation() {
|
||||
goTo('navigation.php?server=' + encodeURIComponent(server) +
|
||||
'&token=' + encodeURIComponent(token) +
|
||||
'&db=' + encodeURIComponent(db) +
|
||||
'&table=' + encodeURIComponent(table) +
|
||||
'&lang=' + encodeURIComponent(lang) +
|
||||
'&collation_connection=' + encodeURIComponent(collation_connection)
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* adds class to element
|
||||
*/
|
||||
function addClass(element, classname)
|
||||
{
|
||||
if (element != null) {
|
||||
element.className += ' ' + classname;
|
||||
//alert('set class: ' + classname + ', now: ' + element.className);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* removes class from element
|
||||
*/
|
||||
function removeClass(element, classname)
|
||||
{
|
||||
if (element != null) {
|
||||
element.className = element.className.replace(' ' + classname, '');
|
||||
// if there is no other class anem there is no leading space
|
||||
element.className = element.className.replace(classname, '');
|
||||
//alert('removed class: ' + classname + ', now: ' + element.className);
|
||||
}
|
||||
}
|
||||
|
||||
function unmarkDbTable(db, table)
|
||||
{
|
||||
var element_reference = window.frame_navigation.document.getElementById(db);
|
||||
if (element_reference != null) {
|
||||
//alert('remove from: ' + db);
|
||||
removeClass(element_reference.parentNode, 'marked');
|
||||
}
|
||||
|
||||
element_reference = window.frame_navigation.document.getElementById(db + '.' + table);
|
||||
if (element_reference != null) {
|
||||
//alert('remove from: ' + db + '.' + table);
|
||||
removeClass(element_reference.parentNode, 'marked');
|
||||
}
|
||||
}
|
||||
|
||||
function markDbTable(db, table)
|
||||
{
|
||||
var element_reference = window.frame_navigation.document.getElementById(db);
|
||||
if (element_reference != null) {
|
||||
addClass(element_reference.parentNode, 'marked');
|
||||
// scrolldown
|
||||
element_reference.focus();
|
||||
// opera marks the text, we dont want this ...
|
||||
element_reference.blur();
|
||||
}
|
||||
|
||||
element_reference = window.frame_navigation.document.getElementById(db + '.' + table);
|
||||
if (element_reference != null) {
|
||||
addClass(element_reference.parentNode, 'marked');
|
||||
// scrolldown
|
||||
element_reference.focus();
|
||||
// opera marks the text, we dont want this ...
|
||||
element_reference.blur();
|
||||
}
|
||||
|
||||
// return to main frame ...
|
||||
window.frame_content.focus();
|
||||
}
|
||||
|
||||
/**
|
||||
* sets current selected server, table and db (called from libraries/footer.inc.php)
|
||||
*/
|
||||
function setAll( new_lang, new_collation_connection, new_server, new_db, new_table, new_token ) {
|
||||
//alert('setAll( ' + new_lang + ', ' + new_collation_connection + ', ' + new_server + ', ' + new_db + ', ' + new_table + ', ' + new_token + ' )');
|
||||
if (new_server != server || new_lang != lang
|
||||
|| new_collation_connection != collation_connection) {
|
||||
// something important has changed
|
||||
server = new_server;
|
||||
db = new_db;
|
||||
table = new_table;
|
||||
collation_connection = new_collation_connection;
|
||||
lang = new_lang;
|
||||
token = new_token;
|
||||
refreshNavigation();
|
||||
} else if (new_db != db || new_table != table) {
|
||||
// save new db and table
|
||||
var old_db = db;
|
||||
var old_table = table;
|
||||
db = new_db;
|
||||
table = new_table;
|
||||
|
||||
if (window.frame_navigation.document.getElementById(db) == null
|
||||
&& window.frame_navigation.document.getElementById(db + '.' + table) == null ) {
|
||||
// table or db is unknown, reload complete left frame
|
||||
refreshNavigation();
|
||||
} else {
|
||||
unmarkDbTable(old_db, old_table);
|
||||
markDbTable(db, table);
|
||||
}
|
||||
|
||||
// TODO: add code to expand db in lightview mode
|
||||
|
||||
// refresh querywindow
|
||||
refreshQuerywindow();
|
||||
}
|
||||
}
|
||||
|
||||
function reload_querywindow(db, table, sql_query)
|
||||
{
|
||||
if ( ! querywindow.closed && querywindow.location ) {
|
||||
if ( ! querywindow.document.sqlform.LockFromUpdate
|
||||
|| ! querywindow.document.sqlform.LockFromUpdate.checked ) {
|
||||
querywindow.document.getElementById('hiddenqueryform').db.value = db;
|
||||
querywindow.document.getElementById('hiddenqueryform').table.value = table;
|
||||
|
||||
if (sql_query) {
|
||||
querywindow.document.getElementById('hiddenqueryform').sql_query.value = sql_query;
|
||||
}
|
||||
|
||||
querywindow.document.getElementById('hiddenqueryform').submit();
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* brings query window to front and inserts query to be edited
|
||||
*/
|
||||
function focus_querywindow(sql_query)
|
||||
{
|
||||
/* if ( querywindow && !querywindow.closed && querywindow.location) { */
|
||||
if ( !querywindow || querywindow.closed || !querywindow.location) {
|
||||
// we need first to open the window and cannot pass the query with it
|
||||
// as we dont know if the query exceeds max url length
|
||||
/* url = 'querywindow.php?' + common_query + '&db=' + db + '&table=' + table + '&sql_query=SELECT * FROM'; */
|
||||
query_to_load = sql_query;
|
||||
open_querywindow();
|
||||
insertQuery(0);
|
||||
} else {
|
||||
//var querywindow = querywindow;
|
||||
if ( querywindow.document.getElementById('hiddenqueryform').querydisplay_tab != 'sql' ) {
|
||||
querywindow.document.getElementById('hiddenqueryform').querydisplay_tab.value = "sql";
|
||||
querywindow.document.getElementById('hiddenqueryform').sql_query.value = sql_query;
|
||||
querywindow.document.getElementById('hiddenqueryform').submit();
|
||||
querywindow.focus();
|
||||
} else {
|
||||
querywindow.focus();
|
||||
}
|
||||
}
|
||||
return true;
|
||||
}
|
||||
|
||||
/**
|
||||
* inserts query string into query window textarea
|
||||
* called from script tag in querywindow
|
||||
*/
|
||||
function insertQuery() {
|
||||
if (query_to_load != '' && querywindow.document && querywindow.document.getElementById && querywindow.document.getElementById('sqlquery')) {
|
||||
querywindow.document.getElementById('sqlquery').value = query_to_load;
|
||||
query_to_load = '';
|
||||
return true;
|
||||
}
|
||||
return false;
|
||||
}
|
||||
|
||||
function open_querywindow( url ) {
|
||||
if ( ! url ) {
|
||||
url = 'querywindow.php?' + common_query + '&db=' + encodeURIComponent(db) + '&table=' + encodeURIComponent(table);
|
||||
}
|
||||
|
||||
if (!querywindow.closed && querywindow.location) {
|
||||
goTo( url, 'query' );
|
||||
querywindow.focus();
|
||||
} else {
|
||||
querywindow = window.open( url + '&init=1', '',
|
||||
'toolbar=0,location=0,directories=0,status=1,menubar=0,' +
|
||||
'scrollbars=yes,resizable=yes,' +
|
||||
'width=' + querywindow_width + ',' +
|
||||
'height=' + querywindow_height );
|
||||
}
|
||||
|
||||
if ( ! querywindow.opener ) {
|
||||
querywindow.opener = window.window;
|
||||
}
|
||||
|
||||
if ( window.focus ) {
|
||||
querywindow.focus();
|
||||
}
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
function refreshQuerywindow( url ) {
|
||||
|
||||
if ( ! querywindow.closed && querywindow.location ) {
|
||||
if ( ! querywindow.document.sqlform.LockFromUpdate
|
||||
|| ! querywindow.document.sqlform.LockFromUpdate.checked ) {
|
||||
open_querywindow( url )
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* opens new url in target frame, with default being left frame
|
||||
* valid is 'main' and 'querywindow' all others leads to 'left'
|
||||
*
|
||||
* @param string targeturl new url to load
|
||||
* @param string target frame where to load the new url
|
||||
*/
|
||||
function goTo(targeturl, target) {
|
||||
//alert(targeturl);
|
||||
if ( target == 'main' ) {
|
||||
target = window.frame_content;
|
||||
} else if ( target == 'query' ) {
|
||||
target = querywindow;
|
||||
//return open_querywindow( targeturl );
|
||||
} else if ( ! target ) {
|
||||
target = window.frame_navigation;
|
||||
}
|
||||
|
||||
if ( target ) {
|
||||
if ( target.location.href == targeturl ) {
|
||||
return true;
|
||||
} else if ( target.location.href == pma_absolute_uri + targeturl ) {
|
||||
return true;
|
||||
}
|
||||
|
||||
if ( safari_browser ) {
|
||||
target.location.href = targeturl;
|
||||
} else {
|
||||
target.location.replace(targeturl);
|
||||
}
|
||||
}
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
// opens selected db in main frame
|
||||
function openDb(new_db) {
|
||||
//alert('opendb(' + new_db + ')');
|
||||
setDb(new_db);
|
||||
setTable('');
|
||||
refreshMain(opendb_url);
|
||||
return true;
|
||||
}
|
||||
|
||||
function updateTableTitle( table_link_id, new_title ) {
|
||||
//alert('updateTableTitle');
|
||||
if ( window.parent.frame_navigation.document.getElementById(table_link_id) ) {
|
||||
var left = window.parent.frame_navigation.document;
|
||||
|
||||
var link = left.getElementById(table_link_id);
|
||||
link.title = window.parent.pma_text_default_tab + ': ' + new_title;
|
||||
|
||||
var link = left.getElementById('quick_' + table_link_id);
|
||||
link.title = window.parent.pma_text_left_default_tab + ': ' + new_title;
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
return false;
|
||||
}
|
||||
124
js/dom-drag.js
124
js/dom-drag.js
@@ -1,124 +0,0 @@
|
||||
/**************************************************
|
||||
* dom-drag.js
|
||||
* 09.25.2001
|
||||
* www.youngpup.net
|
||||
**************************************************
|
||||
* Copyright 2001, Aaron Boodman
|
||||
* This code is public domain. Please use it for good, not evil.
|
||||
**************************************************
|
||||
* 10.28.2001 - fixed minor bug where events
|
||||
* sometimes fired off the handle, not the root.
|
||||
**************************************************/
|
||||
|
||||
var Drag = {
|
||||
|
||||
obj : null,
|
||||
|
||||
init : function(o, oRoot, minX, maxX, minY, maxY, bSwapHorzRef, bSwapVertRef, fXMapper, fYMapper)
|
||||
{
|
||||
o.onmousedown = Drag.start;
|
||||
|
||||
o.hmode = bSwapHorzRef ? false : true ;
|
||||
o.vmode = bSwapVertRef ? false : true ;
|
||||
|
||||
o.root = oRoot && oRoot != null ? oRoot : o ;
|
||||
|
||||
if (o.hmode && isNaN(parseInt(o.root.style.left ))) o.root.style.left = "0px";
|
||||
if (o.vmode && isNaN(parseInt(o.root.style.top ))) o.root.style.top = "0px";
|
||||
if (!o.hmode && isNaN(parseInt(o.root.style.right ))) o.root.style.right = "0px";
|
||||
if (!o.vmode && isNaN(parseInt(o.root.style.bottom))) o.root.style.bottom = "0px";
|
||||
|
||||
o.minX = typeof minX != 'undefined' ? minX : null;
|
||||
o.minY = typeof minY != 'undefined' ? minY : null;
|
||||
o.maxX = typeof maxX != 'undefined' ? maxX : null;
|
||||
o.maxY = typeof maxY != 'undefined' ? maxY : null;
|
||||
|
||||
o.xMapper = fXMapper ? fXMapper : null;
|
||||
o.yMapper = fYMapper ? fYMapper : null;
|
||||
|
||||
o.root.onDragStart = new Function();
|
||||
o.root.onDragEnd = new Function();
|
||||
o.root.onDrag = new Function();
|
||||
},
|
||||
|
||||
start : function(e)
|
||||
{
|
||||
var o = Drag.obj = this;
|
||||
e = Drag.fixE(e);
|
||||
var y = parseInt(o.vmode ? o.root.style.top : o.root.style.bottom);
|
||||
var x = parseInt(o.hmode ? o.root.style.left : o.root.style.right );
|
||||
o.root.onDragStart(x, y);
|
||||
|
||||
o.lastMouseX = e.clientX;
|
||||
o.lastMouseY = e.clientY;
|
||||
|
||||
if (o.hmode) {
|
||||
if (o.minX != null) o.minMouseX = e.clientX - x + o.minX;
|
||||
if (o.maxX != null) o.maxMouseX = o.minMouseX + o.maxX - o.minX;
|
||||
} else {
|
||||
if (o.minX != null) o.maxMouseX = -o.minX + e.clientX + x;
|
||||
if (o.maxX != null) o.minMouseX = -o.maxX + e.clientX + x;
|
||||
}
|
||||
|
||||
if (o.vmode) {
|
||||
if (o.minY != null) o.minMouseY = e.clientY - y + o.minY;
|
||||
if (o.maxY != null) o.maxMouseY = o.minMouseY + o.maxY - o.minY;
|
||||
} else {
|
||||
if (o.minY != null) o.maxMouseY = -o.minY + e.clientY + y;
|
||||
if (o.maxY != null) o.minMouseY = -o.maxY + e.clientY + y;
|
||||
}
|
||||
|
||||
document.onmousemove = Drag.drag;
|
||||
document.onmouseup = Drag.end;
|
||||
|
||||
return false;
|
||||
},
|
||||
|
||||
drag : function(e)
|
||||
{
|
||||
e = Drag.fixE(e);
|
||||
var o = Drag.obj;
|
||||
|
||||
var ey = e.clientY;
|
||||
var ex = e.clientX;
|
||||
var y = parseInt(o.vmode ? o.root.style.top : o.root.style.bottom);
|
||||
var x = parseInt(o.hmode ? o.root.style.left : o.root.style.right );
|
||||
var nx, ny;
|
||||
|
||||
if (o.minX != null) ex = o.hmode ? Math.max(ex, o.minMouseX) : Math.min(ex, o.maxMouseX);
|
||||
if (o.maxX != null) ex = o.hmode ? Math.min(ex, o.maxMouseX) : Math.max(ex, o.minMouseX);
|
||||
if (o.minY != null) ey = o.vmode ? Math.max(ey, o.minMouseY) : Math.min(ey, o.maxMouseY);
|
||||
if (o.maxY != null) ey = o.vmode ? Math.min(ey, o.maxMouseY) : Math.max(ey, o.minMouseY);
|
||||
|
||||
nx = x + ((ex - o.lastMouseX) * (o.hmode ? 1 : -1));
|
||||
ny = y + ((ey - o.lastMouseY) * (o.vmode ? 1 : -1));
|
||||
|
||||
if (o.xMapper) nx = o.xMapper(y)
|
||||
else if (o.yMapper) ny = o.yMapper(x)
|
||||
|
||||
Drag.obj.root.style[o.hmode ? "left" : "right"] = nx + "px";
|
||||
Drag.obj.root.style[o.vmode ? "top" : "bottom"] = ny + "px";
|
||||
Drag.obj.lastMouseX = ex;
|
||||
Drag.obj.lastMouseY = ey;
|
||||
|
||||
Drag.obj.root.onDrag(nx, ny);
|
||||
return false;
|
||||
},
|
||||
|
||||
end : function()
|
||||
{
|
||||
document.onmousemove = null;
|
||||
document.onmouseup = null;
|
||||
Drag.obj.root.onDragEnd( parseInt(Drag.obj.root.style[Drag.obj.hmode ? "left" : "right"]),
|
||||
parseInt(Drag.obj.root.style[Drag.obj.vmode ? "top" : "bottom"]));
|
||||
Drag.obj = null;
|
||||
},
|
||||
|
||||
fixE : function(e)
|
||||
{
|
||||
if (typeof e == 'undefined') e = window.event;
|
||||
if (typeof e.layerX == 'undefined') e.layerX = e.offsetX;
|
||||
if (typeof e.layerY == 'undefined') e.layerY = e.offsetY;
|
||||
return e;
|
||||
}
|
||||
};
|
||||
1657
js/functions.js
1657
js/functions.js
File diff suppressed because it is too large
Load Diff
@@ -1,91 +0,0 @@
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* function used for index manipulation pages
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
* Ensures a value submitted in a form is numeric and is in a range
|
||||
*
|
||||
* @param object the form
|
||||
* @param string the name of the form field to check
|
||||
* @param integer the minimum authorized value
|
||||
* @param integer the maximum authorized value
|
||||
*
|
||||
* @return boolean whether a valid number has been submitted or not
|
||||
*/
|
||||
function checkFormElementInRange(theForm, theFieldName, message, min, max)
|
||||
{
|
||||
var theField = theForm.elements[theFieldName];
|
||||
var val = parseInt(theField.value);
|
||||
|
||||
if (typeof(min) == 'undefined') {
|
||||
min = 0;
|
||||
}
|
||||
if (typeof(max) == 'undefined') {
|
||||
max = Number.MAX_VALUE;
|
||||
}
|
||||
|
||||
// It's not a number
|
||||
if (isNaN(val)) {
|
||||
theField.select();
|
||||
alert(PMA_messages['strNotNumber']);
|
||||
theField.focus();
|
||||
return false;
|
||||
}
|
||||
// It's a number but it is not between min and max
|
||||
else if (val < min || val > max) {
|
||||
theField.select();
|
||||
alert(message.replace('%d', val));
|
||||
theField.focus();
|
||||
return false;
|
||||
}
|
||||
// It's a valid number
|
||||
else {
|
||||
theField.value = val;
|
||||
}
|
||||
|
||||
return true;
|
||||
} // end of the 'checkFormElementInRange()' function
|
||||
|
||||
|
||||
/**
|
||||
* Ensures indexes names are valid according to their type and, for a primary
|
||||
* key, lock index name to 'PRIMARY'
|
||||
*
|
||||
* @return boolean false if there is no index form, true else
|
||||
*/
|
||||
function checkIndexName()
|
||||
{
|
||||
if (typeof(document.forms['index_frm']) == 'undefined') {
|
||||
return false;
|
||||
}
|
||||
|
||||
// Gets the elements pointers
|
||||
var the_idx_name = document.forms['index_frm'].elements['index'];
|
||||
var the_idx_type = document.forms['index_frm'].elements['index_type'];
|
||||
|
||||
// Index is a primary key
|
||||
if (the_idx_type.options[0].value == 'PRIMARY' && the_idx_type.options[0].selected) {
|
||||
document.forms['index_frm'].elements['index'].value = 'PRIMARY';
|
||||
if (typeof(the_idx_name.disabled) != 'undefined') {
|
||||
document.forms['index_frm'].elements['index'].disabled = true;
|
||||
}
|
||||
}
|
||||
|
||||
// Other cases
|
||||
else {
|
||||
if (the_idx_name.value == 'PRIMARY') {
|
||||
document.forms['index_frm'].elements['index'].value = '';
|
||||
}
|
||||
if (typeof(the_idx_name.disabled) != 'undefined') {
|
||||
document.forms['index_frm'].elements['index'].disabled = false;
|
||||
}
|
||||
}
|
||||
|
||||
return true;
|
||||
} // end of the 'checkIndexName()' function
|
||||
|
||||
|
||||
onload = checkIndexName;
|
||||
@@ -1,59 +0,0 @@
|
||||
/**
|
||||
* Allows moving around inputs/select by Ctrl+arrows
|
||||
*
|
||||
* @param object event data
|
||||
*/
|
||||
function onKeyDownArrowsHandler(e) {
|
||||
e = e||window.event;
|
||||
var o = (e.srcElement||e.target);
|
||||
if (!o) return;
|
||||
if (o.tagName != "TEXTAREA" && o.tagName != "INPUT" && o.tagName != "SELECT") return;
|
||||
if (navigator.userAgent.toLowerCase().indexOf('applewebkit/') != -1) {
|
||||
if (e.ctrlKey || e.shiftKey || !e.altKey) return;
|
||||
} else {
|
||||
if (!e.ctrlKey || e.shiftKey || e.altKey) return;
|
||||
}
|
||||
if (!o.id) return;
|
||||
|
||||
var pos = o.id.split("_");
|
||||
if (pos[0] != "field" || typeof pos[2] == "undefined") return;
|
||||
|
||||
var x = pos[2], y=pos[1];
|
||||
|
||||
// skip non existent fields
|
||||
for (i=0; i<10; i++)
|
||||
{
|
||||
if (switch_movement) {
|
||||
switch(e.keyCode) {
|
||||
case 38: x--; break; // up
|
||||
case 40: x++; break; // down
|
||||
case 37: y--; break; // left
|
||||
case 39: y++; break; // right
|
||||
default: return;
|
||||
}
|
||||
} else {
|
||||
switch(e.keyCode) {
|
||||
case 38: y--; break; // up
|
||||
case 40: y++; break; // down
|
||||
case 37: x--; break; // left
|
||||
case 39: x++; break; // right
|
||||
default: return;
|
||||
}
|
||||
}
|
||||
|
||||
var id = "field_" + y + "_" + x;
|
||||
var nO = document.getElementById(id);
|
||||
if (!nO) {
|
||||
var id = "field_" + y + "_" + x + "_0";
|
||||
var nO = document.getElementById(id);
|
||||
}
|
||||
if (nO) break;
|
||||
}
|
||||
|
||||
if (!nO) return;
|
||||
nO.focus();
|
||||
if (nO.tagName != 'SELECT') {
|
||||
nO.select();
|
||||
}
|
||||
e.returnValue = false;
|
||||
}
|
||||
Binary file not shown.
|
Before Width: | Height: | Size: 43 B |
Binary file not shown.
|
Before Width: | Height: | Size: 94 B |
Binary file not shown.
|
Before Width: | Height: | Size: 799 B |
Binary file not shown.
|
Before Width: | Height: | Size: 80 B |
Binary file not shown.
|
Before Width: | Height: | Size: 590 B |
Binary file not shown.
|
Before Width: | Height: | Size: 768 B |
Binary file not shown.
|
Before Width: | Height: | Size: 794 B |
@@ -1,114 +0,0 @@
|
||||
/***
|
||||
* - mooRainbow: defaultCSS
|
||||
* author: w00fz <w00fzIT@gmail.com>
|
||||
*/
|
||||
|
||||
#mooRainbow { font-size: 11px; color: #000; }
|
||||
|
||||
.moor-box {
|
||||
width: 390px;
|
||||
height: 310px;
|
||||
border: 1px solid #636163;
|
||||
background-color: #f9f9f9;
|
||||
}
|
||||
.moor-overlayBox {
|
||||
width: 256px; /* Width and Height of the overlay must be setted here: default 256x256 */
|
||||
height: 256px;
|
||||
margin-top: 9px;
|
||||
margin-left: 9px;
|
||||
border: 1px solid #000;
|
||||
}
|
||||
.moor-slider {
|
||||
border: 1px solid #000;
|
||||
margin-top: 9px;
|
||||
margin-left: 280px;
|
||||
width: 19px; /* if you want a bigger or smaller slider... */
|
||||
height: 256px;
|
||||
}
|
||||
.moor-colorBox {
|
||||
border: 1px solid #000;
|
||||
width: 59px;
|
||||
height: 68px;
|
||||
margin-top: 20px;
|
||||
margin-left: 315px;
|
||||
}
|
||||
.moor-currentColor { /* Bottom Box Color, the backup one */
|
||||
margin-top: 55px;
|
||||
margin-left: 316px;
|
||||
width: 59px;
|
||||
height: 34px;
|
||||
}
|
||||
.moor-okButton {
|
||||
font-family: Tahoma;
|
||||
font-weight: bold;
|
||||
font-size: 11px;
|
||||
margin-top: 278px;
|
||||
margin-left: 8px;
|
||||
background: #e6e6e6;
|
||||
height: 23px;
|
||||
border: 1px solid #d6d6d6;
|
||||
border-left-color: #f5f5f5;
|
||||
border-top-color: #f5f5f5;
|
||||
}
|
||||
#mooRainbow label {
|
||||
font-family: mono;
|
||||
}
|
||||
/* Following are just <label> */
|
||||
.moor-rLabel {
|
||||
margin-top: 100px;
|
||||
margin-left: 315px;
|
||||
}
|
||||
.moor-gLabel {
|
||||
margin-top: 125px;
|
||||
margin-left: 315px;
|
||||
}
|
||||
.moor-bLabel {
|
||||
margin-top: 150px;
|
||||
margin-left: 315px;
|
||||
}
|
||||
.moor-HueLabel {
|
||||
margin-top: 190px;
|
||||
margin-left: 315px;
|
||||
}
|
||||
span.moor-ballino { /* Style hue <20> (degree) !! */
|
||||
margin-top: 190px;
|
||||
margin-left: 370px;
|
||||
}
|
||||
.moor-SatuLabel {
|
||||
margin-top: 215px;
|
||||
margin-left: 315px;
|
||||
}
|
||||
.moor-BrighLabel {
|
||||
margin-top: 240px;
|
||||
margin-left: 315px;
|
||||
}
|
||||
.moor-hexLabel {
|
||||
margin-top: 275px;
|
||||
margin-left: 280px;
|
||||
}
|
||||
|
||||
/* <input> */
|
||||
.moor-rInput, .moor-gInput, .moor-bInput, .moor-HueInput, .moor-SatuInput, .moor-BrighInput {
|
||||
width: 30px;
|
||||
}
|
||||
.moor-hexInput {
|
||||
width: 55px;
|
||||
}
|
||||
.moor-cursor {
|
||||
background-image: url(images/moor_cursor.gif);
|
||||
width: 12px;
|
||||
height: 12px;
|
||||
}
|
||||
.moor-arrows {
|
||||
background-image: url(images/moor_arrows.gif);
|
||||
top: 9px;
|
||||
left: 270px;
|
||||
width: 41px;
|
||||
height: 9px;
|
||||
}
|
||||
.moor-chooseColor { /* Top Box Color, the choosen one */
|
||||
margin-top: 21px;
|
||||
margin-left: 316px;
|
||||
width: 59px;
|
||||
height: 34px;
|
||||
}
|
||||
@@ -1,563 +0,0 @@
|
||||
/***
|
||||
* MooRainbow
|
||||
*
|
||||
* @version 1.2b1
|
||||
* @license MIT-style license
|
||||
* @author Djamil Legato (w00fz) - < w00fzIT [at] gmail.com >
|
||||
* @infos http://moorainbow.woolly-sheep.net
|
||||
* @copyright Author
|
||||
*
|
||||
* includes a fix for mootools 1.2 by Piotr Przybylski
|
||||
*/
|
||||
|
||||
var MooRainbow = new Class({
|
||||
Implements: [Options, Events],
|
||||
options: {
|
||||
id: 'mooRainbow',
|
||||
prefix: 'moor-',
|
||||
imgPath: 'images/',
|
||||
startColor: [255, 0, 0],
|
||||
wheel: false,
|
||||
onComplete: Class.empty,
|
||||
onChange: Class.empty,
|
||||
selectText: 'Select'
|
||||
},
|
||||
|
||||
initialize: function(el, options) {
|
||||
this.element = $(el); if (!this.element) return;
|
||||
this.setOptions(options);
|
||||
|
||||
this.sliderPos = 0;
|
||||
this.pickerPos = {x: 0, y: 0};
|
||||
this.backupColor = this.options.startColor;
|
||||
this.currentColor = this.options.startColor;
|
||||
this.sets = {
|
||||
rgb: [],
|
||||
hsb: [],
|
||||
hex: []
|
||||
};
|
||||
this.pickerClick = this.sliderClick = false;
|
||||
if (!this.layout) this.doLayout();
|
||||
this.OverlayEvents();
|
||||
this.sliderEvents();
|
||||
this.backupEvent();
|
||||
if (this.options.wheel) this.wheelEvents();
|
||||
this.element.addEvent('click', function(e) { this.toggle(e); }.bind(this));
|
||||
|
||||
this.layout.overlay.setStyle('background-color', this.options.startColor.rgbToHex());
|
||||
this.layout.backup.setStyle('background-color', this.backupColor.rgbToHex());
|
||||
|
||||
this.pickerPos.x = this.snippet('curPos').l + this.snippet('curSize', 'int').w;
|
||||
this.pickerPos.y = this.snippet('curPos').t + this.snippet('curSize', 'int').h;
|
||||
|
||||
this.manualSet(this.options.startColor);
|
||||
|
||||
this.pickerPos.x = this.snippet('curPos').l + this.snippet('curSize', 'int').w;
|
||||
this.pickerPos.y = this.snippet('curPos').t + this.snippet('curSize', 'int').h;
|
||||
this.sliderPos = this.snippet('arrPos') - this.snippet('arrSize', 'int');
|
||||
|
||||
if (Browser.Engine.webkit) this.hide();
|
||||
},
|
||||
|
||||
toggle: function() {
|
||||
this[this.visible ? 'hide' : 'show']()
|
||||
},
|
||||
|
||||
show: function() {
|
||||
this.rePosition();
|
||||
this.layout.setStyle('display', 'block');
|
||||
this.visible = true;
|
||||
},
|
||||
|
||||
hide: function() {
|
||||
this.layout.setStyles({'display': 'none'});
|
||||
this.visible = false;
|
||||
},
|
||||
|
||||
manualSet: function(color, type) {
|
||||
if (!type || (type != 'hsb' && type != 'hex')) type = 'rgb';
|
||||
var rgb, hsb, hex;
|
||||
|
||||
if (type == 'rgb') { rgb = color; hsb = color.rgbToHsb(); hex = color.rgbToHex(); }
|
||||
else if (type == 'hsb') { hsb = color; rgb = color.hsbToRgb(); hex = rgb.rgbToHex(); }
|
||||
else { hex = color; rgb = color.hexToRgb(true); hsb = rgb.rgbToHsb(); }
|
||||
|
||||
this.setMooRainbow(rgb);
|
||||
this.autoSet(hsb);
|
||||
},
|
||||
|
||||
autoSet: function(hsb) {
|
||||
var curH = this.snippet('curSize', 'int').h;
|
||||
var curW = this.snippet('curSize', 'int').w;
|
||||
var oveH = this.layout.overlay.height;
|
||||
var oveW = this.layout.overlay.width;
|
||||
var sliH = this.layout.slider.height;
|
||||
var arwH = this.snippet('arrSize', 'int');
|
||||
var hue;
|
||||
|
||||
var posx = Math.round(((oveW * hsb[1]) / 100) - curW);
|
||||
var posy = Math.round(- ((oveH * hsb[2]) / 100) + oveH - curH);
|
||||
|
||||
var c = Math.round(((sliH * hsb[0]) / 360)); c = (c == 360) ? 0 : c;
|
||||
var position = sliH - c + this.snippet('slider') - arwH;
|
||||
hue = [this.sets.hsb[0], 100, 100].hsbToRgb().rgbToHex();
|
||||
|
||||
this.layout.cursor.setStyles({'top': posy, 'left': posx});
|
||||
this.layout.arrows.setStyle('top', position);
|
||||
this.layout.overlay.setStyle('background-color', hue);
|
||||
this.sliderPos = this.snippet('arrPos') - arwH;
|
||||
this.pickerPos.x = this.snippet('curPos').l + curW;
|
||||
this.pickerPos.y = this.snippet('curPos').t + curH;
|
||||
},
|
||||
|
||||
setMooRainbow: function(color, type) {
|
||||
if (!type || (type != 'hsb' && type != 'hex')) type = 'rgb';
|
||||
var rgb, hsb, hex;
|
||||
|
||||
if (type == 'rgb') { rgb = color; hsb = color.rgbToHsb(); hex = color.rgbToHex(); }
|
||||
else if (type == 'hsb') { hsb = color; rgb = color.hsbToRgb(); hex = rgb.rgbToHex(); }
|
||||
else { hex = color; rgb = color.hexToRgb(); hsb = rgb.rgbToHsb(); }
|
||||
|
||||
this.sets = {
|
||||
rgb: rgb,
|
||||
hsb: hsb,
|
||||
hex: hex
|
||||
};
|
||||
|
||||
if (!$chk(this.pickerPos.x))
|
||||
this.autoSet(hsb);
|
||||
|
||||
this.RedInput.value = rgb[0];
|
||||
this.GreenInput.value = rgb[1];
|
||||
this.BlueInput.value = rgb[2];
|
||||
this.HueInput.value = hsb[0];
|
||||
this.SatuInput.value = hsb[1];
|
||||
this.BrighInput.value = hsb[2];
|
||||
this.hexInput.value = hex;
|
||||
|
||||
this.currentColor = rgb;
|
||||
|
||||
this.chooseColor.setStyle('background-color', rgb.rgbToHex());
|
||||
},
|
||||
|
||||
parseColors: function(x, y, z) {
|
||||
var s = Math.round((x * 100) / this.layout.overlay.width);
|
||||
var b = 100 - Math.round((y * 100) / this.layout.overlay.height);
|
||||
var h = 360 - Math.round((z * 360) / this.layout.slider.height) + this.snippet('slider') - this.snippet('arrSize', 'int');
|
||||
h -= this.snippet('arrSize', 'int');
|
||||
h = (h >= 360) ? 0 : (h < 0) ? 0 : h;
|
||||
s = (s > 100) ? 100 : (s < 0) ? 0 : s;
|
||||
b = (b > 100) ? 100 : (b < 0) ? 0 : b;
|
||||
|
||||
return [h, s, b];
|
||||
},
|
||||
|
||||
OverlayEvents: function() {
|
||||
var lim, curH, curW, inputs;
|
||||
curH = this.snippet('curSize', 'int').h;
|
||||
curW = this.snippet('curSize', 'int').w;
|
||||
inputs = $A(this.arrRGB).concat(this.arrHSB, this.hexInput);
|
||||
|
||||
document.addEvent('click', function() {
|
||||
if(this.visible) this.hide(this.layout);
|
||||
}.bind(this));
|
||||
|
||||
inputs.each(function(el) {
|
||||
if(el) {
|
||||
el.addEvent('keydown', this.eventKeydown.bindWithEvent(this, el));
|
||||
el.addEvent('keyup', this.eventKeyup.bindWithEvent(this, el));
|
||||
}
|
||||
}, this);
|
||||
[this.element, this.layout].each(function(el) {
|
||||
el.addEvents({
|
||||
'click': function(e) { new Event(e).stop();},
|
||||
'keyup': function(e) {
|
||||
e = new Event(e);
|
||||
if(e.key == 'esc' && this.visible) this.hide(this.layout);
|
||||
}.bind(this)
|
||||
}, this);
|
||||
}, this);
|
||||
|
||||
lim = {
|
||||
x: [0 - curW, (this.layout.overlay.width - curW)],
|
||||
y: [0 - curH, (this.layout.overlay.height - curH)]
|
||||
};
|
||||
|
||||
this.layout.drag = new Drag(this.layout.cursor, {
|
||||
limit: lim,
|
||||
onStart: this.overlayDrag.bind(this),
|
||||
onDrag: this.overlayDrag.bind(this),
|
||||
snap: 0
|
||||
});
|
||||
|
||||
this.layout.overlay2.addEvent('mousedown', function(e){
|
||||
e = new Event(e);
|
||||
this.layout.cursor.setStyles({
|
||||
'top': e.page.y - this.layout.overlay.getPosition().y - curH,
|
||||
'left': e.page.x - this.layout.overlay.getPosition().x - curW
|
||||
});
|
||||
this.overlayDrag();
|
||||
this.layout.drag.start(e);
|
||||
}.bind(this));
|
||||
|
||||
this.okButton.addEvent('click', function() {
|
||||
if(this.currentColor == this.options.startColor) {
|
||||
this.hide();
|
||||
this.fireEvent('onComplete', [this.sets, this]);
|
||||
}
|
||||
else {
|
||||
this.backupColor = this.currentColor;
|
||||
this.layout.backup.setStyle('background-color', this.backupColor.rgbToHex());
|
||||
this.hide();
|
||||
this.fireEvent('onComplete', [this.sets, this]);
|
||||
}
|
||||
}.bind(this));
|
||||
},
|
||||
|
||||
overlayDrag: function() {
|
||||
var curH = this.snippet('curSize', 'int').h;
|
||||
var curW = this.snippet('curSize', 'int').w;
|
||||
this.pickerPos.x = this.snippet('curPos').l + curW;
|
||||
this.pickerPos.y = this.snippet('curPos').t + curH;
|
||||
|
||||
this.setMooRainbow(this.parseColors(this.pickerPos.x, this.pickerPos.y, this.sliderPos), 'hsb');
|
||||
this.fireEvent('onChange', [this.sets, this]);
|
||||
},
|
||||
|
||||
sliderEvents: function() {
|
||||
var arwH = this.snippet('arrSize', 'int'), lim;
|
||||
|
||||
lim = [0 + this.snippet('slider') - arwH, this.layout.slider.height - arwH + this.snippet('slider')];
|
||||
this.layout.sliderDrag = new Drag(this.layout.arrows, {
|
||||
limit: {y: lim},
|
||||
modifiers: {x: false},
|
||||
onStart: this.sliderDrag.bind(this),
|
||||
onDrag: this.sliderDrag.bind(this),
|
||||
snap: 0
|
||||
});
|
||||
|
||||
this.layout.slider.addEvent('mousedown', function(e){
|
||||
e = new Event(e);
|
||||
|
||||
this.layout.arrows.setStyle(
|
||||
'top', e.page.y - this.layout.slider.getPosition().y + this.snippet('slider') - arwH
|
||||
);
|
||||
this.sliderDrag();
|
||||
this.layout.sliderDrag.start(e);
|
||||
}.bind(this));
|
||||
},
|
||||
|
||||
sliderDrag: function() {
|
||||
var arwH = this.snippet('arrSize', 'int'), hue;
|
||||
|
||||
this.sliderPos = this.snippet('arrPos') - arwH;
|
||||
this.setMooRainbow(this.parseColors(this.pickerPos.x, this.pickerPos.y, this.sliderPos), 'hsb');
|
||||
hue = [this.sets.hsb[0], 100, 100].hsbToRgb().rgbToHex();
|
||||
this.layout.overlay.setStyle('background-color', hue);
|
||||
this.fireEvent('onChange', [this.sets, this]);
|
||||
},
|
||||
|
||||
backupEvent: function() {
|
||||
this.layout.backup.addEvent('click', function() {
|
||||
this.manualSet(this.backupColor);
|
||||
this.fireEvent('onChange', [this.sets, this]);
|
||||
}.bind(this));
|
||||
},
|
||||
|
||||
wheelEvents: function() {
|
||||
var arrColors = $A(this.arrRGB).extend(this.arrHSB);
|
||||
|
||||
arrColors.each(function(el) {
|
||||
el.addEvents({
|
||||
'mousewheel': this.eventKeys.bindWithEvent(this, el),
|
||||
'keydown': this.eventKeys.bindWithEvent(this, el)
|
||||
});
|
||||
}, this);
|
||||
|
||||
[this.layout.arrows, this.layout.slider].each(function(el) {
|
||||
el.addEvents({
|
||||
'mousewheel': this.eventKeys.bindWithEvent(this, [this.arrHSB[0], 'slider']),
|
||||
'keydown': this.eventKeys.bindWithEvent(this, [this.arrHSB[0], 'slider'])
|
||||
});
|
||||
}, this);
|
||||
},
|
||||
|
||||
eventKeys: function(e, el, id) {
|
||||
var wheel, type;
|
||||
id = (!id) ? el.id : this.arrHSB[0];
|
||||
|
||||
if (e.type == 'keydown') {
|
||||
if (e.key == 'up') wheel = 1;
|
||||
else if (e.key == 'down') wheel = -1;
|
||||
else return;
|
||||
} else if (e.type == Element.Events.mousewheel.base) wheel = (e.wheel > 0) ? 1 : -1;
|
||||
|
||||
if (this.arrRGB.contains(el)) type = 'rgb';
|
||||
else if (this.arrHSB.contains(el)) type = 'hsb';
|
||||
else type = 'hsb';
|
||||
|
||||
if (type == 'rgb') {
|
||||
var rgb = this.sets.rgb, hsb = this.sets.hsb, prefix = this.options.prefix, pass;
|
||||
var value = (el.value.toInt() || 0) + wheel;
|
||||
value = (value > 255) ? 255 : (value < 0) ? 0 : value;
|
||||
|
||||
switch(el.className) {
|
||||
case prefix + 'rInput': pass = [value, rgb[1], rgb[2]]; break;
|
||||
case prefix + 'gInput': pass = [rgb[0], value, rgb[2]]; break;
|
||||
case prefix + 'bInput': pass = [rgb[0], rgb[1], value]; break;
|
||||
default : pass = rgb;
|
||||
}
|
||||
this.manualSet(pass);
|
||||
this.fireEvent('onChange', [this.sets, this]);
|
||||
} else {
|
||||
var rgb = this.sets.rgb, hsb = this.sets.hsb, prefix = this.options.prefix, pass;
|
||||
var value = (el.value.toInt() || 0) + wheel;
|
||||
|
||||
if (el.className.test(/(HueInput)/)) value = (value > 359) ? 0 : (value < 0) ? 0 : value;
|
||||
else value = (value > 100) ? 100 : (value < 0) ? 0 : value;
|
||||
|
||||
switch(el.className) {
|
||||
case prefix + 'HueInput': pass = [value, hsb[1], hsb[2]]; break;
|
||||
case prefix + 'SatuInput': pass = [hsb[0], value, hsb[2]]; break;
|
||||
case prefix + 'BrighInput': pass = [hsb[0], hsb[1], value]; break;
|
||||
default : pass = hsb;
|
||||
}
|
||||
|
||||
this.manualSet(pass, 'hsb');
|
||||
this.fireEvent('onChange', [this.sets, this]);
|
||||
}
|
||||
e.stop();
|
||||
},
|
||||
|
||||
eventKeydown: function(e, el) {
|
||||
var n = e.code, k = e.key;
|
||||
|
||||
if ((!el.className.test(/hexInput/) && !(n >= 48 && n <= 57)) &&
|
||||
(k!='backspace' && k!='tab' && k !='delete' && k!='left' && k!='right'))
|
||||
e.stop();
|
||||
},
|
||||
|
||||
eventKeyup: function(e, el) {
|
||||
var n = e.code, k = e.key, pass, prefix, chr = el.value.charAt(0);
|
||||
|
||||
if (!$chk(el.value)) return;
|
||||
if (el.className.test(/hexInput/)) {
|
||||
if (chr != "#" && el.value.length != 6) return;
|
||||
if (chr == '#' && el.value.length != 7) return;
|
||||
} else {
|
||||
if (!(n >= 48 && n <= 57) && (!['backspace', 'tab', 'delete', 'left', 'right'].contains(k)) && el.value.length > 3) return;
|
||||
}
|
||||
|
||||
prefix = this.options.prefix;
|
||||
|
||||
if (el.className.test(/(rInput|gInput|bInput)/)) {
|
||||
if (el.value < 0 || el.value > 255) return;
|
||||
switch(el.className){
|
||||
case prefix + 'rInput': pass = [el.value, this.sets.rgb[1], this.sets.rgb[2]]; break;
|
||||
case prefix + 'gInput': pass = [this.sets.rgb[0], el.value, this.sets.rgb[2]]; break;
|
||||
case prefix + 'bInput': pass = [this.sets.rgb[0], this.sets.rgb[1], el.value]; break;
|
||||
default : pass = this.sets.rgb;
|
||||
}
|
||||
this.manualSet(pass);
|
||||
this.fireEvent('onChange', [this.sets, this]);
|
||||
}
|
||||
else if (!el.className.test(/hexInput/)) {
|
||||
if (el.className.test(/HueInput/) && el.value < 0 || el.value > 360) return;
|
||||
else if (el.className.test(/HueInput/) && el.value == 360) el.value = 0;
|
||||
else if (el.className.test(/(SatuInput|BrighInput)/) && el.value < 0 || el.value > 100) return;
|
||||
switch(el.className){
|
||||
case prefix + 'HueInput': pass = [el.value, this.sets.hsb[1], this.sets.hsb[2]]; break;
|
||||
case prefix + 'SatuInput': pass = [this.sets.hsb[0], el.value, this.sets.hsb[2]]; break;
|
||||
case prefix + 'BrighInput': pass = [this.sets.hsb[0], this.sets.hsb[1], el.value]; break;
|
||||
default : pass = this.sets.hsb;
|
||||
}
|
||||
this.manualSet(pass, 'hsb');
|
||||
this.fireEvent('onChange', [this.sets, this]);
|
||||
} else {
|
||||
pass = el.value.hexToRgb(true);
|
||||
if (isNaN(pass[0])||isNaN(pass[1])||isNaN(pass[2])) return;
|
||||
|
||||
if ($chk(pass)) {
|
||||
this.manualSet(pass);
|
||||
this.fireEvent('onChange', [this.sets, this]);
|
||||
}
|
||||
}
|
||||
|
||||
},
|
||||
|
||||
doLayout: function() {
|
||||
var id = this.options.id, prefix = this.options.prefix;
|
||||
var idPrefix = id + ' .' + prefix;
|
||||
|
||||
this.layout = new Element('div', {
|
||||
'styles': {'display': 'block', 'position': 'absolute'},
|
||||
'id': id
|
||||
}).inject(document.body);
|
||||
|
||||
var box = new Element('div', {
|
||||
'styles': {'position': 'relative'},
|
||||
'class': prefix + 'box'
|
||||
}).inject(this.layout);
|
||||
|
||||
var div = new Element('div', {
|
||||
'styles': {'position': 'absolute', 'overflow': 'hidden'},
|
||||
'class': prefix + 'overlayBox'
|
||||
}).inject(box);
|
||||
|
||||
var ar = new Element('div', {
|
||||
'styles': {'position': 'absolute', 'zIndex': 1},
|
||||
'class': prefix + 'arrows'
|
||||
}).inject(box);
|
||||
ar.width = ar.getStyle('width').toInt();
|
||||
ar.height = ar.getStyle('height').toInt();
|
||||
|
||||
var ov = new Element('img', {
|
||||
'styles': {'background-color': '#fff', 'position': 'relative', 'zIndex': 2},
|
||||
'src': this.options.imgPath + 'moor_woverlay.png',
|
||||
'class': prefix + 'overlay'
|
||||
}).inject(div);
|
||||
|
||||
var ov2 = new Element('img', {
|
||||
'styles': {'position': 'absolute', 'top': 0, 'left': 0, 'zIndex': 2},
|
||||
'src': this.options.imgPath + 'moor_boverlay.png',
|
||||
'class': prefix + 'overlay'
|
||||
}).inject(div);
|
||||
|
||||
if (Browser.Engine.trident4) {
|
||||
div.setStyle('overflow', '');
|
||||
var src = ov.src;
|
||||
ov.src = this.options.imgPath + 'blank.gif';
|
||||
ov.style.filter = "progid:DXImageTransform.Microsoft.AlphaImageLoader(src='" + src + "', sizingMethod='scale')";
|
||||
src = ov2.src;
|
||||
ov2.src = this.options.imgPath + 'blank.gif';
|
||||
ov2.style.filter = "progid:DXImageTransform.Microsoft.AlphaImageLoader(src='" + src + "', sizingMethod='scale')";
|
||||
}
|
||||
ov.width = ov2.width = div.getStyle('width').toInt();
|
||||
ov.height = ov2.height = div.getStyle('height').toInt();
|
||||
|
||||
var cr = new Element('div', {
|
||||
'styles': {'overflow': 'hidden', 'position': 'absolute', 'zIndex': 2},
|
||||
'class': prefix + 'cursor'
|
||||
}).inject(div);
|
||||
cr.width = cr.getStyle('width').toInt();
|
||||
cr.height = cr.getStyle('height').toInt();
|
||||
|
||||
var sl = new Element('img', {
|
||||
'styles': {'position': 'absolute', 'z-index': 2},
|
||||
'src': this.options.imgPath + 'moor_slider.png',
|
||||
'class': prefix + 'slider'
|
||||
}).inject(box);
|
||||
this.layout.slider = sl;
|
||||
sl.width = sl.getStyle('width').toInt();
|
||||
sl.height = sl.getStyle('height').toInt();
|
||||
|
||||
new Element('div', {
|
||||
'styles': {'position': 'absolute'},
|
||||
'class': prefix + 'colorBox'
|
||||
}).inject(box);
|
||||
|
||||
new Element('div', {
|
||||
'styles': {'zIndex': 2, 'position': 'absolute'},
|
||||
'class': prefix + 'chooseColor'
|
||||
}).inject(box);
|
||||
|
||||
this.layout.backup = new Element('div', {
|
||||
'styles': {'zIndex': 2, 'position': 'absolute', 'cursor': 'pointer'},
|
||||
'class': prefix + 'currentColor'
|
||||
}).inject(box);
|
||||
|
||||
var R = new Element('label').inject(box).setStyle('position', 'absolute');
|
||||
var G = R.clone().inject(box).addClass(prefix + 'gLabel').set('html', 'G: ');
|
||||
var B = R.clone().inject(box).addClass(prefix + 'bLabel').set('html', 'B: ');
|
||||
R.set('html', 'R: ').addClass(prefix + 'rLabel');
|
||||
|
||||
var inputR = new Element('input');
|
||||
var inputG = inputR.clone().inject(G).addClass(prefix + 'gInput');
|
||||
var inputB = inputR.clone().inject(B).addClass(prefix + 'bInput');
|
||||
inputR.inject(R).addClass(prefix + 'rInput');
|
||||
|
||||
var HU = new Element('label').inject(box).setStyle('position', 'absolute');
|
||||
var SA = HU.clone().inject(box).addClass(prefix + 'SatuLabel').set('html', 'S: ');
|
||||
var BR = HU.clone().inject(box).addClass(prefix + 'BrighLabel').set('html', 'B: ');
|
||||
HU.set('html', 'H: ').addClass(prefix + 'HueLabel');
|
||||
|
||||
var inputHU = new Element('input');
|
||||
var inputSA = inputHU.clone().inject(SA).addClass(prefix + 'SatuInput');
|
||||
var inputBR = inputHU.clone().inject(BR).addClass(prefix + 'BrighInput');
|
||||
inputHU.inject(HU).addClass(prefix + 'HueInput');
|
||||
SA.innerHTML += " %"; BR.innerHTML += " %";
|
||||
SP = new Element('span', {'styles': {'position': 'absolute'}, 'class': prefix + 'ballino'})
|
||||
SP.innerHTML = " °"
|
||||
SP.inject(HU,'after');
|
||||
|
||||
var hex = new Element('label').inject(box).setStyle('position', 'absolute').addClass(prefix + 'hexLabel').set('html', '#hex: ').adopt(new Element('input').addClass(prefix + 'hexInput'));
|
||||
|
||||
var ok = new Element('input', {
|
||||
'styles': {'position': 'absolute'},
|
||||
'type': 'button',
|
||||
'value': this.options.selectText,
|
||||
'class': prefix + 'okButton'
|
||||
}).inject(box);
|
||||
|
||||
this.rePosition();
|
||||
|
||||
var overlays = $$('#' + id + ' .' + prefix + 'overlay');
|
||||
this.layout.overlay = overlays[0];
|
||||
this.layout.overlay2 = overlays[1];
|
||||
this.layout.cursor = cr;
|
||||
this.layout.arrows = ar;
|
||||
this.chooseColor = this.layout.getElement('.' + prefix + 'chooseColor');
|
||||
this.RedInput = inputR;
|
||||
this.GreenInput = inputG;
|
||||
this.BlueInput = inputB;
|
||||
this.HueInput = inputHU;
|
||||
this.SatuInput = this.layout.getElement('.' + prefix + 'SatuInput');
|
||||
this.BrighInput = this.layout.getElement('.' + prefix + 'BrighInput');
|
||||
this.hexInput = this.layout.getElement('.' + prefix + 'hexInput');;
|
||||
|
||||
this.arrRGB = [this.RedInput, this.GreenInput, this.BlueInput];
|
||||
this.arrHSB = [this.HueInput, this.SatuInput, this.BrighInput];
|
||||
this.okButton = ok;
|
||||
|
||||
if (!Browser.Engine.webkit419) this.hide();
|
||||
},
|
||||
rePosition: function() {
|
||||
var coords = this.element.getCoordinates();
|
||||
this.layout.setStyles({
|
||||
'left': coords.left,
|
||||
'top': coords.top + coords.height + 1
|
||||
});
|
||||
},
|
||||
|
||||
snippet: function(mode, type) {
|
||||
var size; type = (type) ? type : 'none';
|
||||
|
||||
switch(mode) {
|
||||
case 'arrPos':
|
||||
var t = this.layout.arrows.getStyle('top').toInt();
|
||||
size = t;
|
||||
break;
|
||||
case 'arrSize':
|
||||
var h = this.layout.arrows.height;
|
||||
h = (type == 'int') ? (h/2).toInt() : h;
|
||||
size = h;
|
||||
break;
|
||||
case 'curPos':
|
||||
var l = this.layout.cursor.getStyle('left').toInt();
|
||||
var t = this.layout.cursor.getStyle('top').toInt();
|
||||
size = {'l': l, 't': t};
|
||||
break;
|
||||
case 'slider':
|
||||
var t = this.layout.slider.getStyle('marginTop').toInt();
|
||||
size = t;
|
||||
break;
|
||||
default :
|
||||
var h = this.layout.cursor.height;
|
||||
var w = this.layout.cursor.width;
|
||||
h = (type == 'int') ? (h/2).toInt() : h;
|
||||
w = (type == 'int') ? (w/2).toInt() : w;
|
||||
size = {w: w, h: h};
|
||||
};
|
||||
return size;
|
||||
}
|
||||
});
|
||||
@@ -1,16 +0,0 @@
|
||||
window.addEvent('domready', function() {
|
||||
var r = new MooRainbow('myRainbow', {
|
||||
'startColor': [58, 142, 246],
|
||||
'imgPath': 'js/mooRainbow/images/',
|
||||
'onChange': function(color) {
|
||||
top.frame_navigation.document.getElementById('body_leftFrame').style.backgroundColor = color.hex;
|
||||
top.frame_navigation.document.getElementById('pmalogo').style.backgroundColor = color.hex;
|
||||
top.frame_content.document.body.style.backgroundColor = color.hex;
|
||||
},
|
||||
'onComplete': function(color) {
|
||||
top.frame_content.document.getElementById('rainbowform').custom_color.value = color.hex;
|
||||
top.frame_content.document.getElementById('rainbowform').custom_color_rgb.value = color.rgb;
|
||||
top.frame_content.document.getElementById('rainbowform').submit();
|
||||
}
|
||||
});
|
||||
});
|
||||
496
js/mootools.js
496
js/mootools.js
@@ -1,496 +0,0 @@
|
||||
//MooTools, <http://mootools.net>, My Object Oriented (JavaScript) Tools. Copyright (c) 2006-2008 Valerio Proietti, <http://mad4milk.net>, MIT Style License.
|
||||
|
||||
var MooTools={version:"1.2.0",build:""};var Native=function(J){J=J||{};var F=J.afterImplement||function(){};var G=J.generics;G=(G!==false);var H=J.legacy;
|
||||
var E=J.initialize;var B=J.protect;var A=J.name;var C=E||H;C.constructor=Native;C.$family={name:"native"};if(H&&E){C.prototype=H.prototype;}C.prototype.constructor=C;
|
||||
if(A){var D=A.toLowerCase();C.prototype.$family={name:D};Native.typize(C,D);}var I=function(M,K,N,L){if(!B||L||!M.prototype[K]){M.prototype[K]=N;}if(G){Native.genericize(M,K,B);
|
||||
}F.call(M,K,N);return M;};C.implement=function(L,K,N){if(typeof L=="string"){return I(this,L,K,N);}for(var M in L){I(this,M,L[M],K);}return this;};C.alias=function(M,K,N){if(typeof M=="string"){M=this.prototype[M];
|
||||
if(M){I(this,K,M,N);}}else{for(var L in M){this.alias(L,M[L],K);}}return this;};return C;};Native.implement=function(D,C){for(var B=0,A=D.length;B<A;B++){D[B].implement(C);
|
||||
}};Native.genericize=function(B,C,A){if((!A||!B[C])&&typeof B.prototype[C]=="function"){B[C]=function(){var D=Array.prototype.slice.call(arguments);return B.prototype[C].apply(D.shift(),D);
|
||||
};}};Native.typize=function(A,B){if(!A.type){A.type=function(C){return($type(C)===B);};}};Native.alias=function(E,B,A,F){for(var D=0,C=E.length;D<C;D++){E[D].alias(B,A,F);
|
||||
}};(function(B){for(var A in B){Native.typize(B[A],A);}})({"boolean":Boolean,"native":Native,object:Object});(function(B){for(var A in B){new Native({name:A,initialize:B[A],protect:true});
|
||||
}})({String:String,Function:Function,Number:Number,Array:Array,RegExp:RegExp,Date:Date});(function(B,A){for(var C=A.length;C--;C){Native.genericize(B,A[C],true);
|
||||
}return arguments.callee;})(Array,["pop","push","reverse","shift","sort","splice","unshift","concat","join","slice","toString","valueOf","indexOf","lastIndexOf"])(String,["charAt","charCodeAt","concat","indexOf","lastIndexOf","match","replace","search","slice","split","substr","substring","toLowerCase","toUpperCase","valueOf"]);
|
||||
function $chk(A){return !!(A||A===0);}function $clear(A){clearTimeout(A);clearInterval(A);return null;}function $defined(A){return(A!=undefined);}function $empty(){}function $arguments(A){return function(){return arguments[A];
|
||||
};}function $lambda(A){return(typeof A=="function")?A:function(){return A;};}function $extend(C,A){for(var B in (A||{})){C[B]=A[B];}return C;}function $unlink(C){var B;
|
||||
switch($type(C)){case"object":B={};for(var E in C){B[E]=$unlink(C[E]);}break;case"hash":B=$unlink(C.getClean());break;case"array":B=[];for(var D=0,A=C.length;
|
||||
D<A;D++){B[D]=$unlink(C[D]);}break;default:return C;}return B;}function $merge(){var E={};for(var D=0,A=arguments.length;D<A;D++){var B=arguments[D];if($type(B)!="object"){continue;
|
||||
}for(var C in B){var G=B[C],F=E[C];E[C]=(F&&$type(G)=="object"&&$type(F)=="object")?$merge(F,G):$unlink(G);}}return E;}function $pick(){for(var B=0,A=arguments.length;
|
||||
B<A;B++){if(arguments[B]!=undefined){return arguments[B];}}return null;}function $random(B,A){return Math.floor(Math.random()*(A-B+1)+B);}function $splat(B){var A=$type(B);
|
||||
return(A)?((A!="array"&&A!="arguments")?[B]:B):[];}var $time=Date.now||function(){return new Date().getTime();};function $try(){for(var B=0,A=arguments.length;
|
||||
B<A;B++){try{return arguments[B]();}catch(C){}}return null;}function $type(A){if(A==undefined){return false;}if(A.$family){return(A.$family.name=="number"&&!isFinite(A))?false:A.$family.name;
|
||||
}if(A.nodeName){switch(A.nodeType){case 1:return"element";case 3:return(/\S/).test(A.nodeValue)?"textnode":"whitespace";}}else{if(typeof A.length=="number"){if(A.callee){return"arguments";
|
||||
}else{if(A.item){return"collection";}}}}return typeof A;}var Hash=new Native({name:"Hash",initialize:function(A){if($type(A)=="hash"){A=$unlink(A.getClean());
|
||||
}for(var B in A){this[B]=A[B];}return this;}});Hash.implement({getLength:function(){var B=0;for(var A in this){if(this.hasOwnProperty(A)){B++;}}return B;
|
||||
},forEach:function(B,C){for(var A in this){if(this.hasOwnProperty(A)){B.call(C,this[A],A,this);}}},getClean:function(){var B={};for(var A in this){if(this.hasOwnProperty(A)){B[A]=this[A];
|
||||
}}return B;}});Hash.alias("forEach","each");function $H(A){return new Hash(A);}Array.implement({forEach:function(C,D){for(var B=0,A=this.length;B<A;B++){C.call(D,this[B],B,this);
|
||||
}}});Array.alias("forEach","each");function $A(C){if(C.item){var D=[];for(var B=0,A=C.length;B<A;B++){D[B]=C[B];}return D;}return Array.prototype.slice.call(C);
|
||||
}function $each(C,B,D){var A=$type(C);((A=="arguments"||A=="collection"||A=="array")?Array:Hash).each(C,B,D);}var Browser=new Hash({Engine:{name:"unknown",version:""},Platform:{name:(navigator.platform.match(/mac|win|linux/i)||["other"])[0].toLowerCase()},Features:{xpath:!!(document.evaluate),air:!!(window.runtime)},Plugins:{}});
|
||||
if(window.opera){Browser.Engine={name:"presto",version:(document.getElementsByClassName)?950:925};}else{if(window.ActiveXObject){Browser.Engine={name:"trident",version:(window.XMLHttpRequest)?5:4};
|
||||
}else{if(!navigator.taintEnabled){Browser.Engine={name:"webkit",version:(Browser.Features.xpath)?420:419};}else{if(document.getBoxObjectFor!=null){Browser.Engine={name:"gecko",version:(document.getElementsByClassName)?19:18};
|
||||
}}}}Browser.Engine[Browser.Engine.name]=Browser.Engine[Browser.Engine.name+Browser.Engine.version]=true;if(window.orientation!=undefined){Browser.Platform.name="ipod";
|
||||
}Browser.Platform[Browser.Platform.name]=true;Browser.Request=function(){return $try(function(){return new XMLHttpRequest();},function(){return new ActiveXObject("MSXML2.XMLHTTP");
|
||||
});};Browser.Features.xhr=!!(Browser.Request());Browser.Plugins.Flash=(function(){var A=($try(function(){return navigator.plugins["Shockwave Flash"].description;
|
||||
},function(){return new ActiveXObject("ShockwaveFlash.ShockwaveFlash").GetVariable("$version");})||"0 r0").match(/\d+/g);return{version:parseInt(A[0]||0+"."+A[1]||0),build:parseInt(A[2]||0)};
|
||||
})();function $exec(B){if(!B){return B;}if(window.execScript){window.execScript(B);}else{var A=document.createElement("script");A.setAttribute("type","text/javascript");
|
||||
A.text=B;document.head.appendChild(A);document.head.removeChild(A);}return B;}Native.UID=1;var $uid=(Browser.Engine.trident)?function(A){return(A.uid||(A.uid=[Native.UID++]))[0];
|
||||
}:function(A){return A.uid||(A.uid=Native.UID++);};var Window=new Native({name:"Window",legacy:(Browser.Engine.trident)?null:window.Window,initialize:function(A){$uid(A);
|
||||
if(!A.Element){A.Element=$empty;if(Browser.Engine.webkit){A.document.createElement("iframe");}A.Element.prototype=(Browser.Engine.webkit)?window["[[DOMElement.prototype]]"]:{};
|
||||
}return $extend(A,Window.Prototype);},afterImplement:function(B,A){window[B]=Window.Prototype[B]=A;}});Window.Prototype={$family:{name:"window"}};new Window(window);
|
||||
var Document=new Native({name:"Document",legacy:(Browser.Engine.trident)?null:window.Document,initialize:function(A){$uid(A);A.head=A.getElementsByTagName("head")[0];
|
||||
A.html=A.getElementsByTagName("html")[0];A.window=A.defaultView||A.parentWindow;if(Browser.Engine.trident4){$try(function(){A.execCommand("BackgroundImageCache",false,true);
|
||||
});}return $extend(A,Document.Prototype);},afterImplement:function(B,A){document[B]=Document.Prototype[B]=A;}});Document.Prototype={$family:{name:"document"}};
|
||||
new Document(document);Array.implement({every:function(C,D){for(var B=0,A=this.length;B<A;B++){if(!C.call(D,this[B],B,this)){return false;}}return true;
|
||||
},filter:function(D,E){var C=[];for(var B=0,A=this.length;B<A;B++){if(D.call(E,this[B],B,this)){C.push(this[B]);}}return C;},clean:function(){return this.filter($defined);
|
||||
},indexOf:function(C,D){var A=this.length;for(var B=(D<0)?Math.max(0,A+D):D||0;B<A;B++){if(this[B]===C){return B;}}return -1;},map:function(D,E){var C=[];
|
||||
for(var B=0,A=this.length;B<A;B++){C[B]=D.call(E,this[B],B,this);}return C;},some:function(C,D){for(var B=0,A=this.length;B<A;B++){if(C.call(D,this[B],B,this)){return true;
|
||||
}}return false;},associate:function(C){var D={},B=Math.min(this.length,C.length);for(var A=0;A<B;A++){D[C[A]]=this[A];}return D;},link:function(C){var A={};
|
||||
for(var E=0,B=this.length;E<B;E++){for(var D in C){if(C[D](this[E])){A[D]=this[E];delete C[D];break;}}}return A;},contains:function(A,B){return this.indexOf(A,B)!=-1;
|
||||
},extend:function(C){for(var B=0,A=C.length;B<A;B++){this.push(C[B]);}return this;},getLast:function(){return(this.length)?this[this.length-1]:null;},getRandom:function(){return(this.length)?this[$random(0,this.length-1)]:null;
|
||||
},include:function(A){if(!this.contains(A)){this.push(A);}return this;},combine:function(C){for(var B=0,A=C.length;B<A;B++){this.include(C[B]);}return this;
|
||||
},erase:function(B){for(var A=this.length;A--;A){if(this[A]===B){this.splice(A,1);}}return this;},empty:function(){this.length=0;return this;},flatten:function(){var D=[];
|
||||
for(var B=0,A=this.length;B<A;B++){var C=$type(this[B]);if(!C){continue;}D=D.concat((C=="array"||C=="collection"||C=="arguments")?Array.flatten(this[B]):this[B]);
|
||||
}return D;},hexToRgb:function(B){if(this.length!=3){return null;}var A=this.map(function(C){if(C.length==1){C+=C;}return C.toInt(16);});return(B)?A:"rgb("+A+")";
|
||||
},rgbToHex:function(D){if(this.length<3){return null;}if(this.length==4&&this[3]==0&&!D){return"transparent";}var B=[];for(var A=0;A<3;A++){var C=(this[A]-0).toString(16);
|
||||
B.push((C.length==1)?"0"+C:C);}return(D)?B:"#"+B.join("");}});Function.implement({extend:function(A){for(var B in A){this[B]=A[B];}return this;},create:function(B){var A=this;
|
||||
B=B||{};return function(D){var C=B.arguments;C=(C!=undefined)?$splat(C):Array.slice(arguments,(B.event)?1:0);if(B.event){C=[D||window.event].extend(C);
|
||||
}var E=function(){return A.apply(B.bind||null,C);};if(B.delay){return setTimeout(E,B.delay);}if(B.periodical){return setInterval(E,B.periodical);}if(B.attempt){return $try(E);
|
||||
}return E();};},pass:function(A,B){return this.create({arguments:A,bind:B});},attempt:function(A,B){return this.create({arguments:A,bind:B,attempt:true})();
|
||||
},bind:function(B,A){return this.create({bind:B,arguments:A});},bindWithEvent:function(B,A){return this.create({bind:B,event:true,arguments:A});},delay:function(B,C,A){return this.create({delay:B,bind:C,arguments:A})();
|
||||
},periodical:function(A,C,B){return this.create({periodical:A,bind:C,arguments:B})();},run:function(A,B){return this.apply(B,$splat(A));}});Number.implement({limit:function(B,A){return Math.min(A,Math.max(B,this));
|
||||
},round:function(A){A=Math.pow(10,A||0);return Math.round(this*A)/A;},times:function(B,C){for(var A=0;A<this;A++){B.call(C,A,this);}},toFloat:function(){return parseFloat(this);
|
||||
},toInt:function(A){return parseInt(this,A||10);}});Number.alias("times","each");(function(B){var A={};B.each(function(C){if(!Number[C]){A[C]=function(){return Math[C].apply(null,[this].concat($A(arguments)));
|
||||
};}});Number.implement(A);})(["abs","acos","asin","atan","atan2","ceil","cos","exp","floor","log","max","min","pow","sin","sqrt","tan"]);String.implement({test:function(A,B){return((typeof A=="string")?new RegExp(A,B):A).test(this);
|
||||
},contains:function(A,B){return(B)?(B+this+B).indexOf(B+A+B)>-1:this.indexOf(A)>-1;},trim:function(){return this.replace(/^\s+|\s+$/g,"");},clean:function(){return this.replace(/\s+/g," ").trim();
|
||||
},camelCase:function(){return this.replace(/-\D/g,function(A){return A.charAt(1).toUpperCase();});},hyphenate:function(){return this.replace(/[A-Z]/g,function(A){return("-"+A.charAt(0).toLowerCase());
|
||||
});},capitalize:function(){return this.replace(/\b[a-z]/g,function(A){return A.toUpperCase();});},escapeRegExp:function(){return this.replace(/([-.*+?^${}()|[\]\/\\])/g,"\\$1");
|
||||
},toInt:function(A){return parseInt(this,A||10);},toFloat:function(){return parseFloat(this);},hexToRgb:function(B){var A=this.match(/^#?(\w{1,2})(\w{1,2})(\w{1,2})$/);
|
||||
return(A)?A.slice(1).hexToRgb(B):null;},rgbToHex:function(B){var A=this.match(/\d{1,3}/g);return(A)?A.rgbToHex(B):null;},stripScripts:function(B){var A="";
|
||||
var C=this.replace(/<script[^>]*>([\s\S]*?)<\/script>/gi,function(){A+=arguments[1]+"\n";return"";});if(B===true){$exec(A);}else{if($type(B)=="function"){B(A,C);
|
||||
}}return C;},substitute:function(A,B){return this.replace(B||(/\\?\{([^}]+)\}/g),function(D,C){if(D.charAt(0)=="\\"){return D.slice(1);}return(A[C]!=undefined)?A[C]:"";
|
||||
});}});Hash.implement({has:Object.prototype.hasOwnProperty,keyOf:function(B){for(var A in this){if(this.hasOwnProperty(A)&&this[A]===B){return A;}}return null;
|
||||
},hasValue:function(A){return(Hash.keyOf(this,A)!==null);},extend:function(A){Hash.each(A,function(C,B){Hash.set(this,B,C);},this);return this;},combine:function(A){Hash.each(A,function(C,B){Hash.include(this,B,C);
|
||||
},this);return this;},erase:function(A){if(this.hasOwnProperty(A)){delete this[A];}return this;},get:function(A){return(this.hasOwnProperty(A))?this[A]:null;
|
||||
},set:function(A,B){if(!this[A]||this.hasOwnProperty(A)){this[A]=B;}return this;},empty:function(){Hash.each(this,function(B,A){delete this[A];},this);
|
||||
return this;},include:function(B,C){var A=this[B];if(A==undefined){this[B]=C;}return this;},map:function(B,C){var A=new Hash;Hash.each(this,function(E,D){A.set(D,B.call(C,E,D,this));
|
||||
},this);return A;},filter:function(B,C){var A=new Hash;Hash.each(this,function(E,D){if(B.call(C,E,D,this)){A.set(D,E);}},this);return A;},every:function(B,C){for(var A in this){if(this.hasOwnProperty(A)&&!B.call(C,this[A],A)){return false;
|
||||
}}return true;},some:function(B,C){for(var A in this){if(this.hasOwnProperty(A)&&B.call(C,this[A],A)){return true;}}return false;},getKeys:function(){var A=[];
|
||||
Hash.each(this,function(C,B){A.push(B);});return A;},getValues:function(){var A=[];Hash.each(this,function(B){A.push(B);});return A;},toQueryString:function(A){var B=[];
|
||||
Hash.each(this,function(F,E){if(A){E=A+"["+E+"]";}var D;switch($type(F)){case"object":D=Hash.toQueryString(F,E);break;case"array":var C={};F.each(function(H,G){C[G]=H;
|
||||
});D=Hash.toQueryString(C,E);break;default:D=E+"="+encodeURIComponent(F);}if(F!=undefined){B.push(D);}});return B.join("&");}});Hash.alias({keyOf:"indexOf",hasValue:"contains"});
|
||||
var Event=new Native({name:"Event",initialize:function(A,F){F=F||window;var K=F.document;A=A||F.event;if(A.$extended){return A;}this.$extended=true;var J=A.type;
|
||||
var G=A.target||A.srcElement;while(G&&G.nodeType==3){G=G.parentNode;}if(J.test(/key/)){var B=A.which||A.keyCode;var M=Event.Keys.keyOf(B);if(J=="keydown"){var D=B-111;
|
||||
if(D>0&&D<13){M="f"+D;}}M=M||String.fromCharCode(B).toLowerCase();}else{if(J.match(/(click|mouse|menu)/i)){K=(!K.compatMode||K.compatMode=="CSS1Compat")?K.html:K.body;
|
||||
var I={x:A.pageX||A.clientX+K.scrollLeft,y:A.pageY||A.clientY+K.scrollTop};var C={x:(A.pageX)?A.pageX-F.pageXOffset:A.clientX,y:(A.pageY)?A.pageY-F.pageYOffset:A.clientY};
|
||||
if(J.match(/DOMMouseScroll|mousewheel/)){var H=(A.wheelDelta)?A.wheelDelta/120:-(A.detail||0)/3;}var E=(A.which==3)||(A.button==2);var L=null;if(J.match(/over|out/)){switch(J){case"mouseover":L=A.relatedTarget||A.fromElement;
|
||||
break;case"mouseout":L=A.relatedTarget||A.toElement;}if(!(function(){while(L&&L.nodeType==3){L=L.parentNode;}return true;}).create({attempt:Browser.Engine.gecko})()){L=false;
|
||||
}}}}return $extend(this,{event:A,type:J,page:I,client:C,rightClick:E,wheel:H,relatedTarget:L,target:G,code:B,key:M,shift:A.shiftKey,control:A.ctrlKey,alt:A.altKey,meta:A.metaKey});
|
||||
}});Event.Keys=new Hash({enter:13,up:38,down:40,left:37,right:39,esc:27,space:32,backspace:8,tab:9,"delete":46});Event.implement({stop:function(){return this.stopPropagation().preventDefault();
|
||||
},stopPropagation:function(){if(this.event.stopPropagation){this.event.stopPropagation();}else{this.event.cancelBubble=true;}return this;},preventDefault:function(){if(this.event.preventDefault){this.event.preventDefault();
|
||||
}else{this.event.returnValue=false;}return this;}});var Class=new Native({name:"Class",initialize:function(B){B=B||{};var A=function(E){for(var D in this){this[D]=$unlink(this[D]);
|
||||
}for(var F in Class.Mutators){if(!this[F]){continue;}Class.Mutators[F](this,this[F]);delete this[F];}this.constructor=A;if(E===$empty){return this;}var C=(this.initialize)?this.initialize.apply(this,arguments):this;
|
||||
if(this.options&&this.options.initialize){this.options.initialize.call(this);}return C;};$extend(A,this);A.constructor=Class;A.prototype=B;return A;}});
|
||||
Class.implement({implement:function(){Class.Mutators.Implements(this.prototype,Array.slice(arguments));return this;}});Class.Mutators={Implements:function(A,B){$splat(B).each(function(C){$extend(A,($type(C)=="class")?new C($empty):C);
|
||||
});},Extends:function(self,klass){var instance=new klass($empty);delete instance.parent;delete instance.parentOf;for(var key in instance){var current=self[key],previous=instance[key];
|
||||
if(current==undefined){self[key]=previous;continue;}var ctype=$type(current),ptype=$type(previous);if(ctype!=ptype){continue;}switch(ctype){case"function":if(!arguments.callee.caller){self[key]=eval("("+String(current).replace(/\bthis\.parent\(\s*(\))?/g,function(full,close){return"arguments.callee._parent_.call(this"+(close||", ");
|
||||
})+")");}self[key]._parent_=previous;break;case"object":self[key]=$merge(previous,current);}}self.parent=function(){return arguments.callee.caller._parent_.apply(this,arguments);
|
||||
};self.parentOf=function(descendant){return descendant._parent_.apply(this,Array.slice(arguments,1));};}};var Chain=new Class({chain:function(){this.$chain=(this.$chain||[]).extend(arguments);
|
||||
return this;},callChain:function(){return(this.$chain&&this.$chain.length)?this.$chain.shift().apply(this,arguments):false;},clearChain:function(){if(this.$chain){this.$chain.empty();
|
||||
}return this;}});var Events=new Class({addEvent:function(C,B,A){C=Events.removeOn(C);if(B!=$empty){this.$events=this.$events||{};this.$events[C]=this.$events[C]||[];
|
||||
this.$events[C].include(B);if(A){B.internal=true;}}return this;},addEvents:function(A){for(var B in A){this.addEvent(B,A[B]);}return this;},fireEvent:function(C,B,A){C=Events.removeOn(C);
|
||||
if(!this.$events||!this.$events[C]){return this;}this.$events[C].each(function(D){D.create({bind:this,delay:A,"arguments":B})();},this);return this;},removeEvent:function(B,A){B=Events.removeOn(B);
|
||||
if(!this.$events||!this.$events[B]){return this;}if(!A.internal){this.$events[B].erase(A);}return this;},removeEvents:function(C){for(var D in this.$events){if(C&&C!=D){continue;
|
||||
}var B=this.$events[D];for(var A=B.length;A--;A){this.removeEvent(D,B[A]);}}return this;}});Events.removeOn=function(A){return A.replace(/^on([A-Z])/,function(B,C){return C.toLowerCase();
|
||||
});};var Options=new Class({setOptions:function(){this.options=$merge.run([this.options].extend(arguments));if(!this.addEvent){return this;}for(var A in this.options){if($type(this.options[A])!="function"||!(/^on[A-Z]/).test(A)){continue;
|
||||
}this.addEvent(A,this.options[A]);delete this.options[A];}return this;}});Document.implement({newElement:function(A,B){if(Browser.Engine.trident&&B){["name","type","checked"].each(function(C){if(!B[C]){return ;
|
||||
}A+=" "+C+'="'+B[C]+'"';if(C!="checked"){delete B[C];}});A="<"+A+">";}return $.element(this.createElement(A)).set(B);},newTextNode:function(A){return this.createTextNode(A);
|
||||
},getDocument:function(){return this;},getWindow:function(){return this.defaultView||this.parentWindow;},purge:function(){var C=this.getElementsByTagName("*");
|
||||
for(var B=0,A=C.length;B<A;B++){Browser.freeMem(C[B]);}}});var Element=new Native({name:"Element",legacy:window.Element,initialize:function(A,B){var C=Element.Constructors.get(A);
|
||||
if(C){return C(B);}if(typeof A=="string"){return document.newElement(A,B);}return $(A).set(B);},afterImplement:function(A,B){if(!Array[A]){Elements.implement(A,Elements.multi(A));
|
||||
}Element.Prototype[A]=B;}});Element.Prototype={$family:{name:"element"}};Element.Constructors=new Hash;var IFrame=new Native({name:"IFrame",generics:false,initialize:function(){var E=Array.link(arguments,{properties:Object.type,iframe:$defined});
|
||||
var C=E.properties||{};var B=$(E.iframe)||false;var D=C.onload||$empty;delete C.onload;C.id=C.name=$pick(C.id,C.name,B.id,B.name,"IFrame_"+$time());B=new Element(B||"iframe",C);
|
||||
var A=function(){var F=$try(function(){return B.contentWindow.location.host;});if(F&&F==window.location.host){var H=new Window(B.contentWindow);var G=new Document(B.contentWindow.document);
|
||||
$extend(H.Element.prototype,Element.Prototype);}D.call(B.contentWindow,B.contentWindow.document);};(!window.frames[C.id])?B.addListener("load",A):A();return B;
|
||||
}});var Elements=new Native({initialize:function(F,B){B=$extend({ddup:true,cash:true},B);F=F||[];if(B.ddup||B.cash){var G={},E=[];for(var C=0,A=F.length;
|
||||
C<A;C++){var D=$.element(F[C],!B.cash);if(B.ddup){if(G[D.uid]){continue;}G[D.uid]=true;}E.push(D);}F=E;}return(B.cash)?$extend(F,this):F;}});Elements.implement({filter:function(A,B){if(!A){return this;
|
||||
}return new Elements(Array.filter(this,(typeof A=="string")?function(C){return C.match(A);}:A,B));}});Elements.multi=function(A){return function(){var B=[];
|
||||
var F=true;for(var D=0,C=this.length;D<C;D++){var E=this[D][A].apply(this[D],arguments);B.push(E);if(F){F=($type(E)=="element");}}return(F)?new Elements(B):B;
|
||||
};};Window.implement({$:function(B,C){if(B&&B.$family&&B.uid){return B;}var A=$type(B);return($[A])?$[A](B,C,this.document):null;},$$:function(A){if(arguments.length==1&&typeof A=="string"){return this.document.getElements(A);
|
||||
}var F=[];var C=Array.flatten(arguments);for(var D=0,B=C.length;D<B;D++){var E=C[D];switch($type(E)){case"element":E=[E];break;case"string":E=this.document.getElements(E,true);
|
||||
break;default:E=false;}if(E){F.extend(E);}}return new Elements(F);},getDocument:function(){return this.document;},getWindow:function(){return this;}});
|
||||
$.string=function(C,B,A){C=A.getElementById(C);return(C)?$.element(C,B):null;};$.element=function(A,D){$uid(A);if(!D&&!A.$family&&!(/^object|embed$/i).test(A.tagName)){var B=Element.Prototype;
|
||||
for(var C in B){A[C]=B[C];}}return A;};$.object=function(B,C,A){if(B.toElement){return $.element(B.toElement(A),C);}return null;};$.textnode=$.whitespace=$.window=$.document=$arguments(0);
|
||||
Native.implement([Element,Document],{getElement:function(A,B){return $(this.getElements(A,true)[0]||null,B);},getElements:function(A,D){A=A.split(",");
|
||||
var C=[];var B=(A.length>1);A.each(function(E){var F=this.getElementsByTagName(E.trim());(B)?C.extend(F):C=F;},this);return new Elements(C,{ddup:B,cash:!D});
|
||||
}});Element.Storage={get:function(A){return(this[A]||(this[A]={}));}};Element.Inserters=new Hash({before:function(B,A){if(A.parentNode){A.parentNode.insertBefore(B,A);
|
||||
}},after:function(B,A){if(!A.parentNode){return ;}var C=A.nextSibling;(C)?A.parentNode.insertBefore(B,C):A.parentNode.appendChild(B);},bottom:function(B,A){A.appendChild(B);
|
||||
},top:function(B,A){var C=A.firstChild;(C)?A.insertBefore(B,C):A.appendChild(B);}});Element.Inserters.inside=Element.Inserters.bottom;Element.Inserters.each(function(C,B){var A=B.capitalize();
|
||||
Element.implement("inject"+A,function(D){C(this,$(D,true));return this;});Element.implement("grab"+A,function(D){C($(D,true),this);return this;});});Element.implement({getDocument:function(){return this.ownerDocument;
|
||||
},getWindow:function(){return this.ownerDocument.getWindow();},getElementById:function(D,C){var B=this.ownerDocument.getElementById(D);if(!B){return null;
|
||||
}for(var A=B.parentNode;A!=this;A=A.parentNode){if(!A){return null;}}return $.element(B,C);},set:function(D,B){switch($type(D)){case"object":for(var C in D){this.set(C,D[C]);
|
||||
}break;case"string":var A=Element.Properties.get(D);(A&&A.set)?A.set.apply(this,Array.slice(arguments,1)):this.setProperty(D,B);}return this;},get:function(B){var A=Element.Properties.get(B);
|
||||
return(A&&A.get)?A.get.apply(this,Array.slice(arguments,1)):this.getProperty(B);},erase:function(B){var A=Element.Properties.get(B);(A&&A.erase)?A.erase.apply(this,Array.slice(arguments,1)):this.removeProperty(B);
|
||||
return this;},match:function(A){return(!A||Element.get(this,"tag")==A);},inject:function(B,A){Element.Inserters.get(A||"bottom")(this,$(B,true));return this;
|
||||
},wraps:function(B,A){B=$(B,true);return this.replaces(B).grab(B,A);},grab:function(B,A){Element.Inserters.get(A||"bottom")($(B,true),this);return this;
|
||||
},appendText:function(B,A){return this.grab(this.getDocument().newTextNode(B),A);},adopt:function(){Array.flatten(arguments).each(function(A){A=$(A,true);
|
||||
if(A){this.appendChild(A);}},this);return this;},dispose:function(){return(this.parentNode)?this.parentNode.removeChild(this):this;},clone:function(D,C){switch($type(this)){case"element":var H={};
|
||||
for(var G=0,E=this.attributes.length;G<E;G++){var B=this.attributes[G],L=B.nodeName.toLowerCase();if(Browser.Engine.trident&&(/input/i).test(this.tagName)&&(/width|height/).test(L)){continue;
|
||||
}var K=(L=="style"&&this.style)?this.style.cssText:B.nodeValue;if(!$chk(K)||L=="uid"||(L=="id"&&!C)){continue;}if(K!="inherit"&&["string","number"].contains($type(K))){H[L]=K;
|
||||
}}var J=new Element(this.nodeName.toLowerCase(),H);if(D!==false){for(var I=0,F=this.childNodes.length;I<F;I++){var A=Element.clone(this.childNodes[I],true,C);
|
||||
if(A){J.grab(A);}}}return J;case"textnode":return document.newTextNode(this.nodeValue);}return null;},replaces:function(A){A=$(A,true);A.parentNode.replaceChild(this,A);
|
||||
return this;},hasClass:function(A){return this.className.contains(A," ");},addClass:function(A){if(!this.hasClass(A)){this.className=(this.className+" "+A).clean();
|
||||
}return this;},removeClass:function(A){this.className=this.className.replace(new RegExp("(^|\\s)"+A+"(?:\\s|$)"),"$1").clean();return this;},toggleClass:function(A){return this.hasClass(A)?this.removeClass(A):this.addClass(A);
|
||||
},getComputedStyle:function(B){if(this.currentStyle){return this.currentStyle[B.camelCase()];}var A=this.getWindow().getComputedStyle(this,null);return(A)?A.getPropertyValue([B.hyphenate()]):null;
|
||||
},empty:function(){$A(this.childNodes).each(function(A){Browser.freeMem(A);Element.empty(A);Element.dispose(A);},this);return this;},destroy:function(){Browser.freeMem(this.empty().dispose());
|
||||
return null;},getSelected:function(){return new Elements($A(this.options).filter(function(A){return A.selected;}));},toQueryString:function(){var A=[];
|
||||
this.getElements("input, select, textarea").each(function(B){if(!B.name||B.disabled){return ;}var C=(B.tagName.toLowerCase()=="select")?Element.getSelected(B).map(function(D){return D.value;
|
||||
}):((B.type=="radio"||B.type=="checkbox")&&!B.checked)?null:B.value;$splat(C).each(function(D){if(D){A.push(B.name+"="+encodeURIComponent(D));}});});return A.join("&");
|
||||
},getProperty:function(C){var B=Element.Attributes,A=B.Props[C];var D=(A)?this[A]:this.getAttribute(C,2);return(B.Bools[C])?!!D:(A)?D:D||null;},getProperties:function(){var A=$A(arguments);
|
||||
return A.map(function(B){return this.getProperty(B);},this).associate(A);},setProperty:function(D,E){var C=Element.Attributes,B=C.Props[D],A=$defined(E);
|
||||
if(B&&C.Bools[D]){E=(E||!A)?true:false;}else{if(!A){return this.removeProperty(D);}}(B)?this[B]=E:this.setAttribute(D,E);return this;},setProperties:function(A){for(var B in A){this.setProperty(B,A[B]);
|
||||
}return this;},removeProperty:function(D){var C=Element.Attributes,B=C.Props[D],A=(B&&C.Bools[D]);(B)?this[B]=(A)?false:"":this.removeAttribute(D);return this;
|
||||
},removeProperties:function(){Array.each(arguments,this.removeProperty,this);return this;}});(function(){var A=function(D,B,I,C,F,H){var E=D[I||B];var G=[];
|
||||
while(E){if(E.nodeType==1&&(!C||Element.match(E,C))){G.push(E);if(!F){break;}}E=E[B];}return(F)?new Elements(G,{ddup:false,cash:!H}):$(G[0],H);};Element.implement({getPrevious:function(B,C){return A(this,"previousSibling",null,B,false,C);
|
||||
},getAllPrevious:function(B,C){return A(this,"previousSibling",null,B,true,C);},getNext:function(B,C){return A(this,"nextSibling",null,B,false,C);},getAllNext:function(B,C){return A(this,"nextSibling",null,B,true,C);
|
||||
},getFirst:function(B,C){return A(this,"nextSibling","firstChild",B,false,C);},getLast:function(B,C){return A(this,"previousSibling","lastChild",B,false,C);
|
||||
},getParent:function(B,C){return A(this,"parentNode",null,B,false,C);},getParents:function(B,C){return A(this,"parentNode",null,B,true,C);},getChildren:function(B,C){return A(this,"nextSibling","firstChild",B,true,C);
|
||||
},hasChild:function(B){B=$(B,true);return(!!B&&$A(this.getElementsByTagName(B.tagName)).contains(B));}});})();Element.Properties=new Hash;Element.Properties.style={set:function(A){this.style.cssText=A;
|
||||
},get:function(){return this.style.cssText;},erase:function(){this.style.cssText="";}};Element.Properties.tag={get:function(){return this.tagName.toLowerCase();
|
||||
}};Element.Properties.href={get:function(){return(!this.href)?null:this.href.replace(new RegExp("^"+document.location.protocol+"//"+document.location.host),"");
|
||||
}};Element.Properties.html={set:function(){return this.innerHTML=Array.flatten(arguments).join("");}};Native.implement([Element,Window,Document],{addListener:function(B,A){if(this.addEventListener){this.addEventListener(B,A,false);
|
||||
}else{this.attachEvent("on"+B,A);}return this;},removeListener:function(B,A){if(this.removeEventListener){this.removeEventListener(B,A,false);}else{this.detachEvent("on"+B,A);
|
||||
}return this;},retrieve:function(B,A){var D=Element.Storage.get(this.uid);var C=D[B];if($defined(A)&&!$defined(C)){C=D[B]=A;}return $pick(C);},store:function(B,A){var C=Element.Storage.get(this.uid);
|
||||
C[B]=A;return this;},eliminate:function(A){var B=Element.Storage.get(this.uid);delete B[A];return this;}});Element.Attributes=new Hash({Props:{html:"innerHTML","class":"className","for":"htmlFor",text:(Browser.Engine.trident)?"innerText":"textContent"},Bools:["compact","nowrap","ismap","declare","noshade","checked","disabled","readonly","multiple","selected","noresize","defer"],Camels:["value","accessKey","cellPadding","cellSpacing","colSpan","frameBorder","maxLength","readOnly","rowSpan","tabIndex","useMap"]});
|
||||
Browser.freeMem=function(A){if(!A){return ;}if(Browser.Engine.trident&&(/object/i).test(A.tagName)){for(var B in A){if(typeof A[B]=="function"){A[B]=$empty;
|
||||
}}Element.dispose(A);}if(A.uid&&A.removeEvents){A.removeEvents();}};(function(B){var C=B.Bools,A=B.Camels;B.Bools=C=C.associate(C);Hash.extend(Hash.combine(B.Props,C),A.associate(A.map(function(D){return D.toLowerCase();
|
||||
})));B.erase("Camels");})(Element.Attributes);window.addListener("unload",function(){window.removeListener("unload",arguments.callee);document.purge();
|
||||
if(Browser.Engine.trident){CollectGarbage();}});Element.Properties.events={set:function(A){this.addEvents(A);}};Native.implement([Element,Window,Document],{addEvent:function(E,G){var H=this.retrieve("events",{});
|
||||
H[E]=H[E]||{keys:[],values:[]};if(H[E].keys.contains(G)){return this;}H[E].keys.push(G);var F=E,A=Element.Events.get(E),C=G,I=this;if(A){if(A.onAdd){A.onAdd.call(this,G);
|
||||
}if(A.condition){C=function(J){if(A.condition.call(this,J)){return G.call(this,J);}return false;};}F=A.base||F;}var D=function(){return G.call(I);};var B=Element.NativeEvents[F]||0;
|
||||
if(B){if(B==2){D=function(J){J=new Event(J,I.getWindow());if(C.call(I,J)===false){J.stop();}};}this.addListener(F,D);}H[E].values.push(D);return this;},removeEvent:function(D,C){var B=this.retrieve("events");
|
||||
if(!B||!B[D]){return this;}var G=B[D].keys.indexOf(C);if(G==-1){return this;}var A=B[D].keys.splice(G,1)[0];var F=B[D].values.splice(G,1)[0];var E=Element.Events.get(D);
|
||||
if(E){if(E.onRemove){E.onRemove.call(this,C);}D=E.base||D;}return(Element.NativeEvents[D])?this.removeListener(D,F):this;},addEvents:function(A){for(var B in A){this.addEvent(B,A[B]);
|
||||
}return this;},removeEvents:function(B){var A=this.retrieve("events");if(!A){return this;}if(!B){for(var C in A){this.removeEvents(C);}A=null;}else{if(A[B]){while(A[B].keys[0]){this.removeEvent(B,A[B].keys[0]);
|
||||
}A[B]=null;}}return this;},fireEvent:function(D,B,A){var C=this.retrieve("events");if(!C||!C[D]){return this;}C[D].keys.each(function(E){E.create({bind:this,delay:A,"arguments":B})();
|
||||
},this);return this;},cloneEvents:function(D,A){D=$(D);var C=D.retrieve("events");if(!C){return this;}if(!A){for(var B in C){this.cloneEvents(D,B);}}else{if(C[A]){C[A].keys.each(function(E){this.addEvent(A,E);
|
||||
},this);}}return this;}});Element.NativeEvents={click:2,dblclick:2,mouseup:2,mousedown:2,contextmenu:2,mousewheel:2,DOMMouseScroll:2,mouseover:2,mouseout:2,mousemove:2,selectstart:2,selectend:2,keydown:2,keypress:2,keyup:2,focus:2,blur:2,change:2,reset:2,select:2,submit:2,load:1,unload:1,beforeunload:2,resize:1,move:1,DOMContentLoaded:1,readystatechange:1,error:1,abort:1,scroll:1};
|
||||
(function(){var A=function(B){var C=B.relatedTarget;if(C==undefined){return true;}if(C===false){return false;}return($type(this)!="document"&&C!=this&&C.prefix!="xul"&&!this.hasChild(C));
|
||||
};Element.Events=new Hash({mouseenter:{base:"mouseover",condition:A},mouseleave:{base:"mouseout",condition:A},mousewheel:{base:(Browser.Engine.gecko)?"DOMMouseScroll":"mousewheel"}});
|
||||
})();Element.Properties.styles={set:function(A){this.setStyles(A);}};Element.Properties.opacity={set:function(A,B){if(!B){if(A==0){if(this.style.visibility!="hidden"){this.style.visibility="hidden";
|
||||
}}else{if(this.style.visibility!="visible"){this.style.visibility="visible";}}}if(!this.currentStyle||!this.currentStyle.hasLayout){this.style.zoom=1;}if(Browser.Engine.trident){this.style.filter=(A==1)?"":"alpha(opacity="+A*100+")";
|
||||
}this.style.opacity=A;this.store("opacity",A);},get:function(){return this.retrieve("opacity",1);}};Element.implement({setOpacity:function(A){return this.set("opacity",A,true);
|
||||
},getOpacity:function(){return this.get("opacity");},setStyle:function(B,A){switch(B){case"opacity":return this.set("opacity",parseFloat(A));case"float":B=(Browser.Engine.trident)?"styleFloat":"cssFloat";
|
||||
}B=B.camelCase();if($type(A)!="string"){var C=(Element.Styles.get(B)||"@").split(" ");A=$splat(A).map(function(E,D){if(!C[D]){return"";}return($type(E)=="number")?C[D].replace("@",Math.round(E)):E;
|
||||
}).join(" ");}else{if(A==String(Number(A))){A=Math.round(A);}}this.style[B]=A;return this;},getStyle:function(G){switch(G){case"opacity":return this.get("opacity");
|
||||
case"float":G=(Browser.Engine.trident)?"styleFloat":"cssFloat";}G=G.camelCase();var A=this.style[G];if(!$chk(A)){A=[];for(var F in Element.ShortStyles){if(G!=F){continue;
|
||||
}for(var E in Element.ShortStyles[F]){A.push(this.getStyle(E));}return A.join(" ");}A=this.getComputedStyle(G);}if(A){A=String(A);var C=A.match(/rgba?\([\d\s,]+\)/);
|
||||
if(C){A=A.replace(C[0],C[0].rgbToHex());}}if(Browser.Engine.presto||(Browser.Engine.trident&&!$chk(parseInt(A)))){if(G.test(/^(height|width)$/)){var B=(G=="width")?["left","right"]:["top","bottom"],D=0;
|
||||
B.each(function(H){D+=this.getStyle("border-"+H+"-width").toInt()+this.getStyle("padding-"+H).toInt();},this);return this["offset"+G.capitalize()]-D+"px";
|
||||
}if(Browser.Engine.presto&&String(A).test("px")){return A;}if(G.test(/(border(.+)Width|margin|padding)/)){return"0px";}}return A;},setStyles:function(B){for(var A in B){this.setStyle(A,B[A]);
|
||||
}return this;},getStyles:function(){var A={};Array.each(arguments,function(B){A[B]=this.getStyle(B);},this);return A;}});Element.Styles=new Hash({left:"@px",top:"@px",bottom:"@px",right:"@px",width:"@px",height:"@px",maxWidth:"@px",maxHeight:"@px",minWidth:"@px",minHeight:"@px",backgroundColor:"rgb(@, @, @)",backgroundPosition:"@px @px",color:"rgb(@, @, @)",fontSize:"@px",letterSpacing:"@px",lineHeight:"@px",clip:"rect(@px @px @px @px)",margin:"@px @px @px @px",padding:"@px @px @px @px",border:"@px @ rgb(@, @, @) @px @ rgb(@, @, @) @px @ rgb(@, @, @)",borderWidth:"@px @px @px @px",borderStyle:"@ @ @ @",borderColor:"rgb(@, @, @) rgb(@, @, @) rgb(@, @, @) rgb(@, @, @)",zIndex:"@",zoom:"@",fontWeight:"@",textIndent:"@px",opacity:"@"});
|
||||
Element.ShortStyles={margin:{},padding:{},border:{},borderWidth:{},borderStyle:{},borderColor:{}};["Top","Right","Bottom","Left"].each(function(G){var F=Element.ShortStyles;
|
||||
var B=Element.Styles;["margin","padding"].each(function(H){var I=H+G;F[H][I]=B[I]="@px";});var E="border"+G;F.border[E]=B[E]="@px @ rgb(@, @, @)";var D=E+"Width",A=E+"Style",C=E+"Color";
|
||||
F[E]={};F.borderWidth[D]=F[E][D]=B[D]="@px";F.borderStyle[A]=F[E][A]=B[A]="@";F.borderColor[C]=F[E][C]=B[C]="rgb(@, @, @)";});(function(){Element.implement({scrollTo:function(H,I){if(B(this)){this.getWindow().scrollTo(H,I);
|
||||
}else{this.scrollLeft=H;this.scrollTop=I;}return this;},getSize:function(){if(B(this)){return this.getWindow().getSize();}return{x:this.offsetWidth,y:this.offsetHeight};
|
||||
},getScrollSize:function(){if(B(this)){return this.getWindow().getScrollSize();}return{x:this.scrollWidth,y:this.scrollHeight};},getScroll:function(){if(B(this)){return this.getWindow().getScroll();
|
||||
}return{x:this.scrollLeft,y:this.scrollTop};},getScrolls:function(){var I=this,H={x:0,y:0};while(I&&!B(I)){H.x+=I.scrollLeft;H.y+=I.scrollTop;I=I.parentNode;
|
||||
}return H;},getOffsetParent:function(){var H=this;if(B(H)){return null;}if(!Browser.Engine.trident){return H.offsetParent;}while((H=H.parentNode)&&!B(H)){if(D(H,"position")!="static"){return H;
|
||||
}}return null;},getOffsets:function(){var I=this,H={x:0,y:0};if(B(this)){return H;}while(I&&!B(I)){H.x+=I.offsetLeft;H.y+=I.offsetTop;if(Browser.Engine.gecko){if(!F(I)){H.x+=C(I);
|
||||
H.y+=G(I);}var J=I.parentNode;if(J&&D(J,"overflow")!="visible"){H.x+=C(J);H.y+=G(J);}}else{if(I!=this&&(Browser.Engine.trident||Browser.Engine.webkit)){H.x+=C(I);
|
||||
H.y+=G(I);}}I=I.offsetParent;if(Browser.Engine.trident){while(I&&!I.currentStyle.hasLayout){I=I.offsetParent;}}}if(Browser.Engine.gecko&&!F(this)){H.x-=C(this);
|
||||
H.y-=G(this);}return H;},getPosition:function(K){if(B(this)){return{x:0,y:0};}var L=this.getOffsets(),I=this.getScrolls();var H={x:L.x-I.x,y:L.y-I.y};var J=(K&&(K=$(K)))?K.getPosition():{x:0,y:0};
|
||||
return{x:H.x-J.x,y:H.y-J.y};},getCoordinates:function(J){if(B(this)){return this.getWindow().getCoordinates();}var H=this.getPosition(J),I=this.getSize();
|
||||
var K={left:H.x,top:H.y,width:I.x,height:I.y};K.right=K.left+K.width;K.bottom=K.top+K.height;return K;},computePosition:function(H){return{left:H.x-E(this,"margin-left"),top:H.y-E(this,"margin-top")};
|
||||
},position:function(H){return this.setStyles(this.computePosition(H));}});Native.implement([Document,Window],{getSize:function(){var I=this.getWindow();
|
||||
if(Browser.Engine.presto||Browser.Engine.webkit){return{x:I.innerWidth,y:I.innerHeight};}var H=A(this);return{x:H.clientWidth,y:H.clientHeight};},getScroll:function(){var I=this.getWindow();
|
||||
var H=A(this);return{x:I.pageXOffset||H.scrollLeft,y:I.pageYOffset||H.scrollTop};},getScrollSize:function(){var I=A(this);var H=this.getSize();return{x:Math.max(I.scrollWidth,H.x),y:Math.max(I.scrollHeight,H.y)};
|
||||
},getPosition:function(){return{x:0,y:0};},getCoordinates:function(){var H=this.getSize();return{top:0,left:0,bottom:H.y,right:H.x,height:H.y,width:H.x};
|
||||
}});var D=Element.getComputedStyle;function E(H,I){return D(H,I).toInt()||0;}function F(H){return D(H,"-moz-box-sizing")=="border-box";}function G(H){return E(H,"border-top-width");
|
||||
}function C(H){return E(H,"border-left-width");}function B(H){return(/^(?:body|html)$/i).test(H.tagName);}function A(H){var I=H.getDocument();return(!I.compatMode||I.compatMode=="CSS1Compat")?I.html:I.body;
|
||||
}})();Native.implement([Window,Document,Element],{getHeight:function(){return this.getSize().y;},getWidth:function(){return this.getSize().x;},getScrollTop:function(){return this.getScroll().y;
|
||||
},getScrollLeft:function(){return this.getScroll().x;},getScrollHeight:function(){return this.getScrollSize().y;},getScrollWidth:function(){return this.getScrollSize().x;
|
||||
},getTop:function(){return this.getPosition().y;},getLeft:function(){return this.getPosition().x;}});Native.implement([Document,Element],{getElements:function(H,G){H=H.split(",");
|
||||
var C,E={};for(var D=0,B=H.length;D<B;D++){var A=H[D],F=Selectors.Utils.search(this,A,E);if(D!=0&&F.item){F=$A(F);}C=(D==0)?F:(C.item)?$A(C).concat(F):C.concat(F);
|
||||
}return new Elements(C,{ddup:(H.length>1),cash:!G});}});Element.implement({match:function(B){if(!B){return true;}var D=Selectors.Utils.parseTagAndID(B);
|
||||
var A=D[0],E=D[1];if(!Selectors.Filters.byID(this,E)||!Selectors.Filters.byTag(this,A)){return false;}var C=Selectors.Utils.parseSelector(B);return(C)?Selectors.Utils.filter(this,C,{}):true;
|
||||
}});var Selectors={Cache:{nth:{},parsed:{}}};Selectors.RegExps={id:(/#([\w-]+)/),tag:(/^(\w+|\*)/),quick:(/^(\w+|\*)$/),splitter:(/\s*([+>~\s])\s*([a-zA-Z#.*:\[])/g),combined:(/\.([\w-]+)|\[(\w+)(?:([!*^$~|]?=)["']?(.*?)["']?)?\]|:([\w-]+)(?:\(["']?(.*?)?["']?\)|$)/g)};
|
||||
Selectors.Utils={chk:function(B,C){if(!C){return true;}var A=$uid(B);if(!C[A]){return C[A]=true;}return false;},parseNthArgument:function(F){if(Selectors.Cache.nth[F]){return Selectors.Cache.nth[F];
|
||||
}var C=F.match(/^([+-]?\d*)?([a-z]+)?([+-]?\d*)?$/);if(!C){return false;}var E=parseInt(C[1]);var B=(E||E===0)?E:1;var D=C[2]||false;var A=parseInt(C[3])||0;
|
||||
if(B!=0){A--;while(A<1){A+=B;}while(A>=B){A-=B;}}else{B=A;D="index";}switch(D){case"n":C={a:B,b:A,special:"n"};break;case"odd":C={a:2,b:0,special:"n"};
|
||||
break;case"even":C={a:2,b:1,special:"n"};break;case"first":C={a:0,special:"index"};break;case"last":C={special:"last-child"};break;case"only":C={special:"only-child"};
|
||||
break;default:C={a:(B-1),special:"index"};}return Selectors.Cache.nth[F]=C;},parseSelector:function(E){if(Selectors.Cache.parsed[E]){return Selectors.Cache.parsed[E];
|
||||
}var D,H={classes:[],pseudos:[],attributes:[]};while((D=Selectors.RegExps.combined.exec(E))){var I=D[1],G=D[2],F=D[3],B=D[4],C=D[5],J=D[6];if(I){H.classes.push(I);
|
||||
}else{if(C){var A=Selectors.Pseudo.get(C);if(A){H.pseudos.push({parser:A,argument:J});}else{H.attributes.push({name:C,operator:"=",value:J});}}else{if(G){H.attributes.push({name:G,operator:F,value:B});
|
||||
}}}}if(!H.classes.length){delete H.classes;}if(!H.attributes.length){delete H.attributes;}if(!H.pseudos.length){delete H.pseudos;}if(!H.classes&&!H.attributes&&!H.pseudos){H=null;
|
||||
}return Selectors.Cache.parsed[E]=H;},parseTagAndID:function(B){var A=B.match(Selectors.RegExps.tag);var C=B.match(Selectors.RegExps.id);return[(A)?A[1]:"*",(C)?C[1]:false];
|
||||
},filter:function(F,C,E){var D;if(C.classes){for(D=C.classes.length;D--;D){var G=C.classes[D];if(!Selectors.Filters.byClass(F,G)){return false;}}}if(C.attributes){for(D=C.attributes.length;
|
||||
D--;D){var B=C.attributes[D];if(!Selectors.Filters.byAttribute(F,B.name,B.operator,B.value)){return false;}}}if(C.pseudos){for(D=C.pseudos.length;D--;D){var A=C.pseudos[D];
|
||||
if(!Selectors.Filters.byPseudo(F,A.parser,A.argument,E)){return false;}}}return true;},getByTagAndID:function(B,A,D){if(D){var C=(B.getElementById)?B.getElementById(D,true):Element.getElementById(B,D,true);
|
||||
return(C&&Selectors.Filters.byTag(C,A))?[C]:[];}else{return B.getElementsByTagName(A);}},search:function(J,I,O){var B=[];var C=I.trim().replace(Selectors.RegExps.splitter,function(Z,Y,X){B.push(Y);
|
||||
return":)"+X;}).split(":)");var K,F,E,V;for(var U=0,Q=C.length;U<Q;U++){var T=C[U];if(U==0&&Selectors.RegExps.quick.test(T)){K=J.getElementsByTagName(T);
|
||||
continue;}var A=B[U-1];var L=Selectors.Utils.parseTagAndID(T);var W=L[0],M=L[1];if(U==0){K=Selectors.Utils.getByTagAndID(J,W,M);}else{var D={},H=[];for(var S=0,R=K.length;
|
||||
S<R;S++){H=Selectors.Getters[A](H,K[S],W,M,D);}K=H;}var G=Selectors.Utils.parseSelector(T);if(G){E=[];for(var P=0,N=K.length;P<N;P++){V=K[P];if(Selectors.Utils.filter(V,G,O)){E.push(V);
|
||||
}}K=E;}}return K;}};Selectors.Getters={" ":function(H,G,I,A,E){var D=Selectors.Utils.getByTagAndID(G,I,A);for(var C=0,B=D.length;C<B;C++){var F=D[C];if(Selectors.Utils.chk(F,E)){H.push(F);
|
||||
}}return H;},">":function(H,G,I,A,F){var C=Selectors.Utils.getByTagAndID(G,I,A);for(var E=0,D=C.length;E<D;E++){var B=C[E];if(B.parentNode==G&&Selectors.Utils.chk(B,F)){H.push(B);
|
||||
}}return H;},"+":function(C,B,A,E,D){while((B=B.nextSibling)){if(B.nodeType==1){if(Selectors.Utils.chk(B,D)&&Selectors.Filters.byTag(B,A)&&Selectors.Filters.byID(B,E)){C.push(B);
|
||||
}break;}}return C;},"~":function(C,B,A,E,D){while((B=B.nextSibling)){if(B.nodeType==1){if(!Selectors.Utils.chk(B,D)){break;}if(Selectors.Filters.byTag(B,A)&&Selectors.Filters.byID(B,E)){C.push(B);
|
||||
}}}return C;}};Selectors.Filters={byTag:function(B,A){return(A=="*"||(B.tagName&&B.tagName.toLowerCase()==A));},byID:function(A,B){return(!B||(A.id&&A.id==B));
|
||||
},byClass:function(B,A){return(B.className&&B.className.contains(A," "));},byPseudo:function(A,D,C,B){return D.call(A,C,B);},byAttribute:function(C,D,B,E){var A=Element.prototype.getProperty.call(C,D);
|
||||
if(!A){return false;}if(!B||E==undefined){return true;}switch(B){case"=":return(A==E);case"*=":return(A.contains(E));case"^=":return(A.substr(0,E.length)==E);
|
||||
case"$=":return(A.substr(A.length-E.length)==E);case"!=":return(A!=E);case"~=":return A.contains(E," ");case"|=":return A.contains(E,"-");}return false;
|
||||
}};Selectors.Pseudo=new Hash({empty:function(){return !(this.innerText||this.textContent||"").length;},not:function(A){return !Element.match(this,A);},contains:function(A){return(this.innerText||this.textContent||"").contains(A);
|
||||
},"first-child":function(){return Selectors.Pseudo.index.call(this,0);},"last-child":function(){var A=this;while((A=A.nextSibling)){if(A.nodeType==1){return false;
|
||||
}}return true;},"only-child":function(){var B=this;while((B=B.previousSibling)){if(B.nodeType==1){return false;}}var A=this;while((A=A.nextSibling)){if(A.nodeType==1){return false;
|
||||
}}return true;},"nth-child":function(G,E){G=(G==undefined)?"n":G;var C=Selectors.Utils.parseNthArgument(G);if(C.special!="n"){return Selectors.Pseudo[C.special].call(this,C.a,E);
|
||||
}var F=0;E.positions=E.positions||{};var D=$uid(this);if(!E.positions[D]){var B=this;while((B=B.previousSibling)){if(B.nodeType!=1){continue;}F++;var A=E.positions[$uid(B)];
|
||||
if(A!=undefined){F=A+F;break;}}E.positions[D]=F;}return(E.positions[D]%C.a==C.b);},index:function(A){var B=this,C=0;while((B=B.previousSibling)){if(B.nodeType==1&&++C>A){return false;
|
||||
}}return(C==A);},even:function(B,A){return Selectors.Pseudo["nth-child"].call(this,"2n+1",A);},odd:function(B,A){return Selectors.Pseudo["nth-child"].call(this,"2n",A);
|
||||
}});Element.Events.domready={onAdd:function(A){if(Browser.loaded){A.call(this);}}};(function(){var B=function(){if(Browser.loaded){return ;}Browser.loaded=true;
|
||||
window.fireEvent("domready");document.fireEvent("domready");};switch(Browser.Engine.name){case"webkit":(function(){(["loaded","complete"].contains(document.readyState))?B():arguments.callee.delay(50);
|
||||
})();break;case"trident":var A=document.createElement("div");(function(){($try(function(){A.doScroll("left");return $(A).inject(document.body).set("html","temp").dispose();
|
||||
}))?B():arguments.callee.delay(50);})();break;default:window.addEvent("load",B);document.addEvent("DOMContentLoaded",B);}})();var JSON=new Hash({encode:function(B){switch($type(B)){case"string":return'"'+B.replace(/[\x00-\x1f\\"]/g,JSON.$replaceChars)+'"';
|
||||
case"array":return"["+String(B.map(JSON.encode).filter($defined))+"]";case"object":case"hash":var A=[];Hash.each(B,function(E,D){var C=JSON.encode(E);if(C){A.push(JSON.encode(D)+":"+C);
|
||||
}});return"{"+A+"}";case"number":case"boolean":return String(B);case false:return"null";}return null;},$specialChars:{"\b":"\\b","\t":"\\t","\n":"\\n","\f":"\\f","\r":"\\r",'"':'\\"',"\\":"\\\\"},$replaceChars:function(A){return JSON.$specialChars[A]||"\\u00"+Math.floor(A.charCodeAt()/16).toString(16)+(A.charCodeAt()%16).toString(16);
|
||||
},decode:function(string,secure){if($type(string)!="string"||!string.length){return null;}if(secure&&!(/^[,:{}\[\]0-9.\-+Eaeflnr-u \n\r\t]*$/).test(string.replace(/\\./g,"@").replace(/"[^"\\\n\r]*"/g,""))){return null;
|
||||
}return eval("("+string+")");}});Native.implement([Hash,Array,String,Number],{toJSON:function(){return JSON.encode(this);}});var Cookie=new Class({Implements:Options,options:{path:false,domain:false,duration:false,secure:false,document:document},initialize:function(B,A){this.key=B;
|
||||
this.setOptions(A);},write:function(B){B=encodeURIComponent(B);if(this.options.domain){B+="; domain="+this.options.domain;}if(this.options.path){B+="; path="+this.options.path;
|
||||
}if(this.options.duration){var A=new Date();A.setTime(A.getTime()+this.options.duration*24*60*60*1000);B+="; expires="+A.toGMTString();}if(this.options.secure){B+="; secure";
|
||||
}this.options.document.cookie=this.key+"="+B;return this;},read:function(){var A=this.options.document.cookie.match("(?:^|;)\\s*"+this.key.escapeRegExp()+"=([^;]*)");
|
||||
return(A)?decodeURIComponent(A[1]):null;},dispose:function(){new Cookie(this.key,$merge(this.options,{duration:-1})).write("");return this;}});Cookie.write=function(B,C,A){return new Cookie(B,A).write(C);
|
||||
};Cookie.read=function(A){return new Cookie(A).read();};Cookie.dispose=function(B,A){return new Cookie(B,A).dispose();};var Swiff=new Class({Implements:[Options],options:{id:null,height:1,width:1,container:null,properties:{},params:{quality:"high",allowScriptAccess:"always",wMode:"transparent",swLiveConnect:true},callBacks:{},vars:{}},toElement:function(){return this.object;
|
||||
},initialize:function(L,M){this.instance="Swiff_"+$time();this.setOptions(M);M=this.options;var B=this.id=M.id||this.instance;var A=$(M.container);Swiff.CallBacks[this.instance]={};
|
||||
var E=M.params,G=M.vars,F=M.callBacks;var H=$extend({height:M.height,width:M.width},M.properties);var K=this;for(var D in F){Swiff.CallBacks[this.instance][D]=(function(N){return function(){return N.apply(K.object,arguments);
|
||||
};})(F[D]);G[D]="Swiff.CallBacks."+this.instance+"."+D;}E.flashVars=Hash.toQueryString(G);if(Browser.Engine.trident){H.classid="clsid:D27CDB6E-AE6D-11cf-96B8-444553540000";
|
||||
E.movie=L;}else{H.type="application/x-shockwave-flash";H.data=L;}var J='<object id="'+B+'"';for(var I in H){J+=" "+I+'="'+H[I]+'"';}J+=">";for(var C in E){if(E[C]){J+='<param name="'+C+'" value="'+E[C]+'" />';
|
||||
}}J+="</object>";this.object=((A)?A.empty():new Element("div")).set("html",J).firstChild;},replaces:function(A){A=$(A,true);A.parentNode.replaceChild(this.toElement(),A);
|
||||
return this;},inject:function(A){$(A,true).appendChild(this.toElement());return this;},remote:function(){return Swiff.remote.apply(Swiff,[this.toElement()].extend(arguments));
|
||||
}});Swiff.CallBacks={};Swiff.remote=function(obj,fn){var rs=obj.CallFunction('<invoke name="'+fn+'" returntype="javascript">'+__flash__argumentsToXML(arguments,2)+"</invoke>");
|
||||
return eval(rs);};var Fx=new Class({Implements:[Chain,Events,Options],options:{fps:50,unit:false,duration:500,link:"ignore",transition:function(A){return -(Math.cos(Math.PI*A)-1)/2;
|
||||
}},initialize:function(A){this.subject=this.subject||this;this.setOptions(A);this.options.duration=Fx.Durations[this.options.duration]||this.options.duration.toInt();
|
||||
var B=this.options.wait;if(B===false){this.options.link="cancel";}},step:function(){var A=$time();if(A<this.time+this.options.duration){var B=this.options.transition((A-this.time)/this.options.duration);
|
||||
this.set(this.compute(this.from,this.to,B));}else{this.set(this.compute(this.from,this.to,1));this.complete();}},set:function(A){return A;},compute:function(C,B,A){return Fx.compute(C,B,A);
|
||||
},check:function(A){if(!this.timer){return true;}switch(this.options.link){case"cancel":this.cancel();return true;case"chain":this.chain(A.bind(this,Array.slice(arguments,1)));
|
||||
return false;}return false;},start:function(B,A){if(!this.check(arguments.callee,B,A)){return this;}this.from=B;this.to=A;this.time=0;this.startTimer();
|
||||
this.onStart();return this;},complete:function(){if(this.stopTimer()){this.onComplete();}return this;},cancel:function(){if(this.stopTimer()){this.onCancel();
|
||||
}return this;},onStart:function(){this.fireEvent("start",this.subject);},onComplete:function(){this.fireEvent("complete",this.subject);if(!this.callChain()){this.fireEvent("chainComplete",this.subject);
|
||||
}},onCancel:function(){this.fireEvent("cancel",this.subject).clearChain();},pause:function(){this.stopTimer();return this;},resume:function(){this.startTimer();
|
||||
return this;},stopTimer:function(){if(!this.timer){return false;}this.time=$time()-this.time;this.timer=$clear(this.timer);return true;},startTimer:function(){if(this.timer){return false;
|
||||
}this.time=$time()-this.time;this.timer=this.step.periodical(Math.round(1000/this.options.fps),this);return true;}});Fx.compute=function(C,B,A){return(B-C)*A+C;
|
||||
};Fx.Durations={"short":250,normal:500,"long":1000};Fx.CSS=new Class({Extends:Fx,prepare:function(D,E,B){B=$splat(B);var C=B[1];if(!$chk(C)){B[1]=B[0];
|
||||
B[0]=D.getStyle(E);}var A=B.map(this.parse);return{from:A[0],to:A[1]};},parse:function(A){A=$lambda(A)();A=(typeof A=="string")?A.split(" "):$splat(A);
|
||||
return A.map(function(C){C=String(C);var B=false;Fx.CSS.Parsers.each(function(F,E){if(B){return ;}var D=F.parse(C);if($chk(D)){B={value:D,parser:F};}});
|
||||
B=B||{value:C,parser:Fx.CSS.Parsers.String};return B;});},compute:function(D,C,B){var A=[];(Math.min(D.length,C.length)).times(function(E){A.push({value:D[E].parser.compute(D[E].value,C[E].value,B),parser:D[E].parser});
|
||||
});A.$family={name:"fx:css:value"};return A;},serve:function(C,B){if($type(C)!="fx:css:value"){C=this.parse(C);}var A=[];C.each(function(D){A=A.concat(D.parser.serve(D.value,B));
|
||||
});return A;},render:function(A,D,C,B){A.setStyle(D,this.serve(C,B));},search:function(A){if(Fx.CSS.Cache[A]){return Fx.CSS.Cache[A];}var B={};Array.each(document.styleSheets,function(E,D){var C=E.href;
|
||||
if(C&&C.contains("://")&&!C.contains(document.domain)){return ;}var F=E.rules||E.cssRules;Array.each(F,function(I,G){if(!I.style){return ;}var H=(I.selectorText)?I.selectorText.replace(/^\w+/,function(J){return J.toLowerCase();
|
||||
}):null;if(!H||!H.test("^"+A+"$")){return ;}Element.Styles.each(function(K,J){if(!I.style[J]||Element.ShortStyles[J]){return ;}K=String(I.style[J]);B[J]=(K.test(/^rgb/))?K.rgbToHex():K;
|
||||
});});});return Fx.CSS.Cache[A]=B;}});Fx.CSS.Cache={};Fx.CSS.Parsers=new Hash({Color:{parse:function(A){if(A.match(/^#[0-9a-f]{3,6}$/i)){return A.hexToRgb(true);
|
||||
}return((A=A.match(/(\d+),\s*(\d+),\s*(\d+)/)))?[A[1],A[2],A[3]]:false;},compute:function(C,B,A){return C.map(function(E,D){return Math.round(Fx.compute(C[D],B[D],A));
|
||||
});},serve:function(A){return A.map(Number);}},Number:{parse:parseFloat,compute:Fx.compute,serve:function(B,A){return(A)?B+A:B;}},String:{parse:$lambda(false),compute:$arguments(1),serve:$arguments(0)}});
|
||||
Fx.Tween=new Class({Extends:Fx.CSS,initialize:function(B,A){this.element=this.subject=$(B);this.parent(A);},set:function(B,A){if(arguments.length==1){A=B;
|
||||
B=this.property||this.options.property;}this.render(this.element,B,A,this.options.unit);return this;},start:function(C,E,D){if(!this.check(arguments.callee,C,E,D)){return this;
|
||||
}var B=Array.flatten(arguments);this.property=this.options.property||B.shift();var A=this.prepare(this.element,this.property,B);return this.parent(A.from,A.to);
|
||||
}});Element.Properties.tween={set:function(A){var B=this.retrieve("tween");if(B){B.cancel();}return this.eliminate("tween").store("tween:options",$extend({link:"cancel"},A));
|
||||
},get:function(A){if(A||!this.retrieve("tween")){if(A||!this.retrieve("tween:options")){this.set("tween",A);}this.store("tween",new Fx.Tween(this,this.retrieve("tween:options")));
|
||||
}return this.retrieve("tween");}};Element.implement({tween:function(A,C,B){this.get("tween").start(arguments);return this;},fade:function(C){var E=this.get("tween"),D="opacity",A;
|
||||
C=$pick(C,"toggle");switch(C){case"in":E.start(D,1);break;case"out":E.start(D,0);break;case"show":E.set(D,1);break;case"hide":E.set(D,0);break;case"toggle":var B=this.retrieve("fade:flag",this.get("opacity")==1);
|
||||
E.start(D,(B)?0:1);this.store("fade:flag",!B);A=true;break;default:E.start(D,arguments);}if(!A){this.eliminate("fade:flag");}return this;},highlight:function(C,A){if(!A){A=this.retrieve("highlight:original",this.getStyle("background-color"));
|
||||
A=(A=="transparent")?"#fff":A;}var B=this.get("tween");B.start("background-color",C||"#ffff88",A).chain(function(){this.setStyle("background-color",this.retrieve("highlight:original"));
|
||||
B.callChain();}.bind(this));return this;}});Fx.Morph=new Class({Extends:Fx.CSS,initialize:function(B,A){this.element=this.subject=$(B);this.parent(A);},set:function(A){if(typeof A=="string"){A=this.search(A);
|
||||
}for(var B in A){this.render(this.element,B,A[B],this.options.unit);}return this;},compute:function(E,D,C){var A={};for(var B in E){A[B]=this.parent(E[B],D[B],C);
|
||||
}return A;},start:function(B){if(!this.check(arguments.callee,B)){return this;}if(typeof B=="string"){B=this.search(B);}var E={},D={};for(var C in B){var A=this.prepare(this.element,C,B[C]);
|
||||
E[C]=A.from;D[C]=A.to;}return this.parent(E,D);}});Element.Properties.morph={set:function(A){var B=this.retrieve("morph");if(B){B.cancel();}return this.eliminate("morph").store("morph:options",$extend({link:"cancel"},A));
|
||||
},get:function(A){if(A||!this.retrieve("morph")){if(A||!this.retrieve("morph:options")){this.set("morph",A);}this.store("morph",new Fx.Morph(this,this.retrieve("morph:options")));
|
||||
}return this.retrieve("morph");}};Element.implement({morph:function(A){this.get("morph").start(A);return this;}});(function(){var A=Fx.prototype.initialize;
|
||||
Fx.prototype.initialize=function(B){A.call(this,B);var C=this.options.transition;if(typeof C=="string"&&(C=C.split(":"))){var D=Fx.Transitions;D=D[C[0]]||D[C[0].capitalize()];
|
||||
if(C[1]){D=D["ease"+C[1].capitalize()+(C[2]?C[2].capitalize():"")];}this.options.transition=D;}};})();Fx.Transition=function(B,A){A=$splat(A);return $extend(B,{easeIn:function(C){return B(C,A);
|
||||
},easeOut:function(C){return 1-B(1-C,A);},easeInOut:function(C){return(C<=0.5)?B(2*C,A)/2:(2-B(2*(1-C),A))/2;}});};Fx.Transitions=new Hash({linear:$arguments(0)});
|
||||
Fx.Transitions.extend=function(A){for(var B in A){Fx.Transitions[B]=new Fx.Transition(A[B]);}};Fx.Transitions.extend({Pow:function(B,A){return Math.pow(B,A[0]||6);
|
||||
},Expo:function(A){return Math.pow(2,8*(A-1));},Circ:function(A){return 1-Math.sin(Math.acos(A));},Sine:function(A){return 1-Math.sin((1-A)*Math.PI/2);
|
||||
},Back:function(B,A){A=A[0]||1.618;return Math.pow(B,2)*((A+1)*B-A);},Bounce:function(D){var C;for(var B=0,A=1;1;B+=A,A/=2){if(D>=(7-4*B)/11){C=-Math.pow((11-6*B-11*D)/4,2)+A*A;
|
||||
break;}}return C;},Elastic:function(B,A){return Math.pow(2,10*--B)*Math.cos(20*B*Math.PI*(A[0]||1)/3);}});["Quad","Cubic","Quart","Quint"].each(function(B,A){Fx.Transitions[B]=new Fx.Transition(function(C){return Math.pow(C,[A+2]);
|
||||
});});var Request=new Class({Implements:[Chain,Events,Options],options:{url:"",data:"",headers:{"X-Requested-With":"XMLHttpRequest",Accept:"text/javascript, text/html, application/xml, text/xml, */*"},async:true,format:false,method:"post",link:"ignore",isSuccess:null,emulation:true,urlEncoded:true,encoding:"utf-8",evalScripts:false,evalResponse:false},initialize:function(A){this.xhr=new Browser.Request();
|
||||
this.setOptions(A);this.options.isSuccess=this.options.isSuccess||this.isSuccess;this.headers=new Hash(this.options.headers);},onStateChange:function(){if(this.xhr.readyState!=4||!this.running){return ;
|
||||
}this.running=false;this.status=0;$try(function(){this.status=this.xhr.status;}.bind(this));if(this.options.isSuccess.call(this,this.status)){this.response={text:this.xhr.responseText,xml:this.xhr.responseXML};
|
||||
this.success(this.response.text,this.response.xml);}else{this.response={text:null,xml:null};this.failure();}this.xhr.onreadystatechange=$empty;},isSuccess:function(){return((this.status>=200)&&(this.status<300));
|
||||
},processScripts:function(A){if(this.options.evalResponse||(/(ecma|java)script/).test(this.getHeader("Content-type"))){return $exec(A);}return A.stripScripts(this.options.evalScripts);
|
||||
},success:function(B,A){this.onSuccess(this.processScripts(B),A);},onSuccess:function(){this.fireEvent("complete",arguments).fireEvent("success",arguments).callChain();
|
||||
},failure:function(){this.onFailure();},onFailure:function(){this.fireEvent("complete").fireEvent("failure",this.xhr);},setHeader:function(A,B){this.headers.set(A,B);
|
||||
return this;},getHeader:function(A){return $try(function(){return this.xhr.getResponseHeader(A);}.bind(this));},check:function(A){if(!this.running){return true;
|
||||
}switch(this.options.link){case"cancel":this.cancel();return true;case"chain":this.chain(A.bind(this,Array.slice(arguments,1)));return false;}return false;
|
||||
},send:function(I){if(!this.check(arguments.callee,I)){return this;}this.running=true;var G=$type(I);if(G=="string"||G=="element"){I={data:I};}var D=this.options;
|
||||
I=$extend({data:D.data,url:D.url,method:D.method},I);var E=I.data,B=I.url,A=I.method;switch($type(E)){case"element":E=$(E).toQueryString();break;case"object":case"hash":E=Hash.toQueryString(E);
|
||||
}if(this.options.format){var H="format="+this.options.format;E=(E)?H+"&"+E:H;}if(this.options.emulation&&["put","delete"].contains(A)){var F="_method="+A;
|
||||
E=(E)?F+"&"+E:F;A="post";}if(this.options.urlEncoded&&A=="post"){var C=(this.options.encoding)?"; charset="+this.options.encoding:"";this.headers.set("Content-type","application/x-www-form-urlencoded"+C);
|
||||
}if(E&&A=="get"){B=B+(B.contains("?")?"&":"?")+E;E=null;}this.xhr.open(A.toUpperCase(),B,this.options.async);this.xhr.onreadystatechange=this.onStateChange.bind(this);
|
||||
this.headers.each(function(K,J){if(!$try(function(){this.xhr.setRequestHeader(J,K);return true;}.bind(this))){this.fireEvent("exception",[J,K]);}},this);
|
||||
this.fireEvent("request");this.xhr.send(E);if(!this.options.async){this.onStateChange();}return this;},cancel:function(){if(!this.running){return this;
|
||||
}this.running=false;this.xhr.abort();this.xhr.onreadystatechange=$empty;this.xhr=new Browser.Request();this.fireEvent("cancel");return this;}});(function(){var A={};
|
||||
["get","post","put","delete","GET","POST","PUT","DELETE"].each(function(B){A[B]=function(){var C=Array.link(arguments,{url:String.type,data:$defined});
|
||||
return this.send($extend(C,{method:B.toLowerCase()}));};});Request.implement(A);})();Element.Properties.send={set:function(A){var B=this.retrieve("send");
|
||||
if(B){B.cancel();}return this.eliminate("send").store("send:options",$extend({data:this,link:"cancel",method:this.get("method")||"post",url:this.get("action")},A));
|
||||
},get:function(A){if(A||!this.retrieve("send")){if(A||!this.retrieve("send:options")){this.set("send",A);}this.store("send",new Request(this.retrieve("send:options")));
|
||||
}return this.retrieve("send");}};Element.implement({send:function(A){var B=this.get("send");B.send({data:this,url:A||B.options.url});return this;}});Request.HTML=new Class({Extends:Request,options:{update:false,evalScripts:true,filter:false},processHTML:function(C){var B=C.match(/<body[^>]*>([\s\S]*?)<\/body>/i);
|
||||
C=(B)?B[1]:C;var A=new Element("div");return $try(function(){var D="<root>"+C+"</root>",G;if(Browser.Engine.trident){G=new ActiveXObject("Microsoft.XMLDOM");
|
||||
G.async=false;G.loadXML(D);}else{G=new DOMParser().parseFromString(D,"text/xml");}D=G.getElementsByTagName("root")[0];for(var F=0,E=D.childNodes.length;
|
||||
F<E;F++){var H=Element.clone(D.childNodes[F],true,true);if(H){A.grab(H);}}return A;})||A.set("html",C);},success:function(D){var C=this.options,B=this.response;
|
||||
B.html=D.stripScripts(function(E){B.javascript=E;});var A=this.processHTML(B.html);B.tree=A.childNodes;B.elements=A.getElements("*");if(C.filter){B.tree=B.elements.filter(C.filter);
|
||||
}if(C.update){$(C.update).empty().adopt(B.tree);}if(C.evalScripts){$exec(B.javascript);}this.onSuccess(B.tree,B.elements,B.html,B.javascript);}});Element.Properties.load={set:function(A){var B=this.retrieve("load");
|
||||
if(B){send.cancel();}return this.eliminate("load").store("load:options",$extend({data:this,link:"cancel",update:this,method:"get"},A));},get:function(A){if(A||!this.retrieve("load")){if(A||!this.retrieve("load:options")){this.set("load",A);
|
||||
}this.store("load",new Request.HTML(this.retrieve("load:options")));}return this.retrieve("load");}};Element.implement({load:function(){this.get("load").send(Array.link(arguments,{data:Object.type,url:String.type}));
|
||||
return this;}});Request.JSON=new Class({Extends:Request,options:{secure:true},initialize:function(A){this.parent(A);this.headers.extend({Accept:"application/json","X-Request":"JSON"});
|
||||
},success:function(A){this.response.json=JSON.decode(A,this.options.secure);this.onSuccess(this.response.json,A);}});
|
||||
|
||||
|
||||
//MooTools More, <http://mootools.net/more>. Copyright (c) 2006-2008 Valerio Proietti, <http://mad4milk.net>, MIT Style License.
|
||||
|
||||
Fx.Slide=new Class({Extends:Fx,options:{mode:"vertical"},initialize:function(B,A){this.addEvent("complete",function(){this.open=(this.wrapper["offset"+this.layout.capitalize()]!=0);
|
||||
if(this.open&&Browser.Engine.webkit419){this.element.dispose().inject(this.wrapper);}},true);this.element=this.subject=$(B);this.parent(A);var C=this.element.retrieve("wrapper");
|
||||
this.wrapper=C||new Element("div",{styles:$extend(this.element.getStyles("margin","position"),{overflow:"hidden"})}).wraps(this.element);this.element.store("wrapper",this.wrapper).setStyle("margin",0);
|
||||
this.now=[];this.open=true;},vertical:function(){this.margin="margin-top";this.layout="height";this.offset=this.element.offsetHeight;},horizontal:function(){this.margin="margin-left";
|
||||
this.layout="width";this.offset=this.element.offsetWidth;},set:function(A){this.element.setStyle(this.margin,A[0]);this.wrapper.setStyle(this.layout,A[1]);
|
||||
return this;},compute:function(E,D,C){var B=[];var A=2;A.times(function(F){B[F]=Fx.compute(E[F],D[F],C);});return B;},start:function(B,E){if(!this.check(arguments.callee,B,E)){return this;
|
||||
}this[E||this.options.mode]();var D=this.element.getStyle(this.margin).toInt();var C=this.wrapper.getStyle(this.layout).toInt();var A=[[D,C],[0,this.offset]];
|
||||
var G=[[D,C],[-this.offset,0]];var F;switch(B){case"in":F=A;break;case"out":F=G;break;case"toggle":F=(this.wrapper["offset"+this.layout.capitalize()]==0)?A:G;
|
||||
}return this.parent(F[0],F[1]);},slideIn:function(A){return this.start("in",A);},slideOut:function(A){return this.start("out",A);},hide:function(A){this[A||this.options.mode]();
|
||||
this.open=false;return this.set([-this.offset,0]);},show:function(A){this[A||this.options.mode]();this.open=true;return this.set([0,this.offset]);},toggle:function(A){return this.start("toggle",A);
|
||||
}});Element.Properties.slide={set:function(B){var A=this.retrieve("slide");if(A){A.cancel();}return this.eliminate("slide").store("slide:options",$extend({link:"cancel"},B));
|
||||
},get:function(A){if(A||!this.retrieve("slide")){if(A||!this.retrieve("slide:options")){this.set("slide",A);}this.store("slide",new Fx.Slide(this,this.retrieve("slide:options")));
|
||||
}return this.retrieve("slide");}};Element.implement({slide:function(D,E){D=D||"toggle";var B=this.get("slide"),A;switch(D){case"hide":B.hide(E);break;case"show":B.show(E);
|
||||
break;case"toggle":var C=this.retrieve("slide:flag",B.open);B[(C)?"slideOut":"slideIn"](E);this.store("slide:flag",!C);A=true;break;default:B.start(D,E);
|
||||
}if(!A){this.eliminate("slide:flag");}return this;}});Fx.Scroll=new Class({Extends:Fx,options:{offset:{x:0,y:0},wheelStops:true},initialize:function(B,A){this.element=this.subject=$(B);
|
||||
this.parent(A);var D=this.cancel.bind(this,false);if($type(this.element)!="element"){this.element=$(this.element.getDocument().body);}var C=this.element;
|
||||
if(this.options.wheelStops){this.addEvent("start",function(){C.addEvent("mousewheel",D);},true);this.addEvent("complete",function(){C.removeEvent("mousewheel",D);
|
||||
},true);}},set:function(){var A=Array.flatten(arguments);this.element.scrollTo(A[0],A[1]);},compute:function(E,D,C){var B=[];var A=2;A.times(function(F){B.push(Fx.compute(E[F],D[F],C));
|
||||
});return B;},start:function(C,H){if(!this.check(arguments.callee,C,H)){return this;}var E=this.element.getSize(),F=this.element.getScrollSize();var B=this.element.getScroll(),D={x:C,y:H};
|
||||
for(var G in D){var A=F[G]-E[G];if($chk(D[G])){D[G]=($type(D[G])=="number")?D[G].limit(0,A):A;}else{D[G]=B[G];}D[G]+=this.options.offset[G];}return this.parent([B.x,B.y],[D.x,D.y]);
|
||||
},toTop:function(){return this.start(false,0);},toLeft:function(){return this.start(0,false);},toRight:function(){return this.start("right",false);},toBottom:function(){return this.start(false,"bottom");
|
||||
},toElement:function(B){var A=$(B).getPosition(this.element);return this.start(A.x,A.y);}});Fx.Elements=new Class({Extends:Fx.CSS,initialize:function(B,A){this.elements=this.subject=$$(B);
|
||||
this.parent(A);},compute:function(G,H,I){var C={};for(var D in G){var A=G[D],E=H[D],F=C[D]={};for(var B in A){F[B]=this.parent(A[B],E[B],I);}}return C;
|
||||
},set:function(B){for(var C in B){var A=B[C];for(var D in A){this.render(this.elements[C],D,A[D],this.options.unit);}}return this;},start:function(C){if(!this.check(arguments.callee,C)){return this;
|
||||
}var H={},I={};for(var D in C){var F=C[D],A=H[D]={},G=I[D]={};for(var B in F){var E=this.prepare(this.elements[D],B,F[B]);A[B]=E.from;G[B]=E.to;}}return this.parent(H,I);
|
||||
}});var Drag=new Class({Implements:[Events,Options],options:{snap:6,unit:"px",grid:false,style:true,limit:false,handle:false,invert:false,preventDefault:false,modifiers:{x:"left",y:"top"}},initialize:function(){var B=Array.link(arguments,{options:Object.type,element:$defined});
|
||||
this.element=$(B.element);this.document=this.element.getDocument();this.setOptions(B.options||{});var A=$type(this.options.handle);this.handles=(A=="array"||A=="collection")?$$(this.options.handle):$(this.options.handle)||this.element;
|
||||
this.mouse={now:{},pos:{}};this.value={start:{},now:{}};this.selection=(Browser.Engine.trident)?"selectstart":"mousedown";this.bound={start:this.start.bind(this),check:this.check.bind(this),drag:this.drag.bind(this),stop:this.stop.bind(this),cancel:this.cancel.bind(this),eventStop:$lambda(false)};
|
||||
this.attach();},attach:function(){this.handles.addEvent("mousedown",this.bound.start);return this;},detach:function(){this.handles.removeEvent("mousedown",this.bound.start);
|
||||
return this;},start:function(C){if(this.options.preventDefault){C.preventDefault();}this.fireEvent("beforeStart",this.element);this.mouse.start=C.page;
|
||||
var A=this.options.limit;this.limit={x:[],y:[]};for(var D in this.options.modifiers){if(!this.options.modifiers[D]){continue;}if(this.options.style){this.value.now[D]=this.element.getStyle(this.options.modifiers[D]).toInt();
|
||||
}else{this.value.now[D]=this.element[this.options.modifiers[D]];}if(this.options.invert){this.value.now[D]*=-1;}this.mouse.pos[D]=C.page[D]-this.value.now[D];
|
||||
if(A&&A[D]){for(var B=2;B--;B){if($chk(A[D][B])){this.limit[D][B]=$lambda(A[D][B])();}}}}if($type(this.options.grid)=="number"){this.options.grid={x:this.options.grid,y:this.options.grid};
|
||||
}this.document.addEvents({mousemove:this.bound.check,mouseup:this.bound.cancel});this.document.addEvent(this.selection,this.bound.eventStop);},check:function(A){if(this.options.preventDefault){A.preventDefault();
|
||||
}var B=Math.round(Math.sqrt(Math.pow(A.page.x-this.mouse.start.x,2)+Math.pow(A.page.y-this.mouse.start.y,2)));if(B>this.options.snap){this.cancel();this.document.addEvents({mousemove:this.bound.drag,mouseup:this.bound.stop});
|
||||
this.fireEvent("start",this.element).fireEvent("snap",this.element);}},drag:function(A){if(this.options.preventDefault){A.preventDefault();}this.mouse.now=A.page;
|
||||
for(var B in this.options.modifiers){if(!this.options.modifiers[B]){continue;}this.value.now[B]=this.mouse.now[B]-this.mouse.pos[B];if(this.options.invert){this.value.now[B]*=-1;
|
||||
}if(this.options.limit&&this.limit[B]){if($chk(this.limit[B][1])&&(this.value.now[B]>this.limit[B][1])){this.value.now[B]=this.limit[B][1];}else{if($chk(this.limit[B][0])&&(this.value.now[B]<this.limit[B][0])){this.value.now[B]=this.limit[B][0];
|
||||
}}}if(this.options.grid[B]){this.value.now[B]-=(this.value.now[B]%this.options.grid[B]);}if(this.options.style){this.element.setStyle(this.options.modifiers[B],this.value.now[B]+this.options.unit);
|
||||
}else{this.element[this.options.modifiers[B]]=this.value.now[B];}}this.fireEvent("drag",this.element);},cancel:function(A){this.document.removeEvent("mousemove",this.bound.check);
|
||||
this.document.removeEvent("mouseup",this.bound.cancel);if(A){this.document.removeEvent(this.selection,this.bound.eventStop);this.fireEvent("cancel",this.element);
|
||||
}},stop:function(A){this.document.removeEvent(this.selection,this.bound.eventStop);this.document.removeEvent("mousemove",this.bound.drag);this.document.removeEvent("mouseup",this.bound.stop);
|
||||
if(A){this.fireEvent("complete",this.element);}}});Element.implement({makeResizable:function(A){return new Drag(this,$merge({modifiers:{x:"width",y:"height"}},A));
|
||||
}});Drag.Move=new Class({Extends:Drag,options:{droppables:[],container:false},initialize:function(C,B){this.parent(C,B);this.droppables=$$(this.options.droppables);
|
||||
this.container=$(this.options.container);if(this.container&&$type(this.container)!="element"){this.container=$(this.container.getDocument().body);}C=this.element;
|
||||
var D=C.getStyle("position");var A=(D!="static")?D:"absolute";if(C.getStyle("left")=="auto"||C.getStyle("top")=="auto"){C.position(C.getPosition(C.offsetParent));
|
||||
}C.setStyle("position",A);this.addEvent("start",function(){this.checkDroppables();},true);},start:function(B){if(this.container){var D=this.element,J=this.container,E=J.getCoordinates(D.offsetParent),F={},A={};
|
||||
["top","right","bottom","left"].each(function(K){F[K]=J.getStyle("padding-"+K).toInt();A[K]=D.getStyle("margin-"+K).toInt();},this);var C=D.offsetWidth+A.left+A.right,I=D.offsetHeight+A.top+A.bottom;
|
||||
var H=[E.left+F.left,E.right-F.right-C];var G=[E.top+F.top,E.bottom-F.bottom-I];this.options.limit={x:H,y:G};}this.parent(B);},checkAgainst:function(B){B=B.getCoordinates();
|
||||
var A=this.mouse.now;return(A.x>B.left&&A.x<B.right&&A.y<B.bottom&&A.y>B.top);},checkDroppables:function(){var A=this.droppables.filter(this.checkAgainst,this).getLast();
|
||||
if(this.overed!=A){if(this.overed){this.fireEvent("leave",[this.element,this.overed]);}if(A){this.overed=A;this.fireEvent("enter",[this.element,A]);}else{this.overed=null;
|
||||
}}},drag:function(A){this.parent(A);if(this.droppables.length){this.checkDroppables();}},stop:function(A){this.checkDroppables();this.fireEvent("drop",[this.element,this.overed]);
|
||||
this.overed=null;return this.parent(A);}});Element.implement({makeDraggable:function(A){return new Drag.Move(this,A);}});Hash.Cookie=new Class({Extends:Cookie,options:{autoSave:true},initialize:function(B,A){this.parent(B,A);
|
||||
this.load();},save:function(){var A=JSON.encode(this.hash);if(!A||A.length>4096){return false;}if(A=="{}"){this.dispose();}else{this.write(A);}return true;
|
||||
},load:function(){this.hash=new Hash(JSON.decode(this.read(),true));return this;}});Hash.Cookie.implement((function(){var A={};Hash.each(Hash.prototype,function(C,B){A[B]=function(){var D=C.apply(this.hash,arguments);
|
||||
if(this.options.autoSave){this.save();}return D;};});return A;})());var Color=new Native({initialize:function(B,C){if(arguments.length>=3){C="rgb";B=Array.slice(arguments,0,3);
|
||||
}else{if(typeof B=="string"){if(B.match(/rgb/)){B=B.rgbToHex().hexToRgb(true);}else{if(B.match(/hsb/)){B=B.hsbToRgb();}else{B=B.hexToRgb(true);}}}}C=C||"rgb";
|
||||
switch(C){case"hsb":var A=B;B=B.hsbToRgb();B.hsb=A;break;case"hex":B=B.hexToRgb(true);break;}B.rgb=B.slice(0,3);B.hsb=B.hsb||B.rgbToHsb();B.hex=B.rgbToHex();
|
||||
return $extend(B,this);}});Color.implement({mix:function(){var A=Array.slice(arguments);var C=($type(A.getLast())=="number")?A.pop():50;var B=this.slice();
|
||||
A.each(function(D){D=new Color(D);for(var E=0;E<3;E++){B[E]=Math.round((B[E]/100*(100-C))+(D[E]/100*C));}});return new Color(B,"rgb");},invert:function(){return new Color(this.map(function(A){return 255-A;
|
||||
}));},setHue:function(A){return new Color([A,this.hsb[1],this.hsb[2]],"hsb");},setSaturation:function(A){return new Color([this.hsb[0],A,this.hsb[2]],"hsb");
|
||||
},setBrightness:function(A){return new Color([this.hsb[0],this.hsb[1],A],"hsb");}});function $RGB(C,B,A){return new Color([C,B,A],"rgb");}function $HSB(C,B,A){return new Color([C,B,A],"hsb");
|
||||
}function $HEX(A){return new Color(A,"hex");}Array.implement({rgbToHsb:function(){var B=this[0],C=this[1],J=this[2];var G,F,H;var I=Math.max(B,C,J),E=Math.min(B,C,J);
|
||||
var K=I-E;H=I/255;F=(I!=0)?K/I:0;if(F==0){G=0;}else{var D=(I-B)/K;var A=(I-C)/K;var L=(I-J)/K;if(B==I){G=L-A;}else{if(C==I){G=2+D-L;}else{G=4+A-D;}}G/=6;
|
||||
if(G<0){G++;}}return[Math.round(G*360),Math.round(F*100),Math.round(H*100)];},hsbToRgb:function(){var C=Math.round(this[2]/100*255);if(this[1]==0){return[C,C,C];
|
||||
}else{var A=this[0]%360;var E=A%60;var F=Math.round((this[2]*(100-this[1]))/10000*255);var D=Math.round((this[2]*(6000-this[1]*E))/600000*255);var B=Math.round((this[2]*(6000-this[1]*(60-E)))/600000*255);
|
||||
switch(Math.floor(A/60)){case 0:return[C,B,F];case 1:return[D,C,F];case 2:return[F,C,B];case 3:return[F,D,C];case 4:return[B,F,C];case 5:return[C,F,D];
|
||||
}}return false;}});String.implement({rgbToHsb:function(){var A=this.match(/\d{1,3}/g);return(A)?hsb.rgbToHsb():null;},hsbToRgb:function(){var A=this.match(/\d{1,3}/g);
|
||||
return(A)?A.hsbToRgb():null;}});var Group=new Class({initialize:function(){this.instances=Array.flatten(arguments);this.events={};this.checker={};},addEvent:function(B,A){this.checker[B]=this.checker[B]||{};
|
||||
this.events[B]=this.events[B]||[];if(this.events[B].contains(A)){return false;}else{this.events[B].push(A);}this.instances.each(function(C,D){C.addEvent(B,this.check.bind(this,[B,C,D]));
|
||||
},this);return this;},check:function(C,A,B){this.checker[C][B]=true;var D=this.instances.every(function(F,E){return this.checker[C][E]||false;},this);if(!D){return ;
|
||||
}this.checker[C]={};this.events[C].each(function(E){E.call(this,this.instances,A);},this);}});var Asset=new Hash({javascript:function(F,D){D=$extend({onload:$empty,document:document,check:$lambda(true)},D);
|
||||
var B=new Element("script",{src:F,type:"text/javascript"});var E=D.onload.bind(B),A=D.check,G=D.document;delete D.onload;delete D.check;delete D.document;
|
||||
B.addEvents({load:E,readystatechange:function(){if(["loaded","complete"].contains(this.readyState)){E();}}}).setProperties(D);if(Browser.Engine.webkit419){var C=(function(){if(!$try(A)){return ;
|
||||
}$clear(C);E();}).periodical(50);}return B.inject(G.head);},css:function(B,A){return new Element("link",$merge({rel:"stylesheet",media:"screen",type:"text/css",href:B},A)).inject(document.head);
|
||||
},image:function(C,B){B=$merge({onload:$empty,onabort:$empty,onerror:$empty},B);var D=new Image();var A=$(D)||new Element("img");["load","abort","error"].each(function(E){var F="on"+E;
|
||||
var G=B[F];delete B[F];D[F]=function(){if(!D){return ;}if(!A.parentNode){A.width=D.width;A.height=D.height;}D=D.onload=D.onabort=D.onerror=null;G.delay(1,A,A);
|
||||
A.fireEvent(E,A,1);};});D.src=A.src=C;if(D&&D.complete){D.onload.delay(1);}return A.setProperties(B);},images:function(D,C){C=$merge({onComplete:$empty,onProgress:$empty},C);
|
||||
if(!D.push){D=[D];}var A=[];var B=0;D.each(function(F){var E=new Asset.image(F,{onload:function(){C.onProgress.call(this,B,D.indexOf(F));B++;if(B==D.length){C.onComplete();
|
||||
}}});A.push(E);});return new Elements(A);}});var Sortables=new Class({Implements:[Events,Options],options:{snap:4,opacity:1,clone:false,revert:false,handle:false,constrain:false},initialize:function(A,B){this.setOptions(B);
|
||||
this.elements=[];this.lists=[];this.idle=true;this.addLists($$($(A)||A));if(!this.options.clone){this.options.revert=false;}if(this.options.revert){this.effect=new Fx.Morph(null,$merge({duration:250,link:"cancel"},this.options.revert));
|
||||
}},attach:function(){this.addLists(this.lists);return this;},detach:function(){this.lists=this.removeLists(this.lists);return this;},addItems:function(){Array.flatten(arguments).each(function(A){this.elements.push(A);
|
||||
var B=A.retrieve("sortables:start",this.start.bindWithEvent(this,A));(this.options.handle?A.getElement(this.options.handle)||A:A).addEvent("mousedown",B);
|
||||
},this);return this;},addLists:function(){Array.flatten(arguments).each(function(A){this.lists.push(A);this.addItems(A.getChildren());},this);return this;
|
||||
},removeItems:function(){var A=[];Array.flatten(arguments).each(function(B){A.push(B);this.elements.erase(B);var C=B.retrieve("sortables:start");(this.options.handle?B.getElement(this.options.handle)||B:B).removeEvent("mousedown",C);
|
||||
},this);return $$(A);},removeLists:function(){var A=[];Array.flatten(arguments).each(function(B){A.push(B);this.lists.erase(B);this.removeItems(B.getChildren());
|
||||
},this);return $$(A);},getClone:function(B,A){if(!this.options.clone){return new Element("div").inject(document.body);}if($type(this.options.clone)=="function"){return this.options.clone.call(this,B,A,this.list);
|
||||
}return A.clone(true).setStyles({margin:"0px",position:"absolute",visibility:"hidden",width:A.getStyle("width")}).inject(this.list).position(A.getPosition(A.getOffsetParent()));
|
||||
},getDroppables:function(){var A=this.list.getChildren();if(!this.options.constrain){A=this.lists.concat(A).erase(this.list);}return A.erase(this.clone).erase(this.element);
|
||||
},insert:function(C,B){var A="inside";if(this.lists.contains(B)){this.list=B;this.drag.droppables=this.getDroppables();}else{A=this.element.getAllPrevious().contains(B)?"before":"after";
|
||||
}this.element.inject(B,A);this.fireEvent("sort",[this.element,this.clone]);},start:function(B,A){if(!this.idle){return ;}this.idle=false;this.element=A;
|
||||
this.opacity=A.get("opacity");this.list=A.getParent();this.clone=this.getClone(B,A);this.drag=new Drag.Move(this.clone,{snap:this.options.snap,container:this.options.constrain&&this.element.getParent(),droppables:this.getDroppables(),onSnap:function(){B.stop();
|
||||
this.clone.setStyle("visibility","visible");this.element.set("opacity",this.options.opacity||0);this.fireEvent("start",[this.element,this.clone]);}.bind(this),onEnter:this.insert.bind(this),onCancel:this.reset.bind(this),onComplete:this.end.bind(this)});
|
||||
this.clone.inject(this.element,"before");this.drag.start(B);},end:function(){this.drag.detach();this.element.set("opacity",this.opacity);if(this.effect){var A=this.element.getStyles("width","height");
|
||||
var B=this.clone.computePosition(this.element.getPosition(this.clone.offsetParent));this.effect.element=this.clone;this.effect.start({top:B.top,left:B.left,width:A.width,height:A.height,opacity:0.25}).chain(this.reset.bind(this));
|
||||
}else{this.reset();}},reset:function(){this.idle=true;this.clone.destroy();this.fireEvent("complete",this.element);},serialize:function(){var C=Array.link(arguments,{modifier:Function.type,index:$defined});
|
||||
var B=this.lists.map(function(D){return D.getChildren().map(C.modifier||function(E){return E.get("id");},this);},this);var A=C.index;if(this.lists.length==1){A=0;
|
||||
}return $chk(A)&&A>=0&&A<this.lists.length?B[A]:B;}});var Tips=new Class({Implements:[Events,Options],options:{onShow:function(A){A.setStyle("visibility","visible");
|
||||
},onHide:function(A){A.setStyle("visibility","hidden");},showDelay:100,hideDelay:100,className:null,offsets:{x:16,y:16},fixed:false},initialize:function(){var C=Array.link(arguments,{options:Object.type,elements:$defined});
|
||||
this.setOptions(C.options||null);this.tip=new Element("div").inject(document.body);if(this.options.className){this.tip.addClass(this.options.className);
|
||||
}var B=new Element("div",{"class":"tip-top"}).inject(this.tip);this.container=new Element("div",{"class":"tip"}).inject(this.tip);var A=new Element("div",{"class":"tip-bottom"}).inject(this.tip);
|
||||
this.tip.setStyles({position:"absolute",top:0,left:0,visibility:"hidden"});if(C.elements){this.attach(C.elements);}},attach:function(A){$$(A).each(function(D){var G=D.retrieve("tip:title",D.get("title"));
|
||||
var F=D.retrieve("tip:text",D.get("rel")||D.get("href"));var E=D.retrieve("tip:enter",this.elementEnter.bindWithEvent(this,D));var C=D.retrieve("tip:leave",this.elementLeave.bindWithEvent(this,D));
|
||||
D.addEvents({mouseenter:E,mouseleave:C});if(!this.options.fixed){var B=D.retrieve("tip:move",this.elementMove.bindWithEvent(this,D));D.addEvent("mousemove",B);
|
||||
}D.store("tip:native",D.get("title"));D.erase("title");},this);return this;},detach:function(A){$$(A).each(function(C){C.removeEvent("mouseenter",C.retrieve("tip:enter")||$empty);
|
||||
C.removeEvent("mouseleave",C.retrieve("tip:leave")||$empty);C.removeEvent("mousemove",C.retrieve("tip:move")||$empty);C.eliminate("tip:enter").eliminate("tip:leave").eliminate("tip:move");
|
||||
var B=C.retrieve("tip:native");if(B){C.set("title",B);}});return this;},elementEnter:function(B,A){$A(this.container.childNodes).each(Element.dispose);
|
||||
var D=A.retrieve("tip:title");if(D){this.titleElement=new Element("div",{"class":"tip-title"}).inject(this.container);this.fill(this.titleElement,D);}var C=A.retrieve("tip:text");
|
||||
if(C){this.textElement=new Element("div",{"class":"tip-text"}).inject(this.container);this.fill(this.textElement,C);}this.timer=$clear(this.timer);this.timer=this.show.delay(this.options.showDelay,this);
|
||||
this.position((!this.options.fixed)?B:{page:A.getPosition()});},elementLeave:function(A){$clear(this.timer);this.timer=this.hide.delay(this.options.hideDelay,this);
|
||||
},elementMove:function(A){this.position(A);},position:function(D){var B=window.getSize(),A=window.getScroll();var E={x:this.tip.offsetWidth,y:this.tip.offsetHeight};
|
||||
var C={x:"left",y:"top"};for(var F in C){var G=D.page[F]+this.options.offsets[F];if((G+E[F]-A[F])>B[F]){G=D.page[F]-this.options.offsets[F]-E[F];}this.tip.setStyle(C[F],G);
|
||||
}},fill:function(A,B){(typeof B=="string")?A.set("html",B):A.adopt(B);},show:function(){this.fireEvent("show",this.tip);},hide:function(){this.fireEvent("hide",this.tip);
|
||||
}});var SmoothScroll=new Class({Extends:Fx.Scroll,initialize:function(B,C){C=C||document;var E=C.getDocument(),D=C.getWindow();this.parent(E,B);this.links=(this.options.links)?$$(this.options.links):$$(E.links);
|
||||
var A=D.location.href.match(/^[^#]*/)[0]+"#";this.links.each(function(G){if(G.href.indexOf(A)!=0){return ;}var F=G.href.substr(A.length);if(F&&$(F)){this.useLink(G,F);
|
||||
}},this);if(!Browser.Engine.webkit419){this.addEvent("complete",function(){D.location.hash=this.anchor;},true);}},useLink:function(B,A){B.addEvent("click",function(C){this.anchor=A;
|
||||
this.toElement(A);C.stop();}.bind(this));}});var Slider=new Class({Implements:[Events,Options],options:{onTick:function(A){if(this.options.snap){A=this.toPosition(this.step);
|
||||
}this.knob.setStyle(this.property,A);},snap:false,offset:0,range:false,wheel:false,steps:100,mode:"horizontal"},initialize:function(E,A,D){this.setOptions(D);
|
||||
this.element=$(E);this.knob=$(A);this.previousChange=this.previousEnd=this.step=-1;this.element.addEvent("mousedown",this.clickedElement.bind(this));if(this.options.wheel){this.element.addEvent("mousewheel",this.scrolledElement.bindWithEvent(this));
|
||||
}var F,B={},C={x:false,y:false};switch(this.options.mode){case"vertical":this.axis="y";this.property="top";F="offsetHeight";break;case"horizontal":this.axis="x";
|
||||
this.property="left";F="offsetWidth";}this.half=this.knob[F]/2;this.full=this.element[F]-this.knob[F]+(this.options.offset*2);this.min=$chk(this.options.range[0])?this.options.range[0]:0;
|
||||
this.max=$chk(this.options.range[1])?this.options.range[1]:this.options.steps;this.range=this.max-this.min;this.steps=this.options.steps||this.full;this.stepSize=Math.abs(this.range)/this.steps;
|
||||
this.stepWidth=this.stepSize*this.full/Math.abs(this.range);this.knob.setStyle("position","relative").setStyle(this.property,-this.options.offset);C[this.axis]=this.property;
|
||||
B[this.axis]=[-this.options.offset,this.full-this.options.offset];this.drag=new Drag(this.knob,{snap:0,limit:B,modifiers:C,onDrag:this.draggedKnob.bind(this),onStart:this.draggedKnob.bind(this),onComplete:function(){this.draggedKnob();
|
||||
this.end();}.bind(this)});if(this.options.snap){this.drag.options.grid=Math.ceil(this.stepWidth);this.drag.options.limit[this.axis][1]=this.full;}},set:function(A){if(!((this.range>0)^(A<this.min))){A=this.min;
|
||||
}if(!((this.range>0)^(A>this.max))){A=this.max;}this.step=Math.round(A);this.checkStep();this.end();this.fireEvent("tick",this.toPosition(this.step));return this;
|
||||
},clickedElement:function(C){var B=this.range<0?-1:1;var A=C.page[this.axis]-this.element.getPosition()[this.axis]-this.half;A=A.limit(-this.options.offset,this.full-this.options.offset);
|
||||
this.step=Math.round(this.min+B*this.toStep(A));this.checkStep();this.end();this.fireEvent("tick",A);},scrolledElement:function(A){var B=(this.options.mode=="horizontal")?(A.wheel<0):(A.wheel>0);
|
||||
this.set(B?this.step-this.stepSize:this.step+this.stepSize);A.stop();},draggedKnob:function(){var B=this.range<0?-1:1;var A=this.drag.value.now[this.axis];
|
||||
A=A.limit(-this.options.offset,this.full-this.options.offset);this.step=Math.round(this.min+B*this.toStep(A));this.checkStep();},checkStep:function(){if(this.previousChange!=this.step){this.previousChange=this.step;
|
||||
this.fireEvent("change",this.step);}},end:function(){if(this.previousEnd!==this.step){this.previousEnd=this.step;this.fireEvent("complete",this.step+"");
|
||||
}},toStep:function(A){var B=(A+this.options.offset)*this.stepSize/this.full*this.steps;return this.options.steps?Math.round(B-=B%this.stepSize):B;},toPosition:function(A){return(this.full*Math.abs(this.min-A))/(this.steps*this.stepSize)-this.options.offset;
|
||||
}});var Scroller=new Class({Implements:[Events,Options],options:{area:20,velocity:1,onChange:function(A,B){this.element.scrollTo(A,B);}},initialize:function(B,A){this.setOptions(A);
|
||||
this.element=$(B);this.listener=($type(this.element)!="element")?$(this.element.getDocument().body):this.element;this.timer=null;this.coord=this.getCoords.bind(this);
|
||||
},start:function(){this.listener.addEvent("mousemove",this.coord);},stop:function(){this.listener.removeEvent("mousemove",this.coord);this.timer=$clear(this.timer);
|
||||
},getCoords:function(A){this.page=(this.listener.get("tag")=="body")?A.client:A.page;if(!this.timer){this.timer=this.scroll.periodical(50,this);}},scroll:function(){var B=this.element.getSize(),A=this.element.getScroll(),E=this.element.getPosition(),D={x:0,y:0};
|
||||
for(var C in this.page){if(this.page[C]<(this.options.area+E[C])&&A[C]!=0){D[C]=(this.page[C]-this.options.area-E[C])*this.options.velocity;}else{if(this.page[C]+this.options.area>(B[C]+E[C])&&B[C]+B[C]!=A[C]){D[C]=(this.page[C]-B[C]+this.options.area-E[C])*this.options.velocity;
|
||||
}}}if(D.y||D.x){this.fireEvent("change",[A.x+D.x,A.y+D.y]);}}});var Accordion=new Class({Extends:Fx.Elements,options:{display:0,show:false,height:true,width:false,opacity:true,fixedHeight:false,fixedWidth:false,wait:false,alwaysHide:false},initialize:function(){var C=Array.link(arguments,{container:Element.type,options:Object.type,togglers:$defined,elements:$defined});
|
||||
this.parent(C.elements,C.options);this.togglers=$$(C.togglers);this.container=$(C.container);this.previous=-1;if(this.options.alwaysHide){this.options.wait=true;
|
||||
}if($chk(this.options.show)){this.options.display=false;this.previous=this.options.show;}if(this.options.start){this.options.display=false;this.options.show=false;
|
||||
}this.effects={};if(this.options.opacity){this.effects.opacity="fullOpacity";}if(this.options.width){this.effects.width=this.options.fixedWidth?"fullWidth":"offsetWidth";
|
||||
}if(this.options.height){this.effects.height=this.options.fixedHeight?"fullHeight":"scrollHeight";}for(var B=0,A=this.togglers.length;B<A;B++){this.addSection(this.togglers[B],this.elements[B]);
|
||||
}this.elements.each(function(E,D){if(this.options.show===D){this.fireEvent("active",[this.togglers[D],E]);}else{for(var F in this.effects){E.setStyle(F,0);
|
||||
}}},this);if($chk(this.options.display)){this.display(this.options.display);}},addSection:function(E,C,G){E=$(E);C=$(C);var F=this.togglers.contains(E);
|
||||
var B=this.togglers.length;this.togglers.include(E);this.elements.include(C);if(B&&(!F||G)){G=$pick(G,B-1);E.inject(this.togglers[G],"before");C.inject(E,"after");
|
||||
}else{if(this.container&&!F){E.inject(this.container);C.inject(this.container);}}var A=this.togglers.indexOf(E);E.addEvent("click",this.display.bind(this,A));
|
||||
if(this.options.height){C.setStyles({"padding-top":0,"border-top":"none","padding-bottom":0,"border-bottom":"none"});}if(this.options.width){C.setStyles({"padding-left":0,"border-left":"none","padding-right":0,"border-right":"none"});
|
||||
}C.fullOpacity=1;if(this.options.fixedWidth){C.fullWidth=this.options.fixedWidth;}if(this.options.fixedHeight){C.fullHeight=this.options.fixedHeight;}C.setStyle("overflow","hidden");
|
||||
if(!F){for(var D in this.effects){C.setStyle(D,0);}}return this;},display:function(A){A=($type(A)=="element")?this.elements.indexOf(A):A;if((this.timer&&this.options.wait)||(A===this.previous&&!this.options.alwaysHide)){return this;
|
||||
}this.previous=A;var B={};this.elements.each(function(E,D){B[D]={};var C=(D!=A)||(this.options.alwaysHide&&(E.offsetHeight>0));this.fireEvent(C?"background":"active",[this.togglers[D],E]);
|
||||
for(var F in this.effects){B[D][F]=C?0:E[this.effects[F]];}},this);return this.start(B);}});
|
||||
@@ -1,15 +0,0 @@
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* Used for replication support
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
function divShowHideFunc(ahref, id) {
|
||||
$(ahref).addEvent('click', function() {
|
||||
if ($(id).getStyle('display')=="none")
|
||||
$(id).tween('display', 'block');
|
||||
else
|
||||
$(id).tween('display', 'none');
|
||||
});
|
||||
}
|
||||
174
js/navigation.js
174
js/navigation.js
@@ -1,174 +0,0 @@
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* function used in or for navigation frame
|
||||
*/
|
||||
|
||||
/**
|
||||
* init
|
||||
*/
|
||||
var today = new Date();
|
||||
var expires = new Date(today.getTime() + (56 * 86400000));
|
||||
var pma_navi_width;
|
||||
var pma_saveframesize_timeout = null;
|
||||
|
||||
/**
|
||||
* opens/closes (hides/shows) tree elements
|
||||
*
|
||||
* @param string id id of the element in the DOM
|
||||
* @param boolean only_open do not close/hide element
|
||||
*/
|
||||
function toggle(id, only_open) {
|
||||
var el = document.getElementById('subel' + id);
|
||||
if (! el) {
|
||||
return false;
|
||||
}
|
||||
|
||||
var img = document.getElementById('el' + id + 'Img');
|
||||
|
||||
if (el.style.display == 'none' || only_open) {
|
||||
el.style.display = '';
|
||||
if (img) {
|
||||
img.src = image_minus;
|
||||
img.alt = '-';
|
||||
}
|
||||
} else {
|
||||
el.style.display = 'none';
|
||||
if (img) {
|
||||
img.src = image_plus;
|
||||
img.alt = '+';
|
||||
}
|
||||
}
|
||||
return true;
|
||||
}
|
||||
|
||||
function PMA_callFunctionDelayed(myfunction, delay)
|
||||
{
|
||||
if (typeof pma_saveframesize_timeout == "number") {
|
||||
window.clearTimeout(pma_saveframesize_timeout);
|
||||
pma_saveframesize_timeout = null;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* saves current navigation frame width in a cookie
|
||||
* usally called on resize of the navigation frame
|
||||
*/
|
||||
function PMA_saveFrameSizeReal()
|
||||
{
|
||||
if (parent.text_dir == 'ltr') {
|
||||
pma_navi_width = parseInt(parent.document.getElementById('mainFrameset').cols)
|
||||
} else {
|
||||
pma_navi_width = parent.document.getElementById('mainFrameset').cols.match(/\d+$/)
|
||||
}
|
||||
if ((pma_navi_width > 0) && (pma_navi_width != PMA_getCookie('pma_navi_width'))) {
|
||||
PMA_setCookie('pma_navi_width', pma_navi_width, expires);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* calls PMA_saveFrameSizeReal with delay
|
||||
*/
|
||||
function PMA_saveFrameSize()
|
||||
{
|
||||
//alert(typeof(pma_saveframesize_timeout) + ' : ' + pma_saveframesize_timeout);
|
||||
|
||||
if (typeof pma_saveframesize_timeout == "number") {
|
||||
window.clearTimeout(pma_saveframesize_timeout);
|
||||
pma_saveframesize_timeout = null;
|
||||
}
|
||||
|
||||
pma_saveframesize_timeout = window.setTimeout(PMA_saveFrameSizeReal, 2000);
|
||||
}
|
||||
|
||||
/**
|
||||
* sets navigation frame width to the value stored in the cookie
|
||||
* usally called on document load
|
||||
*/
|
||||
function PMA_setFrameSize()
|
||||
{
|
||||
pma_navi_width = PMA_getCookie('pma_navi_width');
|
||||
//alert('from cookie: ' + typeof(pma_navi_width) + ' : ' + pma_navi_width);
|
||||
if (pma_navi_width != null) {
|
||||
if (parent.text_dir == 'ltr') {
|
||||
parent.document.getElementById('mainFrameset').cols = pma_navi_width + ',*';
|
||||
} else {
|
||||
parent.document.getElementById('mainFrameset').cols = '*,' + pma_navi_width;
|
||||
}
|
||||
//alert('framesize set');
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* retrieves a named value from cookie
|
||||
*
|
||||
* @param string name name of the value to retrieve
|
||||
* @return string value value for the given name from cookie
|
||||
*/
|
||||
function PMA_getCookie(name) {
|
||||
var start = document.cookie.indexOf(name + "=");
|
||||
var len = start + name.length + 1;
|
||||
if ((!start) && (name != document.cookie.substring(0, name.length))) {
|
||||
return null;
|
||||
}
|
||||
if (start == -1) {
|
||||
return null;
|
||||
}
|
||||
var end = document.cookie.indexOf(";", len);
|
||||
if (end == -1) {
|
||||
end = document.cookie.length;
|
||||
}
|
||||
return unescape(document.cookie.substring(len,end));
|
||||
}
|
||||
|
||||
/**
|
||||
* stores a named value into cookie
|
||||
*
|
||||
* @param string name name of value
|
||||
* @param string value value to be stored
|
||||
* @param Date expires expire time
|
||||
* @param string path
|
||||
* @param string domain
|
||||
* @param boolean secure
|
||||
*/
|
||||
function PMA_setCookie(name, value, expires, path, domain, secure) {
|
||||
document.cookie = name + "=" + escape(value) +
|
||||
( (expires) ? ";expires=" + expires.toGMTString() : "") +
|
||||
( (path) ? ";path=" + path : "") +
|
||||
( (domain) ? ";domain=" + domain : "") +
|
||||
( (secure) ? ";secure" : "");
|
||||
}
|
||||
|
||||
/**
|
||||
* hide all LI elements with second A tag which doesn`t contain requested value
|
||||
*
|
||||
* @param string value requested value
|
||||
*
|
||||
*/
|
||||
function fast_filter(value){
|
||||
var oTarget = document.getElementById("subel0");
|
||||
if(!oTarget || !document.getElementById('fast_filter')) return false;
|
||||
if(value!=document.getElementById('fast_filter').value) return false;
|
||||
document.getElementById('fast_filter').disabled=true;
|
||||
for(var iCh in oTarget.childNodes){
|
||||
var oCh = oTarget.childNodes.item(iCh);
|
||||
if(!oCh) continue;
|
||||
if(oCh.nodeName=="LI"){
|
||||
if(value=="") oCh.style.display="";
|
||||
else{
|
||||
var i=0;
|
||||
for(var iA in oCh.childNodes){
|
||||
var oA = oCh.childNodes.item(iA);
|
||||
if(!oA) continue;
|
||||
if(oA.nodeName=="A"){
|
||||
if(i==0) i = 1;
|
||||
else{
|
||||
if(oA.innerHTML.indexOf(value)==-1) oCh.style.display="none";
|
||||
else oCh.style.display="";
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
document.getElementById('fast_filter').disabled=false;
|
||||
}
|
||||
@@ -1,42 +0,0 @@
|
||||
function PMA_queryAutoCommit()
|
||||
{
|
||||
document.getElementById('sqlqueryform').target = window.opener.frame_content.name;
|
||||
document.getElementById('sqlqueryform').submit();
|
||||
return;
|
||||
}
|
||||
|
||||
function PMA_querywindowCommit(tab)
|
||||
{
|
||||
document.getElementById('hiddenqueryform').querydisplay_tab.value = tab;
|
||||
document.getElementById('hiddenqueryform').submit();
|
||||
return false;
|
||||
}
|
||||
|
||||
function PMA_querywindowSetFocus()
|
||||
{
|
||||
document.getElementById('sqlquery').focus();
|
||||
}
|
||||
|
||||
function PMA_querywindowResize()
|
||||
{
|
||||
// for Gecko
|
||||
if (typeof(self.sizeToContent) == 'function') {
|
||||
self.sizeToContent();
|
||||
//self.scrollbars.visible = false;
|
||||
// give some more space ... to prevent 'fli(pp/ck)ing'
|
||||
self.resizeBy(10, 50);
|
||||
return;
|
||||
}
|
||||
|
||||
// for IE, Opera
|
||||
if (document.getElementById && typeof(document.getElementById('querywindowcontainer')) != 'undefined') {
|
||||
|
||||
// get content size
|
||||
var newWidth = document.getElementById('querywindowcontainer').offsetWidth;
|
||||
var newHeight = document.getElementById('querywindowcontainer').offsetHeight;
|
||||
|
||||
// set size to contentsize
|
||||
// plus some offset for scrollbars, borders, statusbar, menus ...
|
||||
self.resizeTo(newWidth + 45, newHeight + 75);
|
||||
}
|
||||
}
|
||||
@@ -1,95 +0,0 @@
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* function used in server privilege pages
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
* Validates the password field in a form
|
||||
*
|
||||
* @uses PMA_messages['strPasswordEmpty']
|
||||
* @uses PMA_messages['strPasswordNotSame']
|
||||
* @param object the form
|
||||
* @return boolean whether the field value is valid or not
|
||||
*/
|
||||
function checkPassword(the_form)
|
||||
{
|
||||
// Did the user select 'no password'?
|
||||
if (typeof(the_form.elements['nopass']) != 'undefined'
|
||||
&& the_form.elements['nopass'][0].checked) {
|
||||
return true;
|
||||
} else if (typeof(the_form.elements['pred_password']) != 'undefined'
|
||||
&& (the_form.elements['pred_password'].value == 'none'
|
||||
|| the_form.elements['pred_password'].value == 'keep')) {
|
||||
return true;
|
||||
}
|
||||
|
||||
var password = the_form.elements['pma_pw'];
|
||||
var password_repeat = the_form.elements['pma_pw2'];
|
||||
var alert_msg = false;
|
||||
|
||||
if (password.value == '') {
|
||||
alert_msg = PMA_messages['strPasswordEmpty'];
|
||||
} else if (password.value != password_repeat.value) {
|
||||
alert_msg = PMA_messages['strPasswordNotSame'];
|
||||
}
|
||||
|
||||
if (alert_msg) {
|
||||
alert(alert_msg);
|
||||
password.value = '';
|
||||
password_repeat.value = '';
|
||||
password.focus();
|
||||
return false;
|
||||
}
|
||||
|
||||
return true;
|
||||
} // end of the 'checkPassword()' function
|
||||
|
||||
|
||||
/**
|
||||
* Validates the "add a user" form
|
||||
*
|
||||
* @return boolean whether the form is validated or not
|
||||
*/
|
||||
function checkAddUser(the_form)
|
||||
{
|
||||
if (the_form.elements['pred_hostname'].value == 'userdefined' && the_form.elements['hostname'].value == '') {
|
||||
alert(PMA_messages['strHostEmpty']);
|
||||
the_form.elements['hostname'].focus();
|
||||
return false;
|
||||
}
|
||||
|
||||
if (the_form.elements['pred_username'].value == 'userdefined' && the_form.elements['username'].value == '') {
|
||||
alert(PMA_messages['strUserEmpty']);
|
||||
the_form.elements['username'].focus();
|
||||
return false;
|
||||
}
|
||||
|
||||
return checkPassword(the_form);
|
||||
} // end of the 'checkAddUser()' function
|
||||
|
||||
|
||||
/**
|
||||
* Generate a new password and copy it to the password input areas
|
||||
*
|
||||
* @param object the form that holds the password fields
|
||||
*
|
||||
* @return boolean always true
|
||||
*/
|
||||
function suggestPassword(passwd_form) {
|
||||
// restrict the password to just letters and numbers to avoid problems:
|
||||
// "editors and viewers regard the password as multiple words and
|
||||
// things like double click no longer work"
|
||||
var pwchars = "abcdefhjmnpqrstuvwxyz23456789ABCDEFGHJKLMNPQRSTUVWYXZ";
|
||||
var passwordlength = 16; // do we want that to be dynamic? no, keep it simple :)
|
||||
var passwd = passwd_form.generated_pw;
|
||||
passwd.value = '';
|
||||
|
||||
for ( i = 0; i < passwordlength; i++ ) {
|
||||
passwd.value += pwchars.charAt( Math.floor( Math.random() * pwchars.length ) )
|
||||
}
|
||||
passwd_form.text_pma_pw.value = passwd.value;
|
||||
passwd_form.text_pma_pw2.value = passwd.value;
|
||||
return true;
|
||||
}
|
||||
358
js/tbl_change.js
358
js/tbl_change.js
@@ -1,358 +0,0 @@
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* function used in table data manipulation pages
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
* Modify from controls when the "NULL" checkbox is selected
|
||||
*
|
||||
* @param string the MySQL field type
|
||||
* @param string the urlencoded field name - OBSOLETE
|
||||
* @param string the md5 hashed field name
|
||||
* @param string the multi_edit row sequence number
|
||||
*
|
||||
* @return boolean always true
|
||||
*/
|
||||
function nullify(theType, urlField, md5Field, multi_edit)
|
||||
{
|
||||
var rowForm = document.forms['insertForm'];
|
||||
|
||||
if (typeof(rowForm.elements['funcs' + multi_edit + '[' + md5Field + ']']) != 'undefined') {
|
||||
rowForm.elements['funcs' + multi_edit + '[' + md5Field + ']'].selectedIndex = -1;
|
||||
}
|
||||
|
||||
// "SET" field , "ENUM" field with more than 20 characters
|
||||
// or foreign key field (drop-down)
|
||||
if (theType == 1 || theType == 3 || theType == 4) {
|
||||
rowForm.elements['field_' + md5Field + multi_edit + '[]'].selectedIndex = -1;
|
||||
}
|
||||
// Other "ENUM" field
|
||||
else if (theType == 2) {
|
||||
var elts = rowForm.elements['field_' + md5Field + multi_edit + '[]'];
|
||||
// when there is just one option in ENUM:
|
||||
if (elts.checked) {
|
||||
elts.checked = false;
|
||||
} else {
|
||||
var elts_cnt = elts.length;
|
||||
for (var i = 0; i < elts_cnt; i++ ) {
|
||||
elts[i].checked = false;
|
||||
} // end for
|
||||
|
||||
} // end if
|
||||
}
|
||||
// foreign key field (with browsing icon for foreign values)
|
||||
else if (theType == 6) {
|
||||
rowForm.elements['field_' + md5Field + multi_edit + '[]'].value = '';
|
||||
}
|
||||
// Other field types
|
||||
else /*if (theType == 5)*/ {
|
||||
rowForm.elements['fields' + multi_edit + '[' + md5Field + ']'].value = '';
|
||||
} // end if... else if... else
|
||||
|
||||
return true;
|
||||
} // end of the 'nullify()' function
|
||||
|
||||
|
||||
/**
|
||||
* Unchecks the "NULL" control when a function has been selected or a value
|
||||
* entered
|
||||
*
|
||||
* @param string the urlencoded field name
|
||||
* @param string the multi_edit row sequence number
|
||||
*
|
||||
* @return boolean always true
|
||||
*/
|
||||
function unNullify(urlField, multi_edit)
|
||||
{
|
||||
var rowForm = document.forms['insertForm'];
|
||||
|
||||
if (typeof(rowForm.elements['fields_null[multi_edit][' + multi_edit + '][' + urlField + ']']) != 'undefined') {
|
||||
rowForm.elements['fields_null[multi_edit][' + multi_edit + '][' + urlField + ']'].checked = false
|
||||
} // end if
|
||||
|
||||
if (typeof(rowForm.elements['insert_ignore_' + multi_edit]) != 'undefined') {
|
||||
rowForm.elements['insert_ignore_' + multi_edit].checked = false
|
||||
} // end if
|
||||
|
||||
return true;
|
||||
} // end of the 'unNullify()' function
|
||||
|
||||
var day;
|
||||
var month;
|
||||
var year;
|
||||
var hour;
|
||||
var minute;
|
||||
var second;
|
||||
var clock_set = 0;
|
||||
|
||||
/**
|
||||
* Opens calendar window.
|
||||
*
|
||||
* @param string calendar.php parameters
|
||||
* @param string form name
|
||||
* @param string id of field name
|
||||
* @param string edit type - date/timestamp
|
||||
* @param string id of the corresponding checkbox for NULL
|
||||
*/
|
||||
function openCalendar(params, form, field, type, fieldNull) {
|
||||
window.open("./calendar.php?" + params, "calendar", "width=400,height=200,status=yes");
|
||||
dateField = eval("document." + form + "." + field);
|
||||
dateType = type;
|
||||
if (fieldNull != '') {
|
||||
dateFieldNull = eval("document." + form + "." + fieldNull);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Formats number to two digits.
|
||||
*
|
||||
* @param int number to format.
|
||||
* @param string type of number
|
||||
*/
|
||||
function formatNum2(i, valtype) {
|
||||
f = (i < 10 ? '0' : '') + i;
|
||||
if (valtype && valtype != '') {
|
||||
switch(valtype) {
|
||||
case 'month':
|
||||
f = (f > 12 ? 12 : f);
|
||||
break;
|
||||
|
||||
case 'day':
|
||||
f = (f > 31 ? 31 : f);
|
||||
break;
|
||||
|
||||
case 'hour':
|
||||
f = (f > 24 ? 24 : f);
|
||||
break;
|
||||
|
||||
default:
|
||||
case 'second':
|
||||
case 'minute':
|
||||
f = (f > 59 ? 59 : f);
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
return f;
|
||||
}
|
||||
|
||||
/**
|
||||
* Formats number to two digits.
|
||||
*
|
||||
* @param int number to format.
|
||||
* @param int default value
|
||||
* @param string type of number
|
||||
*/
|
||||
function formatNum2d(i, default_v, valtype) {
|
||||
i = parseInt(i, 10);
|
||||
if (isNaN(i)) return default_v;
|
||||
return formatNum2(i, valtype)
|
||||
}
|
||||
|
||||
/**
|
||||
* Formats number to four digits.
|
||||
*
|
||||
* @param int number to format.
|
||||
*/
|
||||
function formatNum4(i) {
|
||||
i = parseInt(i, 10)
|
||||
return (i < 1000 ? i < 100 ? i < 10 ? '000' : '00' : '0' : '') + i;
|
||||
}
|
||||
|
||||
/**
|
||||
* Initializes calendar window.
|
||||
*/
|
||||
function initCalendar() {
|
||||
if (!year && !month && !day) {
|
||||
/* Called for first time */
|
||||
if (window.opener.dateField.value) {
|
||||
value = window.opener.dateField.value;
|
||||
if (window.opener.dateType == 'datetime' || window.opener.dateType == 'date') {
|
||||
if (window.opener.dateType == 'datetime') {
|
||||
parts = value.split(' ');
|
||||
value = parts[0];
|
||||
|
||||
if (parts[1]) {
|
||||
time = parts[1].split(':');
|
||||
hour = parseInt(time[0],10);
|
||||
minute = parseInt(time[1],10);
|
||||
second = parseInt(time[2],10);
|
||||
}
|
||||
}
|
||||
date = value.split("-");
|
||||
day = parseInt(date[2],10);
|
||||
month = parseInt(date[1],10) - 1;
|
||||
year = parseInt(date[0],10);
|
||||
} else {
|
||||
year = parseInt(value.substr(0,4),10);
|
||||
month = parseInt(value.substr(4,2),10) - 1;
|
||||
day = parseInt(value.substr(6,2),10);
|
||||
hour = parseInt(value.substr(8,2),10);
|
||||
minute = parseInt(value.substr(10,2),10);
|
||||
second = parseInt(value.substr(12,2),10);
|
||||
}
|
||||
}
|
||||
if (isNaN(year) || isNaN(month) || isNaN(day) || day == 0) {
|
||||
dt = new Date();
|
||||
year = dt.getFullYear();
|
||||
month = dt.getMonth();
|
||||
day = dt.getDate();
|
||||
}
|
||||
if (isNaN(hour) || isNaN(minute) || isNaN(second)) {
|
||||
dt = new Date();
|
||||
hour = dt.getHours();
|
||||
minute = dt.getMinutes();
|
||||
second = dt.getSeconds();
|
||||
}
|
||||
} else {
|
||||
/* Moving in calendar */
|
||||
if (month > 11) {
|
||||
month = 0;
|
||||
year++;
|
||||
}
|
||||
if (month < 0) {
|
||||
month = 11;
|
||||
year--;
|
||||
}
|
||||
}
|
||||
|
||||
if (document.getElementById) {
|
||||
cnt = document.getElementById("calendar_data");
|
||||
} else if (document.all) {
|
||||
cnt = document.all["calendar_data"];
|
||||
}
|
||||
|
||||
cnt.innerHTML = "";
|
||||
|
||||
str = ""
|
||||
|
||||
//heading table
|
||||
str += '<table class="calendar"><tr><th width="50%">';
|
||||
str += '<form method="NONE" onsubmit="return 0">';
|
||||
str += '<a href="javascript:month--; initCalendar();">«</a> ';
|
||||
str += '<select id="select_month" name="monthsel" onchange="month = parseInt(document.getElementById(\'select_month\').value); initCalendar();">';
|
||||
for (i =0; i < 12; i++) {
|
||||
if (i == month) selected = ' selected="selected"';
|
||||
else selected = '';
|
||||
str += '<option value="' + i + '" ' + selected + '>' + month_names[i] + '</option>';
|
||||
}
|
||||
str += '</select>';
|
||||
str += ' <a href="javascript:month++; initCalendar();">»</a>';
|
||||
str += '</form>';
|
||||
str += '</th><th width="50%">';
|
||||
str += '<form method="NONE" onsubmit="return 0">';
|
||||
str += '<a href="javascript:year--; initCalendar();">«</a> ';
|
||||
str += '<select id="select_year" name="yearsel" onchange="year = parseInt(document.getElementById(\'select_year\').value); initCalendar();">';
|
||||
for (i = year - 25; i < year + 25; i++) {
|
||||
if (i == year) selected = ' selected="selected"';
|
||||
else selected = '';
|
||||
str += '<option value="' + i + '" ' + selected + '>' + i + '</option>';
|
||||
}
|
||||
str += '</select>';
|
||||
str += ' <a href="javascript:year++; initCalendar();">»</a>';
|
||||
str += '</form>';
|
||||
str += '</th></tr></table>';
|
||||
|
||||
str += '<table class="calendar"><tr>';
|
||||
for (i = 0; i < 7; i++) {
|
||||
str += "<th>" + day_names[i] + "</th>";
|
||||
}
|
||||
str += "</tr>";
|
||||
|
||||
var firstDay = new Date(year, month, 1).getDay();
|
||||
var lastDay = new Date(year, month + 1, 0).getDate();
|
||||
|
||||
str += "<tr>";
|
||||
|
||||
dayInWeek = 0;
|
||||
for (i = 0; i < firstDay; i++) {
|
||||
str += "<td> </td>";
|
||||
dayInWeek++;
|
||||
}
|
||||
for (i = 1; i <= lastDay; i++) {
|
||||
if (dayInWeek == 7) {
|
||||
str += "</tr><tr>";
|
||||
dayInWeek = 0;
|
||||
}
|
||||
|
||||
dispmonth = 1 + month;
|
||||
|
||||
if (window.opener.dateType == 'datetime' || window.opener.dateType == 'date') {
|
||||
actVal = "" + formatNum4(year) + "-" + formatNum2(dispmonth, 'month') + "-" + formatNum2(i, 'day');
|
||||
} else {
|
||||
actVal = "" + formatNum4(year) + formatNum2(dispmonth, 'month') + formatNum2(i, 'day');
|
||||
}
|
||||
if (i == day) {
|
||||
style = ' class="selected"';
|
||||
current_date = actVal;
|
||||
} else {
|
||||
style = '';
|
||||
}
|
||||
str += "<td" + style + "><a href=\"javascript:returnDate('" + actVal + "');\">" + i + "</a></td>"
|
||||
dayInWeek++;
|
||||
}
|
||||
for (i = dayInWeek; i < 7; i++) {
|
||||
str += "<td> </td>";
|
||||
}
|
||||
|
||||
str += "</tr></table>";
|
||||
|
||||
cnt.innerHTML = str;
|
||||
|
||||
// Should we handle time also?
|
||||
if (window.opener.dateType != 'date' && !clock_set) {
|
||||
|
||||
if (document.getElementById) {
|
||||
cnt = document.getElementById("clock_data");
|
||||
} else if (document.all) {
|
||||
cnt = document.all["clock_data"];
|
||||
}
|
||||
|
||||
str = '';
|
||||
init_hour = hour;
|
||||
init_minute = minute;
|
||||
init_second = second;
|
||||
str += '<fieldset>';
|
||||
str += '<form method="NONE" class="clock" onsubmit="returnDate(\'' + current_date + '\')">';
|
||||
str += '<input id="hour" type="text" size="2" maxlength="2" onblur="this.value=formatNum2d(this.value, init_hour, \'hour\'); init_hour = this.value;" value="' + formatNum2(hour, 'hour') + '" />:';
|
||||
str += '<input id="minute" type="text" size="2" maxlength="2" onblur="this.value=formatNum2d(this.value, init_minute, \'minute\'); init_minute = this.value;" value="' + formatNum2(minute, 'minute') + '" />:';
|
||||
str += '<input id="second" type="text" size="2" maxlength="2" onblur="this.value=formatNum2d(this.value, init_second, \'second\'); init_second = this.value;" value="' + formatNum2(second, 'second') + '" />';
|
||||
str += ' ';
|
||||
str += '<input type="submit" value="' + submit_text + '"/>';
|
||||
str += '</form>';
|
||||
str += '</fieldset>';
|
||||
|
||||
cnt.innerHTML = str;
|
||||
clock_set = 1;
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
/**
|
||||
* Returns date from calendar.
|
||||
*
|
||||
* @param string date text
|
||||
*/
|
||||
function returnDate(d) {
|
||||
txt = d;
|
||||
if (window.opener.dateType != 'date') {
|
||||
// need to get time
|
||||
h = parseInt(document.getElementById('hour').value,10);
|
||||
m = parseInt(document.getElementById('minute').value,10);
|
||||
s = parseInt(document.getElementById('second').value,10);
|
||||
if (window.opener.dateType == 'datetime') {
|
||||
txt += ' ' + formatNum2(h, 'hour') + ':' + formatNum2(m, 'minute') + ':' + formatNum2(s, 'second');
|
||||
} else {
|
||||
// timestamp
|
||||
txt += formatNum2(h, 'hour') + formatNum2(m, 'minute') + formatNum2(s, 'second');
|
||||
}
|
||||
}
|
||||
|
||||
window.opener.dateField.value = txt;
|
||||
if (typeof(window.opener.dateFieldNull) != 'undefined') {
|
||||
window.opener.dateFieldNull.checked = false;
|
||||
}
|
||||
window.close();
|
||||
}
|
||||
212
js/tooltip.js
212
js/tooltip.js
@@ -1,212 +0,0 @@
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* Displays the Tooltips (hints), if we have some
|
||||
* 2005-01-20 added by Michael Keck (mkkeck)
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
*
|
||||
*/
|
||||
var ttXpos = 0, ttYpos = 0;
|
||||
var ttXadd = 10, ttYadd = -10;
|
||||
var ttDisplay = 0, ttHoldIt = 0;
|
||||
|
||||
// Check if browser does support dynamic content and dhtml
|
||||
if (document.getElementById) {
|
||||
// DOM-compatible browsers
|
||||
var ttDOM = 1;
|
||||
} else {
|
||||
// the old Netscape 4
|
||||
var ttNS4 = (document.layers) ? 1 : 0;
|
||||
// browser wich uses document.all
|
||||
var ttIE4 = (document.all) ? 1 : 0;
|
||||
}
|
||||
|
||||
var myTooltipContainer = null;
|
||||
|
||||
/**
|
||||
* initialize tooltip
|
||||
*/
|
||||
function PMA_TT_init()
|
||||
{
|
||||
// get all 'light bubbles' on page
|
||||
var tooltip_icons = window.parent.getElementsByClassName('footnotemarker', document, 'sup');
|
||||
var tooltip_count = tooltip_icons.length;
|
||||
|
||||
if (tooltip_count < 1) {
|
||||
// no 'bubbles' found
|
||||
return;
|
||||
}
|
||||
|
||||
// insert tooltip container
|
||||
myTooltipContainer = document.createElement("div");
|
||||
myTooltipContainer.id = 'TooltipContainer';
|
||||
window.parent.addEvent(myTooltipContainer, 'mouseover', holdTooltip);
|
||||
window.parent.addEvent(myTooltipContainer, 'mouseout', swapTooltip);
|
||||
document.body.appendChild(myTooltipContainer);
|
||||
|
||||
// capture mouse-events
|
||||
for (i = 0; i < tooltip_count; i++) {
|
||||
window.parent.addEvent(tooltip_icons[i], 'mousemove', mouseMove);
|
||||
window.parent.addEvent(tooltip_icons[i], 'mouseover', pmaTooltip);
|
||||
window.parent.addEvent(tooltip_icons[i], 'mouseout', swapTooltip);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* init the tooltip and write the text into it
|
||||
*
|
||||
* @param string theText tooltip content
|
||||
*/
|
||||
function PMA_TT_setText(theText)
|
||||
{
|
||||
if (ttDOM || ttIE4) { // document.getEelementById || document.all
|
||||
myTooltipContainer.innerHTML = ""; // we should empty it first
|
||||
myTooltipContainer.innerHTML = theText;
|
||||
} else if (ttNS4) { // document.layers
|
||||
var layerNS4 = myTooltipContainer.document;
|
||||
layerNS4.write(theText);
|
||||
layerNS4.close();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* @var integer
|
||||
*/
|
||||
var ttTimerID = 0;
|
||||
|
||||
/**
|
||||
* swap the Tooltip // show and hide
|
||||
*
|
||||
* @param boolean stat view status
|
||||
*/
|
||||
function swapTooltip(stat)
|
||||
{
|
||||
if (ttHoldIt != 1) {
|
||||
if (stat == 'true') {
|
||||
showTooltip(true);
|
||||
} else if (ttDisplay) {
|
||||
ttTimerID = setTimeout("showTooltip(false);", 500);
|
||||
} else {
|
||||
showTooltip(true);
|
||||
}
|
||||
} else {
|
||||
if (ttTimerID) {
|
||||
clearTimeout(ttTimerID);
|
||||
ttTimerID = 0;
|
||||
}
|
||||
showTooltip(true);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* show / hide the Tooltip
|
||||
*
|
||||
* @param boolean stat view status
|
||||
*/
|
||||
function showTooltip(stat)
|
||||
{
|
||||
if (stat == false) {
|
||||
if (ttNS4)
|
||||
myTooltipContainer.visibility = "hide";
|
||||
else
|
||||
myTooltipContainer.style.visibility = "hidden";
|
||||
ttDisplay = 0;
|
||||
} else {
|
||||
if (ttNS4)
|
||||
myTooltipContainer.visibility = "show";
|
||||
else
|
||||
myTooltipContainer.style.visibility = "visible";
|
||||
ttDisplay = 1;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* hold it, if we create or move the mouse over the tooltip
|
||||
*/
|
||||
function holdTooltip()
|
||||
{
|
||||
ttHoldIt = 1;
|
||||
swapTooltip('true');
|
||||
ttHoldIt = 0;
|
||||
}
|
||||
|
||||
/**
|
||||
* move the tooltip to mouse position
|
||||
*
|
||||
* @param integer posX horiz. position
|
||||
* @param integer posY vert. position
|
||||
*/
|
||||
function moveTooltip(posX, posY)
|
||||
{
|
||||
if (ttDOM || ttIE4) {
|
||||
myTooltipContainer.style.left = posX + "px";
|
||||
myTooltipContainer.style.top = posY + "px";
|
||||
} else if (ttNS4) {
|
||||
myTooltipContainer.left = posX;
|
||||
myTooltipContainer.top = posY;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* build the tooltip
|
||||
* usally called from eventhandler
|
||||
*
|
||||
* @param string theText tooltip content
|
||||
*/
|
||||
function pmaTooltip(e)
|
||||
{
|
||||
var theText = document.getElementById('footnote_' + this.innerHTML).innerHTML;
|
||||
|
||||
var plusX = 0, plusY = 0, docX = 0, docY = 0;
|
||||
var divHeight = myTooltipContainer.clientHeight;
|
||||
var divWidth = myTooltipContainer.clientWidth;
|
||||
|
||||
if (navigator.appName.indexOf("Explorer") != -1) {
|
||||
// IE ...
|
||||
if (document.documentElement && document.documentElement.scrollTop) {
|
||||
plusX = document.documentElement.scrollLeft;
|
||||
plusY = document.documentElement.scrollTop;
|
||||
docX = document.documentElement.offsetWidth + plusX;
|
||||
docY = document.documentElement.offsetHeight + plusY;
|
||||
} else {
|
||||
plusX = document.body.scrollLeft;
|
||||
plusY = document.body.scrollTop;
|
||||
docX = document.body.offsetWidth + plusX;
|
||||
docY = document.body.offsetHeight + plusY;
|
||||
}
|
||||
} else {
|
||||
docX = document.body.clientWidth;
|
||||
docY = document.body.clientHeight;
|
||||
}
|
||||
|
||||
ttXpos = ttXpos + plusX;
|
||||
ttYpos = ttYpos + plusY;
|
||||
|
||||
if ((ttXpos + divWidth) > docX)
|
||||
ttXpos = ttXpos - (divWidth + (ttXadd * 2));
|
||||
if ((ttYpos + divHeight) > docY)
|
||||
ttYpos = ttYpos - (divHeight + (ttYadd * 2));
|
||||
|
||||
PMA_TT_setText(theText);
|
||||
moveTooltip((ttXpos + ttXadd), (ttYpos + ttYadd));
|
||||
holdTooltip();
|
||||
}
|
||||
|
||||
/**
|
||||
* register mouse moves
|
||||
*
|
||||
* @param event e
|
||||
*/
|
||||
function mouseMove(e) {
|
||||
if ( typeof( event ) != 'undefined' ) {
|
||||
ttXpos = event.x;
|
||||
ttYpos = event.y;
|
||||
} else {
|
||||
ttXpos = e.pageX;
|
||||
ttYpos = e.pageY;
|
||||
}
|
||||
moveTooltip((ttXpos + ttXadd), (ttYpos + ttYadd));
|
||||
}
|
||||
@@ -1,32 +0,0 @@
|
||||
#!/bin/bash
|
||||
# $Id$
|
||||
#
|
||||
# Shell script that adds a message to all message files (Lem9)
|
||||
#
|
||||
# Example: add_message.sh '$strNewMessage' 'new message contents'
|
||||
#
|
||||
|
||||
if [ $# -ne 2 ] ; then
|
||||
echo "usage: add_message.sh '\$strNewMessage' 'new message contents'"
|
||||
exit 1
|
||||
fi
|
||||
|
||||
for file in *.inc.php
|
||||
do
|
||||
echo $file " "
|
||||
grep -v '?>' ${file} > ${file}.new
|
||||
case $file in
|
||||
english*)
|
||||
echo "$1 = '"$2"';" >> ${file}.new
|
||||
;;
|
||||
*)
|
||||
echo "$1 = '"$2"'; //to translate" >> ${file}.new
|
||||
;;
|
||||
esac
|
||||
echo "?>" >> ${file}.new
|
||||
rm $file
|
||||
mv ${file}.new $file
|
||||
done
|
||||
./sort_lang.sh english*
|
||||
echo " "
|
||||
echo "Message added to all message files (including english)"
|
||||
@@ -1,32 +0,0 @@
|
||||
#!/bin/bash
|
||||
# $Id$
|
||||
#
|
||||
# Shell script that adds a message file to all message files
|
||||
# adding "//to translate" on each line
|
||||
#
|
||||
# Example: add_message_file.sh xxx
|
||||
#
|
||||
if [ $# -ne 1 ] ; then
|
||||
echo "usage: add_message_file.sh filename"
|
||||
exit 1
|
||||
fi
|
||||
|
||||
for file in *.inc.php
|
||||
do
|
||||
echo $file " "
|
||||
grep -v '?>' ${file} > ${file}.new
|
||||
case $file in
|
||||
english*)
|
||||
sed -n 's/\(.*\);/\1;/p' $1 >> ${file}.new
|
||||
;;
|
||||
*)
|
||||
sed -n 's/\(.*\);/\1; \/\/to translate/p' $1 >> ${file}.new
|
||||
;;
|
||||
esac
|
||||
echo "?>" >> ${file}.new
|
||||
rm $file
|
||||
mv ${file}.new $file
|
||||
done
|
||||
./sort_lang.sh english*
|
||||
echo " "
|
||||
echo "Messages added to add message files (including english)"
|
||||
File diff suppressed because it is too large
Load Diff
File diff suppressed because it is too large
Load Diff
File diff suppressed because it is too large
Load Diff
File diff suppressed because it is too large
Load Diff
File diff suppressed because it is too large
Load Diff
File diff suppressed because it is too large
Load Diff
File diff suppressed because it is too large
Load Diff
File diff suppressed because it is too large
Load Diff
File diff suppressed because it is too large
Load Diff
File diff suppressed because it is too large
Load Diff
File diff suppressed because it is too large
Load Diff
File diff suppressed because it is too large
Load Diff
@@ -1,62 +0,0 @@
|
||||
#!/bin/sh
|
||||
# $Id$
|
||||
##
|
||||
# Shell script to check that all language files are syncronized
|
||||
# Catches duplicate/missing strings
|
||||
#
|
||||
# Robin Johnson <robbat2@users.sourceforge.net>
|
||||
# August 9, 2002
|
||||
##
|
||||
|
||||
MASTER="english-utf-8.inc.php"
|
||||
TMPDIR="tmp-check"
|
||||
FILEPAT="*.inc.php"
|
||||
STRINGMATCH='^[[:space:]]*\$[[:alnum:]_]+[[:blank:]]+='
|
||||
IGNOREMATCH='strEncto|strKanjiEncodConvert|strXkana|allow_recoding|doc_lang'
|
||||
|
||||
if [ "`which diffstat`" = "" ] ; then
|
||||
echo 'You need diffstat to use this!'
|
||||
exit 1
|
||||
fi
|
||||
|
||||
rm -rf $TMPDIR
|
||||
mkdir -p $TMPDIR
|
||||
|
||||
# Build the list of variables in each file
|
||||
echo "Building data"
|
||||
for f in $FILEPAT;
|
||||
do
|
||||
awk "/$STRINGMATCH/ && ! /$IGNOREMATCH/ { print \$1 }" $f | sort > $TMPDIR/$f
|
||||
done
|
||||
|
||||
|
||||
# Build the diff files used for checking
|
||||
# And if there are no differences, delete the empty files
|
||||
echo "Comparing data"
|
||||
for f in $FILEPAT;
|
||||
do
|
||||
if [ ! $MASTER = $f ]; then
|
||||
if diff -u $TMPDIR/$MASTER $TMPDIR/$f >$TMPDIR/$f.diff ; then
|
||||
rm -f $TMPDIR/$f.diff $TMPDIR/$f
|
||||
fi
|
||||
fi
|
||||
done
|
||||
|
||||
# Cleanup
|
||||
rm -f $TMPDIR/$MASTER
|
||||
|
||||
# Build the nice difference table
|
||||
echo "Differences"
|
||||
diffstat -f 0 $TMPDIR/*.diff >$TMPDIR/diffstat 2>/dev/null
|
||||
echo "Dupe Miss Filename"
|
||||
head -n -1 $TMPDIR/diffstat | \
|
||||
while read filename sep change add plus sub minus edits exclaim;
|
||||
do
|
||||
echo "$add $sub $filename";
|
||||
done
|
||||
|
||||
echo
|
||||
echo "Dupe = Duplicate Variables"
|
||||
echo "Miss = Missing Variables"
|
||||
echo "For exact problem listings, look in the $TMPDIR/ directory"
|
||||
echo "Please remember to remove '$TMPDIR/' once you are done"
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user