3.1
9
CREDITS
@@ -1,9 +0,0 @@
|
||||
$Id$
|
||||
|
||||
|
||||
phpMyAdmin - Credits
|
||||
====================
|
||||
|
||||
Please have a look to the Documentation.txt or
|
||||
Documentation.html files.
|
||||
|
782
ChangeLog
@@ -1,782 +0,0 @@
|
||||
----------------------
|
||||
phpMyAdmin - ChangeLog
|
||||
----------------------
|
||||
|
||||
$Id$
|
||||
$HeadURL: https://phpmyadmin.svn.sourceforge.net/svnroot/phpmyadmin/trunk/phpMyAdmin/ChangeLog $
|
||||
|
||||
3.1.0.0 (not yet released)
|
||||
+ [auth] Support for Swekey hardware authentication
|
||||
- bug #2046883 [core] Notices about deprecated dl() (so stop using it)
|
||||
+ BLOBstreaming support, thanks to Raj Kissu Rajandran and
|
||||
Google Summer of Code 2008
|
||||
+ patch #2067462 [lang] link FAQ references in messages,
|
||||
thanks to Thijs Kinkhorst - kink
|
||||
+ new setup script, thanks to Piotr Przybylski (work in progress)
|
||||
- rfe #1892243 [export] more links to documentation
|
||||
+ [auth] cookie auth now autogenerates blowfish_secret, but it has some
|
||||
limitations and you still should set it in config file
|
||||
+ [auth] cookie authentication is now the default
|
||||
+ [auth] do not allow root user without password unless explicitly enabled by
|
||||
AllowNoPasswordRoot
|
||||
+ rfe #1778908 [auth] arbitrary server auth can now also accept port
|
||||
- patch #2089240 [export] handle correctly switching SQL modes
|
||||
+ rfe #1612724 [export] add option to export without comments
|
||||
- bug #2090002 [display] Cannot edit row in VIEW
|
||||
- patch #2099962 [js] fix js error without frameset, thanks to Xuefer
|
||||
- patch #2099972 [structure] Display None when there is no default value,
|
||||
thanks to Xuefer - xuefer
|
||||
- patch #2122883 [PDF schema] Option to display just the keys,
|
||||
thanks to Samuel Sol Villar dos Santos - yohanleafheart
|
||||
+ rfe #1276463 [search] Search empty/not empty values
|
||||
+ rfe #823652 [structure] ENUM values: field size too small
|
||||
- [lang] Persian update, thanks to Goolex - goolex
|
||||
- [lang] Czech update, thanks to Nicky 726.
|
||||
|
||||
3.0.2.0 (not yet released)
|
||||
- [lang] Italian update, thanks to Luca and fantu
|
||||
- bug #2107583 [GUI] Leading newline truncated, thanks to Isart Montane
|
||||
- bug #2222230 [import] Assigning a value in import.php, thanks to
|
||||
Glen Arason
|
||||
|
||||
3.0.1.1 (2008-10-30)
|
||||
- [security] XSS in a Designer component
|
||||
|
||||
3.0.1.0 (2008-10-22)
|
||||
- bug #2134126 [GUI] SQL error after sorting a subset
|
||||
+ [lang] Catalan update, thanks to Xavier Navarro
|
||||
+ [lang] Russian update, thanks to Victor Volkov
|
||||
- patch #2143882 [import] Temporary uploaded file not deleted,
|
||||
thanks to David Misc - dmisc
|
||||
- bug #2136986 [auth] Cannot create database after session timeout
|
||||
- bug #1914066 [core] ForceSSL generates incorrectly escaped redirections,
|
||||
this time with the correct fix
|
||||
+ [lang] Hungarian update, thanks to Jozsef Tamas Herczeg - dodika
|
||||
- bug #2153970 [core] Properly truncate SQL to avoid half of html tags
|
||||
+ [lang] Romanian update, thanks to Sergiu Bivol - sbivol
|
||||
- bug #2161443 [structure] Incorrect index choice shown when modifying an
|
||||
index
|
||||
- bug #2127094 [interface] Misleading message after cancelling an action
|
||||
+ [lang] Croatian update, thanks to Renato Pavicic
|
||||
+ [lang] Finnish update, thanks to Jouni Kahkonen
|
||||
+ [lang] Polish update, thanks to Jakub Wilk
|
||||
+ [lang] Japanese update, thanks to Ishigaki Kenichi
|
||||
- patch #2176438 [privileges] Wrong message when changing password,
|
||||
thanks to incognito - zytisin
|
||||
- bug #2163437 [core] Cannot disable PMA tables
|
||||
- bug #2184240 [lang] Problems with Italian language file, thanks to Luca
|
||||
Rebellato
|
||||
- bug #2187193 [interface] ShowChgPassword setting not respected
|
||||
|
||||
3.0.0.0 (2008-09-27)
|
||||
+ [export] properly handle line breaks for YAML, thanks to Dan Barry -
|
||||
danbarry
|
||||
+ [navi] new parameter $cfg['LeftDefaultTabTable']
|
||||
+ [table] support MySQL 5.1 PARTITION: CREATE TABLE / Table structure,
|
||||
partition maintenance
|
||||
+ [privileges] support for EVENT and TRIGGER
|
||||
+ [error handler] NEW handle errors to prevent path disclosure and display/collect errors
|
||||
+ [mysqlnd] do not display $strMysqlLibDiffersServerVersion if the client
|
||||
is mysqlnd
|
||||
+ [webapp] experimental Mozilla Prism support
|
||||
+ [export] new plugin "codegen" for NHibernate, thanks to caocao; I'm
|
||||
looking for a name more descriptive than codegen, taking into account
|
||||
that it might later support other formats like JSON in the same plugin
|
||||
+ [export] new export to Texy! markup
|
||||
+ [lang] Finnish update, thanks to Jouni Kahkonen
|
||||
+ [config] new parameter $cfg['CheckConfigurationPermissions']
|
||||
+ [config] new parameter $cfg['Servers'][$i]['ShowDatabasesCommand']
|
||||
+ [config] new parameter $cfg['Servers'][$i]['CountTables']
|
||||
+ rfe #1775288 [transformation] proper display if IP-address stored as INT
|
||||
+ rfe #1758177 [core] Add the Geometry DataTypes
|
||||
+ rfe #1741101, patch #1798184 UUID default for CHAR(36) PRIMARY KEY,
|
||||
thanks to Gert Palok - gert_p
|
||||
- bug #1664240 [GUI] css height makes cfg TextareaRows useless
|
||||
- bug #1724217 [Create PHP Code] doesn't include newlines for text fields
|
||||
- bug #1845605 [i18n] translators.html still uses iso-8859-1
|
||||
- bug #1823018 [charset] Edit(Delete) img-links pointing to wrong row
|
||||
- bug #1826205 [export] Problems with yaml text export
|
||||
- bug #1344768 [database] create/alter table new field can not have empty string
|
||||
as default
|
||||
+ rfe #1840165 [interface] Enlarge column name field in vertical mode
|
||||
+ patch #1847534 [interface] New "Inside field" in db search,
|
||||
thanks to obiserver
|
||||
+ [GUI] Mootools js library (http://mootools.net) and new parameter
|
||||
$cfg['InitialSlidersState']
|
||||
* [core] cache some MySQL stats (do not query them with every page request)
|
||||
+ [view] clearer dialog WITH (CASCADED | LOCAL) CHECK OPTION
|
||||
+ [lang] Norwegian update, thanks to Sven-Erik Andersen
|
||||
+ [lang] Japanese update, thanks to Ishigaki Kenichi
|
||||
+ [lang] Italian update, thanks to Luca Rebellato
|
||||
+ [gui] Events
|
||||
* minimal support on db structure page
|
||||
* export
|
||||
+ [pdf] Merged tcpdf 2.2.002 (PHP5 version), thanks to Nicola Asuni
|
||||
+ [engines] Maria support
|
||||
+ [engines] MyISAM and InnoDB: support ROW_FORMAT table option
|
||||
+ prevent search indexes from indexing phpMyAdmin installations
|
||||
+ [engines] PBXT: table options, foreign key (relation view, designer)
|
||||
+ [lang] New Bangla, thanks to Raquibul Islam and Joy Kumar Nag
|
||||
+ [interface] Display options; thanks to Dave Grijalva
|
||||
for the idea about showing the display field while browsing
|
||||
- bug #1910621 [display] part 2: do not display a BINARY content as text
|
||||
+ [auth] support SweKey hardware authentication
|
||||
see http://phpmyadmin.net/auth_key
|
||||
+ rfe #1962383 [designer] Option to create a PDF page
|
||||
- patch #2007196, Typos in comments, thanks to knittl - knittl
|
||||
- bug #1982315 [GUI] Comma and quote in ENUM, thanks to Joshua Hogendorn
|
||||
+ [GUI] Color picker
|
||||
- bug #1970836 [parser] SQL parser is slow, thanks to Christian Schmidt
|
||||
+ rfe #1692928 [transformation] Option to disable browser transformations
|
||||
+ [import] Speed optimization to be able to import the sakila database
|
||||
+ [doc] Documentation for distributing phpMyAdmin in README.VENDOR.
|
||||
+ [display] headwords for sorted column
|
||||
- bug #2033962 [import] Cannot import zip file
|
||||
+ [lang] Swedish update, thanks to Björn T. Hallberg
|
||||
- bug #2050068 [gui] "Check tables having overhead" selects wrong tables
|
||||
+ [lang] Belarusian update, thanks to Jaska Zedlik
|
||||
+ [lang] Norwegian update, thanks to Sven-Erik Andersen
|
||||
+ [lang] Italian update, thanks to Luca Rebellato
|
||||
- [core] safer handling of temporary files with open_basedir (thanks to Thijs
|
||||
Kinkhorst)
|
||||
- [core] do not automatically set and create TempDir, it might lead to security
|
||||
issue (thanks to Thijs Kinkhorst)
|
||||
+ [lang] Czech update
|
||||
- bug #2066923 [display] Navi browse icon does not go to page 1
|
||||
- patch #2075263 [auth] Single sign-on and cookie clearing,
|
||||
thanks to Charles Suh - cws125
|
||||
- [doc] better documentation of $cfg['TempDir']
|
||||
- bug #2080963 [charset] Clarify doc and improved code, thanks to
|
||||
Victor Volkov - hanut
|
||||
- bug [charset] Cannot sort twice on a column when the table name
|
||||
contains accents
|
||||
+ [lang] Spanish update, thanks to Daniel Hinostroza
|
||||
+ [lang] Hungarian update, thanks to Jozsef Tamas Herczeg - dodika
|
||||
- bug #2113848 [navi] Page number after database switching
|
||||
- patch #2115966 [GUI] Checkboxes and IE 7, thanks to Martin - maschg
|
||||
- bug #1914066 [core] ForceSSL generates incorrectly escaped redirections
|
||||
|
||||
2.11.9.3 (2008-10-30)
|
||||
- [security] XSS in a Designer component
|
||||
|
||||
2.11.9.2 (2008-09-22)
|
||||
- [security] XSS in MSIE using NUL byte, thanks to JPCERT.
|
||||
|
||||
2.11.9.1 (2008-09-15)
|
||||
- [security] Code execution vulnerability, thanks to Norman Hippert
|
||||
|
||||
2.11.9.0 (2008-08-28)
|
||||
- bug #2031221 [auth] Links to version number on login screen
|
||||
- bug #2032707 [core] PMA does not start if ini_set() is disabled
|
||||
- bug #2004915 [bookmarks] Saved queries greater than 1000 chars not
|
||||
displayed, thanks to Maik Wiege - mswiege
|
||||
- bug #2037381 [export] Export type "replace" does not work
|
||||
- bug #2037375 [export] DROP PROCEDURE needs IF EXISTS
|
||||
- bug #2045512 [export] Numbers in Excel export
|
||||
- bug #2074250 [parser] Undefined variable seen_from
|
||||
|
||||
2.11.8.0 (2008-07-28)
|
||||
- patch #1987593 [interface] Table list pagination in navi,
|
||||
thanks to Jason Day - jday29
|
||||
- bug #1989081 [profiling] Profiling causes query to be executed again
|
||||
(really causes a problem in case of INSERT/UPDATE)
|
||||
- bug #1990342 [import] SQL file import very slow on Windows,
|
||||
thanks to Richard Heaton - wotnot
|
||||
- bug [XHTML] problem with tabindex and radio fields
|
||||
- bug #1971221 [interface] tabindex not set correctly
|
||||
- bug [views] VIEW name created via the GUI was not protected with backquotes
|
||||
- bug #1989813 [interface] Deleting multiple views (space in name)
|
||||
- bug #1992628 [parser] SQL parser removes essential space
|
||||
- bug #1989281 [export] Export fails if one table is marked as crashed
|
||||
- bug #2001005 [GUI] ARCHIVE cannot have indexes
|
||||
- bug #1989281 [export] CSV for MS Excel incorrect escaping of double quotes
|
||||
- bug #1959855 [interface] Font size option problem when no config file
|
||||
(todo (trunk): navi frame size does not change for theme original)
|
||||
- bug #1982489 [relation] Relationship view should check for changes
|
||||
- bug [history] Do not save too big queries in history
|
||||
- [security] Do not show version info on login screen
|
||||
- bug #2018595 [import] Potential data loss on import resubmit
|
||||
- patch #2020630 [export] Safari and timedate, thanks to Sebastian Mendel,
|
||||
Isaac Bennetch and Jürgen Wind
|
||||
- bug #2022182 [import, export] Import/Export fails because of Mac files
|
||||
- [security] protection against cross-frame scripting and
|
||||
new directive AllowThirdPartyFraming, thanks to YGN Ethical Hacker Group
|
||||
- [security] possible XSS during setup, thanks to YGN Ethical Hacker Group
|
||||
- [interface] revert language changing problem introduced with 2.11.7.1
|
||||
|
||||
2.11.7.1 (2008-07-15)
|
||||
- bug [security] XSRF/CSRF by manipulating the db,
|
||||
convcharset and collation_connection parameters,
|
||||
thanks to YGN Ethical Hacker Group
|
||||
|
||||
2.11.7.0 (2008-06-23)
|
||||
- bug #1908719 [interface] New field cannot be auto-increment and primary key
|
||||
- [dbi] Incorrect interpretation for some mysqli field flags
|
||||
- bug #1910621 [display] part 1: do not display a TEXT utf8_bin as BLOB
|
||||
(fixed for mysqli extension only)
|
||||
- [interface] sanitize the after_field parameter,
|
||||
thanks to Norman Hippert
|
||||
- [structure] do not remove the BINARY attribute in drop-down
|
||||
- bug #1955386 [session] Overriding session.hash_bits_per_character
|
||||
- [interface] sanitize the table comments in table print view,
|
||||
db print view and db data dictionary, thanks to Norman Hippert
|
||||
- bug #1939031 Auto_Increment selected for TimeStamp by Default
|
||||
- patch #1957998 [display] No tilde for InnoDB row counter when we know
|
||||
it for sure, thanks to Vladyslav Bakayev - dandy76
|
||||
- bug #1955572 [display] alt text causes duplicated strings
|
||||
- bug #1762029 [interface] Cannot upload BLOB into existing row
|
||||
- bug #1981043 [export] HTML in exports getting corrupted,
|
||||
thanks to Jason Judge - jasonjudge
|
||||
- bug #1936761 [interface] BINARY not treated as BLOB: update/delete issues
|
||||
- protection against XSS when register_globals is on and .htaccess has
|
||||
no effect, thanks to Tim Starling
|
||||
- bug #1996943 [export] Firefox 3 and .sql.gz (corrupted); detect Gecko 1.9,
|
||||
thanks to Jürgen Wind - windkiel
|
||||
|
||||
2.11.6.0 (2008-04-29)
|
||||
- bug #1903724 [interface] Displaying of very large queries in error message
|
||||
- bug #1905711 [compatibility] Functions deprecated in PHP 5.3: is_a() and
|
||||
get_magic_quotes_gpc(), thanks to Dmitry N. Shilnikov - yrtimd
|
||||
- bug [lang] catalan wrong accented characters
|
||||
- bug #1893034 [Export] SET NAMES for importing with command-line client
|
||||
+ [lang] Russian update, thanks to Victor Volkov
|
||||
- bug #1910485 [core] Unsetting the whitelist during the loop,
|
||||
thanks to Jeroen Vrijkorte - jv_map
|
||||
- bug #1906980 [Export] Import of VIEWs fails if temp table exists,
|
||||
thanks to Falk Nisius - klaf
|
||||
- bug #1812763 [Copy] Table copy when server is in ANSI_QUOTES sql_mode
|
||||
thanks to Tony Marston - tonymarston
|
||||
- bug #1918531 [compatibility] Navigation isn't w3.org valid
|
||||
thanks to Michael Keck - mkkeck
|
||||
- bug #1926357 [data] BIT defaults displayed incorrectly
|
||||
- patch #1930057 [auth] colon in password prevents HTTP login on CGI/IIS,
|
||||
thanks to Jürgen Wind - windkiel
|
||||
- patch #1929553 [lang] Don't output BOM character in Swedish language file,
|
||||
thanks to Samuel L. B. - samuellb
|
||||
- patch #1895796 [lang] Typo in Japanese lang files,
|
||||
thanks to tyman - acoustype
|
||||
- bug #1935652 [auth] Access denied (show warning about mcrypt on login page)
|
||||
- bug #1906983 [export] Reimport of FUNCTION fails
|
||||
- bug #1919808 [operations] Renaming a database fails to handle functions
|
||||
- bug #1934401 [core] Cannot force a language
|
||||
- bug #1944077 [core] Config file containing a BOM,
|
||||
thanks to Gaetano Giunta - ggiunta
|
||||
- bug #1947189 [scripts] Missing </head> in scripts/signon.php,
|
||||
thanks to Dolf Schimmel
|
||||
+ [lang] Romanian update, thanks to Sergiu Bivol - sbivol
|
||||
|
||||
2.11.5.2 (2008-04-22)
|
||||
- PMASA-2008-3 [security] File disclosure
|
||||
|
||||
2.11.5.1 (2008-03-29)
|
||||
- bug #1909711 [security] Sensitive data in session files
|
||||
|
||||
2.11.5.0 (2008-03-01)
|
||||
- bug #1862661 [GUI] Warn about rename deleting database
|
||||
- bug #1866041 [interface] Incorrect sorting with AS
|
||||
- bug #1871038 [import] Notice: undefined variable first_sql_delimiter
|
||||
- bug #1873110 [export] Problem exporting with a LIMIT clause
|
||||
- bug #1871164 [GUI] Empty and navigation frame synch.
|
||||
- patch #1873188 [GUI] Making db pager work when js is disabled,
|
||||
thanks to Jürgen Wind - windkiel
|
||||
- bug #1875010 [auth] MySQL server and client version mismatch (mysql ext.)
|
||||
- patch #1879031 [transform] dateformat transformation and UNIX timestamps,
|
||||
thanks to Tim Steiner - spam38
|
||||
- bug [import] Do not verify a missing enclosing character for CSV,
|
||||
because files generated by Excel don't have any enclosing character
|
||||
- bug #1799691 [export] "Propose table structure" and Export
|
||||
- bug #1884911 [GUI] Space usage
|
||||
- bug #1863326 [GUI] Wrong error message / no edit (Suhosin)
|
||||
- bug #1887204 [GUI] Order columns in result list messing up query
|
||||
- patch #1893538 [GUI] Display issues on Opera 9.50,
|
||||
thanks to Jürgen Wind - windkiel
|
||||
- bug [GUI] Do not display the database name used by the previous user,
|
||||
thanks to Ronny Görner
|
||||
- bug [security] Remove cookies from $_REQUEST for better coexistence with
|
||||
other applications, thanks to Richard Cunningham. See PMASA-2008-1.
|
||||
|
||||
2.11.4.0 (2008-01-12)
|
||||
- bug #1843428 [GUI] Space issue with DROP/DELETE/ALTER TABLE
|
||||
- bug #1807816 [search] regular expression search doesn't work with
|
||||
backslashes
|
||||
- bug #1843463 [GUI] DROP PROCEDURE does not show alert
|
||||
- bug #1835904 [GUI] Back link after a SQL error forgets the query
|
||||
- bug #1835654 [core] wrong escaping when using double quotes
|
||||
- bug #1817612 [cookies] Wrong cookie path on IIS with PHP-CGI,
|
||||
thanks to Carsten Wiedmann
|
||||
- bug #1848889 [export] export trigger should use DROP TRIGGER IF EXISTS
|
||||
- bug #1851833 [display] Sorting forgets an explicit LIMIT
|
||||
(fix for sorting on column headers)
|
||||
- bug #1764182 [cookies] Suhosin cookie encryption breaks phpMyAdmin
|
||||
- bug #1798786 [import] Wrong error when a string contains semicolon
|
||||
- bug #1813508 [login] Missing parameter: field after re-login
|
||||
- bug #1710144 [parser] Space after COUNT breaks Export but not Query
|
||||
- bug #1783620 [parser] Subquery results without "as" are ignored
|
||||
- bug #1821264 [display] MaxTableList and INFORMATION_SCHEMA
|
||||
- bug #1859460 [display] Operations and many databases
|
||||
- bug #1814679 [display] Database selection pagination when switching servers
|
||||
- patch #1861717 [export] CSV Escape character not exported right,
|
||||
thanks to nicolasdigraf
|
||||
- bug #1864468 [display] Theme does not switch to darkblue_orange
|
||||
- bug #1847409 [security] Path disclosure on darkblue_orange/layout.inc.php,
|
||||
thanks to Jürgen Wind - windkiel
|
||||
|
||||
2.11.3.0 (2007-12-08)
|
||||
- patch #1818389 to remove a notice (failed to flush buffer), thanks to
|
||||
Bertrand
|
||||
- patch #1821154, HTTP authentication: fix auth working with php/mod_fastcgi,
|
||||
thanks to yarodin
|
||||
- wrong default charset in case of broken session
|
||||
- bug #1824506 [profiling] Profile command repeated on older MySQL servers
|
||||
- bug #1825172 [export] Exporting and functions
|
||||
- bug #1817224 [import] Incorrect detection of file_uploads in some cases,
|
||||
thanks to Juergen Wind
|
||||
- bug #1777249 [display] Do not underline links in left panel (in default
|
||||
themes)
|
||||
- bug #1826022 [privileges] unable to add user (MySQL 3.23) since PMA 2.11.2
|
||||
- bug #1823045 [import] Error importing file with lowercase "delimiter"
|
||||
- bug #1828913 [structure] Can't set FULLTEXT index on CHAR column
|
||||
- bug #1804081 [export] export on server doesn't obey AllowAnyWhereRecoding
|
||||
- bug #1789988 [display] space before SHOW COLUMNS
|
||||
- bug #1831646 [table creation] Error in CREATE TABLE with multiple primary
|
||||
keys and AUTO_INCREMENT
|
||||
- [display] Division by zero when showing all records (page selector)
|
||||
- bug #1828265 [privileges] No weird characters in generated password
|
||||
- bug #1759194 [import] open_basedir warning
|
||||
- bug #1793948 [parser] ROW_FORMAT incorrectly parsed
|
||||
- undefined PMA_MYSQL_INT_VERSION when no default server is set
|
||||
- bug #1763343 [session] Behavior with session.auto_start enabled
|
||||
+ [lang] Hungarian update, thanks to Mihály Mészáros
|
||||
+ [lang] German update, thanks to Jürgen Wind - windkiel
|
||||
- patch #1837691 [query window] js errors, thanks to Victor Volkov
|
||||
- patch #1839052 [lang] catalan not in UTF-8, thanks to jaz001
|
||||
- patch #1838626 [GUI] Login interface broken on Konqueror, thanks to fhimpe
|
||||
|
||||
2.11.2.2 (2007-11-20)
|
||||
- bug #1835123 [security] fixed XSS vulnerability on login page,
|
||||
thanks to Tim Brown (Nth Dimension) for the advisory
|
||||
and to Sebastian for the fix
|
||||
|
||||
2.11.2.1 (2007-11-11)
|
||||
- fixed possible SQL injection using database name
|
||||
- fixed possible XSS in database name - thanks to Omer Singer, The DigiTrust Group
|
||||
|
||||
2.11.2.0 (2007-10-27)
|
||||
- patch #1791576 HTTP auth: support REDIRECT_REMOTE_USER, thanks to Allard
|
||||
+ [lang] Serbian update, thanks to Mihailo Stefanovic
|
||||
- bug #1798841 [relations] Copying db does not copy internal relations
|
||||
- bug #1798646 [display] Character '+' in query wrongly interpreted
|
||||
- bug #1801919 [themes] Do not use NaviDatabaseNameColor for fieldset legend
|
||||
- bug #1764735 [core] Designer: PDF error when deleting a table
|
||||
- bug #1764195 [views] DROP button does not work on defective views
|
||||
- bug #1805773 [relations] browse foreign values: return values not escaped,
|
||||
thanks to Alex Rambau
|
||||
- bug #1807923 [login] Login with html entities in password fails
|
||||
- [core] Undefined variable when creating a table that exists
|
||||
- patch #1808578 Changes in font size were no longer detected after patch
|
||||
#1787915
|
||||
+ [lang] Croatian update, thanks to Renato Pavicic
|
||||
- patch #1807615 [GUI] Display patch for column rights in Opera
|
||||
- bug #1811519 Can't delete user with a german umlaut.
|
||||
- bug #1811519 [privileges] fixed used collation for accessing mysql.user in server privileges
|
||||
- it should not be possible to move or copy a table to information_schema
|
||||
- bug #1814733 win: copy db to mixed name db fails
|
||||
- bug #1777249 [display] Remove horizontal lines in navigation panel
|
||||
- bug #1805102 [display] TextareaAutoSelect issues: set this parameter
|
||||
default value to false to help cut&paste from a terminal window; also
|
||||
set focus to the textarea
|
||||
- bug #1814463 [display] Wrong database size
|
||||
- bug #1811527 [display] Problem with links to the MySQL manual
|
||||
- patch #1817529 [auth] Incorrect login via URL when AllowArbitraryServer
|
||||
is true, thanks to Juergen Wind
|
||||
|
||||
2.11.1.2 (2007-10-17)
|
||||
- fixed XSS in server_status.php, thanks to Omer Singer, The DigiTrust Group
|
||||
- fixed some possible XSS with PHP_SELF, PATH_INFO, REQUEST_URI
|
||||
(reference: CVE-2007-5589)
|
||||
|
||||
2.11.1.1 (2007-10-15)
|
||||
- bug #1810629 [setup] XSS in setup.php, thanks to Omer Singer, The DigiTrust Group
|
||||
|
||||
2.11.1.0 (2007-09-20)
|
||||
- bug #1783667 [export] NO_AUTO_VALUE_ON_ZERO and MySQL version
|
||||
- bug #1780098 [GUI] Logout causes CSS loss, thanks to Juergen Wind
|
||||
. incorrect field ids, thanks to Michael Keck
|
||||
- bug #1787522 [view] wrong choice in algorithm drop-down
|
||||
- bug #1777620 [GUI] Table Print preview: missing column header,
|
||||
thanks to Mario Rohkrämer
|
||||
- Do not display "Your MySQL library..." if only the Z part of X.Y.Z version
|
||||
is different
|
||||
- bugs #1767759, 1216521 [data] Duplicate entry error Browse feature: this minor
|
||||
feature removed due to its complexity
|
||||
- bug #1774825 [operations] Rename database loses charset info
|
||||
- bug #1791568 [core] Undefined cfg, thanks to Christian Schmidt
|
||||
- bug #1782332 [structure] New table form does not overtake data
|
||||
- bug #1793763 [requirements] minimum PHP should be 4.2.0
|
||||
- patch #1787915 Avoid CSS reloading on every click, thanks to Juergen Wind
|
||||
- bug #1798627 [GUI] Wrong storage engine displayed
|
||||
|
||||
2.11.0.0 (2007-08-21)
|
||||
+ [import] support handling of DELIMITER to mimic mysql CLI, thanks to fb1
|
||||
+ improved PHP 6 compatibility
|
||||
- bug #1674914 [structure] changing definition of a TIMESTAMP field
|
||||
- bug #1615530 [upload] added more specific error message if field upload fails
|
||||
- bug #1627210, #1083301, #1482401 [data] warning on duplicate indexes
|
||||
- bug #1668724 JavaScript focus login Opera
|
||||
- bug #1666657 [auth] Cookie password delete on timeout / inactivity
|
||||
- bug #1648802 different mysql library and server version
|
||||
- bug #1662976 [auth] Authentication fails when controluser/pass is set
|
||||
- bug #1643758 [import] Error #1264 importing NULL values in MySQL 5.0
|
||||
- bug #1523747 [innodb] make warning about row count more visible
|
||||
- bug #1676012 [auth] strip non-US-ASCII characters (RFC2616)
|
||||
- bug #1679440 Added FAQ entry about header errors under IIS caused by
|
||||
an end-of-line character
|
||||
- [gui] avoid displaying a wide selector in server selection
|
||||
- bug #1614004 [relation] foreign key spanning multiple columns are
|
||||
incorrectly displayed
|
||||
- bug #1681598 [interface] Edit next row
|
||||
- bug #1688053 [export] Wrong export of binary character fields
|
||||
- bug #1498281 [parser] Wrong primary key used for displaying results
|
||||
with subquery
|
||||
- bug #1699772 Visual space bug in table name (in browser)
|
||||
- bug #1699532 Cause of data manipulation issues: implemented changes
|
||||
as suggested by crisp_; still have to work on updating an ENUM value
|
||||
+ [core] added PMA_fatalError() and made use of it
|
||||
. [core] added PMA_isValid() and PMA_ifSetOr() for variable handling
|
||||
. [i18n] use generic $strOptions
|
||||
. [core] get rid of $propicon
|
||||
. [core] globalized variables to be includable inside function in
|
||||
libraries/select_lang.lib.php
|
||||
+ [doc] changed all documentation in config.inc.php to phpDocumentor style
|
||||
+ [data] support for CREATE VIEW from query results
|
||||
+ [gui] dropped css/ folder and moved into root of PMA
|
||||
+ [l10n] new: Sinhala, Macedonian
|
||||
+ [export] YAML export (see yaml.org), thanks to Bryce Thornton
|
||||
+ [upload] moved file upload functionality into own class
|
||||
+ [upload] make use of $cfg['TempDir'] for file uploads
|
||||
+ [server] improved display of binary logs
|
||||
+ [data] better error handling in tbl_create.php
|
||||
+ [routines] from Patch #1649881, thanks to Mike Beck
|
||||
+ [querywindow] store sql history in session
|
||||
+ [querywindow] sql history now without db too
|
||||
+ [querywindow] tweaks in sql history view
|
||||
+ [export] Native Excel (Spreadsheet_Excel_Writer) improvements,
|
||||
thanks to Christian Schmidt
|
||||
+ [doc] requirement of mcrypt on 64-bit, thanks to Isaac Bennetch
|
||||
+ [lang] Danish update, thanks to Finn Sorensen
|
||||
+ RFE #1435922 [gui] navigation frame shows listing of databases when none selected
|
||||
+ [data] support BIT datatype (under mysqli), thanks to Christian Schmidt
|
||||
+ [display] automatic confirmation for sort by key, thanks to Juergen Wind
|
||||
+ [data] can now choose the number of insert rows
|
||||
+ RFE #1704779 [gui] link documentation from login page
|
||||
+ RFE #1513345 [setup] check control user connection during setup
|
||||
+ [structure] TRIGGERS: display/edit/drop/SQL export
|
||||
+ [browse] store browse state in session per query
|
||||
+ [lang] Turkish update, thanks to Burak Yavuz
|
||||
+ [lang] Galician update, thanks to Xosé Calvo
|
||||
+ [lang] Brazilian-Portuguese update, thanks to Airon Luis Pereira
|
||||
+ [gui] Insert/Edit: no longer display the Go button each 15 lines
|
||||
but just at the end of a row
|
||||
+ [gui] Query window: use verbose server name if any
|
||||
+ [auth] patch #1712514 specify host for single signon, thanks to Thierry
|
||||
+ [gui] Navigator for the db list in the navigation panel
|
||||
+ [gui] Navigator for the table list in the content panel
|
||||
- bug #1727138 HTML not encoded (more than 1000 characters)
|
||||
+ [display] Support for MySQL 5.0.37 profiling
|
||||
+ RFE #1743983 [gui] Replace $max_characters by a configurable param:
|
||||
$cfg['MaxCharactersInDisplayedSQL']
|
||||
- bug #1746186 LeftLogoLink fails if set to some external site
|
||||
. [transformations]: remove "auto-detect" MIME-type that was never implemented
|
||||
+ [display] patch #1749705, Allow multibyte characters in number formatting,
|
||||
thanks to garas
|
||||
- bug #1747215 Export emits blanks at line ends
|
||||
- bug #1751172 Do not export data when exporting a single VIEW
|
||||
+ [lang] Swedish update, thanks to Björn T. Hallberg
|
||||
+ [lang] Russian update, thanks to Victor Volkov and the php-myadmin.ru users
|
||||
+ [privileges] Support password hashing on the Edit Privileges interface
|
||||
- bug #1755339 Warn about rename dataase actually being copy/delete
|
||||
- bug #1746921 Left frame shrinks on db change, thanks to Juergen Wind
|
||||
+ [gui] Export: Select All/Unselect All over the choices,
|
||||
thanks to Florian Schmitz
|
||||
+ [lang] Japanese update, thanks to Ishigaki Kenichi
|
||||
- bug #1759528 browse_foreigners fails due to newlines,
|
||||
thanks to Hanno Boeck
|
||||
+ [lang] Norwegian update, thanks to Sven-Erik Andersen
|
||||
+ [lang] Italian update, thanks to Luca Rebellato
|
||||
+ [lang] Spanish update, thanks to Daniel Hinostroza
|
||||
. [export] Do not obey $cfg['MaxTableList'] on database export
|
||||
- [doc] UploadDir and the Import tab, thanks to Juergen Wind
|
||||
- bug #1766975 Parameters lost when editing stored routine
|
||||
- [export] patch #1766633 Incorrect export with specified MySQL port,
|
||||
thanks to Juergen Wind
|
||||
+ [lang] Catalan update, thanks to Xavier Navarro
|
||||
- bug #1751553 Drop-down instead of input when editing
|
||||
- [data] foreign key browser: encoding mixups, thanks to Thijs Kinkhorst
|
||||
- bug #1771721 Old SVN URLs
|
||||
|
||||
2.10.3.0 (2007-07-20)
|
||||
- bug #1734285 Copy database with VIEWs
|
||||
- bug #1722502 DROP TABLE in export VIEW
|
||||
- bug #1729027 Sorting results of VIEW browsing
|
||||
- bug #1733012 Unwanted table alias in delete button
|
||||
- bug #1736405 Pretty printer and HTML line breaks
|
||||
- bug #1745257 Invalid DB name is still displayed
|
||||
- bug #1730367 Calendar "Go" has no effect
|
||||
- bug #1748633 Incorrect parameter validation for VIEWs
|
||||
+ [lang] Russian revision, thanks to Victor Volkov and the users of
|
||||
php-myadmin.ru
|
||||
- Do not try to delete an internal relation if we just deleted an InnoDB one
|
||||
|
||||
2.10.2.0 (2007-06-15)
|
||||
+ [data] display all warnings, not only last one
|
||||
- typo in fix for bug #1671813
|
||||
- bug #1714908 Inserted Row Count is wrong
|
||||
- bug #1712570 Deleting last record freezes
|
||||
- bug #1717339 Missing header when deleting a checked column,
|
||||
thanks to Michael Keck
|
||||
- bug #1717477 Warning on Query page when db is empty
|
||||
- bug #1721002 db rename -> undefined cfgRelation, thanks to Jürgen Wind
|
||||
- bug #1721571 CREATE database privilege not always detected,
|
||||
thanks to Gordon McNaughton
|
||||
- bug #1715709 export in SQL format always includes procedures and functions
|
||||
- bug #1722502 DROP TABLE in export view structure
|
||||
- bug #1718787 Multi-server setup breaks Designer
|
||||
- bug #1724401 Column truncation in repair table output
|
||||
- patch #1726500 Wrong position of </tbody>, thanks to Jürgen Wind
|
||||
- bug #1728590 Detected failing session_start fails, thanks to Jürgen Wind
|
||||
- RFE #1714760 Obey ShowCreateDb on the Databases tab
|
||||
- patch #1733762 Typo in message "INSERT DELAY", thanks to Victor Volkov
|
||||
- patch #1730171 Dead message strLanguageFileNotFound, thanks to Victor Volkov
|
||||
- patch #1731280 Avoid negative exponent in gmp_pow(), thanks to anosek
|
||||
|
||||
2.10.1.0 (2007-04-23)
|
||||
- bug #1541147 [js] '#' in database names not correctly handled by queywindow.js
|
||||
- bug #1671403 [parser] using "client" as table name
|
||||
- bug #1672379 [core] Call to undefined function PMA_removeCookie()
|
||||
- bug [core] undefined variable in libraries/tbl_replace_fields.inc.php
|
||||
- bug [gui] query window icon did not work, thanks to Jürgen Wind - windkiel
|
||||
. [general] use PMA_getenv('PHP_SELF')
|
||||
- bug #1676033 [core] pow(int,int) causes overflow
|
||||
- bug #1680952 [core] undefined function PMA_getUvaCondition()
|
||||
- bug #1596328 [export] drop support for POSTGRESQL compatibility mode
|
||||
- bug #1609443 [privileges] Grant all priv. on wildcard name (fix message)
|
||||
- bug #1567317 [sqp] Syntax highlighter: extra spaces
|
||||
- bug #1239401 [sqp] table dot numeric field name
|
||||
- bug #1672789 [sqp] Undefined offset: 4 in sqlparser.lib.php #1674
|
||||
- bug #1682044 [export] Export file even if file not selected
|
||||
- bug #1664212 querywindow loses url encoded characters
|
||||
- replaced ctype_digit() with is_numeric()
|
||||
+ [config] clean cookies on phpMyAdmin upgrade
|
||||
- bug #1674972 [export] no export with %afm%
|
||||
- bug #1667887 HTML maxlength
|
||||
- bug #1679055 #1050 - Table '<table name>' already exists
|
||||
- patch #1681620 [interface] support reordering of $cfg['ColumnTypes'],
|
||||
thanks to Leonard den Ottolander
|
||||
- bug #1690718 Can't edit if BLOB and no PK
|
||||
- bug #1672636 [export] PDF export too wide
|
||||
+ [lang] brazilian-portuguese update, thanks to Airon Luis Pereira
|
||||
- patch #1698964 javascript typo, thanks to Corey Hollaway
|
||||
- bug #1703897 [css] undefined index 'js_frame'
|
||||
- bug #1690561 Blobs being cleared on Edit of row
|
||||
- bug #1679801 [core] XSS vulnerability in PMA_sanitize(), thanks to sp3x SecurityReason
|
||||
- bug #1704467 XSS vulnerability in browse_foreigners.php, thanks to sp3x SecurityReason
|
||||
|
||||
2.10.0.2 (2007-03-02)
|
||||
+ bug #1671813 CVE-2006-1549 deep recursion crash
|
||||
|
||||
2.10.0.1 (2007-03-01)
|
||||
. [config] set $cfg['Servers'][$i]['ssl'] default value to false,
|
||||
we got reports from some users having problems with the default value of true
|
||||
|
||||
2.10.0.0 (2007-02-28)
|
||||
- bug #1659176 [general] memory error displaying a table with large BLOBs
|
||||
- bug #1668662 [install] can create the new pma_designer_coords table
|
||||
+ [gui] navi logo now links to main page by default, with still the possibility
|
||||
of having an external URL
|
||||
|
||||
2007-02-25 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* libraries/common.lib.php: bug #1667466, undefined variable when
|
||||
export + save on server
|
||||
* server_status.php: bug #1665930, undefined PHP_SELF
|
||||
|
||||
2007-02-24 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* libraries/config.default.php: RFE #1621437, HEX and UNHEX were not
|
||||
available for a BINARY field
|
||||
|
||||
2007-02-21 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* pmd/scripts/move.js: bug #1650770, Designer and Mac OSX,
|
||||
thanks to Ivan Kirillov
|
||||
|
||||
2007-02-17 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* Documentation.html: patch #1659347, missing doc for some config,
|
||||
thanks to Isaac Bennetch
|
||||
* libraries/export/sql.php: bug #1663336, undefined variable
|
||||
|
||||
2007-02-16 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* libraries/common.lib.php, footer.inc.php: avoid generating big links
|
||||
after an upload into a BLOB
|
||||
|
||||
2007-02-14 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* libraries/common.lib.php: white page after uploading a 700 Kio BLOB
|
||||
* add a warning on main page if mcrypt can't be loaded (bug 1658160)
|
||||
|
||||
2007-02-12 Sebastian Mendel <cybot_tm@users.sourceforge.net>
|
||||
* libraries/database_interface.lib.php: bug #1616486 server_databases does
|
||||
not show all databases
|
||||
* libraries/sqlparser.data.php: MySQL function and column names, reserved
|
||||
and forbidden words updated,
|
||||
bug #1657045 Spatial functions not supported
|
||||
bug #1657037 Missing column type "geometry"
|
||||
|
||||
2007-02-09 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* main.php: some links should open a new page
|
||||
* Documentation.html, libraries/navigation_header.inc.php,
|
||||
libraries/config.default.php: $cfg['LeftLogoLinkWindow'] to decide
|
||||
in which window the logo-linked page will appear
|
||||
|
||||
2007-02-09 Michal Čihař <michal@cihar.com>
|
||||
* lang/czech: Fix syntax error (sorry for that).
|
||||
|
||||
2007-02-08 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* themes/darkblue_orange/img/logo_left.png,
|
||||
themes/original/img/logo_left.png: smaller PMA logo for navi
|
||||
|
||||
2007-02-08 Sebastian Mendel <cybot_tm@users.sourceforge.net>
|
||||
* themes/*/css/theme_right.css.php: bug #1653769 browsing highlight disabling
|
||||
doesn't work
|
||||
|
||||
2007-02-06 Sebastian Mendel <cybot_tm@users.sourceforge.net>
|
||||
* pmd_general.php, pmd_pdf.php, pmd_save_pos.php: fixed short open tags
|
||||
patch #1652886 thanks to Martin Thielecke - mthie
|
||||
* tbl_change.php: fixed escaping of field names in HTML and JavaScript
|
||||
* libraries/common.lib.php: PMA_backquote() did not quote 0
|
||||
* tbl_change.php: bug #1652810 - slashes are not escaped properly
|
||||
|
||||
2007-02-05 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* lang/japanese: Update, thanks to Ishigaki Kenichi - tcool.
|
||||
|
||||
2007-02-05 Sebastian Mendel <cybot_tm@users.sourceforge.net>
|
||||
* lang/german: updated
|
||||
|
||||
2007-02-03 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* pmd/scripts/move.js: display problems in Opera, thanks to Maxim Bulygin
|
||||
|
||||
2007-02-02 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* tbl_replace.php: Calendar icon does not work on "Insert another new row"
|
||||
|
||||
2007-02-01 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* libraries/import.lib.php: bug #1626064, too much quoting on import
|
||||
|
||||
2007-02-01 Sebastian Mendel <cybot_tm@users.sourceforge.net>
|
||||
* libraries/display_tbl.lib.php: bug #1644740 - $cfg['Order'] = 'SMART'
|
||||
overwritten
|
||||
* libraries/Theme.class.php: removed __wakeup() due to some requirements are
|
||||
not fulfilled at this point - also thanks to Jürgen Wind - windkiel
|
||||
|
||||
2007-01-31 Sebastian Mendel <cybot_tm@users.sourceforge.net>
|
||||
* libraries/session.inc.php:
|
||||
bug #1630871 - Detecting a missing write permission on sessions directory
|
||||
|
||||
2007-01-30 Sebastian Mendel <cybot_tm@users.sourceforge.net>
|
||||
* libraries/sqlparser.lib.php PMA_SQP_analyze():
|
||||
bug #1647785 - do not pass variables by reference
|
||||
|
||||
2007-01-29 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* lang/catalan update, thanks to Xavier Navarro (xavin)
|
||||
* pmd_general.php: possibility of quotes in Designer messages,
|
||||
thanks to Ivan Kirillov
|
||||
|
||||
2007-01-26 Michal Čihař <michal@cihar.com>
|
||||
* libraries/common.lib.php, libraries/js_escape.lib.php,
|
||||
test/escape_js_string.php, test/core.lib.php: Move java script escaping
|
||||
to separate library, make it safer on </script> escaping and add
|
||||
testcase for it.
|
||||
* test/theme.php: Move to test package.
|
||||
|
||||
2007-01-22 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* pmd/*: button for direct/angular links, thanks to Ivan Kirillov
|
||||
|
||||
2007-01-22 Michal Čihař <michal@cihar.com>
|
||||
* lang/czech: Updated.
|
||||
|
||||
2007-01-21 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* libraries/Table.class.php: on a MySQL 5.0.33 server with 4400 databases,
|
||||
one of which having 400 tables, it took more than 3 minutes just to
|
||||
see the database structure (some accesses to INFORMATION_SCHEMA are
|
||||
just too slow) so I changed PMA_Table::isView() to avoid calling
|
||||
INFORMATION_SCHEMA
|
||||
|
||||
2007-01-20 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* libraries/sqlparser.lib.php: bug #1638267, wrong reserved word
|
||||
recognition
|
||||
* server_privileges.php: bug #1635377, superfluous backslash,
|
||||
thanks to Hanut
|
||||
|
||||
2007-01-19 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* pmd*, lang/*: Designer now supports set/unset of the display field,
|
||||
thanks to Ivan Kirillov
|
||||
|
||||
2007-01-18 Michal Čihař <michal@cihar.com>
|
||||
* lang/czech: Updated.
|
||||
* libraries/auth/cookie.auth.lib.php: Make server switching honour more
|
||||
server settings (patch #1630104).
|
||||
|
||||
2007-01-17 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* lang/turkish: update, thanks to Burak Yavuz - bourock
|
||||
|
||||
2007-01-16 Marc Delisle <lem9@users.sourceforge.net>
|
||||
### 2.9.2 released from QA_2_9
|
||||
|
||||
2007-01-12 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* (many files): Designer, two features (snap to grid / display field)
|
||||
thanks to Ivan Kirillov
|
||||
* libraries/Theme_Manager.class.php: patch #1611684, force a change
|
||||
of a session variable to avoid phpmyadmin.css.php caching problems,
|
||||
thanks to Christian Schmidt
|
||||
|
||||
2007-01-11 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* lang/estonian: Update, thanks to Marko Ellermaa - uhuu
|
||||
|
||||
2007-01-09 Michal Čihař <michal@cihar.com>
|
||||
* index.php: Properly escape strings written in JS code.
|
||||
* libraries/Theme_Manager.class.php: Avoid trigger error here, parameter
|
||||
comes from user and it might lead to path disclossure.
|
||||
* libraries/common.lib.php:
|
||||
- Properly escape </script> in JS code.
|
||||
- Check db, table and sql_query params to be string.
|
||||
|
||||
2007-01-08 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* libraries/session.inc.php: prevent attack on session name cookie
|
||||
|
||||
2007-01-05 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* libraries/session.inc.php: bug #1538132, remove the setting of
|
||||
session.save_handler to 'files'
|
||||
* pmd_general.php: patch #1627831,
|
||||
English language improvements, thanks to Isaac Bennetch
|
||||
* pmd_general.php, pmd_relation_new.php, lang/*: abstract messages
|
||||
|
||||
2007-01-04 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* pmd/scripts/move.js: avoid text selection when moving a table object
|
||||
under MSIE 6, thanks to Ivan Kirillov
|
||||
* libraries/db_links.inc.php: better icon for Designer, thanks to I.K.
|
||||
|
||||
2007-01-02 Marc Delisle <lem9@users.sourceforge.net>
|
||||
* Designer: various fixes and improvements (for example support
|
||||
for MSIE 6), thanks to Ivan Kirillov
|
||||
* pdf_pages.php: undefined $pdf_page_number when no auto layout
|
||||
* server_privileges.php: bug #1614087, deleting a user having a
|
||||
global GRANT privilege fails under MySQL 4.1.x
|
||||
|
||||
2007-01-02 Michal Čihař <michal@cihar.com>
|
||||
* libraries/common.lib.php: Add <div> to allow selecting whole SQL by
|
||||
tripple click (patch #1611591).
|
||||
* libraries/export/sql.php: DELIMITER should not be commented out (bug
|
||||
#1612870).
|
||||
|
||||
--- Older ChangeLogs can be found on our project website ---
|
||||
http://www.phpmyadmin.net/old-stuff/ChangeLogs/
|
||||
|
||||
# vim: et ts=4 sw=4 sts=4
|
||||
# vim: ft=changelog fenc=utf-8 encoding=utf-8
|
||||
# vim: fde=getline(v\:lnum-1)=~'^\\s*$'&&getline(v\:lnum)=~'\\S'?'>1'\:1&&v\:lnum>8&&getline(v\:lnum)!~'^#'
|
||||
# vim: fdn=1 fdm=expr
|
4528
Documentation.html
9
INSTALL
@@ -1,9 +0,0 @@
|
||||
$Id$
|
||||
|
||||
phpMyAdmin - Installation
|
||||
-------------------------
|
||||
|
||||
Please have a look to the Documentation.txt or
|
||||
Documentation.html files.
|
||||
|
||||
|
340
LICENSE
@@ -1,340 +0,0 @@
|
||||
GNU GENERAL PUBLIC LICENSE
|
||||
Version 2, June 1991
|
||||
|
||||
Copyright (C) 1989, 1991 Free Software Foundation, Inc.
|
||||
51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
Everyone is permitted to copy and distribute verbatim copies
|
||||
of this license document, but changing it is not allowed.
|
||||
|
||||
Preamble
|
||||
|
||||
The licenses for most software are designed to take away your
|
||||
freedom to share and change it. By contrast, the GNU General Public
|
||||
License is intended to guarantee your freedom to share and change free
|
||||
software--to make sure the software is free for all its users. This
|
||||
General Public License applies to most of the Free Software
|
||||
Foundation's software and to any other program whose authors commit to
|
||||
using it. (Some other Free Software Foundation software is covered by
|
||||
the GNU Library General Public License instead.) You can apply it to
|
||||
your programs, too.
|
||||
|
||||
When we speak of free software, we are referring to freedom, not
|
||||
price. Our General Public Licenses are designed to make sure that you
|
||||
have the freedom to distribute copies of free software (and charge for
|
||||
this service if you wish), that you receive source code or can get it
|
||||
if you want it, that you can change the software or use pieces of it
|
||||
in new free programs; and that you know you can do these things.
|
||||
|
||||
To protect your rights, we need to make restrictions that forbid
|
||||
anyone to deny you these rights or to ask you to surrender the rights.
|
||||
These restrictions translate to certain responsibilities for you if you
|
||||
distribute copies of the software, or if you modify it.
|
||||
|
||||
For example, if you distribute copies of such a program, whether
|
||||
gratis or for a fee, you must give the recipients all the rights that
|
||||
you have. You must make sure that they, too, receive or can get the
|
||||
source code. And you must show them these terms so they know their
|
||||
rights.
|
||||
|
||||
We protect your rights with two steps: (1) copyright the software, and
|
||||
(2) offer you this license which gives you legal permission to copy,
|
||||
distribute and/or modify the software.
|
||||
|
||||
Also, for each author's protection and ours, we want to make certain
|
||||
that everyone understands that there is no warranty for this free
|
||||
software. If the software is modified by someone else and passed on, we
|
||||
want its recipients to know that what they have is not the original, so
|
||||
that any problems introduced by others will not reflect on the original
|
||||
authors' reputations.
|
||||
|
||||
Finally, any free program is threatened constantly by software
|
||||
patents. We wish to avoid the danger that redistributors of a free
|
||||
program will individually obtain patent licenses, in effect making the
|
||||
program proprietary. To prevent this, we have made it clear that any
|
||||
patent must be licensed for everyone's free use or not licensed at all.
|
||||
|
||||
The precise terms and conditions for copying, distribution and
|
||||
modification follow.
|
||||
|
||||
GNU GENERAL PUBLIC LICENSE
|
||||
TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
|
||||
|
||||
0. This License applies to any program or other work which contains
|
||||
a notice placed by the copyright holder saying it may be distributed
|
||||
under the terms of this General Public License. The "Program", below,
|
||||
refers to any such program or work, and a "work based on the Program"
|
||||
means either the Program or any derivative work under copyright law:
|
||||
that is to say, a work containing the Program or a portion of it,
|
||||
either verbatim or with modifications and/or translated into another
|
||||
language. (Hereinafter, translation is included without limitation in
|
||||
the term "modification".) Each licensee is addressed as "you".
|
||||
|
||||
Activities other than copying, distribution and modification are not
|
||||
covered by this License; they are outside its scope. The act of
|
||||
running the Program is not restricted, and the output from the Program
|
||||
is covered only if its contents constitute a work based on the
|
||||
Program (independent of having been made by running the Program).
|
||||
Whether that is true depends on what the Program does.
|
||||
|
||||
1. You may copy and distribute verbatim copies of the Program's
|
||||
source code as you receive it, in any medium, provided that you
|
||||
conspicuously and appropriately publish on each copy an appropriate
|
||||
copyright notice and disclaimer of warranty; keep intact all the
|
||||
notices that refer to this License and to the absence of any warranty;
|
||||
and give any other recipients of the Program a copy of this License
|
||||
along with the Program.
|
||||
|
||||
You may charge a fee for the physical act of transferring a copy, and
|
||||
you may at your option offer warranty protection in exchange for a fee.
|
||||
|
||||
2. You may modify your copy or copies of the Program or any portion
|
||||
of it, thus forming a work based on the Program, and copy and
|
||||
distribute such modifications or work under the terms of Section 1
|
||||
above, provided that you also meet all of these conditions:
|
||||
|
||||
a) You must cause the modified files to carry prominent notices
|
||||
stating that you changed the files and the date of any change.
|
||||
|
||||
b) You must cause any work that you distribute or publish, that in
|
||||
whole or in part contains or is derived from the Program or any
|
||||
part thereof, to be licensed as a whole at no charge to all third
|
||||
parties under the terms of this License.
|
||||
|
||||
c) If the modified program normally reads commands interactively
|
||||
when run, you must cause it, when started running for such
|
||||
interactive use in the most ordinary way, to print or display an
|
||||
announcement including an appropriate copyright notice and a
|
||||
notice that there is no warranty (or else, saying that you provide
|
||||
a warranty) and that users may redistribute the program under
|
||||
these conditions, and telling the user how to view a copy of this
|
||||
License. (Exception: if the Program itself is interactive but
|
||||
does not normally print such an announcement, your work based on
|
||||
the Program is not required to print an announcement.)
|
||||
|
||||
These requirements apply to the modified work as a whole. If
|
||||
identifiable sections of that work are not derived from the Program,
|
||||
and can be reasonably considered independent and separate works in
|
||||
themselves, then this License, and its terms, do not apply to those
|
||||
sections when you distribute them as separate works. But when you
|
||||
distribute the same sections as part of a whole which is a work based
|
||||
on the Program, the distribution of the whole must be on the terms of
|
||||
this License, whose permissions for other licensees extend to the
|
||||
entire whole, and thus to each and every part regardless of who wrote it.
|
||||
|
||||
Thus, it is not the intent of this section to claim rights or contest
|
||||
your rights to work written entirely by you; rather, the intent is to
|
||||
exercise the right to control the distribution of derivative or
|
||||
collective works based on the Program.
|
||||
|
||||
In addition, mere aggregation of another work not based on the Program
|
||||
with the Program (or with a work based on the Program) on a volume of
|
||||
a storage or distribution medium does not bring the other work under
|
||||
the scope of this License.
|
||||
|
||||
3. You may copy and distribute the Program (or a work based on it,
|
||||
under Section 2) in object code or executable form under the terms of
|
||||
Sections 1 and 2 above provided that you also do one of the following:
|
||||
|
||||
a) Accompany it with the complete corresponding machine-readable
|
||||
source code, which must be distributed under the terms of Sections
|
||||
1 and 2 above on a medium customarily used for software interchange; or,
|
||||
|
||||
b) Accompany it with a written offer, valid for at least three
|
||||
years, to give any third party, for a charge no more than your
|
||||
cost of physically performing source distribution, a complete
|
||||
machine-readable copy of the corresponding source code, to be
|
||||
distributed under the terms of Sections 1 and 2 above on a medium
|
||||
customarily used for software interchange; or,
|
||||
|
||||
c) Accompany it with the information you received as to the offer
|
||||
to distribute corresponding source code. (This alternative is
|
||||
allowed only for noncommercial distribution and only if you
|
||||
received the program in object code or executable form with such
|
||||
an offer, in accord with Subsection b above.)
|
||||
|
||||
The source code for a work means the preferred form of the work for
|
||||
making modifications to it. For an executable work, complete source
|
||||
code means all the source code for all modules it contains, plus any
|
||||
associated interface definition files, plus the scripts used to
|
||||
control compilation and installation of the executable. However, as a
|
||||
special exception, the source code distributed need not include
|
||||
anything that is normally distributed (in either source or binary
|
||||
form) with the major components (compiler, kernel, and so on) of the
|
||||
operating system on which the executable runs, unless that component
|
||||
itself accompanies the executable.
|
||||
|
||||
If distribution of executable or object code is made by offering
|
||||
access to copy from a designated place, then offering equivalent
|
||||
access to copy the source code from the same place counts as
|
||||
distribution of the source code, even though third parties are not
|
||||
compelled to copy the source along with the object code.
|
||||
|
||||
4. You may not copy, modify, sublicense, or distribute the Program
|
||||
except as expressly provided under this License. Any attempt
|
||||
otherwise to copy, modify, sublicense or distribute the Program is
|
||||
void, and will automatically terminate your rights under this License.
|
||||
However, parties who have received copies, or rights, from you under
|
||||
this License will not have their licenses terminated so long as such
|
||||
parties remain in full compliance.
|
||||
|
||||
5. You are not required to accept this License, since you have not
|
||||
signed it. However, nothing else grants you permission to modify or
|
||||
distribute the Program or its derivative works. These actions are
|
||||
prohibited by law if you do not accept this License. Therefore, by
|
||||
modifying or distributing the Program (or any work based on the
|
||||
Program), you indicate your acceptance of this License to do so, and
|
||||
all its terms and conditions for copying, distributing or modifying
|
||||
the Program or works based on it.
|
||||
|
||||
6. Each time you redistribute the Program (or any work based on the
|
||||
Program), the recipient automatically receives a license from the
|
||||
original licensor to copy, distribute or modify the Program subject to
|
||||
these terms and conditions. You may not impose any further
|
||||
restrictions on the recipients' exercise of the rights granted herein.
|
||||
You are not responsible for enforcing compliance by third parties to
|
||||
this License.
|
||||
|
||||
7. If, as a consequence of a court judgment or allegation of patent
|
||||
infringement or for any other reason (not limited to patent issues),
|
||||
conditions are imposed on you (whether by court order, agreement or
|
||||
otherwise) that contradict the conditions of this License, they do not
|
||||
excuse you from the conditions of this License. If you cannot
|
||||
distribute so as to satisfy simultaneously your obligations under this
|
||||
License and any other pertinent obligations, then as a consequence you
|
||||
may not distribute the Program at all. For example, if a patent
|
||||
license would not permit royalty-free redistribution of the Program by
|
||||
all those who receive copies directly or indirectly through you, then
|
||||
the only way you could satisfy both it and this License would be to
|
||||
refrain entirely from distribution of the Program.
|
||||
|
||||
If any portion of this section is held invalid or unenforceable under
|
||||
any particular circumstance, the balance of the section is intended to
|
||||
apply and the section as a whole is intended to apply in other
|
||||
circumstances.
|
||||
|
||||
It is not the purpose of this section to induce you to infringe any
|
||||
patents or other property right claims or to contest validity of any
|
||||
such claims; this section has the sole purpose of protecting the
|
||||
integrity of the free software distribution system, which is
|
||||
implemented by public license practices. Many people have made
|
||||
generous contributions to the wide range of software distributed
|
||||
through that system in reliance on consistent application of that
|
||||
system; it is up to the author/donor to decide if he or she is willing
|
||||
to distribute software through any other system and a licensee cannot
|
||||
impose that choice.
|
||||
|
||||
This section is intended to make thoroughly clear what is believed to
|
||||
be a consequence of the rest of this License.
|
||||
|
||||
8. If the distribution and/or use of the Program is restricted in
|
||||
certain countries either by patents or by copyrighted interfaces, the
|
||||
original copyright holder who places the Program under this License
|
||||
may add an explicit geographical distribution limitation excluding
|
||||
those countries, so that distribution is permitted only in or among
|
||||
countries not thus excluded. In such case, this License incorporates
|
||||
the limitation as if written in the body of this License.
|
||||
|
||||
9. The Free Software Foundation may publish revised and/or new versions
|
||||
of the General Public License from time to time. Such new versions will
|
||||
be similar in spirit to the present version, but may differ in detail to
|
||||
address new problems or concerns.
|
||||
|
||||
Each version is given a distinguishing version number. If the Program
|
||||
specifies a version number of this License which applies to it and "any
|
||||
later version", you have the option of following the terms and conditions
|
||||
either of that version or of any later version published by the Free
|
||||
Software Foundation. If the Program does not specify a version number of
|
||||
this License, you may choose any version ever published by the Free Software
|
||||
Foundation.
|
||||
|
||||
10. If you wish to incorporate parts of the Program into other free
|
||||
programs whose distribution conditions are different, write to the author
|
||||
to ask for permission. For software which is copyrighted by the Free
|
||||
Software Foundation, write to the Free Software Foundation; we sometimes
|
||||
make exceptions for this. Our decision will be guided by the two goals
|
||||
of preserving the free status of all derivatives of our free software and
|
||||
of promoting the sharing and reuse of software generally.
|
||||
|
||||
NO WARRANTY
|
||||
|
||||
11. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY
|
||||
FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW. EXCEPT WHEN
|
||||
OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES
|
||||
PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED
|
||||
OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
|
||||
MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE. THE ENTIRE RISK AS
|
||||
TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU. SHOULD THE
|
||||
PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING,
|
||||
REPAIR OR CORRECTION.
|
||||
|
||||
12. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
|
||||
WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR
|
||||
REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES,
|
||||
INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING
|
||||
OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED
|
||||
TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY
|
||||
YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER
|
||||
PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE
|
||||
POSSIBILITY OF SUCH DAMAGES.
|
||||
|
||||
END OF TERMS AND CONDITIONS
|
||||
|
||||
How to Apply These Terms to Your New Programs
|
||||
|
||||
If you develop a new program, and you want it to be of the greatest
|
||||
possible use to the public, the best way to achieve this is to make it
|
||||
free software which everyone can redistribute and change under these terms.
|
||||
|
||||
To do so, attach the following notices to the program. It is safest
|
||||
to attach them to the start of each source file to most effectively
|
||||
convey the exclusion of warranty; and each file should have at least
|
||||
the "copyright" line and a pointer to where the full notice is found.
|
||||
|
||||
<one line to give the program's name and a brief idea of what it does.>
|
||||
Copyright (C) <year> <name of author>
|
||||
|
||||
This program is free software; you can redistribute it and/or modify
|
||||
it under the terms of the GNU General Public License as published by
|
||||
the Free Software Foundation; either version 2 of the License, or
|
||||
(at your option) any later version.
|
||||
|
||||
This program is distributed in the hope that it will be useful,
|
||||
but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
GNU General Public License for more details.
|
||||
|
||||
You should have received a copy of the GNU General Public License
|
||||
along with this program; if not, write to the Free Software
|
||||
Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
|
||||
|
||||
Also add information on how to contact you by electronic and paper mail.
|
||||
|
||||
If the program is interactive, make it output a short notice like this
|
||||
when it starts in an interactive mode:
|
||||
|
||||
Gnomovision version 69, Copyright (C) year name of author
|
||||
Gnomovision comes with ABSOLUTELY NO WARRANTY; for details type `show w'.
|
||||
This is free software, and you are welcome to redistribute it
|
||||
under certain conditions; type `show c' for details.
|
||||
|
||||
The hypothetical commands `show w' and `show c' should show the appropriate
|
||||
parts of the General Public License. Of course, the commands you use may
|
||||
be called something other than `show w' and `show c'; they could even be
|
||||
mouse-clicks or menu items--whatever suits your program.
|
||||
|
||||
You should also get your employer (if you work as a programmer) or your
|
||||
school, if any, to sign a "copyright disclaimer" for the program, if
|
||||
necessary. Here is a sample; alter the names:
|
||||
|
||||
Yoyodyne, Inc., hereby disclaims all copyright interest in the program
|
||||
`Gnomovision' (which makes passes at compilers) written by James Hacker.
|
||||
|
||||
<signature of Ty Coon>, 1 April 1989
|
||||
Ty Coon, President of Vice
|
||||
|
||||
This General Public License does not permit incorporating your program into
|
||||
proprietary programs. If your program is a subroutine library, you may
|
||||
consider it more useful to permit linking proprietary applications with the
|
||||
library. If this is what you want to do, use the GNU Library General
|
||||
Public License instead of this License.
|
74
README
@@ -1,74 +0,0 @@
|
||||
$Id$
|
||||
|
||||
phpMyAdmin - Readme
|
||||
===================
|
||||
|
||||
A set of PHP-scripts to manage MySQL over the web.
|
||||
|
||||
Version 3.1.0-dev
|
||||
-----------------
|
||||
http://www.phpmyadmin.net/
|
||||
|
||||
Copyright (C) 1998-2000 Tobias Ratschiller <tobias_at_ratschiller.com>
|
||||
Copyright (C) 2001-2007 Marc Delisle <Marc.Delisle_at_cegepsherbrooke.qc.ca>
|
||||
Olivier Müller <om_at_omnis.ch>
|
||||
Robin Johnson <robbat2_at_users.sourceforge.net>
|
||||
Alexander M. Turek <me_at_derrabus.de>
|
||||
Michal Čihař <michal_at_cihar.com>
|
||||
Garvin Hicking <me_at_supergarv.de>
|
||||
Michael Keck <mkkeck_at_users.sourceforge.net>
|
||||
Sebastian Mendel <cybot_tm_at_users.sourceforge.net>
|
||||
[check Documentation.txt/.html file for more details]
|
||||
|
||||
This program is free software; you can redistribute it and/or modify
|
||||
it under the terms of the GNU General Public License version 2,
|
||||
as published by the Free Software Foundation.
|
||||
|
||||
This program is distributed in the hope that it will be useful,
|
||||
but WITHOUT ANY WARRANTY; without even the implied warranty of
|
||||
MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
||||
GNU General Public License for more details.
|
||||
|
||||
You should have received a copy of the GNU General Public License
|
||||
along with this program; if not, write to the Free Software
|
||||
Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA 02110-1301 USA
|
||||
|
||||
Requirements:
|
||||
php 5.2 or later
|
||||
MySQL 5.0 or later
|
||||
a web-browser (doh!)
|
||||
|
||||
Summary:
|
||||
phpMyAdmin is intended to handle the administration of MySQL over the web.
|
||||
For a summary of features, please see the Documentation.txt/.html file.
|
||||
|
||||
Download:
|
||||
You can get the newest version at http://www.phpmyadmin.net/.
|
||||
|
||||
Credits:
|
||||
Please see the Documentation.txt/.html file.
|
||||
|
||||
Installation:
|
||||
Please see the Documentation.txt/.html file.
|
||||
|
||||
ChangeLog:
|
||||
Now in ChangeLog
|
||||
|
||||
Documentation:
|
||||
Basic documentation available in Documentation.txt/.html
|
||||
|
||||
Support:
|
||||
See reference about support forums under http://www.phpmyadmin.net/
|
||||
|
||||
|
||||
Enjoy!
|
||||
The phpMyAdmin Devel team
|
||||
|
||||
|
||||
PS: Please, don't send us emails with question like "How do I compile
|
||||
PHP with MySQL-support". We just don't have the time to be your
|
||||
free helpdesk.
|
||||
Please send your questions to the appropriate mailinglists / forums.
|
||||
Before contacting us, please read the Documentation.html (esp. the
|
||||
FAQ part).
|
||||
|
@@ -1,21 +0,0 @@
|
||||
$Id: README 10967 2007-12-08 12:46:36Z lem9 $
|
||||
|
||||
phpMyAdmin - hints for distributing phpMyAdmin
|
||||
==============================================
|
||||
|
||||
This document is intended to give advices to people who want to
|
||||
redistribute phpMyAdmin inside other software package such as Linux
|
||||
distribution or some all in one package including web server and MySQL
|
||||
server.
|
||||
|
||||
|
||||
Setup script
|
||||
------------
|
||||
|
||||
If you want to integrate setup script to your packaging, you might want
|
||||
to change $cfg_db['_config_file_path'] in setup/lib/config_info.inc.php
|
||||
to point to place where you want to generated config file to be saved.
|
||||
Please note that directory and the file has to be writable for web
|
||||
server user.
|
||||
|
||||
# vim: et ts=4 sw=4 sts=4 tw=72 spell spelllang=en_us
|
10
TODO
@@ -1,10 +0,0 @@
|
||||
$Id$
|
||||
|
||||
phpMyAdmin - Todo
|
||||
=================
|
||||
|
||||
We are currently using the Sourceforge Tracker as Todo list:
|
||||
|
||||
http://sourceforge.net/tracker/?atid=377411&group_id=23067&func=browse
|
||||
|
||||
-- swix/20010704
|
@@ -1,289 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* display selection for relational field values
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
* Gets a core script and starts output buffering work
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
|
||||
PMA_checkParameters(array('db', 'table', 'field'));
|
||||
|
||||
require_once './libraries/ob.lib.php';
|
||||
PMA_outBufferPre();
|
||||
|
||||
require_once './libraries/header_http.inc.php';
|
||||
|
||||
/**
|
||||
* Displays the frame
|
||||
*/
|
||||
$per_page = 200;
|
||||
require_once './libraries/relation.lib.php'; // foreign keys
|
||||
require_once './libraries/transformations.lib.php'; // Transformations
|
||||
$cfgRelation = PMA_getRelationsParam();
|
||||
$foreigners = ($cfgRelation['relwork'] ? PMA_getForeigners($db, $table) : FALSE);
|
||||
|
||||
$override_total = TRUE;
|
||||
|
||||
if (!isset($pos)) {
|
||||
$pos = 0;
|
||||
}
|
||||
|
||||
$foreign_limit = 'LIMIT ' . $pos . ', ' . $per_page . ' ';
|
||||
if (isset($foreign_navig) && $foreign_navig == $strShowAll) {
|
||||
unset($foreign_limit);
|
||||
}
|
||||
|
||||
$foreignData = PMA_getForeignData($foreigners, $field, $override_total, isset($foreign_filter) ? $foreign_filter : '', $foreign_limit);
|
||||
|
||||
if (isset($pk)) {
|
||||
$pk_uri = '&pk=' . urlencode($pk);
|
||||
?>
|
||||
<input type="hidden" name="pk" value="<?php echo htmlspecialchars($pk); ?>" />
|
||||
<?php
|
||||
} else {
|
||||
$pk_uri = '';
|
||||
}
|
||||
|
||||
$gotopage = '';
|
||||
$showall = '';
|
||||
|
||||
if (is_array($foreignData['disp_row'])) {
|
||||
|
||||
if ($cfg['ShowAll'] && ($foreignData['the_total'] > $per_page)) {
|
||||
$showall = '<input type="submit" name="foreign_navig" value="' . $strShowAll . '" />';
|
||||
}
|
||||
|
||||
$session_max_rows = $per_page;
|
||||
$pageNow = @floor($pos / $session_max_rows) + 1;
|
||||
$nbTotalPage = @ceil($foreignData['the_total'] / $session_max_rows);
|
||||
|
||||
if ($foreignData['the_total'] > $per_page) {
|
||||
$gotopage = PMA_pageselector(
|
||||
'browse_foreigners.php?field=' . urlencode($field) .
|
||||
'&' . PMA_generate_common_url($db, $table)
|
||||
. $pk_uri .
|
||||
'&fieldkey=' . (isset($fieldkey) ? urlencode($fieldkey) : '') .
|
||||
'&foreign_filter=' . (isset($foreign_filter) ? urlencode($foreign_filter) : '') .
|
||||
'&',
|
||||
$session_max_rows,
|
||||
$pageNow,
|
||||
$nbTotalPage,
|
||||
200,
|
||||
5,
|
||||
5,
|
||||
20,
|
||||
10,
|
||||
$GLOBALS['strPageNumber']
|
||||
);
|
||||
}
|
||||
}
|
||||
?>
|
||||
<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN"
|
||||
"http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
|
||||
<html xmlns="http://www.w3.org/1999/xhtml"
|
||||
xml:lang="<?php echo $available_languages[$lang][2]; ?>"
|
||||
lang="<?php echo $available_languages[$lang][2]; ?>"
|
||||
dir="<?php echo $text_dir; ?>">
|
||||
|
||||
<head>
|
||||
<title>phpMyAdmin</title>
|
||||
<meta http-equiv="Content-Type" content="text/html; charset=<?php echo $charset; ?>" />
|
||||
<link rel="stylesheet" type="text/css"
|
||||
href="phpmyadmin.css.php?<?php echo PMA_generate_common_url('', ''); ?>&js_frame=right&nocache=<?php echo $_SESSION['PMA_Config']->getThemeUniqueValue(); ?>" />
|
||||
<script src="./js/functions.js" type="text/javascript"></script>
|
||||
<script type="text/javascript">
|
||||
//<![CDATA[
|
||||
self.focus();
|
||||
function formupdate(field, key) {
|
||||
if (opener && opener.document && opener.document.insertForm) {
|
||||
var field = 'field_' + field;
|
||||
|
||||
<?php if (isset($pk)) { ?>
|
||||
var element_name = field + '[multi_edit][<?php echo htmlspecialchars($pk); ?>][]';
|
||||
<?php } else { ?>
|
||||
var element_name = field + '[]';
|
||||
<?php } ?>
|
||||
|
||||
<?php if (isset($fieldkey) && is_numeric($fieldkey)) { ?>
|
||||
var element_name_alt = field + '[<?php echo $fieldkey; ?>]';
|
||||
<?php } else { ?>
|
||||
var element_name_alt = field + '[0]';
|
||||
<?php } ?>
|
||||
|
||||
if (opener.document.insertForm.elements[element_name]) {
|
||||
// Edit/Insert form
|
||||
opener.document.insertForm.elements[element_name].value = key;
|
||||
self.close();
|
||||
return false;
|
||||
} else if (opener.document.insertForm.elements[element_name_alt]) {
|
||||
// Search form
|
||||
opener.document.insertForm.elements[element_name_alt].value = key;
|
||||
self.close();
|
||||
return false;
|
||||
}
|
||||
}
|
||||
|
||||
alert('<?php echo PMA_jsFormat($strWindowNotFound); ?>');
|
||||
}
|
||||
//]]>
|
||||
</script>
|
||||
</head>
|
||||
|
||||
<body id="body_browse_foreigners">
|
||||
|
||||
<form action="browse_foreigners.php" method="post">
|
||||
<fieldset>
|
||||
<?php echo PMA_generate_common_hidden_inputs($db, $table); ?>
|
||||
<input type="hidden" name="field" value="<?php echo htmlspecialchars($field); ?>" />
|
||||
<input type="hidden" name="fieldkey"
|
||||
value="<?php echo isset($fieldkey) ? htmlspecialchars($fieldkey) : ''; ?>" />
|
||||
<?php if (isset($pk)) { ?>
|
||||
<input type="hidden" name="pk" value="<?php echo htmlspecialchars($pk); ?>" />
|
||||
<?php } ?>
|
||||
<span class="formelement">
|
||||
<label for="input_foreign_filter"><?php echo $strSearch . ':'; ?></label>
|
||||
<input type="text" name="foreign_filter" id="input_foreign_filter"
|
||||
value="<?php echo isset($foreign_filter) ? htmlspecialchars($foreign_filter) : ''; ?>" />
|
||||
<input type="submit" name="submit_foreign_filter" value="<?php echo $strGo;?>" />
|
||||
</span>
|
||||
<span class="formelement">
|
||||
<?php echo $gotopage; ?>
|
||||
</span>
|
||||
<span class="formelement">
|
||||
<?php echo $showall; ?>
|
||||
</span>
|
||||
</fieldset>
|
||||
</form>
|
||||
|
||||
<table width="100%">
|
||||
<?php
|
||||
if (is_array($foreignData['disp_row'])) {
|
||||
$header = '<tr>
|
||||
<th>' . $strKeyname . '</th>
|
||||
<th>' . $strDescription . '</th>
|
||||
<td width="20%"></td>
|
||||
<th>' . $strDescription . '</th>
|
||||
<th>' . $strKeyname . '</th>
|
||||
</tr>';
|
||||
|
||||
echo '<thead>' . $header . '</thead>' . "\n"
|
||||
.'<tfoot>' . $header . '</tfoot>' . "\n"
|
||||
.'<tbody>' . "\n";
|
||||
|
||||
$values = array();
|
||||
$keys = array();
|
||||
foreach ($foreignData['disp_row'] as $relrow) {
|
||||
if ($foreignData['foreign_display'] != FALSE) {
|
||||
$values[] = $relrow[$foreignData['foreign_display']];
|
||||
} else {
|
||||
$values[] = '';
|
||||
}
|
||||
|
||||
$keys[] = $relrow[$foreignData['foreign_field']];
|
||||
}
|
||||
|
||||
asort($keys);
|
||||
|
||||
$hcount = 0;
|
||||
$odd_row = true;
|
||||
$val_ordered_current_row = 0;
|
||||
$val_ordered_current_equals_data = false;
|
||||
$key_ordered_current_equals_data = false;
|
||||
foreach ($keys as $key_ordered_current_row => $value) {
|
||||
//for ($i = 0; $i < $count; $i++) {
|
||||
$hcount++;
|
||||
|
||||
if ($cfg['RepeatCells'] > 0 && $hcount > $cfg['RepeatCells']) {
|
||||
echo $header;
|
||||
$hcount = 0;
|
||||
$odd_row = true;
|
||||
}
|
||||
|
||||
$key_ordered_current_key = $keys[$key_ordered_current_row];
|
||||
$key_ordered_current_val = $values[$key_ordered_current_row];
|
||||
|
||||
$val_ordered_current_key = $keys[$val_ordered_current_row];
|
||||
$val_ordered_current_val = $values[$val_ordered_current_row];
|
||||
|
||||
$val_ordered_current_row++;
|
||||
|
||||
if (PMA_strlen($val_ordered_current_val) <= $cfg['LimitChars']) {
|
||||
$val_ordered_current_val = htmlspecialchars($val_ordered_current_val);
|
||||
$val_ordered_current_val_title = '';
|
||||
} else {
|
||||
$val_ordered_current_val_title =
|
||||
htmlspecialchars($val_ordered_current_val);
|
||||
$val_ordered_current_val =
|
||||
htmlspecialchars(PMA_substr($val_ordered_current_val, 0,
|
||||
$cfg['LimitChars']) . '...');
|
||||
}
|
||||
if (PMA_strlen($key_ordered_current_val) <= $cfg['LimitChars']) {
|
||||
$key_ordered_current_val = htmlspecialchars($key_ordered_current_val);
|
||||
$key_ordered_current_val_title = '';
|
||||
} else {
|
||||
$key_ordered_current_val_title =
|
||||
htmlspecialchars($key_ordered_current_val);
|
||||
$key_ordered_current_val =
|
||||
htmlspecialchars(PMA_substr($key_ordered_current_val, 0,
|
||||
$cfg['LimitChars']) . '...');
|
||||
}
|
||||
|
||||
if (! empty($data)) {
|
||||
$val_ordered_current_equals_data = $val_ordered_current_key == $data;
|
||||
$key_ordered_current_equals_data = $key_ordered_current_key == $data;
|
||||
}
|
||||
|
||||
?>
|
||||
<tr class="<?php echo $odd_row ? 'odd' : 'even'; $odd_row = ! $odd_row; ?>">
|
||||
<td nowrap="nowrap">
|
||||
<?php
|
||||
echo ($key_ordered_current_equals_data ? '<strong>' : '')
|
||||
.'<a href="#" title="' . $strUseThisValue
|
||||
. ($key_ordered_current_val_title != '' ? ': ' . $key_ordered_current_val_title : '') . '"'
|
||||
.' onclick="formupdate(\'' . md5($field) . '\', \''
|
||||
. PMA_jsFormat($key_ordered_current_key, false) . '\'); return false;">'
|
||||
.htmlspecialchars($key_ordered_current_key) . '</a>' . ($key_ordered_current_equals_data ? '</strong>' : '');
|
||||
?></td>
|
||||
<td>
|
||||
<?php
|
||||
echo ($key_ordered_current_equals_data ? '<strong>' : '')
|
||||
. '<a href="#" title="' . $strUseThisValue . ($key_ordered_current_val_title != '' ? ': '
|
||||
. $key_ordered_current_val_title : '') . '" onclick="formupdate(\''
|
||||
. md5($field) . '\', \'' . PMA_jsFormat($key_ordered_current_key, false) . '\'); return false;">'
|
||||
. $key_ordered_current_val . '</a>' . ($key_ordered_current_equals_data ? '</strong>' : '');
|
||||
?></td>
|
||||
<td width="20%">
|
||||
<img src="<?php echo $GLOBALS['pmaThemeImage'] . 'spacer.png'; ?>"
|
||||
alt="" width="1" height="1"></td>
|
||||
|
||||
<td>
|
||||
<?php
|
||||
echo ($val_ordered_current_equals_data ? '<strong>' : '')
|
||||
. '<a href="#" title="' . $strUseThisValue . ($val_ordered_current_val_title != '' ? ': '
|
||||
. $val_ordered_current_val_title : '') . '" onclick="formupdate(\'' . md5($field)
|
||||
. '\', \'' . PMA_jsFormat($val_ordered_current_key, false) . '\'); return false;">'
|
||||
. $val_ordered_current_val . '</a>' . ($val_ordered_current_equals_data ? '</strong>' : '');
|
||||
?></td>
|
||||
<td nowrap="nowrap">
|
||||
<?php
|
||||
echo ($val_ordered_current_equals_data ? '<strong>' : '') . '<a href="#" title="'
|
||||
. $strUseThisValue . ($val_ordered_current_val_title != '' ? ': ' . $val_ordered_current_val_title : '')
|
||||
. '" onclick="formupdate(\'' . md5($field) . '\', \''
|
||||
. PMA_jsFormat($val_ordered_current_key, false) . '\'); return false;">' . htmlspecialchars($val_ordered_current_key)
|
||||
. '</a>' . ($val_ordered_current_equals_data ? '</strong>' : '');
|
||||
?></td>
|
||||
</tr>
|
||||
<?php
|
||||
} // end while
|
||||
}
|
||||
?>
|
||||
</tbody>
|
||||
</table>
|
||||
|
||||
</body>
|
||||
</html>
|
@@ -1,97 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* @author Raj Kissu Rajandran
|
||||
* @version 1.0
|
||||
* @package BLOBStreaming
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
|
||||
/**
|
||||
* @var string contains database name
|
||||
*/
|
||||
$bsDB = isset($_REQUEST['bs_db']) ? urldecode($_REQUEST['bs_db']) : NULL;
|
||||
|
||||
/**
|
||||
* @var string contains table name
|
||||
*/
|
||||
$bsTable = isset($_REQUEST['bs_table']) ? urldecode($_REQUEST['bs_table']) : NULL;
|
||||
|
||||
/**
|
||||
* @var string contains BLOB reference
|
||||
*/
|
||||
$bsReference = isset($_REQUEST['bs_reference']) ? urldecode($_REQUEST['bs_reference']) : NULL;
|
||||
|
||||
/**
|
||||
* @var string contains MIME type
|
||||
*/
|
||||
$bsNewMIMEType = isset($_REQUEST['bs_new_mime_type']) ? urldecode($_REQUEST['bs_new_mime_type']) : NULL;
|
||||
|
||||
// necessary variables exist
|
||||
if ($bsDB && $bsTable && $bsReference && $bsNewMIMEType)
|
||||
{
|
||||
// load PMA configuration
|
||||
$PMA_Config = $_SESSION['PMA_Config'];
|
||||
|
||||
// if PMA configuration exists
|
||||
if (!empty($PMA_Config))
|
||||
{
|
||||
// if BS plugins exist
|
||||
if ($PMA_Config->get('BLOBSTREAMING_PLUGINS_EXIST'))
|
||||
{
|
||||
$mybs_ref_tbl = $PMA_Config->get('PBMS_NAME') . '_reference';
|
||||
$mybs_cust_content_type_tbl = $PMA_Config->get('PBMS_NAME') . '_custom_content_type';
|
||||
|
||||
// if specified DB is selected
|
||||
if (PMA_DBI_select_db($bsDB))
|
||||
{
|
||||
$query = "SELECT * FROM " . PMA_backquote($mybs_ref_tbl);
|
||||
$query .= " WHERE Blob_url='" . PMA_sqlAddslashes($bsReference) . "'";
|
||||
|
||||
$result = PMA_DBI_query($query);
|
||||
|
||||
// if record exists
|
||||
if ($data = PMA_DBI_fetch_assoc($result))
|
||||
{
|
||||
$query = "SELECT count(*) FROM " . PMA_backquote($mybs_cust_content_type_tbl);
|
||||
$query .= " WHERE Blob_url='" . PMA_sqlAddslashes($bsReference) . "'";
|
||||
|
||||
$result = PMA_DBI_query($query);
|
||||
|
||||
// if record exists
|
||||
if ($data = PMA_DBI_fetch_assoc($result))
|
||||
{
|
||||
if (1 == $data['count(*)'])
|
||||
{
|
||||
$query = "UPDATE " . PMA_backquote($mybs_cust_content_type_tbl) . " SET Content_type='";
|
||||
$query .= PMA_sqlAddslashes($bsNewMIMEType) . "' WHERE Blob_url='" . PMA_sqlAddslashes($bsReference) . "'";
|
||||
}
|
||||
else
|
||||
{
|
||||
$query = "INSERT INTO " . PMA_backquote($mybs_cust_content_type_tbl) . " (Blob_url, Content_type)";
|
||||
$query .= " VALUES('" . PMA_sqlAddslashes($bsReference) . "', '" . PMA_sqlAddslashes($bsNewMIMEType) . "')";
|
||||
}
|
||||
|
||||
$result = PMA_DBI_query($query);
|
||||
|
||||
// if query execution succeeded
|
||||
if ($result)
|
||||
{
|
||||
// determine redirector page
|
||||
$newLoc = $cfg['PmaAbsoluteUri'] . 'sql.php?' . PMA_generate_common_url ('','', '&') . (isset($bsDB) ? '&db=' . urlencode($bsDB) : '') . (isset($bsTable) ? '&table=' . urlencode($bsTable) : '') . (isset($token) ? '&token=' . urlencode($token) : '') . (isset($goto) ? '&goto=' . urlencode($goto) : '') . '&reload=1&purge=1';
|
||||
|
||||
// redirect to specified page
|
||||
?>
|
||||
<script>
|
||||
window.location = "<?php echo $newLoc ?>";
|
||||
</script>
|
||||
<?php
|
||||
} // end if ($result)
|
||||
} // end if ($data = PMA_DBI_fetch_assoc($result))
|
||||
} // end if ($data = PMA_DBI_fetch_assoc($result))
|
||||
} // end if (PMA_DBI_select_db($bsDB))
|
||||
} // end if ($PMA_Config->get('BLOBSTREAMING_PLUGINS_EXIST'))
|
||||
} // end if (!empty($PMA_Config))
|
||||
} // end if ($bsDB && $bsTable && $bsReference && $bsNewMIMEType)
|
||||
|
||||
?>
|
@@ -1,52 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* @author Raj Kissu Rajandran
|
||||
* @version 1.0
|
||||
* @package BLOBStreaming
|
||||
*/
|
||||
|
||||
set_time_limit(0);
|
||||
|
||||
$filename = isset($_REQUEST['file_path']) ? $_REQUEST['file_path'] : NULL;
|
||||
$c_type = isset($_REQUEST['c_type']) ? $_REQUEST['c_type'] : NULL;
|
||||
|
||||
if (isset($filename) && isset($c_type))
|
||||
{
|
||||
$hdrs = get_headers($filename, 1);
|
||||
|
||||
if (is_array($hdrs))
|
||||
$f_size = $hdrs['Content-Length'];
|
||||
|
||||
header("Expires: 0");
|
||||
header("Last-Modified: " . gmdate("D, d M Y H:i:s") . " GMT");
|
||||
header("Cache-Control: no-store, no-cache, must-revalidate");
|
||||
header("Cache-Control: post-check=0, pre-check=0", false);
|
||||
header("Pragma: no-cache");
|
||||
header("Content-type: $c_type");
|
||||
header('Content-length: ' . $f_size);
|
||||
header("Content-disposition: attachment; filename=" . basename($filename));
|
||||
|
||||
$fHnd = fopen($filename, "rb");
|
||||
|
||||
if ($fHnd)
|
||||
{
|
||||
$pos = 0;
|
||||
$content = "";
|
||||
|
||||
while (!feof($fHnd))
|
||||
{
|
||||
$content .= fread($fHnd, $f_size);
|
||||
$pos = strlen($content);
|
||||
|
||||
if ($pos >= $f_size)
|
||||
break;
|
||||
}
|
||||
|
||||
echo $content;
|
||||
flush();
|
||||
|
||||
fclose($fHnd);
|
||||
}
|
||||
}
|
||||
?>
|
@@ -1,70 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* @author Raj Kissu Rajandran
|
||||
* @version 1.0
|
||||
* @package BLOBStreaming
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
|
||||
/*
|
||||
* @var string contains media type of BLOB reference
|
||||
*/
|
||||
$mediaType = isset($_REQUEST['media_type']) ? $_REQUEST['media_type'] : NULL;
|
||||
|
||||
/*
|
||||
* @var string indicates whether media type is of custom type
|
||||
*/
|
||||
$customType = isset($_REQUEST['custom_type']) ? $_REQUEST['custom_type'] : false;
|
||||
|
||||
/*
|
||||
* @var string contains BLOB reference
|
||||
*/
|
||||
$bsReference = isset($_REQUEST['bs_reference']) ? $_REQUEST['bs_reference'] : NULL;
|
||||
|
||||
// if media type and BS reference are specified
|
||||
if (isset($mediaType) && isset($bsReference))
|
||||
{
|
||||
// load PMA configuration
|
||||
$PMA_Config = $_SESSION['PMA_Config'];
|
||||
|
||||
// if PMA configuration exists
|
||||
if (!empty($PMA_Config))
|
||||
{
|
||||
// retrieve BS server variables from PMA configuration
|
||||
$bs_server = $PMA_Config->get('BLOBSTREAMING_SERVER');
|
||||
$bs_file_path = "http://" . $bs_server . '/' . $bsReference;
|
||||
|
||||
if (isset($customType) && $customType)
|
||||
$bs_file_path = "bs_disp_as_mime_type.php?file_path=" . urlencode($bs_file_path) . "&c_type=" . urlencode($mediaType);
|
||||
|
||||
?>
|
||||
<html>
|
||||
<head>
|
||||
</head>
|
||||
<body>
|
||||
<?php
|
||||
|
||||
// supported media types
|
||||
switch ($mediaType)
|
||||
{
|
||||
// audio content
|
||||
case 'audio/mpeg':
|
||||
?><embed width=620 height=100 src="<?php echo $bs_file_path; ?>" autostart=true></embed><?php
|
||||
break;
|
||||
// video content
|
||||
case 'application/x-flash-video':
|
||||
case 'video/mpeg':
|
||||
?><embed width=620 height=460 src="<?php echo $bs_file_path; ?>" autostart=true></embed><?php
|
||||
break;
|
||||
default:
|
||||
// do nothing
|
||||
}
|
||||
?>
|
||||
</body>
|
||||
</html>
|
||||
<?php
|
||||
} // end if (!empty($PMA_Config))
|
||||
} // end if (isset($mediaType) && isset($bsReference))
|
||||
|
||||
?>
|
30
calendar.php
@@ -1,30 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
*
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
require_once './libraries/header_http.inc.php';
|
||||
$page_title = $strCalendar;
|
||||
require './libraries/header_meta_style.inc.php';
|
||||
$GLOBALS['js_include'][] = 'tbl_change.js';
|
||||
require './libraries/header_scripts.inc.php';
|
||||
?>
|
||||
<script type="text/javascript">
|
||||
//<![CDATA[
|
||||
var month_names = new Array("<?php echo implode('","', $month); ?>");
|
||||
var day_names = new Array("<?php echo implode('","', $day_of_week); ?>");
|
||||
var submit_text = "<?php echo $strGo . ' (' . $strTime . ')'; ?>";
|
||||
//]]>
|
||||
</script>
|
||||
</head>
|
||||
<body onload="initCalendar();">
|
||||
<div id="calendar_data"></div>
|
||||
<div id="clock_data"></div>
|
||||
</body>
|
||||
</html>
|
@@ -1,87 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* Simple script to set correct charset for changelog
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
$changelog = htmlspecialchars(file_get_contents('ChangeLog'));
|
||||
|
||||
$replaces = array(
|
||||
'@(http://[./a-zA-Z0-9.-]*[/a-zA-Z0-9])@'
|
||||
=> '<a href="\\1">\\1</a>',
|
||||
|
||||
// sourceforge users
|
||||
'/([0-9]{4}-[0-9]{2}-[0-9]{2}) (.+[^ ]) +<(.*)@users.sourceforge.net>/i'
|
||||
=> '\\1 <a href="https://sourceforge.net/users/\\3/">\\2</a>',
|
||||
'/thanks to ([^\(\r\n]+) \(([-\w]+)\)/i'
|
||||
=> 'thanks to <a href="https://sourceforge.net/users/\\2/">\\1</a>',
|
||||
'/thanks to ([^\(\r\n]+) -\s+([-\w]+)/i'
|
||||
=> 'thanks to <a href="https://sourceforge.net/users/\\2/">\\1</a>',
|
||||
|
||||
// mail adresse
|
||||
'/([0-9]{4}-[0-9]{2}-[0-9]{2}) (.+[^ ]) +<(.*@.*)>/i'
|
||||
=> '\\1 <a href="mailto:\\3">\\2</a>',
|
||||
|
||||
// linking patches
|
||||
'/patch\s*#?([0-9]{6,})/i'
|
||||
=> '<a href="https://sourceforge.net/support/tracker.php?aid=\\1">patch #\\1</a>',
|
||||
|
||||
// linking RFE
|
||||
'/(?:rfe|feature)\s*#?([0-9]{6,})/i'
|
||||
=> '<a href="https://sourceforge.net/support/tracker.php?aid=\\1">RFE #\\1</a>',
|
||||
|
||||
// linking files
|
||||
'/(\s+)([\\/a-z_0-9\.]+\.(?:php3?|html|pl|js|sh))/i'
|
||||
=> '\\1<a href="http://phpmyadmin.svn.sourceforge.net/viewvc/phpmyadmin/trunk/phpMyAdmin/\\2?annotate=HEAD">\\2</a>',
|
||||
|
||||
// FAQ entries
|
||||
'/FAQ ([0-9]+)\.([0-9a-z]+)/i'
|
||||
=> '<a href="http://localhost/phpMyAdmin/Documentation.html#faq\\1_\\2">FAQ \\1.\\2</a>',
|
||||
|
||||
// linking bugs
|
||||
'/bug\s*#?([0-9]{6,})/i'
|
||||
=> '<a href="https://sourceforge.net/support/tracker.php?aid=\\1">bug #\\1</a>',
|
||||
|
||||
// all other 6+ digit numbers are treated as bugs
|
||||
'/(?<!BUG|RFE|patch) #?([0-9]{6,})/i'
|
||||
=> ' <a href="https://sourceforge.net/support/tracker.php?aid=\\1">bug #\\1</a>',
|
||||
|
||||
// CVE/CAN entries
|
||||
'/((CAN|CVE)-[0-9]+-[0-9]+)/'
|
||||
=> '<a href="http://cve.mitre.org/cgi-bin/cvename.cgi?name=\\1">\\1</a>',
|
||||
|
||||
// Highlight releases (with links)
|
||||
'/(( ### )(([0-9]+)\.([0-9]+)\.([0-9]+)\.([0-9]+) (.*)))/'
|
||||
=> '<a name="\\4_\\5_\\6_\\7"></a>\\2<a href="http://svn.sourceforge.net/viewvc/phpmyadmin/tags/RELEASE_\\4_\\5_\\6_\\7/phpMyAdmin">\\4.\\5.\\6.\\7 \\8</a>',
|
||||
'/(( ### )(([0-9]+)\.([0-9]+)\.([0-9]+) (.*)))/'
|
||||
=> '<a name="\\4_\\5_\\6_\\7"></a>\\2<a href="http://svn.sourceforge.net/viewvc/phpmyadmin/tags/RELEASE_\\4_\\5_\\6/phpMyAdmin">\\4.\\5.\\6 \\7</a>',
|
||||
|
||||
// Highlight releases (not linkable)
|
||||
'/( ### )(.*)/'
|
||||
=> '\\1<b>\\2</b>',
|
||||
|
||||
);
|
||||
|
||||
header('Content-type: text/html; charset=utf-8');
|
||||
echo '<?xml version="1.0" encoding="utf-8"?'.'>';
|
||||
?>
|
||||
<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN"
|
||||
"http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
|
||||
<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en" lang="en" dir="ltr">
|
||||
<head>
|
||||
<link rel="icon" href="./favicon.ico" type="image/x-icon" />
|
||||
<link rel="shortcut icon" href="./favicon.ico" type="image/x-icon" />
|
||||
<title>phpMyAdmin - ChangeLog</title>
|
||||
<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
|
||||
</head>
|
||||
<body>
|
||||
<h1>phpMyAdmin - ChangeLog</h1>
|
||||
<?php
|
||||
echo '<pre>';
|
||||
echo preg_replace(array_keys($replaces), $replaces, $changelog);
|
||||
echo '</pre>';
|
||||
?>
|
||||
</body>
|
||||
</html>
|
26
chk_rel.php
@@ -1,26 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
* Gets some core libraries
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
require_once './libraries/db_common.inc.php';
|
||||
require_once './libraries/relation.lib.php';
|
||||
|
||||
|
||||
/**
|
||||
* Gets the relation settings
|
||||
*/
|
||||
$cfgRelation = PMA_getRelationsParam(TRUE);
|
||||
|
||||
|
||||
/**
|
||||
* Displays the footer
|
||||
*/
|
||||
require_once './libraries/footer.inc.php';
|
||||
?>
|
@@ -1,69 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* phpMyAdmin sample configuration, you can use it as base for
|
||||
* manual configuration. For easier setup you can use setup/
|
||||
*
|
||||
* All directives are explained in Documentation.html and on phpMyAdmin
|
||||
* wiki <http://wiki.cihar.com>.
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/*
|
||||
* This is needed for cookie based authentication to encrypt password in
|
||||
* cookie
|
||||
*/
|
||||
$cfg['blowfish_secret'] = ''; /* YOU MUST FILL IN THIS FOR COOKIE AUTH! */
|
||||
|
||||
/*
|
||||
* Servers configuration
|
||||
*/
|
||||
$i = 0;
|
||||
|
||||
/*
|
||||
* First server
|
||||
*/
|
||||
$i++;
|
||||
/* Authentication type */
|
||||
$cfg['Servers'][$i]['auth_type'] = 'cookie';
|
||||
/* Server parameters */
|
||||
$cfg['Servers'][$i]['host'] = 'localhost';
|
||||
$cfg['Servers'][$i]['connect_type'] = 'tcp';
|
||||
$cfg['Servers'][$i]['compress'] = false;
|
||||
/* Select mysqli if your server has it */
|
||||
$cfg['Servers'][$i]['extension'] = 'mysql';
|
||||
|
||||
/* rajk - for blobstreaming */
|
||||
$cfg['Servers'][$i]['bs_garbage_threshold'] = 50;
|
||||
$cfg['Servers'][$i]['bs_repository_threshold'] = '32M';
|
||||
$cfg['Servers'][$i]['bs_temp_blob_timeout'] = 600;
|
||||
$cfg['Servers'][$i]['bs_temp_log_threshold'] = '32M';
|
||||
|
||||
/* User for advanced features */
|
||||
// $cfg['Servers'][$i]['controluser'] = 'pma';
|
||||
// $cfg['Servers'][$i]['controlpass'] = 'pmapass';
|
||||
/* Advanced phpMyAdmin features */
|
||||
// $cfg['Servers'][$i]['pmadb'] = 'phpmyadmin';
|
||||
// $cfg['Servers'][$i]['bookmarktable'] = 'pma_bookmark';
|
||||
// $cfg['Servers'][$i]['relation'] = 'pma_relation';
|
||||
// $cfg['Servers'][$i]['table_info'] = 'pma_table_info';
|
||||
// $cfg['Servers'][$i]['table_coords'] = 'pma_table_coords';
|
||||
// $cfg['Servers'][$i]['pdf_pages'] = 'pma_pdf_pages';
|
||||
// $cfg['Servers'][$i]['column_info'] = 'pma_column_info';
|
||||
// $cfg['Servers'][$i]['history'] = 'pma_history';
|
||||
// $cfg['Servers'][$i]['designer_coords'] = 'pma_designer_coords';
|
||||
/* Contrib / Swekey authentication */
|
||||
// $cfg['Servers'][$i]['auth_swekey_config'] = '/etc/swekey-pma.conf';
|
||||
|
||||
/*
|
||||
* End of servers configuration
|
||||
*/
|
||||
|
||||
/*
|
||||
* Directories for saving/loading files from server
|
||||
*/
|
||||
$cfg['UploadDir'] = '';
|
||||
$cfg['SaveDir'] = '';
|
||||
|
||||
?>
|
@@ -1,12 +0,0 @@
|
||||
$Id$
|
||||
|
||||
This directory contains various stuff contributed by users that might be
|
||||
useful to other. There is no guarantee it will work for you.
|
||||
|
||||
Current content of this directory:
|
||||
|
||||
packaging - Contains files needed for creating packages for various
|
||||
distributions. Please prefer official packages from your vendor if
|
||||
possible.
|
||||
|
||||
vim: expandtab ts=4 sw=4 sts=4 tw=78
|
@@ -1,12 +0,0 @@
|
||||
#
|
||||
# MySQL server administration.
|
||||
#
|
||||
Alias /phpMyAdmin /var/www/myadmin
|
||||
|
||||
<Directory /var/www/myadmin>
|
||||
DirectoryIndex index.php
|
||||
Options Indexes Includes ExecCGI
|
||||
AllowOverride None
|
||||
Order deny,allow
|
||||
Allow from all
|
||||
</Directory>
|
@@ -1,163 +0,0 @@
|
||||
%define _myadminpath /var/www/myadmin
|
||||
%define pkgrelease rc1
|
||||
%define microrelease 1
|
||||
|
||||
Name: phpMyAdmin
|
||||
Version: 2.8.0
|
||||
Release: %{pkgrelease}.%{microrelease}
|
||||
License: GPL
|
||||
Group: Applications/Databases/Interfaces
|
||||
Source0: http://prdownloads.sourceforge.net/phpmyadmin/%{name}-%{version}-%{pkgrelease}.tar.bz2
|
||||
Source1: phpMyAdmin-http.conf
|
||||
URL: http://sourceforge.net/projects/phpmyadmin/
|
||||
Requires: mysql
|
||||
Requires: php-mysql
|
||||
Buildarch: noarch
|
||||
BuildRoot: %{_tmppath}/%{name}-root
|
||||
|
||||
Summary: phpMyAdmin - web-based MySQL administration
|
||||
|
||||
%description
|
||||
phpMyAdmin can manage a whole MySQL-server (needs a super-user) but
|
||||
also a single database. To accomplish the latter you'll need a
|
||||
properly set up MySQL-user which can read/write only the desired
|
||||
database. It's up to you to look up the appropiate part in the MySQL
|
||||
manual. Currently phpMyAdmin can:
|
||||
- create and drop databases
|
||||
- create, copy, drop and alter tables
|
||||
- delete, edit and add fields
|
||||
- execute any SQL-statement, even batch-queries
|
||||
- manage keys on fields
|
||||
- load text files into tables
|
||||
- create (*) and read dumps of tables
|
||||
- export (*) and import data to CSV values
|
||||
- administer multiple servers and single databases
|
||||
- check referencial integrity
|
||||
- create complex queries automatically connecting required tables
|
||||
- create PDF graphics of your database layout
|
||||
- communicate in more than 38 different languages
|
||||
|
||||
|
||||
%prep
|
||||
%setup -q -n %{name}-%{version}-%{pkgrelease}
|
||||
|
||||
|
||||
%build
|
||||
|
||||
|
||||
%install
|
||||
[ "${RPM_BUILD_ROOT}" != "/" ] && [ -d "${RPM_BUILD_ROOT}" ] && \
|
||||
rm -rf "${RPM_BUILD_ROOT}"
|
||||
|
||||
# Create directories.
|
||||
|
||||
install -d "${RPM_BUILD_ROOT}%{_myadminpath}"/{css,js,lang,libraries,themes}
|
||||
install -d "${RPM_BUILD_ROOT}%{_myadminpath}"/libraries/{auth,dbg,dbi,engines}
|
||||
install -d "${RPM_BUILD_ROOT}%{_myadminpath}"/libraries/{export,tcpdf,import}
|
||||
install -d "${RPM_BUILD_ROOT}%{_myadminpath}"/libraries/transformations
|
||||
install -d "${RPM_BUILD_ROOT}%{_myadminpath}"/libraries/tcpdf/font
|
||||
install -d "${RPM_BUILD_ROOT}%{_myadminpath}"/themes/{darkblue_orange,original}
|
||||
install -d "${RPM_BUILD_ROOT}%{_myadminpath}"/themes/darkblue_orange/{css,img}
|
||||
install -d "${RPM_BUILD_ROOT}%{_myadminpath}"/themes/original/{css,img}
|
||||
|
||||
# Install files.
|
||||
|
||||
install libraries/config.default.php \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}"/config.inc.php
|
||||
install *.{php,ico} "${RPM_BUILD_ROOT}%{_myadminpath}"/
|
||||
install ChangeLog LICENSE README "${RPM_BUILD_ROOT}%{_myadminpath}"/
|
||||
install Documentation.html docs.css "${RPM_BUILD_ROOT}%{_myadminpath}"/
|
||||
install css/* "${RPM_BUILD_ROOT}%{_myadminpath}/css"/
|
||||
install js/* "${RPM_BUILD_ROOT}%{_myadminpath}/js"/
|
||||
install lang/*.php "${RPM_BUILD_ROOT}%{_myadminpath}/lang"/
|
||||
install libraries/*.php "${RPM_BUILD_ROOT}%{_myadminpath}/libraries"/
|
||||
install libraries/auth/*.php "${RPM_BUILD_ROOT}%{_myadminpath}/libraries/auth"/
|
||||
install libraries/dbg/*.php "${RPM_BUILD_ROOT}%{_myadminpath}/libraries/dbg"/
|
||||
install libraries/dbi/*.php "${RPM_BUILD_ROOT}%{_myadminpath}/libraries/dbi"/
|
||||
install libraries/engines/*.php \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}/libraries/engines"/
|
||||
install libraries/export/*.php \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}/libraries/export"/
|
||||
install libraries/tcpdf/*.php "${RPM_BUILD_ROOT}%{_myadminpath}/libraries/tcpdf"/
|
||||
install libraries/tcpdf/font/*.{php,z} \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}/libraries/tcpdf/font"/
|
||||
install libraries/import/*.php \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}/libraries/import"/
|
||||
install libraries/transformations/*.php \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}/libraries/transformations"/
|
||||
install themes/darkblue_orange/*.{php,png} \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}/themes/darkblue_orange"/
|
||||
install themes/darkblue_orange/css/*.php \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}/themes/darkblue_orange/css"/
|
||||
install themes/darkblue_orange/img/*.{png,ico} \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}/themes/darkblue_orange/img"/
|
||||
install themes/original/*.{php,png} \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}/themes/original"/
|
||||
install themes/original/css/*.php \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}/themes/original/css"/
|
||||
install themes/original/img/*.{png,ico} \
|
||||
"${RPM_BUILD_ROOT}%{_myadminpath}/themes/original/img"/
|
||||
|
||||
# Create documentation directories.
|
||||
|
||||
DOCROOT="${RPM_BUILD_ROOT}%{_docdir}/%{name}-%{version}"
|
||||
install -d "${DOCROOT}"
|
||||
install -d "${DOCROOT}"/{lang,scripts,transformations}
|
||||
|
||||
# Install documentation files.
|
||||
|
||||
install RELEASE-DATE-* "${DOCROOT}"/
|
||||
install CREDITS ChangeLog INSTALL LICENSE "${DOCROOT}"/
|
||||
install README TODO "${DOCROOT}"/
|
||||
install Documentation.* docs.css "${DOCROOT}"/
|
||||
install translators.html "${DOCROOT}"/
|
||||
install lang/*.sh "${DOCROOT}"/lang/
|
||||
install scripts/* "${DOCROOT}"/scripts/
|
||||
install libraries/tcpdf/README "${DOCROOT}"/README.tcpdf
|
||||
install libraries/import/README "${DOCROOT}"/README.import
|
||||
install libraries/transformations/README "${DOCROOT}"/transformations/
|
||||
install libraries/transformations/TEMPLATE* "${DOCROOT}"/transformations/
|
||||
install libraries/transformations/*.sh "${DOCROOT}"/transformations/
|
||||
|
||||
# Install configuration file for Apache.
|
||||
|
||||
install -d "${RPM_BUILD_ROOT}%{_sysconfdir}/httpd/conf.d"
|
||||
install "%{SOURCE1}" \
|
||||
"${RPM_BUILD_ROOT}%{_sysconfdir}/httpd/conf.d/phpMyAdmin.conf"
|
||||
|
||||
# Generate non-configuration file list.
|
||||
|
||||
(cd "${RPM_BUILD_ROOT}"; ls -d ."%{_myadminpath}"/*) |
|
||||
sed -e '/\/config\.inc\.php$/d' -e 's/^.//' > files.list
|
||||
|
||||
|
||||
|
||||
%clean
|
||||
[ "${RPM_BUILD_ROOT}" != "/" ] && [ -d "${RPM_BUILD_ROOT}" ] && \
|
||||
rm -rf "${RPM_BUILD_ROOT}"
|
||||
|
||||
|
||||
%files -f files.list
|
||||
%defattr(644, root, root, 755)
|
||||
%doc %{_docdir}/%{name}-%{version}
|
||||
%dir %{_myadminpath}
|
||||
%attr(640,root,apache) %config(noreplace) %verify(not size mtime md5) %{_myadminpath}/config.inc.php
|
||||
%config(noreplace) %verify(not size mtime md5) %{_sysconfdir}/httpd/conf.d/*
|
||||
|
||||
|
||||
%changelog
|
||||
* Thu Feb 23 2006 Patrick Monnerat <pm@datasphere.ch>
|
||||
- Version 2.8.0-rc1.1.
|
||||
|
||||
* Thu Dec 22 2005 Patrick Monnerat <patrick.monnerat@econophone.ch>
|
||||
- Path "nullpw" to allow trying connection with null password after failure.
|
||||
- Version 2.7.0-pl1.1.
|
||||
|
||||
* Mon Aug 22 2005 Patrick Monnerat <patrick.monnerat@econophone.ch>
|
||||
- Version 2.6.3-pl1.
|
||||
|
||||
* Wed Jul 21 2004 Patrick Monnerat <patrick.monnerat@econophone.ch>
|
||||
- Version 2.5.7-pl1.
|
||||
|
||||
* Fri Nov 22 2002 Patrick Monnerat <patrick.monnerat@econophone.ch>
|
||||
- Version 2.3.0-rc1.
|
@@ -1,44 +0,0 @@
|
||||
# This is a typical file used to enable Swekey hardware authentication.
|
||||
#
|
||||
# To activate the Swekey authentication add the following line to your config.inc.php file.
|
||||
# $cfg['Servers'][$i]['auth_swekey_config'] = '/etc/swekey-pma.conf';
|
||||
# Then rename this file "swekey-pma.conf" and copy it to the /etc directory.
|
||||
# Add all the Swekey ids you want to grant access to in the file.
|
||||
# After each Swekey id put the corresponding user name.
|
||||
#
|
||||
# If you don't know the id of a Swekey just visit http://www.swekey.com?sel=support
|
||||
# while your Swekey is connected.
|
||||
#
|
||||
# If you need to purchase a Swekey please visit http://phpmyadmin.net/auth_key
|
||||
# since this link provides funding to PhpMyAdmin.
|
||||
#
|
||||
|
||||
0000000000000000000000000000763A:root
|
||||
000000000000000000000000000089E4:steve
|
||||
0000000000000000000000000000231E:scott
|
||||
|
||||
#
|
||||
# It is recommended to include the following lines to contact the
|
||||
# authentication servers in SSL mode.
|
||||
#
|
||||
|
||||
SERVER_CHECK=https://auth-check-ssl.musbe.net
|
||||
SERVER_RNDTOKEN=https://auth-rnd-gen-ssl.musbe.net
|
||||
SERVER_STATUS=https://auth-status-ssl.musbe.net
|
||||
|
||||
#
|
||||
# The path of the root certificate file used to ensure a secure
|
||||
# communication with the authentication servers in SSL mode.
|
||||
# If not specified, will use musbe-ca.crt found in your
|
||||
# phpMyAdmin/libraries/auth/swekey.
|
||||
#
|
||||
|
||||
#CA_FILE=/var/http-root/phpmyadmin/libraries/auth/swekey/musbe-ca.crt
|
||||
|
||||
#
|
||||
# If your server receives many login requests, you can enable the random
|
||||
# token caching to accelerate the authentication process.
|
||||
# Token caching is enabled by default.
|
||||
#
|
||||
|
||||
#ENABLE_TOKEN_CACHE=0
|
@@ -1,52 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
* Gets some core libraries
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
$GLOBALS['js_include'][] = 'functions.js';
|
||||
require_once './libraries/mysql_charsets.lib.php';
|
||||
|
||||
PMA_checkParameters(array('new_db'));
|
||||
|
||||
/**
|
||||
* Defines the url to return to in case of error in a sql statement
|
||||
*/
|
||||
$err_url = 'main.php?' . PMA_generate_common_url();
|
||||
|
||||
/**
|
||||
* Builds and executes the db creation sql query
|
||||
*/
|
||||
$sql_query = 'CREATE DATABASE ' . PMA_backquote($new_db);
|
||||
if (!empty($db_collation)) {
|
||||
list($db_charset) = explode('_', $db_collation);
|
||||
if (in_array($db_charset, $mysql_charsets) && in_array($db_collation, $mysql_collations[$db_charset])) {
|
||||
$sql_query .= ' DEFAULT' . PMA_generateCharsetQueryPart($db_collation);
|
||||
}
|
||||
unset($db_charset, $db_collation);
|
||||
}
|
||||
$sql_query .= ';';
|
||||
|
||||
$result = PMA_DBI_try_query($sql_query);
|
||||
|
||||
if (! $result) {
|
||||
$message = PMA_Message::rawError(PMA_DBI_getError());
|
||||
// avoid displaying the not-created db name in header or navi panel
|
||||
$GLOBALS['db'] = '';
|
||||
$GLOBALS['table'] = '';
|
||||
require_once './libraries/header.inc.php';
|
||||
require_once './main.php';
|
||||
} else {
|
||||
$message = PMA_Message::success('strDatabaseHasBeenCreated');
|
||||
$message->addParam($new_db);
|
||||
$GLOBALS['db'] = $new_db;
|
||||
|
||||
require_once './libraries/header.inc.php';
|
||||
require_once './' . $cfg['DefaultTabDatabase'];
|
||||
}
|
||||
?>
|
327
db_datadict.php
@@ -1,327 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
* Gets the variables sent or posted to this script, then displays headers
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
|
||||
if (!isset($selected_tbl)) {
|
||||
require_once './libraries/header.inc.php';
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Gets the relations settings
|
||||
*/
|
||||
require_once './libraries/relation.lib.php';
|
||||
require_once './libraries/transformations.lib.php';
|
||||
|
||||
$cfgRelation = PMA_getRelationsParam();
|
||||
|
||||
/**
|
||||
* Check parameters
|
||||
*/
|
||||
PMA_checkParameters(array('db'));
|
||||
|
||||
/**
|
||||
* Defines the url to return to in case of error in a sql statement
|
||||
*/
|
||||
if (strlen($table)) {
|
||||
$err_url = 'tbl_sql.php?' . PMA_generate_common_url($db, $table);
|
||||
} else {
|
||||
$err_url = 'db_sql.php?' . PMA_generate_common_url($db);
|
||||
}
|
||||
|
||||
if ($cfgRelation['commwork']) {
|
||||
$comment = PMA_getDbComment($db);
|
||||
|
||||
/**
|
||||
* Displays DB comment
|
||||
*/
|
||||
if ($comment) {
|
||||
?>
|
||||
<p> <?php echo $strDBComment; ?>
|
||||
<i><?php echo htmlspecialchars($comment); ?></i></p>
|
||||
<?php
|
||||
} // end if
|
||||
}
|
||||
|
||||
/**
|
||||
* Selects the database and gets tables names
|
||||
*/
|
||||
PMA_DBI_select_db($db);
|
||||
$rowset = PMA_DBI_query('SHOW TABLES FROM ' . PMA_backquote($db) . ';', null, PMA_DBI_QUERY_STORE);
|
||||
|
||||
$count = 0;
|
||||
while ($row = PMA_DBI_fetch_assoc($rowset)) {
|
||||
$myfieldname = 'Tables_in_' . htmlspecialchars($db);
|
||||
$table = $row[$myfieldname];
|
||||
$comments = PMA_getComments($db, $table);
|
||||
|
||||
if ($count != 0) {
|
||||
echo '<div style="page-break-before: always;">' . "\n";
|
||||
} else {
|
||||
echo '<div>' . "\n";
|
||||
}
|
||||
|
||||
echo '<h2>' . $table . '</h2>' . "\n";
|
||||
|
||||
/**
|
||||
* Gets table informations
|
||||
*/
|
||||
// The 'show table' statement works correct since 3.23.03
|
||||
$showtable = PMA_DBI_get_tables_full($db, $table);
|
||||
$num_rows = (isset($showtable[$table]['TABLE_ROWS']) ? $showtable[$table]['TABLE_ROWS'] : 0);
|
||||
$show_comment = (isset($showtable[$table]['TABLE_COMMENT']) ? $showtable[$table]['TABLE_COMMENT'] : '');
|
||||
unset($showtable);
|
||||
|
||||
|
||||
/**
|
||||
* Gets table keys and retains them
|
||||
*/
|
||||
|
||||
PMA_DBI_select_db($db);
|
||||
$result = PMA_DBI_query('SHOW KEYS FROM ' . PMA_backquote($table) . ';');
|
||||
$primary = '';
|
||||
$indexes = array();
|
||||
$lastIndex = '';
|
||||
$indexes_info = array();
|
||||
$indexes_data = array();
|
||||
$pk_array = array(); // will be use to emphasis prim. keys in the table
|
||||
// view
|
||||
while ($row = PMA_DBI_fetch_assoc($result)) {
|
||||
// Backups the list of primary keys
|
||||
if ($row['Key_name'] == 'PRIMARY') {
|
||||
$primary .= $row['Column_name'] . ', ';
|
||||
$pk_array[$row['Column_name']] = 1;
|
||||
}
|
||||
// Retains keys informations
|
||||
if ($row['Key_name'] != $lastIndex){
|
||||
$indexes[] = $row['Key_name'];
|
||||
$lastIndex = $row['Key_name'];
|
||||
}
|
||||
$indexes_info[$row['Key_name']]['Sequences'][] = $row['Seq_in_index'];
|
||||
$indexes_info[$row['Key_name']]['Non_unique'] = $row['Non_unique'];
|
||||
if (isset($row['Cardinality'])) {
|
||||
$indexes_info[$row['Key_name']]['Cardinality'] = $row['Cardinality'];
|
||||
}
|
||||
// I don't know what does following column mean....
|
||||
// $indexes_info[$row['Key_name']]['Packed'] = $row['Packed'];
|
||||
|
||||
$indexes_info[$row['Key_name']]['Comment'] = $row['Comment'];
|
||||
|
||||
$indexes_data[$row['Key_name']][$row['Seq_in_index']]['Column_name'] = $row['Column_name'];
|
||||
if (isset($row['Sub_part'])) {
|
||||
$indexes_data[$row['Key_name']][$row['Seq_in_index']]['Sub_part'] = $row['Sub_part'];
|
||||
}
|
||||
|
||||
} // end while
|
||||
if ($result) {
|
||||
PMA_DBI_free_result($result);
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Gets fields properties
|
||||
*/
|
||||
$result = PMA_DBI_query('SHOW FIELDS FROM ' . PMA_backquote($table) . ';', null, PMA_DBI_QUERY_STORE);
|
||||
$fields_cnt = PMA_DBI_num_rows($result);
|
||||
|
||||
if (PMA_MYSQL_INT_VERSION < 50025) {
|
||||
// We need this to correctly learn if a TIMESTAMP is NOT NULL, since
|
||||
// SHOW FULL FIELDS or INFORMATION_SCHEMA incorrectly says NULL
|
||||
// and SHOW CREATE TABLE says NOT NULL
|
||||
// http://bugs.mysql.com/20910.
|
||||
|
||||
$show_create_table = PMA_DBI_fetch_value(
|
||||
'SHOW CREATE TABLE ' . PMA_backquote($db) . '.' . PMA_backquote($table),
|
||||
0, 1);
|
||||
$analyzed_sql = PMA_SQP_analyze(PMA_SQP_parse($show_create_table));
|
||||
}
|
||||
|
||||
// Check if we can use Relations (Mike Beck)
|
||||
if (!empty($cfgRelation['relation'])) {
|
||||
// Find which tables are related with the current one and write it in
|
||||
// an array
|
||||
$res_rel = PMA_getForeigners($db, $table);
|
||||
|
||||
if (count($res_rel) > 0) {
|
||||
$have_rel = TRUE;
|
||||
} else {
|
||||
$have_rel = FALSE;
|
||||
}
|
||||
} else {
|
||||
$have_rel = FALSE;
|
||||
} // end if
|
||||
|
||||
|
||||
/**
|
||||
* Displays the comments of the table if MySQL >= 3.23
|
||||
*/
|
||||
if (!empty($show_comment)) {
|
||||
echo $strTableComments . ': ' . htmlspecialchars($show_comment) . '<br /><br />';
|
||||
}
|
||||
|
||||
/**
|
||||
* Displays the table structure
|
||||
*/
|
||||
?>
|
||||
|
||||
<table width="100%" class="print">
|
||||
<tr><th width="50"><?php echo $strField; ?></th>
|
||||
<th width="80"><?php echo $strType; ?></th>
|
||||
<?php /* <th width="50"><?php echo $strAttr; ?></th>*/ ?>
|
||||
<th width="40"><?php echo $strNull; ?></th>
|
||||
<th width="70"><?php echo $strDefault; ?></th>
|
||||
<?php /* <th width="50"><?php echo $strExtra; ?></th>*/ ?>
|
||||
<?php
|
||||
if ($have_rel) {
|
||||
echo ' <th>' . $strLinksTo . '</th>' . "\n";
|
||||
}
|
||||
echo ' <th>' . $strComments . '</th>' . "\n";
|
||||
if ($cfgRelation['mimework']) {
|
||||
echo ' <th>MIME</th>' . "\n";
|
||||
}
|
||||
?>
|
||||
</tr>
|
||||
<?php
|
||||
$odd_row = true;
|
||||
while ($row = PMA_DBI_fetch_assoc($result)) {
|
||||
|
||||
if ($row['Null'] == '') {
|
||||
$row['Null'] = 'NO';
|
||||
}
|
||||
$type = $row['Type'];
|
||||
// reformat mysql query output - staybyte - 9. June 2001
|
||||
// loic1: set or enum types: slashes single quotes inside options
|
||||
if (preg_match('@^(set|enum)\((.+)\)$@i', $type, $tmp)) {
|
||||
$tmp[2] = substr(preg_replace('@([^,])\'\'@', '\\1\\\'', ',' . $tmp[2]), 1);
|
||||
$type = $tmp[1] . '(' . str_replace(',', ', ', $tmp[2]) . ')';
|
||||
$type_nowrap = '';
|
||||
|
||||
$binary = 0;
|
||||
$unsigned = 0;
|
||||
$zerofill = 0;
|
||||
} else {
|
||||
$binary = stristr($row['Type'], 'binary');
|
||||
$unsigned = stristr($row['Type'], 'unsigned');
|
||||
$zerofill = stristr($row['Type'], 'zerofill');
|
||||
$type_nowrap = ' nowrap="nowrap"';
|
||||
$type = preg_replace('@BINARY@i', '', $type);
|
||||
$type = preg_replace('@ZEROFILL@i', '', $type);
|
||||
$type = preg_replace('@UNSIGNED@i', '', $type);
|
||||
if (empty($type)) {
|
||||
$type = ' ';
|
||||
}
|
||||
}
|
||||
$strAttribute = ' ';
|
||||
if ($binary) {
|
||||
$strAttribute = 'BINARY';
|
||||
}
|
||||
if ($unsigned) {
|
||||
$strAttribute = 'UNSIGNED';
|
||||
}
|
||||
if ($zerofill) {
|
||||
$strAttribute = 'UNSIGNED ZEROFILL';
|
||||
}
|
||||
if (!isset($row['Default'])) {
|
||||
if ($row['Null'] != 'NO') {
|
||||
$row['Default'] = '<i>NULL</i>';
|
||||
}
|
||||
} else {
|
||||
$row['Default'] = htmlspecialchars($row['Default']);
|
||||
}
|
||||
$field_name = htmlspecialchars($row['Field']);
|
||||
|
||||
if (PMA_MYSQL_INT_VERSION < 50025
|
||||
&& ! empty($analyzed_sql[0]['create_table_fields'][$field_name]['type'])
|
||||
&& $analyzed_sql[0]['create_table_fields'][$field_name]['type'] == 'TIMESTAMP'
|
||||
&& $analyzed_sql[0]['create_table_fields'][$field_name]['timestamp_not_null']) {
|
||||
// here, we have a TIMESTAMP that SHOW FULL FIELDS reports as having the
|
||||
// NULL attribute, but SHOW CREATE TABLE says the contrary. Believe
|
||||
// the latter.
|
||||
/**
|
||||
* @todo merge this logic with the one in tbl_structure.php
|
||||
* or move it in a function similar to PMA_DBI_get_columns_full()
|
||||
* but based on SHOW CREATE TABLE because information_schema
|
||||
* cannot be trusted in this case (MySQL bug)
|
||||
*/
|
||||
$row['Null'] = 'NO';
|
||||
}
|
||||
?>
|
||||
<tr class="<?php echo $odd_row ? 'odd' : 'even'; $odd_row = ! $odd_row; ?>">
|
||||
<td nowrap="nowrap">
|
||||
<?php
|
||||
if (isset($pk_array[$row['Field']])) {
|
||||
echo '<u>' . $field_name . '</u>';
|
||||
} else {
|
||||
echo $field_name;
|
||||
}
|
||||
?>
|
||||
</td>
|
||||
<td<?php echo $type_nowrap; ?> xml:lang="en" dir="ltr"><?php echo $type; ?></td>
|
||||
<?php /* <td<?php echo $type_nowrap; ?>><?php echo $strAttribute; ?></td>*/ ?>
|
||||
<td><?php echo (($row['Null'] == 'NO') ? $strNo : $strYes); ?></td>
|
||||
<td nowrap="nowrap"><?php if (isset($row['Default'])) { echo $row['Default']; } ?></td>
|
||||
<?php /* <td<?php echo $type_nowrap; ?>><?php echo $row['Extra']; ?></td>*/ ?>
|
||||
<?php
|
||||
if ($have_rel) {
|
||||
echo ' <td>';
|
||||
if (isset($res_rel[$field_name])) {
|
||||
echo htmlspecialchars($res_rel[$field_name]['foreign_table'] . ' -> ' . $res_rel[$field_name]['foreign_field']);
|
||||
}
|
||||
echo '</td>' . "\n";
|
||||
}
|
||||
echo ' <td>';
|
||||
if (isset($comments[$field_name])) {
|
||||
echo htmlspecialchars($comments[$field_name]);
|
||||
}
|
||||
echo '</td>' . "\n";
|
||||
if ($cfgRelation['mimework']) {
|
||||
$mime_map = PMA_getMIME($db, $table, true);
|
||||
|
||||
echo ' <td>';
|
||||
if (isset($mime_map[$field_name])) {
|
||||
echo htmlspecialchars(str_replace('_', '/', $mime_map[$field_name]['mimetype']));
|
||||
}
|
||||
echo '</td>' . "\n";
|
||||
}
|
||||
?>
|
||||
</tr>
|
||||
<?php
|
||||
} // end while
|
||||
PMA_DBI_free_result($result);
|
||||
$count++;
|
||||
?>
|
||||
</table>
|
||||
</div>
|
||||
<?php
|
||||
} //ends main while
|
||||
|
||||
/**
|
||||
* Displays the footer
|
||||
*/
|
||||
?>
|
||||
<script type="text/javascript">
|
||||
//<![CDATA[
|
||||
function printPage()
|
||||
{
|
||||
document.getElementById('print').style.visibility = 'hidden';
|
||||
// Do print the page
|
||||
if (typeof(window.print) != 'undefined') {
|
||||
window.print();
|
||||
}
|
||||
document.getElementById('print').style.visibility = '';
|
||||
}
|
||||
//]]>
|
||||
</script>
|
||||
<?php
|
||||
echo '<br /><br /><input type="button" id="print" value="' . $strPrint . '" onclick="printPage()" />';
|
||||
|
||||
require_once './libraries/footer.inc.php';
|
||||
?>
|
@@ -1,77 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* dumps a database
|
||||
*
|
||||
* @version $Id$
|
||||
* @uses libraries/db_common.inc.php
|
||||
* @uses libraries/db_info.inc.php
|
||||
* @uses libraries/display_export.lib.php
|
||||
* @uses $tables from libraries/db_info.inc.php
|
||||
*/
|
||||
|
||||
/**
|
||||
* Gets some core libraries
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
|
||||
// $sub_part is also used in db_info.inc.php to see if we are coming from
|
||||
// db_export.php, in which case we don't obey $cfg['MaxTableList']
|
||||
$sub_part = '_export';
|
||||
require_once './libraries/db_common.inc.php';
|
||||
$url_query .= '&goto=db_export.php';
|
||||
require_once './libraries/db_info.inc.php';
|
||||
|
||||
/**
|
||||
* Displays the form
|
||||
*/
|
||||
$export_page_title = $strViewDumpDB;
|
||||
|
||||
// exit if no tables in db found
|
||||
if ($num_tables < 1) {
|
||||
PMA_Message::error('strNoTablesFound')->display();
|
||||
require './libraries/footer.inc.php';
|
||||
exit;
|
||||
} // end if
|
||||
|
||||
$checkall_url = 'db_export.php?'
|
||||
. PMA_generate_common_url($db)
|
||||
. '&goto=db_export.php';
|
||||
|
||||
$multi_values = '<div align="center">';
|
||||
$multi_values .= '<a href="' . $checkall_url . '" onclick="setSelectOptions(\'dump\', \'table_select[]\', true); return false;">' . $strSelectAll . '</a>
|
||||
/
|
||||
<a href="' . $checkall_url . '&unselectall=1" onclick="setSelectOptions(\'dump\', \'table_select[]\', false); return false;">' . $strUnselectAll . '</a><br />';
|
||||
|
||||
$multi_values .= '<select name="table_select[]" size="6" multiple="multiple">';
|
||||
$multi_values .= "\n";
|
||||
|
||||
foreach ($tables as $each_table) {
|
||||
// ok we show also views
|
||||
//if (is_null($each_table['Engine'])) {
|
||||
// Don't offer to export views yet.
|
||||
// continue;
|
||||
//}
|
||||
if (! empty($unselectall)
|
||||
|| (isset($tmp_select)
|
||||
&& false !== strpos($tmp_select, '|' . $each_table['Name'] . '|'))) {
|
||||
$is_selected = '';
|
||||
} else {
|
||||
$is_selected = ' selected="selected"';
|
||||
}
|
||||
$table_html = htmlspecialchars($each_table['Name']);
|
||||
$multi_values .= ' <option value="' . $table_html . '"'
|
||||
. $is_selected . '>'
|
||||
. str_replace(' ', ' ', $table_html) . '</option>' . "\n";
|
||||
} // end for
|
||||
$multi_values .= "\n";
|
||||
$multi_values .= '</select></div><br />';
|
||||
|
||||
$export_type = 'database';
|
||||
require_once './libraries/display_export.lib.php';
|
||||
|
||||
/**
|
||||
* Displays the footer
|
||||
*/
|
||||
require_once './libraries/footer.inc.php';
|
||||
?>
|
@@ -1,27 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
*
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
|
||||
/**
|
||||
* Gets tables informations and displays top links
|
||||
*/
|
||||
require './libraries/db_common.inc.php';
|
||||
require './libraries/db_info.inc.php';
|
||||
|
||||
$import_type = 'database';
|
||||
require './libraries/display_import.lib.php';
|
||||
|
||||
/**
|
||||
* Displays the footer
|
||||
*/
|
||||
require './libraries/footer.inc.php';
|
||||
?>
|
||||
|
@@ -1,673 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* handles miscellaneous db operations:
|
||||
* - move/rename
|
||||
* - copy
|
||||
* - changing collation
|
||||
* - changing comment
|
||||
* - adding tables
|
||||
* - viewing PDF schemas
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
* requirements
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
require_once './libraries/Table.class.php';
|
||||
require_once './libraries/mysql_charsets.lib.php';
|
||||
|
||||
// add blobstreaming library functions
|
||||
require_once "./libraries/blobstreaming.lib.php";
|
||||
|
||||
/**
|
||||
* Rename/move or copy database
|
||||
*/
|
||||
if (strlen($db) && (! empty($db_rename) || ! empty($db_copy))) {
|
||||
|
||||
if (! empty($db_rename)) {
|
||||
$move = true;
|
||||
} else {
|
||||
$move = false;
|
||||
}
|
||||
|
||||
if (!isset($newname) || !strlen($newname)) {
|
||||
$message = PMA_Message::error('strDatabaseEmpty');
|
||||
} else {
|
||||
$sql_query = ''; // in case target db exists
|
||||
$_error = false;
|
||||
if ($move ||
|
||||
(isset($create_database_before_copying) && $create_database_before_copying)) {
|
||||
// lower_case_table_names=1 `DB` becomes `db`
|
||||
$lower_case_table_names = PMA_DBI_fetch_value('SHOW VARIABLES LIKE "lower_case_table_names"', 0, 1);
|
||||
if ($lower_case_table_names === '1') {
|
||||
$newname = strtolower($newname);
|
||||
}
|
||||
|
||||
$local_query = 'CREATE DATABASE ' . PMA_backquote($newname);
|
||||
if (isset($db_collation)) {
|
||||
$local_query .= ' DEFAULT' . PMA_generateCharsetQueryPart($db_collation);
|
||||
}
|
||||
$local_query .= ';';
|
||||
$sql_query = $local_query;
|
||||
PMA_DBI_query($local_query);
|
||||
|
||||
// rebuild the database list because PMA_Table::moveCopy
|
||||
// checks in this list if the target db exists
|
||||
$GLOBALS['pma']->databases->build();
|
||||
}
|
||||
|
||||
if (isset($GLOBALS['add_constraints'])) {
|
||||
$GLOBALS['sql_constraints_query_full_db'] = '';
|
||||
}
|
||||
|
||||
$tables_full = PMA_DBI_get_tables_full($db);
|
||||
$views = array();
|
||||
foreach ($tables_full as $each_table => $tmp) {
|
||||
// to be able to rename a db containing views, we
|
||||
// first collect in $views all the views we find and we
|
||||
// will handle them after the tables
|
||||
/**
|
||||
* @todo support a view of a view
|
||||
* @todo support triggers
|
||||
*/
|
||||
if (PMA_Table::isView($db, $each_table)) {
|
||||
$views[] = $each_table;
|
||||
continue;
|
||||
}
|
||||
|
||||
$back = $sql_query;
|
||||
$sql_query = '';
|
||||
|
||||
// value of $what for this table only
|
||||
$this_what = $what;
|
||||
|
||||
// do not copy the data from a Merge table
|
||||
// note: on the calling FORM, 'data' means 'structure and data'
|
||||
if ($tables_full[$each_table]['Engine'] == 'MRG_MyISAM') {
|
||||
if ($this_what == 'data') {
|
||||
$this_what = 'structure';
|
||||
}
|
||||
if ($this_what == 'dataonly') {
|
||||
$this_what = 'nocopy';
|
||||
}
|
||||
}
|
||||
|
||||
if ($this_what != 'nocopy') {
|
||||
if (! PMA_Table::moveCopy($db, $each_table, $newname, $each_table,
|
||||
isset($this_what) ? $this_what : 'data', $move, 'db_copy'))
|
||||
{
|
||||
$_error = true;
|
||||
// $sql_query is filled by PMA_Table::moveCopy()
|
||||
$sql_query = $back . $sql_query;
|
||||
break;
|
||||
}
|
||||
if (isset($GLOBALS['add_constraints'])) {
|
||||
$GLOBALS['sql_constraints_query_full_db'] .= $GLOBALS['sql_constraints_query'];
|
||||
unset($GLOBALS['sql_constraints_query']);
|
||||
}
|
||||
}
|
||||
// $sql_query is filled by PMA_Table::moveCopy()
|
||||
$sql_query = $back . $sql_query;
|
||||
} // end (foreach)
|
||||
unset($each_table);
|
||||
|
||||
// handle the views
|
||||
if (! $_error) {
|
||||
foreach ($views as $view) {
|
||||
if (! PMA_Table::moveCopy($db, $view, $newname, $view,
|
||||
'structure', $move, 'db_copy')) {
|
||||
$_error = true;
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
unset($view, $views);
|
||||
|
||||
// now that all tables exist, create all the accumulated constraints
|
||||
if (! $_error && isset($GLOBALS['add_constraints'])) {
|
||||
/**
|
||||
* @todo this works with mysqli but not with mysql, because
|
||||
* mysql extension does not accept more than one statement; maybe
|
||||
* interface with the sql import plugin that handles statement delimiter
|
||||
*/
|
||||
PMA_DBI_query($GLOBALS['sql_constraints_query_full_db']);
|
||||
|
||||
// and prepare to display them
|
||||
$GLOBALS['sql_query'] .= "\n" . $GLOBALS['sql_constraints_query_full_db'];
|
||||
unset($GLOBALS['sql_constraints_query_full_db']);
|
||||
}
|
||||
|
||||
if (PMA_MYSQL_INT_VERSION >= 50000) {
|
||||
// here I don't use DELIMITER because it's not part of the
|
||||
// language; I have to send each statement one by one
|
||||
|
||||
// to avoid selecting alternatively the current and new db
|
||||
// we would need to modify the CREATE definitions to qualify
|
||||
// the db name
|
||||
$procedure_names = PMA_DBI_get_procedures_or_functions($db, 'PROCEDURE');
|
||||
if ($procedure_names) {
|
||||
foreach($procedure_names as $procedure_name) {
|
||||
PMA_DBI_select_db($db);
|
||||
$tmp_query = PMA_DBI_get_definition($db, 'PROCEDURE', $procedure_name);
|
||||
// collect for later display
|
||||
$GLOBALS['sql_query'] .= "\n" . $tmp_query;
|
||||
PMA_DBI_select_db($newname);
|
||||
PMA_DBI_query($tmp_query);
|
||||
}
|
||||
}
|
||||
|
||||
$function_names = PMA_DBI_get_procedures_or_functions($db, 'FUNCTION');
|
||||
if ($function_names) {
|
||||
foreach($function_names as $function_name) {
|
||||
PMA_DBI_select_db($db);
|
||||
$tmp_query = PMA_DBI_get_definition($db, 'FUNCTION', $function_name);
|
||||
// collect for later display
|
||||
$GLOBALS['sql_query'] .= "\n" . $tmp_query;
|
||||
PMA_DBI_select_db($newname);
|
||||
PMA_DBI_query($tmp_query);
|
||||
}
|
||||
}
|
||||
}
|
||||
// go back to current db, just in case
|
||||
PMA_DBI_select_db($db);
|
||||
|
||||
// Duplicate the bookmarks for this db (done once for each db)
|
||||
if (! $_error && $db != $newname) {
|
||||
$get_fields = array('user', 'label', 'query');
|
||||
$where_fields = array('dbase' => $db);
|
||||
$new_fields = array('dbase' => $newname);
|
||||
PMA_Table::duplicateInfo('bookmarkwork', 'bookmark', $get_fields,
|
||||
$where_fields, $new_fields);
|
||||
}
|
||||
|
||||
if (! $_error && $move) {
|
||||
// cleanup pmadb stuff for this db
|
||||
require_once './libraries/relation_cleanup.lib.php';
|
||||
PMA_relationsCleanupDatabase($db);
|
||||
|
||||
// if someday the RENAME DATABASE reappears, do not DROP
|
||||
$local_query = 'DROP DATABASE ' . PMA_backquote($db) . ';';
|
||||
$sql_query .= "\n" . $local_query;
|
||||
PMA_DBI_query($local_query);
|
||||
|
||||
$message = PMA_Message::success('strRenameDatabaseOK');
|
||||
$message->addParam($db);
|
||||
$message->addParam($newname);
|
||||
} elseif (! $_error) {
|
||||
$message = PMA_Message::success('strCopyDatabaseOK');
|
||||
$message->addParam($db);
|
||||
$message->addParam($newname);
|
||||
}
|
||||
$reload = true;
|
||||
|
||||
/* Change database to be used */
|
||||
if (! $_error && $move) {
|
||||
$db = $newname;
|
||||
} elseif (! $_error) {
|
||||
if (isset($switch_to_new) && $switch_to_new == 'true') {
|
||||
PMA_setCookie('pma_switch_to_new', 'true');
|
||||
$db = $newname;
|
||||
} else {
|
||||
PMA_setCookie('pma_switch_to_new', '');
|
||||
}
|
||||
}
|
||||
|
||||
if ($_error && ! isset($message)) {
|
||||
$message = PMA_Message::error();
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/*
|
||||
* Enable/Disable/Repair BLOB Repository Monitoring for current database
|
||||
*/
|
||||
if (strlen($db) > 0 && !empty($db_blob_streaming_op))
|
||||
{
|
||||
// load PMA_Config
|
||||
$PMA_Config = $_SESSION['PMA_Config'];
|
||||
|
||||
if (!empty($PMA_Config))
|
||||
{
|
||||
if ($PMA_Config->get('PBXT_NAME') !== strtolower($db))
|
||||
{
|
||||
// if Blobstreaming plugins exist, begin checking for Blobstreaming tables
|
||||
if ($PMA_Config->get('BLOBSTREAMING_PLUGINS_EXIST'))
|
||||
{
|
||||
$bs_tables = $PMA_Config->get('BLOBSTREAMABLE_DATABASES');
|
||||
$bs_tables = $bs_tables[$db];
|
||||
|
||||
$oneBSTableExists = FALSE;
|
||||
|
||||
// check if at least one blobstreaming table exists
|
||||
foreach ($bs_tables as $table_key=>$tbl)
|
||||
if ($bs_tables[$table_key]['Exists'])
|
||||
{
|
||||
$oneBSTableExists = TRUE;
|
||||
break;
|
||||
}
|
||||
|
||||
switch ($db_blob_streaming_op)
|
||||
{
|
||||
// enable BLOB repository monitoring
|
||||
case "enable":
|
||||
// if blobstreaming tables do not exist, create them
|
||||
if (!$oneBSTableExists)
|
||||
PMA_BS_CreateTables($db);
|
||||
break;
|
||||
// disable BLOB repository monitoring
|
||||
case "disable":
|
||||
// if at least one blobstreaming table exists, execute drop
|
||||
if ($oneBSTableExists)
|
||||
PMA_BS_DropTables($db);
|
||||
break;
|
||||
// repair BLOB repository
|
||||
case "repair":
|
||||
// check if a blobstreaming table is missing
|
||||
foreach ($bs_tables as $table_key=>$tbl)
|
||||
if (!$bs_tables[$table_key]['Exists'])
|
||||
{
|
||||
PMA_DBI_select_db($db);
|
||||
PMA_DBI_query(PMA_BS_GetTableStruct($table_key));
|
||||
}
|
||||
}
|
||||
|
||||
// refresh side menu
|
||||
PMA_sendHeaderLocation($cfg['PmaAbsoluteUri'] . 'db_operations.php?' . PMA_generate_common_url ('','', '&') . (isset($db) ? '&db=' . urlencode($db) : '') . (isset($token) ? '&token=' . urlencode($token) : '') . (isset($goto) ? '&goto=' . urlencode($goto) : '') . 'reload=1&purge=1');
|
||||
} // end if ($PMA_Config->get('BLOBSTREAMING_PLUGINS_EXIST'))
|
||||
} // end if ($PMA_Config->get('PBXT_NAME') !== strtolower($db))
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Settings for relations stuff
|
||||
*/
|
||||
|
||||
require_once './libraries/relation.lib.php';
|
||||
$cfgRelation = PMA_getRelationsParam();
|
||||
|
||||
/**
|
||||
* Check if comments were updated
|
||||
* (must be done before displaying the menu tabs)
|
||||
*/
|
||||
if (isset($_REQUEST['comment'])) {
|
||||
PMA_setDbComment($db, $comment);
|
||||
}
|
||||
|
||||
/**
|
||||
* Prepares the tables list if the user where not redirected to this script
|
||||
* because there is no table in the database ($is_info is true)
|
||||
*/
|
||||
if (empty($is_info)) {
|
||||
require './libraries/db_common.inc.php';
|
||||
$url_query .= '&goto=db_operations.php';
|
||||
|
||||
// Gets the database structure
|
||||
$sub_part = '_structure';
|
||||
require './libraries/db_info.inc.php';
|
||||
echo "\n";
|
||||
|
||||
if (isset($message)) {
|
||||
PMA_showMessage($message, $sql_query);
|
||||
unset($message);
|
||||
}
|
||||
}
|
||||
|
||||
$db_collation = PMA_getDbCollation($db);
|
||||
if ($db == 'information_schema') {
|
||||
$is_information_schema = true;
|
||||
} else {
|
||||
$is_information_schema = false;
|
||||
}
|
||||
|
||||
if (!$is_information_schema) {
|
||||
|
||||
require './libraries/display_create_table.lib.php';
|
||||
|
||||
if ($cfgRelation['commwork']) {
|
||||
/**
|
||||
* database comment
|
||||
*/
|
||||
?>
|
||||
<form method="post" action="db_operations.php">
|
||||
<?php echo PMA_generate_common_hidden_inputs($db); ?>
|
||||
<fieldset>
|
||||
<legend>
|
||||
<?php echo PMA_getIcon('b_comment.png', $strDBComment, false, true); ?>
|
||||
</legend>
|
||||
<input type="text" name="comment" class="textfield" size="30"
|
||||
value="<?php
|
||||
echo htmlspecialchars(PMA_getDBComment($db)); ?>" />
|
||||
<input type="submit" value="<?php echo $strGo; ?>" />
|
||||
</fieldset>
|
||||
</form>
|
||||
<?php
|
||||
}
|
||||
/**
|
||||
* rename database
|
||||
*/
|
||||
?>
|
||||
<form method="post" action="db_operations.php"
|
||||
onsubmit="return emptyFormElements(this, 'newname')">
|
||||
<?php
|
||||
if (isset($db_collation)) {
|
||||
echo '<input type="hidden" name="db_collation" value="' . $db_collation
|
||||
.'" />' . "\n";
|
||||
}
|
||||
?>
|
||||
<input type="hidden" name="what" value="data" />
|
||||
<input type="hidden" name="db_rename" value="true" />
|
||||
<?php echo PMA_generate_common_hidden_inputs($db); ?>
|
||||
<fieldset>
|
||||
<legend>
|
||||
<?php
|
||||
if ($cfg['PropertiesIconic']) {
|
||||
echo '<img class="icon" src="' . $pmaThemeImage . 'b_edit.png"'
|
||||
.' alt="" width="16" height="16" />';
|
||||
}
|
||||
echo $strDBRename . ':';
|
||||
?>
|
||||
</legend>
|
||||
<input type="text" name="newname" size="30" class="textfield" value="" />
|
||||
<?php
|
||||
echo '(' . $strCommand . ': ';
|
||||
/**
|
||||
* @todo (see explanations above in a previous todo)
|
||||
*/
|
||||
//if (PMA_MYSQL_INT_VERSION >= XYYZZ) {
|
||||
// echo 'RENAME DATABASE';
|
||||
//} else {
|
||||
echo 'INSERT INTO ... SELECT';
|
||||
//}
|
||||
echo ')'; ?>
|
||||
<input type="submit" value="<?php echo $strGo; ?>" onclick="return confirmLink(this, 'CREATE DATABASE ... <?php echo $strAndThen; ?> DROP DATABASE <?php echo PMA_jsFormat($db); ?>')" />
|
||||
</fieldset>
|
||||
</form>
|
||||
|
||||
<?php
|
||||
/**
|
||||
* Copy database
|
||||
*/
|
||||
?>
|
||||
<form method="post" action="db_operations.php"
|
||||
onsubmit="return emptyFormElements(this, 'newname')">
|
||||
<?php
|
||||
if (isset($db_collation)) {
|
||||
echo '<input type="hidden" name="db_collation" value="' . $db_collation
|
||||
.'" />' . "\n";
|
||||
}
|
||||
echo '<input type="hidden" name="db_copy" value="true" />' . "\n";
|
||||
echo PMA_generate_common_hidden_inputs($db);
|
||||
?>
|
||||
<fieldset>
|
||||
<legend>
|
||||
<?php
|
||||
if ($cfg['PropertiesIconic']) {
|
||||
echo '<img class="icon" src="' . $pmaThemeImage . 'b_edit.png"'
|
||||
.' alt="" width="16" height="16" />';
|
||||
}
|
||||
echo $strDBCopy . ':';
|
||||
$drop_clause = 'DROP TABLE / DROP VIEW';
|
||||
?>
|
||||
</legend>
|
||||
<input type="text" name="newname" size="30" class="textfield" value="" /><br />
|
||||
<?php
|
||||
$choices = array(
|
||||
'structure' => $strStrucOnly,
|
||||
'data' => $strStrucData,
|
||||
'dataonly' => $strDataOnly);
|
||||
PMA_generate_html_radio('what', $choices, 'data', true);
|
||||
unset($choices);
|
||||
?>
|
||||
<input type="checkbox" name="create_database_before_copying" value="1"
|
||||
id="checkbox_create_database_before_copying"
|
||||
style="vertical-align: middle" checked="checked" />
|
||||
<label for="checkbox_create_database_before_copying">
|
||||
<?php echo $strCreateDatabaseBeforeCopying; ?></label><br />
|
||||
<input type="checkbox" name="drop_if_exists" value="true"
|
||||
id="checkbox_drop" style="vertical-align: middle" />
|
||||
<label for="checkbox_drop"><?php echo sprintf($strAddClause, $drop_clause); ?></label><br />
|
||||
<input type="checkbox" name="sql_auto_increment" value="1"
|
||||
id="checkbox_auto_increment" style="vertical-align: middle" />
|
||||
<label for="checkbox_auto_increment">
|
||||
<?php echo $strAddAutoIncrement; ?></label><br />
|
||||
<input type="checkbox" name="add_constraints" value="1"
|
||||
id="checkbox_constraints" style="vertical-align: middle" />
|
||||
<label for="checkbox_constraints">
|
||||
<?php echo $strAddConstraints; ?></label><br />
|
||||
<?php
|
||||
unset($drop_clause);
|
||||
|
||||
if (isset($_COOKIE) && isset($_COOKIE['pma_switch_to_new'])
|
||||
&& $_COOKIE['pma_switch_to_new'] == 'true') {
|
||||
$pma_switch_to_new = 'true';
|
||||
}
|
||||
?>
|
||||
<input type="checkbox" name="switch_to_new" value="true"
|
||||
id="checkbox_switch"
|
||||
<?php echo ((isset($pma_switch_to_new) && $pma_switch_to_new == 'true') ? ' checked="checked"' : ''); ?>
|
||||
style="vertical-align: middle" />
|
||||
<label for="checkbox_switch"><?php echo $strSwitchToDatabase; ?></label>
|
||||
</fieldset>
|
||||
<fieldset class="tblFooters">
|
||||
<input type="submit" name="submit_copy" value="<?php echo $strGo; ?>" />
|
||||
</fieldset>
|
||||
</form>
|
||||
|
||||
<?php
|
||||
/*
|
||||
* BLOB streaming support
|
||||
*/
|
||||
|
||||
// load PMA_Config
|
||||
$PMA_Config = $_SESSION['PMA_Config'];
|
||||
|
||||
// if all blobstreaming plugins exist, begin checking for blobstreaming tables
|
||||
if (!empty($PMA_Config))
|
||||
{
|
||||
if ($PMA_Config->get('PBXT_NAME') !== strtolower($db))
|
||||
{
|
||||
if ($PMA_Config->get('BLOBSTREAMING_PLUGINS_EXIST'))
|
||||
{
|
||||
$bs_tables = $PMA_Config->get('BLOBSTREAMABLE_DATABASES');
|
||||
$bs_tables = $bs_tables[$db];
|
||||
|
||||
$oneBSTableExists = FALSE;
|
||||
$allBSTablesExist = TRUE;
|
||||
|
||||
// first check that all blobstreaming tables do not exist
|
||||
foreach ($bs_tables as $table_key=>$tbl)
|
||||
if ($bs_tables[$table_key]['Exists'])
|
||||
$oneBSTableExists = TRUE;
|
||||
else
|
||||
$allBSTablesExist = FALSE;
|
||||
|
||||
?>
|
||||
|
||||
<form method="post" action="./db_operations.php">
|
||||
<?php echo PMA_generate_common_hidden_inputs($db); ?>
|
||||
<fieldset>
|
||||
<legend>
|
||||
<?php echo PMA_getIcon('b_edit.png', $strBLOBRepository, false, true); ?>
|
||||
</legend>
|
||||
|
||||
<?php echo $strBLOBRepositoryStatus; ?>:
|
||||
|
||||
<?php
|
||||
|
||||
// if the blobstreaming tables exist, provide option to disable the BLOB repository
|
||||
if ($allBSTablesExist)
|
||||
{
|
||||
?>
|
||||
<?php echo $strBLOBRepositoryEnabled; ?>
|
||||
</fieldset>
|
||||
<fieldset class="tblFooters">
|
||||
<input type="hidden" name="db_blob_streaming_op" value="disable" />
|
||||
<input type="submit" onclick="return confirmDisableRepository('<?php echo $db; ?>');" value="<?php echo $strBLOBRepositoryDisable; ?>" />
|
||||
</fieldset>
|
||||
<?php
|
||||
}
|
||||
else
|
||||
{
|
||||
// if any of the blobstreaming tables are missing, provide option to repair the BLOB repository
|
||||
if ($oneBSTableExists && !$allBSTablesExist)
|
||||
{
|
||||
?>
|
||||
<?php echo $strBLOBRepositoryDamaged; ?>
|
||||
</fieldset>
|
||||
<fieldset class="tblFooters">
|
||||
<input type="hidden" name="db_blob_streaming_op" value="repair" />
|
||||
<input type="submit" value="<?php echo $strBLOBRepositoryRepair; ?>" />
|
||||
</fieldset>
|
||||
<?php
|
||||
}
|
||||
// if none of the blobstreaming tables exist, provide option to enable BLOB repository
|
||||
else
|
||||
{
|
||||
?>
|
||||
<?php echo $strBLOBRepositoryDisabled; ?>
|
||||
</fieldset>
|
||||
<fieldset class="tblFooters">
|
||||
<input type="hidden" name="db_blob_streaming_op" value="enable" />
|
||||
<input type="submit" value="<?php echo $strBLOBRepositoryEnable; ?>" />
|
||||
</fieldset>
|
||||
<?php
|
||||
}
|
||||
} // end if ($allBSTablesExist)
|
||||
|
||||
?>
|
||||
</form>
|
||||
<?php
|
||||
} // end if ($PMA_Config->get('BLOBSTREAMING_PLUGINS_EXIST'))
|
||||
} // end if ($PMA_Config->get('PBXT_NAME') !== strtolower($db))
|
||||
}
|
||||
|
||||
/**
|
||||
* Change database charset
|
||||
*/
|
||||
echo '<form method="post" action="./db_operations.php">' . "\n"
|
||||
. PMA_generate_common_hidden_inputs($db, $table)
|
||||
. '<fieldset>' . "\n"
|
||||
. ' <legend>';
|
||||
if ($cfg['PropertiesIconic']) {
|
||||
echo '<img class="icon" src="' . $pmaThemeImage . 's_asci.png"'
|
||||
.' alt="" width="16" height="16" />';
|
||||
}
|
||||
echo ' <label for="select_db_collation">' . $strCollation . ':</label>' . "\n"
|
||||
. ' </legend>' . "\n"
|
||||
. PMA_generateCharsetDropdownBox(PMA_CSDROPDOWN_COLLATION,
|
||||
'db_collation', 'select_db_collation', $db_collation, false, 3)
|
||||
. ' <input type="submit" name="submitcollation"'
|
||||
. ' value="' . $strGo . '" style="vertical-align: middle" />' . "\n"
|
||||
. '</fieldset>' . "\n"
|
||||
. '</form>' . "\n";
|
||||
|
||||
if ($num_tables > 0
|
||||
&& !$cfgRelation['allworks'] && $cfg['PmaNoRelation_DisableWarning'] == false) {
|
||||
$message = PMA_Message::notice('strRelationNotWorking');
|
||||
$message->addParam('<a href="' . $cfg['PmaAbsoluteUri'] . 'chk_rel.php?' . $url_query . '">', false);
|
||||
$message->addParam('</a>', false);
|
||||
/* Show error if user has configured something, notice elsewhere */
|
||||
if (!empty($cfg['Servers'][$server]['pmadb'])) {
|
||||
$message->isError(true);
|
||||
}
|
||||
$message->display();
|
||||
} // end if
|
||||
} // end if (!$is_information_schema)
|
||||
|
||||
|
||||
// not sure about displaying the PDF dialog in case db is information_schema
|
||||
if ($cfgRelation['pdfwork'] && $num_tables > 0) { ?>
|
||||
<!-- Work on PDF Pages -->
|
||||
|
||||
<?php
|
||||
// We only show this if we find something in the new pdf_pages table
|
||||
|
||||
$test_query = '
|
||||
SELECT *
|
||||
FROM ' . PMA_backquote($GLOBALS['cfgRelation']['db']) . '.' . PMA_backquote($cfgRelation['pdf_pages']) . '
|
||||
WHERE db_name = \'' . PMA_sqlAddslashes($db) . '\'';
|
||||
$test_rs = PMA_query_as_cu($test_query, null, PMA_DBI_QUERY_STORE);
|
||||
|
||||
if ($test_rs && PMA_DBI_num_rows($test_rs) > 0) { ?>
|
||||
<!-- PDF schema -->
|
||||
<form method="post" action="pdf_schema.php">
|
||||
<fieldset>
|
||||
<legend>
|
||||
<?php
|
||||
echo PMA_generate_common_hidden_inputs($db);
|
||||
if ($cfg['PropertiesIconic']) {
|
||||
echo '<img class="icon" src="' . $pmaThemeImage . 'b_view.png"'
|
||||
.' alt="" width="16" height="16" />';
|
||||
}
|
||||
echo $strDisplayPDF;
|
||||
?>:
|
||||
</legend>
|
||||
<label for="pdf_page_number_opt"><?php echo $strPageNumber; ?></label>
|
||||
<select name="pdf_page_number" id="pdf_page_number_opt">
|
||||
<?php
|
||||
while ($pages = @PMA_DBI_fetch_assoc($test_rs)) {
|
||||
echo ' <option value="' . $pages['page_nr'] . '">'
|
||||
. $pages['page_nr'] . ': ' . $pages['page_descr'] . '</option>' . "\n";
|
||||
} // end while
|
||||
PMA_DBI_free_result($test_rs);
|
||||
unset($test_rs);
|
||||
?>
|
||||
</select><br />
|
||||
|
||||
<input type="checkbox" name="show_grid" id="show_grid_opt" />
|
||||
<label for="show_grid_opt"><?php echo $strShowGrid; ?></label><br />
|
||||
<input type="checkbox" name="show_color" id="show_color_opt"
|
||||
checked="checked" />
|
||||
<label for="show_color_opt"><?php echo $strShowColor; ?></label><br />
|
||||
<input type="checkbox" name="show_table_dimension" id="show_table_dim_opt" />
|
||||
<label for="show_table_dim_opt"><?php echo $strShowTableDimension; ?>
|
||||
</label><br />
|
||||
<input type="checkbox" name="all_tab_same_wide" id="all_tab_same_wide" />
|
||||
<label for="all_tab_same_wide"><?php echo $strAllTableSameWidth; ?>
|
||||
</label><br />
|
||||
<input type="checkbox" name="with_doc" id="with_doc" checked="checked" />
|
||||
<label for="with_doc"><?php echo $strDataDict; ?></label><br />
|
||||
<input type="checkbox" name="show_keys" id="show_keys" />
|
||||
<label for="show_keys"><?php echo $strShowKeys; ?></label><br />
|
||||
|
||||
<label for="orientation_opt"><?php echo $strShowDatadictAs; ?></label>
|
||||
<select name="orientation" id="orientation_opt">
|
||||
<option value="L"><?php echo $strLandscape;?></option>
|
||||
<option value="P"><?php echo $strPortrait;?></option>
|
||||
</select><br />
|
||||
|
||||
<label for="paper_opt"><?php echo $strPaperSize; ?></label>
|
||||
<select name="paper" id="paper_opt">
|
||||
<?php
|
||||
foreach ($cfg['PDFPageSizes'] AS $key => $val) {
|
||||
echo '<option value="' . $val . '"';
|
||||
if ($val == $cfg['PDFDefaultPageSize']) {
|
||||
echo ' selected="selected"';
|
||||
}
|
||||
echo ' >' . $val . '</option>' . "\n";
|
||||
}
|
||||
?>
|
||||
</select>
|
||||
</fieldset>
|
||||
<fieldset class="tblFooters">
|
||||
<input type="submit" value="<?php echo $strGo; ?>" />
|
||||
</fieldset>
|
||||
</form>
|
||||
<?php
|
||||
} // end if
|
||||
echo '<br /><a href="pdf_pages.php?' . $url_query . '">';
|
||||
if ($cfg['PropertiesIconic']) {
|
||||
echo '<img class="icon" src="' . $pmaThemeImage . 'b_edit.png"'
|
||||
.' alt="" width="16" height="16" />';
|
||||
}
|
||||
echo $strEditPDFPages . '</a>';
|
||||
} // end if
|
||||
|
||||
/**
|
||||
* Displays the footer
|
||||
*/
|
||||
require_once './libraries/footer.inc.php';
|
||||
?>
|
269
db_printview.php
@@ -1,269 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
*
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
|
||||
/**
|
||||
* Gets the variables sent or posted to this script, then displays headers
|
||||
*/
|
||||
$print_view = true;
|
||||
require_once './libraries/header.inc.php';
|
||||
|
||||
PMA_checkParameters(array('db'));
|
||||
|
||||
/**
|
||||
* Defines the url to return to in case of error in a sql statement
|
||||
*/
|
||||
$err_url = 'db_sql.php?' . PMA_generate_common_url($db);
|
||||
|
||||
/**
|
||||
* Settings for relations stuff
|
||||
*/
|
||||
require_once './libraries/relation.lib.php';
|
||||
$cfgRelation = PMA_getRelationsParam();
|
||||
|
||||
/**
|
||||
* Gets the list of the table in the current db and informations about these
|
||||
* tables if possible
|
||||
*
|
||||
* @todo merge this speedup _optionaly_ into PMA_DBI_get_tables_full()
|
||||
*
|
||||
// staybyte: speedup view on locked tables - 11 June 2001
|
||||
// Special speedup for newer MySQL Versions (in 4.0 format changed)
|
||||
if ($cfg['SkipLockedTables'] == true) {
|
||||
$result = PMA_DBI_query('SHOW OPEN TABLES FROM ' . PMA_backquote($db) . ';');
|
||||
// Blending out tables in use
|
||||
if ($result != false && PMA_DBI_num_rows($result) > 0) {
|
||||
while ($tmp = PMA_DBI_fetch_row($result)) {
|
||||
// if in use memorize tablename
|
||||
if (preg_match('@in_use=[1-9]+@i', $tmp[0])) {
|
||||
$sot_cache[$tmp[0]] = true;
|
||||
}
|
||||
}
|
||||
PMA_DBI_free_result($result);
|
||||
|
||||
if (isset($sot_cache)) {
|
||||
$result = PMA_DBI_query('SHOW TABLES FROM ' . PMA_backquote($db) . ';', null, PMA_DBI_QUERY_STORE);
|
||||
if ($result != false && PMA_DBI_num_rows($result) > 0) {
|
||||
while ($tmp = PMA_DBI_fetch_row($result)) {
|
||||
if (!isset($sot_cache[$tmp[0]])) {
|
||||
$sts_result = PMA_DBI_query('SHOW TABLE STATUS FROM ' . PMA_backquote($db) . ' LIKE \'' . addslashes($tmp[0]) . '\';');
|
||||
$sts_tmp = PMA_DBI_fetch_assoc($sts_result);
|
||||
$tables[] = $sts_tmp;
|
||||
} else { // table in use
|
||||
$tables[] = array('Name' => $tmp[0]);
|
||||
}
|
||||
}
|
||||
PMA_DBI_free_result($result);
|
||||
$sot_ready = true;
|
||||
}
|
||||
}
|
||||
unset($tmp, $result);
|
||||
}
|
||||
}
|
||||
|
||||
if (! isset($sot_ready)) {
|
||||
$result = PMA_DBI_query('SHOW TABLE STATUS FROM ' . PMA_backquote($db) . ';');
|
||||
if (PMA_DBI_num_rows($result) > 0) {
|
||||
while ($sts_tmp = PMA_DBI_fetch_assoc($result)) {
|
||||
$tables[] = $sts_tmp;
|
||||
}
|
||||
PMA_DBI_free_result($result);
|
||||
unset($res);
|
||||
}
|
||||
}
|
||||
*/
|
||||
|
||||
/**
|
||||
* If there is at least one table, displays the printer friendly view, else
|
||||
* an error message
|
||||
*/
|
||||
$tables = PMA_DBI_get_tables_full($db);
|
||||
$num_tables = count($tables);
|
||||
|
||||
echo '<br />';
|
||||
|
||||
// 1. No table
|
||||
if ($num_tables == 0) {
|
||||
echo $strNoTablesFound;
|
||||
}
|
||||
// 2. Shows table informations on mysql >= 3.23.03 - staybyte - 11 June 2001
|
||||
else {
|
||||
?>
|
||||
<table>
|
||||
<thead>
|
||||
<tr>
|
||||
<th><?php echo $strTable; ?></th>
|
||||
<th><?php echo $strRecords; ?></th>
|
||||
<th><?php echo $strType; ?></th>
|
||||
<?php
|
||||
if ($cfg['ShowStats']) {
|
||||
echo '<th>' . $strSize . '</th>';
|
||||
}
|
||||
?>
|
||||
<th><?php echo $strComments; ?></th>
|
||||
</tr>
|
||||
</thead>
|
||||
<tbody>
|
||||
<?php
|
||||
$sum_entries = $sum_size = 0;
|
||||
$odd_row = true;
|
||||
foreach ($tables as $sts_data) {
|
||||
if (strtoupper($sts_data['ENGINE']) == 'MRG_MYISAM'
|
||||
|| strtoupper($sts_data['ENGINE']) == 'FEDERATED') {
|
||||
$merged_size = true;
|
||||
} else {
|
||||
$merged_size = false;
|
||||
}
|
||||
$sum_entries += $sts_data['TABLE_ROWS'];
|
||||
?>
|
||||
<tr class="<?php echo $odd_row ? 'odd' : 'even'; ?>">
|
||||
<th>
|
||||
<?php echo htmlspecialchars($sts_data['TABLE_NAME']); ?>
|
||||
</th>
|
||||
<?php
|
||||
|
||||
if (isset($sts_data['TABLE_ROWS'])) {
|
||||
?>
|
||||
<td align="right">
|
||||
<?php
|
||||
if ($merged_size) {
|
||||
echo '<i>' . PMA_formatNumber($sts_data['TABLE_ROWS'], 0) . '</i>' . "\n";
|
||||
} else {
|
||||
echo PMA_formatNumber($sts_data['TABLE_ROWS'], 0) . "\n";
|
||||
}
|
||||
?>
|
||||
</td>
|
||||
<td nowrap="nowrap">
|
||||
<?php echo $sts_data['ENGINE']; ?>
|
||||
</td>
|
||||
<?php
|
||||
if ($cfg['ShowStats']) {
|
||||
$tblsize = $sts_data['Data_length'] + $sts_data['Index_length'];
|
||||
$sum_size += $tblsize;
|
||||
list($formated_size, $unit) = PMA_formatByteDown($tblsize, 3, 1);
|
||||
?>
|
||||
<td align="right" nowrap="nowrap">
|
||||
<?php echo $formated_size . ' ' . $unit; ?>
|
||||
</td>
|
||||
<?php
|
||||
} // end if
|
||||
} else {
|
||||
?>
|
||||
<td colspan="3" align="center">
|
||||
<?php echo $strInUse; ?>
|
||||
</td>
|
||||
<?php
|
||||
}
|
||||
?>
|
||||
<td>
|
||||
<?php
|
||||
if (! empty($sts_data['Comment'])) {
|
||||
echo htmlspecialchars($sts_data['Comment']);
|
||||
$needs_break = '<br />';
|
||||
} else {
|
||||
$needs_break = '';
|
||||
}
|
||||
|
||||
if (! empty($sts_data['Create_time'])
|
||||
|| ! empty($sts_data['Update_time'])
|
||||
|| ! empty($sts_data['Check_time'])) {
|
||||
echo $needs_break;
|
||||
?>
|
||||
<table width="100%">
|
||||
<?php
|
||||
|
||||
if (! empty($sts_data['Create_time'])) {
|
||||
?>
|
||||
<tr>
|
||||
<td align="right"><?php echo $strStatCreateTime . ': '; ?></td>
|
||||
<td align="right"><?php echo PMA_localisedDate(strtotime($sts_data['Create_time'])); ?></td>
|
||||
</tr>
|
||||
<?php
|
||||
}
|
||||
|
||||
if (! empty($sts_data['Update_time'])) {
|
||||
?>
|
||||
<tr>
|
||||
<td align="right"><?php echo $strStatUpdateTime . ': '; ?></td>
|
||||
<td align="right"><?php echo PMA_localisedDate(strtotime($sts_data['Update_time'])); ?></td>
|
||||
</tr>
|
||||
<?php
|
||||
}
|
||||
|
||||
if (! empty($sts_data['Check_time'])) {
|
||||
?>
|
||||
<tr>
|
||||
<td align="right"><?php echo $strStatCheckTime . ': '; ?></td>
|
||||
<td align="right"><?php echo PMA_localisedDate(strtotime($sts_data['Check_time'])); ?></td>
|
||||
</tr>
|
||||
<?php
|
||||
}
|
||||
?>
|
||||
</table>
|
||||
<?php
|
||||
}
|
||||
?>
|
||||
</td>
|
||||
</tr>
|
||||
<?php
|
||||
}
|
||||
?>
|
||||
<tr>
|
||||
<th align="center">
|
||||
<?php echo sprintf($strTables, PMA_formatNumber($num_tables, 0)); ?>
|
||||
</th>
|
||||
<th align="right" nowrap="nowrap">
|
||||
<?php echo PMA_formatNumber($sum_entries, 0); ?>
|
||||
</th>
|
||||
<th align="center">
|
||||
--
|
||||
</th>
|
||||
<?php
|
||||
if ($cfg['ShowStats']) {
|
||||
list($sum_formated, $unit) = PMA_formatByteDown($sum_size, 3, 1);
|
||||
?>
|
||||
<th align="right" nowrap="nowrap">
|
||||
<?php echo $sum_formated . ' ' . $unit; ?>
|
||||
</th>
|
||||
<?php
|
||||
}
|
||||
?>
|
||||
<th> </th>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
<?php
|
||||
}
|
||||
|
||||
/**
|
||||
* Displays the footer
|
||||
*/
|
||||
?>
|
||||
|
||||
<script type="text/javascript">
|
||||
//<![CDATA[
|
||||
function printPage()
|
||||
{
|
||||
// Do print the page
|
||||
if (typeof(window.print) != 'undefined') {
|
||||
window.print();
|
||||
}
|
||||
}
|
||||
//]]>
|
||||
</script>
|
||||
<br /><br />
|
||||
|
||||
<input type="button" class="print_ignore"
|
||||
id="print" value="<?php echo $strPrint; ?>" onclick="printPage()" />
|
||||
|
||||
<?php
|
||||
require_once './libraries/footer.inc.php';
|
||||
?>
|
944
db_qbe.php
@@ -1,944 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* query by example the whole database
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
* requirements
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
require_once './libraries/Table.class.php';
|
||||
require_once './libraries/relation.lib.php';
|
||||
|
||||
|
||||
/**
|
||||
* Gets the relation settings
|
||||
*/
|
||||
$cfgRelation = PMA_getRelationsParam();
|
||||
|
||||
|
||||
/**
|
||||
* A query has been submitted -> execute it, else display the headers
|
||||
*/
|
||||
if (isset($_REQUEST['submit_sql']) && ! empty($sql_query)) {
|
||||
$goto = 'db_sql.php';
|
||||
$zero_rows = htmlspecialchars($GLOBALS['strSuccess']);
|
||||
require './sql.php';
|
||||
exit;
|
||||
} else {
|
||||
$sub_part = '_qbe';
|
||||
require './libraries/db_common.inc.php';
|
||||
$url_query .= '&goto=db_qbe.php';
|
||||
$url_params['goto'] = 'db_qbe.php';
|
||||
require './libraries/db_info.inc.php';
|
||||
}
|
||||
|
||||
if (isset($_REQUEST['submit_sql'])
|
||||
&& ! preg_match('@^SELECT@i', $sql_query)) {
|
||||
PMA_Message::warning('strHaveToShow')->display();
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Initialize some variables
|
||||
*/
|
||||
$col_cnt = PMA_ifSetOr($_REQUEST['col_cnt'], 3, 'numeric');
|
||||
$add_col = PMA_ifSetOr($_REQUEST['add_col'], 0, 'numeric');
|
||||
$add_row = PMA_ifSetOr($_REQUEST['add_row'], 0, 'numeric');
|
||||
|
||||
$rows = PMA_ifSetOr($_REQUEST['rows'], 0, 'numeric');
|
||||
$ins_col = PMA_ifSetOr($_REQUEST['ins_col'], null, 'array');
|
||||
$del_col = PMA_ifSetOr($_REQUEST['del_col'], null, 'array');
|
||||
|
||||
$prev_criteria = isset($_REQUEST['prev_criteria'])
|
||||
? $_REQUEST['prev_criteria']
|
||||
: array();
|
||||
$criteria = isset($_REQUEST['criteria'])
|
||||
? $_REQUEST['criteria']
|
||||
: array_fill(0, $col_cnt, '');
|
||||
|
||||
$ins_row = isset($_REQUEST['ins_row'])
|
||||
? $_REQUEST['ins_row']
|
||||
: array_fill(0, $col_cnt, '');
|
||||
$del_row = isset($_REQUEST['del_row'])
|
||||
? $_REQUEST['del_row']
|
||||
: array_fill(0, $col_cnt, '');
|
||||
$and_or_row = isset($_REQUEST['and_or_row'])
|
||||
? $_REQUEST['and_or_row']
|
||||
: array_fill(0, $col_cnt, '');
|
||||
$and_or_col = isset($_REQUEST['and_or_col'])
|
||||
? $_REQUEST['and_or_col']
|
||||
: array_fill(0, $col_cnt, '');
|
||||
|
||||
// minimum width
|
||||
$form_column_width = 12;
|
||||
$col = max($col_cnt + $add_col, 0);
|
||||
$row = max($rows + $add_row, 0);
|
||||
|
||||
|
||||
// The tables list sent by a previously submitted form
|
||||
if (PMA_isValid($_REQUEST['TableList'], 'array')) {
|
||||
foreach ($_REQUEST['TableList'] as $each_table) {
|
||||
$tbl_names[$each_table] = ' selected="selected"';
|
||||
}
|
||||
} // end if
|
||||
|
||||
|
||||
// this was a work in progress, deactivated for now
|
||||
//$columns = PMA_DBI_get_columns_full($GLOBALS['db']);
|
||||
//$tables = PMA_DBI_get_columns_full($GLOBALS['db']);
|
||||
|
||||
|
||||
/**
|
||||
* Prepares the form
|
||||
*/
|
||||
$tbl_result = PMA_DBI_query('SHOW TABLES FROM ' . PMA_backquote($db) . ';', null, PMA_DBI_QUERY_STORE);
|
||||
$tbl_result_cnt = PMA_DBI_num_rows($tbl_result);
|
||||
if (0 == $tbl_result_cnt) {
|
||||
PMA_Message::error('strNoTablesFound')->display();
|
||||
require_once './libraries/footer.inc.php';
|
||||
exit;
|
||||
}
|
||||
|
||||
// The tables list gets from MySQL
|
||||
while (list($tbl) = PMA_DBI_fetch_row($tbl_result)) {
|
||||
$fld_results = PMA_DBI_get_fields($db, $tbl);
|
||||
|
||||
if (empty($tbl_names[$tbl]) && !empty($_REQUEST['TableList'])) {
|
||||
$tbl_names[$tbl] = '';
|
||||
} else {
|
||||
$tbl_names[$tbl] = ' selected="selected"';
|
||||
} // end if
|
||||
|
||||
// The fields list per selected tables
|
||||
if ($tbl_names[$tbl] == ' selected="selected"') {
|
||||
$each_table = PMA_backquote($tbl);
|
||||
$fld[] = $each_table . '.*';
|
||||
foreach ($fld_results as $each_field) {
|
||||
$each_field = $each_table . '.' . PMA_backquote($each_field['Field']);
|
||||
$fld[] = $each_field;
|
||||
|
||||
// increase the width if necessary
|
||||
$form_column_width = max(strlen($each_field), $form_column_width);
|
||||
} // end foreach
|
||||
} // end if
|
||||
} // end while
|
||||
PMA_DBI_free_result($tbl_result);
|
||||
|
||||
// largest width found
|
||||
$realwidth = $form_column_width . 'ex';
|
||||
|
||||
|
||||
/**
|
||||
* Displays the Query by example form
|
||||
*/
|
||||
|
||||
/**
|
||||
* Enter description here...
|
||||
*
|
||||
* @param array $columns
|
||||
* @param numeric $column_number
|
||||
* @param string $selected
|
||||
*/
|
||||
function showColumnSelectCell($columns, $column_number, $selected = '')
|
||||
{
|
||||
?>
|
||||
<td align="center">
|
||||
<select name="Field[<?php echo $column_number; ?>]" size="1">
|
||||
<option value=""> </option>
|
||||
<?php
|
||||
foreach ($columns as $column) {
|
||||
if ($column === $selected) {
|
||||
$sel = ' selected="selected"';
|
||||
} else {
|
||||
$sel = '';
|
||||
}
|
||||
echo '<option value="' . htmlspecialchars($column) . '"' . $sel . '>'
|
||||
. str_replace(' ', ' ', htmlspecialchars($column)) . '</option>' . "\n";
|
||||
}
|
||||
?>
|
||||
</select>
|
||||
</td>
|
||||
<?php
|
||||
}
|
||||
|
||||
?>
|
||||
<fieldset>
|
||||
<form action="db_qbe.php" method="post">
|
||||
<table class="data" style="width: 100%;">
|
||||
<tr class="odd noclick">
|
||||
<th><?php echo $strField; ?>:</th>
|
||||
<?php
|
||||
$z = 0;
|
||||
for ($x = 0; $x < $col; $x++) {
|
||||
if (isset($ins_col[$x]) && $ins_col[$x] == 'on') {
|
||||
showColumnSelectCell($fld, $z);
|
||||
$z++;
|
||||
}
|
||||
|
||||
if (! empty($del_col) && isset($del_col[$x]) && $del_col[$x] == 'on') {
|
||||
continue;
|
||||
}
|
||||
|
||||
$selected = '';
|
||||
if (isset($Field[$x])) {
|
||||
$selected = $Field[$x];
|
||||
$curField[$z] = $Field[$x];
|
||||
}
|
||||
showColumnSelectCell($fld, $z, $selected);
|
||||
$z++;
|
||||
} // end for
|
||||
?>
|
||||
</tr>
|
||||
|
||||
<!-- Sort row -->
|
||||
<tr class="even noclick">
|
||||
<th><?php echo $strSort; ?>:</th>
|
||||
<?php
|
||||
$z = 0;
|
||||
for ($x = 0; $x < $col; $x++) {
|
||||
if (!empty($ins_col) && isset($ins_col[$x]) && $ins_col[$x] == 'on') {
|
||||
?>
|
||||
<td align="center">
|
||||
<select style="width: <?php echo $realwidth; ?>" name="Sort[<?php echo $z; ?>]" size="1">
|
||||
<option value=""> </option>
|
||||
<option value="ASC"><?php echo $strAscending; ?></option>
|
||||
<option value="DESC"><?php echo $strDescending; ?></option>
|
||||
</select>
|
||||
</td>
|
||||
<?php
|
||||
$z++;
|
||||
} // end if
|
||||
echo "\n";
|
||||
|
||||
if (!empty($del_col) && isset($del_col[$x]) && $del_col[$x] == 'on') {
|
||||
continue;
|
||||
}
|
||||
?>
|
||||
<td align="center">
|
||||
<select style="width: <?php echo $realwidth; ?>" name="Sort[<?php echo $z; ?>]" size="1">
|
||||
<option value=""> </option>
|
||||
<?php
|
||||
echo "\n";
|
||||
|
||||
// If they have chosen all fields using the * selector,
|
||||
// then sorting is not available
|
||||
// Robbat2 - Fix for Bug #570698
|
||||
if (isset($Sort[$x]) && isset($Field[$x])
|
||||
&& substr($Field[$x], -2) == '.*') {
|
||||
$Sort[$x] = '';
|
||||
} //end if
|
||||
|
||||
if (isset($Sort[$x]) && $Sort[$x] == 'ASC') {
|
||||
$curSort[$z] = $Sort[$x];
|
||||
$sel = ' selected="selected"';
|
||||
} else {
|
||||
$sel = '';
|
||||
} // end if
|
||||
echo ' ';
|
||||
echo '<option value="ASC"' . $sel . '>' . $strAscending . '</option>' . "\n";
|
||||
if (isset($Sort[$x]) && $Sort[$x] == 'DESC') {
|
||||
$curSort[$z] = $Sort[$x];
|
||||
$sel = ' selected="selected"';
|
||||
} else {
|
||||
$sel = '';
|
||||
} // end if
|
||||
echo ' ';
|
||||
echo '<option value="DESC"' . $sel . '>' . $strDescending . '</option>' . "\n";
|
||||
?>
|
||||
</select>
|
||||
</td>
|
||||
<?php
|
||||
$z++;
|
||||
echo "\n";
|
||||
} // end for
|
||||
?>
|
||||
</tr>
|
||||
|
||||
<!-- Show row -->
|
||||
<tr class="odd noclick">
|
||||
<th><?php echo $strShow; ?>:</th>
|
||||
<?php
|
||||
$z = 0;
|
||||
for ($x = 0; $x < $col; $x++) {
|
||||
if (!empty($ins_col) && isset($ins_col[$x]) && $ins_col[$x] == 'on') {
|
||||
?>
|
||||
<td align="center">
|
||||
<input type="checkbox" name="Show[<?php echo $z; ?>]" />
|
||||
</td>
|
||||
<?php
|
||||
$z++;
|
||||
} // end if
|
||||
echo "\n";
|
||||
|
||||
if (!empty($del_col) && isset($del_col[$x]) && $del_col[$x] == 'on') {
|
||||
continue;
|
||||
}
|
||||
if (isset($Show[$x])) {
|
||||
$checked = ' checked="checked"';
|
||||
$curShow[$z] = $Show[$x];
|
||||
} else {
|
||||
$checked = '';
|
||||
}
|
||||
?>
|
||||
<td align="center">
|
||||
<input type="checkbox" name="Show[<?php echo $z; ?>]"<?php echo $checked; ?> />
|
||||
</td>
|
||||
<?php
|
||||
$z++;
|
||||
echo "\n";
|
||||
} // end for
|
||||
?>
|
||||
</tr>
|
||||
|
||||
<!-- Criteria row -->
|
||||
<tr class="even noclick">
|
||||
<th><?php echo $strCriteria; ?>:</th>
|
||||
<?php
|
||||
$z = 0;
|
||||
for ($x = 0; $x < $col; $x++) {
|
||||
if (!empty($ins_col) && isset($ins_col[$x]) && $ins_col[$x] == 'on') {
|
||||
?>
|
||||
<td align="center">
|
||||
<input type="text" name="criteria[<?php echo $z; ?>]" value="" class="textfield" style="width: <?php echo $realwidth; ?>" size="20" />
|
||||
</td>
|
||||
<?php
|
||||
$z++;
|
||||
} // end if
|
||||
echo "\n";
|
||||
|
||||
if (!empty($del_col) && isset($del_col[$x]) && $del_col[$x] == 'on') {
|
||||
continue;
|
||||
}
|
||||
if (isset($criteria[$x])) {
|
||||
$stripped_Criteria = $criteria[$x];
|
||||
}
|
||||
if ((empty($prev_criteria) || !isset($prev_criteria[$x]))
|
||||
|| $prev_criteria[$x] != htmlspecialchars($stripped_Criteria)) {
|
||||
$curCriteria[$z] = $stripped_Criteria;
|
||||
} else {
|
||||
$curCriteria[$z] = $prev_criteria[$x];
|
||||
}
|
||||
?>
|
||||
<td align="center">
|
||||
<input type="hidden" name="prev_criteria[<?php echo $z; ?>]" value="<?php echo htmlspecialchars($curCriteria[$z]); ?>" />
|
||||
<input type="text" name="criteria[<?php echo $z; ?>]" value="<?php echo htmlspecialchars($stripped_Criteria); ?>" class="textfield" style="width: <?php echo $realwidth; ?>" size="20" />
|
||||
</td>
|
||||
<?php
|
||||
$z++;
|
||||
echo "\n";
|
||||
} // end for
|
||||
?>
|
||||
</tr>
|
||||
|
||||
<!-- And/Or columns and rows -->
|
||||
<?php
|
||||
$w = 0;
|
||||
$odd_row = true;
|
||||
for ($y = 0; $y <= $row; $y++) {
|
||||
if (isset($ins_row[$y]) && $ins_row[$y] == 'on') {
|
||||
$chk['or'] = ' checked="checked"';
|
||||
$chk['and'] = '';
|
||||
?>
|
||||
<tr class="<?php echo $odd_row ? 'odd' : 'even'; ?> noclick">
|
||||
<td align="<?php echo $cell_align_right; ?>" nowrap="nowrap">
|
||||
<!-- Row controls -->
|
||||
<table cellpadding="0" cellspacing="0" border="0">
|
||||
<tr>
|
||||
<td align="<?php echo $cell_align_right; ?>" nowrap="nowrap">
|
||||
<small><?php echo $strQBEIns; ?>:</small>
|
||||
<input type="checkbox" name="ins_row[<?php echo $w; ?>]" />
|
||||
</td>
|
||||
<td align="<?php echo $cell_align_right; ?>">
|
||||
<strong><?php echo $strAnd; ?>:</strong>
|
||||
</td>
|
||||
<td>
|
||||
<input type="radio" name="and_or_row[<?php echo $w; ?>]" value="and"<?php echo $chk['and']; ?> />
|
||||
|
||||
</td>
|
||||
</tr>
|
||||
<tr>
|
||||
<td align="<?php echo $cell_align_right; ?>" nowrap="nowrap">
|
||||
<small><?php echo $strQBEDel; ?>:</small>
|
||||
<input type="checkbox" name="del_row[<?php echo $w; ?>]" />
|
||||
</td>
|
||||
<td align="<?php echo $cell_align_right; ?>">
|
||||
<strong><?php echo $strOr; ?>:</strong>
|
||||
</td>
|
||||
<td>
|
||||
<input type="radio" name="and_or_row[<?php echo $w; ?>]" value="or"<?php echo $chk['or']; ?> />
|
||||
|
||||
</td>
|
||||
</tr>
|
||||
</table>
|
||||
</td>
|
||||
<?php
|
||||
$z = 0;
|
||||
for ($x = 0; $x < $col; $x++) {
|
||||
if (isset($ins_col[$x]) && $ins_col[$x] == 'on') {
|
||||
echo "\n";
|
||||
$or = 'Or' . $w . '[' . $z . ']';
|
||||
?>
|
||||
<td align="center">
|
||||
<textarea cols="20" rows="2" style="width: <?php echo $realwidth; ?>" name="<?php echo $or; ?>" dir="<?php echo $text_dir; ?>"></textarea>
|
||||
</td>
|
||||
<?php
|
||||
$z++;
|
||||
} // end if
|
||||
if (isset($del_col[$x]) && $del_col[$x] == 'on') {
|
||||
continue;
|
||||
}
|
||||
|
||||
echo "\n";
|
||||
$or = 'Or' . $w . '[' . $z . ']';
|
||||
?>
|
||||
<td align="center">
|
||||
<textarea cols="20" rows="2" style="width: <?php echo $realwidth; ?>" name="<?php echo $or; ?>" dir="<?php echo $text_dir; ?>"></textarea>
|
||||
</td>
|
||||
<?php
|
||||
$z++;
|
||||
} // end for
|
||||
$w++;
|
||||
echo "\n";
|
||||
?>
|
||||
</tr>
|
||||
<?php
|
||||
$odd_row =! $odd_row;
|
||||
} // end if
|
||||
|
||||
if (isset($del_row[$y]) && $del_row[$y] == 'on') {
|
||||
continue;
|
||||
}
|
||||
|
||||
if (isset($and_or_row[$y])) {
|
||||
$curAndOrRow[$w] = $and_or_row[$y];
|
||||
}
|
||||
if (isset($and_or_row[$y]) && $and_or_row[$y] == 'and') {
|
||||
$chk['and'] = ' checked="checked"';
|
||||
$chk['or'] = '';
|
||||
} else {
|
||||
$chk['or'] = ' checked="checked"';
|
||||
$chk['and'] = '';
|
||||
}
|
||||
echo "\n";
|
||||
?>
|
||||
<tr class="<?php echo $odd_row ? 'odd' : 'even'; ?> noclick">
|
||||
<td align="<?php echo $cell_align_right; ?>" nowrap="nowrap">
|
||||
<!-- Row controls -->
|
||||
<table border="0" cellpadding="0" cellspacing="0">
|
||||
<tr>
|
||||
<td align="<?php echo $cell_align_right; ?>" nowrap="nowrap">
|
||||
<small><?php echo $strQBEIns; ?>:</small>
|
||||
<input type="checkbox" name="ins_row[<?php echo $w; ?>]" />
|
||||
</td>
|
||||
<td align="<?php echo $cell_align_right; ?>">
|
||||
<strong><?php echo $strAnd; ?>:</strong>
|
||||
</td>
|
||||
<td>
|
||||
<input type="radio" name="and_or_row[<?php echo $w; ?>]" value="and"<?php echo $chk['and']; ?> />
|
||||
</td>
|
||||
</tr>
|
||||
<tr>
|
||||
<td align="<?php echo $cell_align_right; ?>" nowrap="nowrap">
|
||||
<small><?php echo $strQBEDel; ?>:</small>
|
||||
<input type="checkbox" name="del_row[<?php echo $w; ?>]" />
|
||||
</td>
|
||||
<td align="<?php echo $cell_align_right; ?>">
|
||||
<strong><?php echo $strOr; ?>:</strong>
|
||||
</td>
|
||||
<td>
|
||||
<input type="radio" name="and_or_row[<?php echo $w; ?>]" value="or"<?php echo $chk['or']; ?> />
|
||||
</td>
|
||||
</tr>
|
||||
</table>
|
||||
</td>
|
||||
<?php
|
||||
$z = 0;
|
||||
for ($x = 0; $x < $col; $x++) {
|
||||
if (!empty($ins_col) && isset($ins_col[$x]) && $ins_col[$x] == 'on') {
|
||||
echo "\n";
|
||||
$or = 'Or' . $w . '[' . $z . ']';
|
||||
?>
|
||||
<td align="center">
|
||||
<textarea cols="20" rows="2" style="width: <?php echo $realwidth; ?>" name="<?php echo $or; ?>" dir="<?php echo $text_dir; ?>"></textarea>
|
||||
</td>
|
||||
<?php
|
||||
$z++;
|
||||
} // end if
|
||||
if (!empty($del_col) && isset($del_col[$x]) && $del_col[$x] == 'on') {
|
||||
continue;
|
||||
}
|
||||
|
||||
echo "\n";
|
||||
$or = 'Or' . $y;
|
||||
if (!isset(${$or})) {
|
||||
${$or} = '';
|
||||
}
|
||||
if (!empty(${$or}) && isset(${$or}[$x])) {
|
||||
$stripped_or = ${$or}[$x];
|
||||
} else {
|
||||
$stripped_or = '';
|
||||
}
|
||||
?>
|
||||
<td align="center">
|
||||
<textarea cols="20" rows="2" style="width: <?php echo $realwidth; ?>" name="Or<?php echo $w . '[' . $z . ']'; ?>" dir="<?php echo $text_dir; ?>"><?php echo htmlspecialchars($stripped_or); ?></textarea>
|
||||
</td>
|
||||
<?php
|
||||
if (!empty(${$or}) && isset(${$or}[$x])) {
|
||||
${'cur' . $or}[$z] = ${$or}[$x];
|
||||
}
|
||||
$z++;
|
||||
} // end for
|
||||
$w++;
|
||||
echo "\n";
|
||||
?>
|
||||
</tr>
|
||||
<?php
|
||||
echo "\n";
|
||||
$odd_row =! $odd_row;
|
||||
} // end for
|
||||
?>
|
||||
<!-- Modify columns -->
|
||||
<tr class="even noclick">
|
||||
<th><?php echo $strModify; ?>:</th>
|
||||
<?php
|
||||
$z = 0;
|
||||
for ($x = 0; $x < $col; $x++) {
|
||||
if (!empty($ins_col) && isset($ins_col[$x]) && $ins_col[$x] == 'on') {
|
||||
$curAndOrCol[$z] = $and_or_col[$y];
|
||||
if ($and_or_col[$z] == 'or') {
|
||||
$chk['or'] = ' checked="checked"';
|
||||
$chk['and'] = '';
|
||||
} else {
|
||||
$chk['and'] = ' checked="checked"';
|
||||
$chk['or'] = '';
|
||||
}
|
||||
?>
|
||||
<td align="center">
|
||||
<strong><?php echo $strOr; ?>:</strong>
|
||||
<input type="radio" name="and_or_col[<?php echo $z; ?>]" value="or"<?php echo $chk['or']; ?> />
|
||||
<strong><?php echo $strAnd; ?>:</strong>
|
||||
<input type="radio" name="and_or_col[<?php echo $z; ?>]" value="and"<?php echo $chk['and']; ?> />
|
||||
<br />
|
||||
<?php echo $strQBEIns . "\n"; ?>
|
||||
<input type="checkbox" name="ins_col[<?php echo $z; ?>]" />
|
||||
<?php echo $strQBEDel . "\n"; ?>
|
||||
<input type="checkbox" name="del_col[<?php echo $z; ?>]" />
|
||||
</td>
|
||||
<?php
|
||||
$z++;
|
||||
} // end if
|
||||
echo "\n";
|
||||
|
||||
if (!empty($del_col) && isset($del_col[$x]) && $del_col[$x] == 'on') {
|
||||
continue;
|
||||
}
|
||||
|
||||
if (isset($and_or_col[$y])) {
|
||||
$curAndOrCol[$z] = $and_or_col[$y];
|
||||
}
|
||||
if (isset($and_or_col[$z]) && $and_or_col[$z] == 'or') {
|
||||
$chk['or'] = ' checked="checked"';
|
||||
$chk['and'] = '';
|
||||
} else {
|
||||
$chk['and'] = ' checked="checked"';
|
||||
$chk['or'] = '';
|
||||
}
|
||||
?>
|
||||
<td align="center">
|
||||
<strong><?php echo $strOr; ?>:</strong>
|
||||
<input type="radio" name="and_or_col[<?php echo $z; ?>]" value="or"<?php echo $chk['or']; ?> />
|
||||
<strong><?php echo $strAnd; ?>:</strong>
|
||||
<input type="radio" name="and_or_col[<?php echo $z; ?>]" value="and"<?php echo $chk['and']; ?> />
|
||||
<br />
|
||||
<?php echo $strQBEIns . "\n"; ?>
|
||||
<input type="checkbox" name="ins_col[<?php echo $z; ?>]" />
|
||||
<?php echo $strQBEDel . "\n"; ?>
|
||||
<input type="checkbox" name="del_col[<?php echo $z; ?>]" />
|
||||
</td>
|
||||
<?php
|
||||
$z++;
|
||||
echo "\n";
|
||||
} // end for
|
||||
?>
|
||||
</tr>
|
||||
</table>
|
||||
|
||||
<!-- Other controls -->
|
||||
<?php
|
||||
$w--;
|
||||
$url_params['db'] = $db;
|
||||
$url_params['col_cnt'] = $z;
|
||||
$url_params['rows'] = $w;
|
||||
echo PMA_generate_common_hidden_inputs($url_params);
|
||||
?>
|
||||
</fieldset>
|
||||
<fieldset class="tblFooters">
|
||||
<table border="0" cellpadding="2" cellspacing="1">
|
||||
<tr>
|
||||
<td nowrap="nowrap">
|
||||
<?php echo $strAddDeleteRow; ?>:
|
||||
<select size="1" name="add_row" style="vertical-align: middle">
|
||||
<option value="-3">-3</option>
|
||||
<option value="-2">-2</option>
|
||||
<option value="-1">-1</option>
|
||||
<option value="0" selected="selected">0</option>
|
||||
<option value="1">1</option>
|
||||
<option value="2">2</option>
|
||||
<option value="3">3</option>
|
||||
</select>
|
||||
</td>
|
||||
<td width="10"> </td>
|
||||
<td nowrap="nowrap"><?php echo $strAddDeleteColumn; ?>:
|
||||
<select size="1" name="add_col" style="vertical-align: middle">
|
||||
<option value="-3">-3</option>
|
||||
<option value="-2">-2</option>
|
||||
<option value="-1">-1</option>
|
||||
<option value="0" selected="selected">0</option>
|
||||
<option value="1">1</option>
|
||||
<option value="2">2</option>
|
||||
<option value="3">3</option>
|
||||
</select>
|
||||
</td>
|
||||
<td width="10"> </td>
|
||||
<!-- Generates a query -->
|
||||
<td><input type="submit" name="modify" value="<?php echo $strUpdateQuery; ?>" /></td>
|
||||
</tr>
|
||||
</table>
|
||||
</fieldset>
|
||||
|
||||
<table>
|
||||
<tr><td>
|
||||
<fieldset>
|
||||
<legend><?php echo $strUseTables; ?></legend>
|
||||
<?php
|
||||
$strTableListOptions = '';
|
||||
$numTableListOptions = 0;
|
||||
foreach ($tbl_names as $key => $val) {
|
||||
$strTableListOptions .= ' ';
|
||||
$strTableListOptions .= '<option value="' . htmlspecialchars($key) . '"' . $val . '>'
|
||||
. str_replace(' ', ' ', htmlspecialchars($key)) . '</option>' . "\n";
|
||||
$numTableListOptions++;
|
||||
}
|
||||
?>
|
||||
<select name="TableList[]" multiple="multiple" id="listTable"
|
||||
size="<?php echo ($numTableListOptions > 30) ? '15' : '7'; ?>">
|
||||
<?php echo $strTableListOptions; ?>
|
||||
</select>
|
||||
</fieldset>
|
||||
<fieldset class="tblFooters">
|
||||
<input type="submit" name="modify" value="<?php echo $strUpdateQuery; ?>" />
|
||||
</fieldset>
|
||||
</td>
|
||||
<td width="20"> </td>
|
||||
<td>
|
||||
<fieldset>
|
||||
<legend><?php echo sprintf($strQueryOnDb, PMA_getDbLink($db)); ?>
|
||||
</legend>
|
||||
<textarea cols="80" name="sql_query" id="textSqlquery"
|
||||
rows="<?php echo ($numTableListOptions > 30) ? '15' : '7'; ?>"
|
||||
dir="<?php echo $text_dir; ?>">
|
||||
<?php
|
||||
// 1. SELECT
|
||||
$last_select = 0;
|
||||
if (!isset($qry_select)) {
|
||||
$qry_select = '';
|
||||
}
|
||||
for ($x = 0; $x < $col; $x++) {
|
||||
if (!empty($curField[$x]) && isset($curShow[$x]) && $curShow[$x] == 'on') {
|
||||
if ($last_select) {
|
||||
$qry_select .= ', ';
|
||||
}
|
||||
$qry_select .= $curField[$x];
|
||||
$last_select = 1;
|
||||
}
|
||||
} // end for
|
||||
if (!empty($qry_select)) {
|
||||
echo 'SELECT ' . htmlspecialchars($qry_select) . "\n";
|
||||
}
|
||||
|
||||
// 2. FROM
|
||||
|
||||
// Create LEFT JOINS out of Relations
|
||||
// Code originally by Mike Beck <mike.beck@ibmiller.de>
|
||||
// If we can use Relations we could make some left joins.
|
||||
// First find out if relations are available in this database.
|
||||
|
||||
// First we need the really needed Tables - those in TableList might still be
|
||||
// all Tables.
|
||||
if (isset($Field) && count($Field) > 0) {
|
||||
// Initialize some variables
|
||||
$tab_all = array();
|
||||
$col_all = array();
|
||||
$tab_wher = array();
|
||||
$tab_know = array();
|
||||
$tab_left = array();
|
||||
$col_where = array();
|
||||
$fromclause = '';
|
||||
|
||||
// We only start this if we have fields, otherwise it would be dumb
|
||||
foreach ($Field as $value) {
|
||||
$parts = explode('.', $value);
|
||||
if (!empty($parts[0]) && !empty($parts[1])) {
|
||||
$tab_raw = $parts[0];
|
||||
$tab = str_replace('`', '', $tab_raw);
|
||||
$tab_all[$tab] = $tab;
|
||||
|
||||
$col_raw = $parts[1];
|
||||
$col_all[] = $tab . '.' . str_replace('`', '', $col_raw);
|
||||
}
|
||||
} // end while
|
||||
|
||||
// Check 'where' clauses
|
||||
if ($cfgRelation['relwork'] && count($tab_all) > 0) {
|
||||
// Now we need all tables that we have in the where clause
|
||||
$crit_cnt = count($criteria);
|
||||
for ($x = 0; $x < $crit_cnt; $x++) {
|
||||
$curr_tab = explode('.', $Field[$x]);
|
||||
if (!empty($curr_tab[0]) && !empty($curr_tab[1])) {
|
||||
$tab_raw = $curr_tab[0];
|
||||
$tab = str_replace('`', '', $tab_raw);
|
||||
|
||||
$col_raw = $curr_tab[1];
|
||||
$col1 = str_replace('`', '', $col_raw);
|
||||
$col1 = $tab . '.' . $col1;
|
||||
// Now we know that our array has the same numbers as $criteria
|
||||
// we can check which of our columns has a where clause
|
||||
if (!empty($criteria[$x])) {
|
||||
if (substr($criteria[$x], 0, 1) == '=' || stristr($criteria[$x], 'is')) {
|
||||
$col_where[$col] = $col1;
|
||||
$tab_wher[$tab] = $tab;
|
||||
}
|
||||
} // end if
|
||||
} // end if
|
||||
} // end for
|
||||
|
||||
// Cleans temp vars w/o further use
|
||||
unset($tab_raw);
|
||||
unset($col_raw);
|
||||
unset($col1);
|
||||
|
||||
if (count($tab_wher) == 1) {
|
||||
// If there is exactly one column that has a decent where-clause
|
||||
// we will just use this
|
||||
$master = key($tab_wher);
|
||||
} else {
|
||||
// Now let's find out which of the tables has an index
|
||||
// (When the control user is the same as the normal user
|
||||
// because he is using one of his databases as pmadb,
|
||||
// the last db selected is not always the one where we need to work)
|
||||
PMA_DBI_select_db($db);
|
||||
|
||||
foreach ($tab_all as $tab) {
|
||||
$ind_rs = PMA_DBI_query('SHOW INDEX FROM ' . PMA_backquote($tab) . ';');
|
||||
while ($ind = PMA_DBI_fetch_assoc($ind_rs)) {
|
||||
$col1 = $tab . '.' . $ind['Column_name'];
|
||||
if (isset($col_all[$col1])) {
|
||||
if ($ind['non_unique'] == 0) {
|
||||
if (isset($col_where[$col1])) {
|
||||
$col_unique[$col1] = 'Y';
|
||||
} else {
|
||||
$col_unique[$col1] = 'N';
|
||||
}
|
||||
} else {
|
||||
if (isset($col_where[$col1])) {
|
||||
$col_index[$col1] = 'Y';
|
||||
} else {
|
||||
$col_index[$col1] = 'N';
|
||||
}
|
||||
}
|
||||
}
|
||||
} // end while (each col of tab)
|
||||
} // end while (each tab)
|
||||
// now we want to find the best.
|
||||
if (isset($col_unique) && count($col_unique) > 0) {
|
||||
$col_cand = $col_unique;
|
||||
$needsort = 1;
|
||||
} elseif (isset($col_index) && count($col_index) > 0) {
|
||||
$col_cand = $col_index;
|
||||
$needsort = 1;
|
||||
} elseif (isset($col_where) && count($col_where) > 0) {
|
||||
$col_cand = $tab_wher;
|
||||
$needsort = 0;
|
||||
} else {
|
||||
$col_cand = $tab_all;
|
||||
$needsort = 0;
|
||||
}
|
||||
|
||||
// If we came up with $col_unique (very good) or $col_index (still
|
||||
// good) as $col_cand we want to check if we have any 'Y' there
|
||||
// (that would mean that they were also found in the whereclauses
|
||||
// which would be great). if yes, we take only those
|
||||
if ($needsort == 1) {
|
||||
foreach ($col_cand as $col => $is_where) {
|
||||
$tab = explode('.', $col);
|
||||
$tab = $tab[0];
|
||||
if ($is_where == 'Y') {
|
||||
$vg[$col] = $tab;
|
||||
} else {
|
||||
$sg[$col] = $tab;
|
||||
}
|
||||
}
|
||||
if (isset($vg)) {
|
||||
$col_cand = $vg;
|
||||
// Candidates restricted in index+where
|
||||
} else {
|
||||
$col_cand = $sg;
|
||||
// None of the candidates where in a where-clause
|
||||
}
|
||||
}
|
||||
|
||||
// If our array of candidates has more than one member we'll just
|
||||
// find the smallest table.
|
||||
// Of course the actual query would be faster if we check for
|
||||
// the Criteria which gives the smallest result set in its table,
|
||||
// but it would take too much time to check this
|
||||
if (count($col_cand) > 1) {
|
||||
// Of course we only want to check each table once
|
||||
$checked_tables = $col_cand;
|
||||
foreach ($col_cand as $tab) {
|
||||
if ($checked_tables[$tab] != 1) {
|
||||
$tsize[$tab] = PMA_Table::countRecords($db, $tab, true, false);
|
||||
$checked_tables[$tab] = 1;
|
||||
}
|
||||
$csize[$tab] = $tsize[$tab];
|
||||
}
|
||||
asort($csize);
|
||||
reset($csize);
|
||||
$master = key($csize); // Smallest
|
||||
} else {
|
||||
reset($col_cand);
|
||||
$master = current($col_cand); // Only one single candidate
|
||||
}
|
||||
} // end if (exactly one where clause)
|
||||
|
||||
$tab_left = $tab_all;
|
||||
unset($tab_left[$master]);
|
||||
$tab_know[$master] = $master;
|
||||
|
||||
$run = 0;
|
||||
$emerg = '';
|
||||
while (count($tab_left) > 0) {
|
||||
if ($run % 2 == 0) {
|
||||
PMA_getRelatives('master');
|
||||
} else {
|
||||
PMA_getRelatives('foreign');
|
||||
}
|
||||
$run++;
|
||||
if ($run > 5) {
|
||||
|
||||
foreach ($tab_left as $tab) {
|
||||
$emerg .= ', ' . PMA_backquote($tab);
|
||||
unset($tab_left[$tab]);
|
||||
}
|
||||
}
|
||||
} // end while
|
||||
$qry_from = PMA_backquote($master) . $emerg . $fromclause;
|
||||
} // end if ($cfgRelation['relwork'] && count($tab_all) > 0)
|
||||
|
||||
} // end count($Field) > 0
|
||||
|
||||
// In case relations are not defined, just generate the FROM clause
|
||||
// from the list of tables, however we don't generate any JOIN
|
||||
|
||||
if (empty($qry_from) && isset($tab_all)) {
|
||||
$qry_from = implode(', ', $tab_all);
|
||||
}
|
||||
// Now let's see what we got
|
||||
if (!empty($qry_from)) {
|
||||
echo 'FROM ' . htmlspecialchars($qry_from) . "\n";
|
||||
}
|
||||
|
||||
// 3. WHERE
|
||||
$qry_where = '';
|
||||
$criteria_cnt = 0;
|
||||
for ($x = 0; $x < $col; $x++) {
|
||||
if (!empty($curField[$x]) && !empty($curCriteria[$x]) && $x && isset($last_where) && isset($curAndOrCol)) {
|
||||
$qry_where .= ' ' . strtoupper($curAndOrCol[$last_where]) . ' ';
|
||||
}
|
||||
if (!empty($curField[$x]) && !empty($curCriteria[$x])) {
|
||||
$qry_where .= '(' . $curField[$x] . ' ' . $curCriteria[$x] . ')';
|
||||
$last_where = $x;
|
||||
$criteria_cnt++;
|
||||
}
|
||||
} // end for
|
||||
if ($criteria_cnt > 1) {
|
||||
$qry_where = '(' . $qry_where . ')';
|
||||
}
|
||||
// OR rows ${'cur' . $or}[$x]
|
||||
if (!isset($curAndOrRow)) {
|
||||
$curAndOrRow = array();
|
||||
}
|
||||
for ($y = 0; $y <= $row; $y++) {
|
||||
$criteria_cnt = 0;
|
||||
$qry_orwhere = '';
|
||||
$last_orwhere = '';
|
||||
for ($x = 0; $x < $col; $x++) {
|
||||
if (!empty($curField[$x]) && !empty(${'curOr' . $y}[$x]) && $x) {
|
||||
$qry_orwhere .= ' ' . strtoupper($curAndOrCol[$last_orwhere]) . ' ';
|
||||
}
|
||||
if (!empty($curField[$x]) && !empty(${'curOr' . $y}[$x])) {
|
||||
$qry_orwhere .= '(' . $curField[$x]
|
||||
. ' '
|
||||
. ${'curOr' . $y}[$x]
|
||||
. ')';
|
||||
$last_orwhere = $x;
|
||||
$criteria_cnt++;
|
||||
}
|
||||
} // end for
|
||||
if ($criteria_cnt > 1) {
|
||||
$qry_orwhere = '(' . $qry_orwhere . ')';
|
||||
}
|
||||
if (!empty($qry_orwhere)) {
|
||||
$qry_where .= "\n"
|
||||
. strtoupper(isset($curAndOrRow[$y]) ? $curAndOrRow[$y] . ' ' : '')
|
||||
. $qry_orwhere;
|
||||
} // end if
|
||||
} // end for
|
||||
|
||||
if (!empty($qry_where) && $qry_where != '()') {
|
||||
echo 'WHERE ' . htmlspecialchars($qry_where) . "\n";
|
||||
} // end if
|
||||
|
||||
|
||||
// 4. ORDER BY
|
||||
$last_orderby = 0;
|
||||
if (!isset($qry_orderby)) {
|
||||
$qry_orderby = '';
|
||||
}
|
||||
for ($x = 0; $x < $col; $x++) {
|
||||
if ($last_orderby && $x && !empty($curField[$x]) && !empty($curSort[$x])) {
|
||||
$qry_orderby .= ', ';
|
||||
}
|
||||
if (!empty($curField[$x]) && !empty($curSort[$x])) {
|
||||
// if they have chosen all fields using the * selector,
|
||||
// then sorting is not available
|
||||
// Robbat2 - Fix for Bug #570698
|
||||
if (substr($curField[$x], -2) != '.*') {
|
||||
$qry_orderby .= $curField[$x] . ' ' . $curSort[$x];
|
||||
$last_orderby = 1;
|
||||
}
|
||||
}
|
||||
} // end for
|
||||
if (!empty($qry_orderby)) {
|
||||
echo 'ORDER BY ' . htmlspecialchars($qry_orderby) . "\n";
|
||||
}
|
||||
?>
|
||||
</textarea>
|
||||
</fieldset>
|
||||
<fieldset class="tblFooters">
|
||||
<input type="submit" name="submit_sql" value="<?php echo $strRunQuery; ?>" />
|
||||
</fieldset>
|
||||
</td>
|
||||
</tr>
|
||||
</table>
|
||||
</form>
|
||||
<?php
|
||||
/**
|
||||
* Displays the footer
|
||||
*/
|
||||
require_once './libraries/footer.inc.php';
|
||||
?>
|
372
db_search.php
@@ -1,372 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* searchs the entire database
|
||||
*
|
||||
* @todo make use of UNION when searching multiple tables
|
||||
* @todo display executed query, optional?
|
||||
* @uses $cfg['UseDbSearch']
|
||||
* @uses $GLOBALS['db']
|
||||
* @uses $GLOBALS['strAccessDenied']
|
||||
* @uses $GLOBALS['strSearchOption1']
|
||||
* @uses $GLOBALS['strSearchOption2']
|
||||
* @uses $GLOBALS['strSearchOption3']
|
||||
* @uses $GLOBALS['strSearchOption4']
|
||||
* @uses $GLOBALS['strSearchResultsFor']
|
||||
* @uses $GLOBALS['strNumSearchResultsInTable']
|
||||
* @uses $GLOBALS['strBrowse']
|
||||
* @uses $GLOBALS['strDelete']
|
||||
* @uses $GLOBALS['strNumSearchResultsTotal']
|
||||
* @uses $GLOBALS['strSearchFormTitle']
|
||||
* @uses $GLOBALS['strSearchNeedle']
|
||||
* @uses $GLOBALS['strSearchType']
|
||||
* @uses $GLOBALS['strSplitWordsWithSpace']
|
||||
* @uses $GLOBALS['strSearchInTables']
|
||||
* @uses $GLOBALS['strUnselectAll']
|
||||
* @uses $GLOBALS['strSelectAll']
|
||||
* @uses PMA_DBI_get_tables()
|
||||
* @uses PMA_sqlAddslashes()
|
||||
* @uses PMA_getSearchSqls()
|
||||
* @uses PMA_DBI_fetch_value()
|
||||
* @uses PMA_linkOrButton()
|
||||
* @uses PMA_generate_common_url()
|
||||
* @uses PMA_generate_common_hidden_inputs()
|
||||
* @uses PMA_showMySQLDocu()
|
||||
* @uses $_REQUEST['search_str']
|
||||
* @uses $_REQUEST['submit_search']
|
||||
* @uses $_REQUEST['search_option']
|
||||
* @uses $_REQUEST['table_select']
|
||||
* @uses $_REQUEST['unselectall']
|
||||
* @uses $_REQUEST['selectall']
|
||||
* @uses $_REQUEST['field_str']
|
||||
* @uses is_string()
|
||||
* @uses htmlspecialchars()
|
||||
* @uses array_key_exists()
|
||||
* @uses is_array()
|
||||
* @uses array_intersect()
|
||||
* @uses sprintf()
|
||||
* @uses in_array()
|
||||
* @version $Id$
|
||||
* @author Thomas Chaumeny <chaume92 at aol.com>
|
||||
*/
|
||||
|
||||
/**
|
||||
*
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
|
||||
/**
|
||||
* Gets some core libraries and send headers
|
||||
*/
|
||||
require './libraries/db_common.inc.php';
|
||||
|
||||
/**
|
||||
* init
|
||||
*/
|
||||
// If config variable $GLOBALS['cfg']['Usedbsearch'] is on false : exit.
|
||||
if (! $GLOBALS['cfg']['UseDbSearch']) {
|
||||
PMA_mysqlDie($GLOBALS['strAccessDenied'], '', false, $err_url);
|
||||
} // end if
|
||||
$url_query .= '&goto=db_search.php';
|
||||
$url_params['goto'] = 'db_search.php';
|
||||
|
||||
/**
|
||||
* @global array list of tables from the current database
|
||||
* but do not clash with $tables coming from db_info.inc.php
|
||||
*/
|
||||
$tables_names_only = PMA_DBI_get_tables($GLOBALS['db']);
|
||||
|
||||
$search_options = array(
|
||||
'1' => $GLOBALS['strSearchOption1'],
|
||||
'2' => $GLOBALS['strSearchOption2'],
|
||||
'3' => $GLOBALS['strSearchOption3'],
|
||||
'4' => $GLOBALS['strSearchOption4'],
|
||||
);
|
||||
|
||||
if (empty($_REQUEST['search_option']) || ! is_string($_REQUEST['search_option'])
|
||||
|| ! array_key_exists($_REQUEST['search_option'], $search_options)) {
|
||||
$search_option = 1;
|
||||
unset($_REQUEST['submit_search']);
|
||||
} else {
|
||||
$search_option = (int) $_REQUEST['search_option'];
|
||||
$option_str = $search_options[$_REQUEST['search_option']];
|
||||
}
|
||||
|
||||
if (empty($_REQUEST['search_str']) || ! is_string($_REQUEST['search_str'])) {
|
||||
unset($_REQUEST['submit_search']);
|
||||
$searched = '';
|
||||
} else {
|
||||
$searched = htmlspecialchars($_REQUEST['search_str']);
|
||||
// For "as regular expression" (search option 4), we should not treat
|
||||
// this as an expression that contains a LIKE (second parameter of
|
||||
// PMA_sqlAddslashes()).
|
||||
//
|
||||
// Usage example: If user is seaching for a literal $ in a regexp search,
|
||||
// he should enter \$ as the value.
|
||||
$search_str = PMA_sqlAddslashes($_REQUEST['search_str'], ($search_option == 4 ? false : true));
|
||||
}
|
||||
|
||||
$tables_selected = array();
|
||||
if (empty($_REQUEST['table_select']) || ! is_array($_REQUEST['table_select'])) {
|
||||
unset($_REQUEST['submit_search']);
|
||||
} elseif (! isset($_REQUEST['selectall']) && ! isset($_REQUEST['unselectall'])) {
|
||||
$tables_selected = array_intersect($_REQUEST['table_select'], $tables_names_only);
|
||||
}
|
||||
|
||||
if (isset($_REQUEST['selectall'])) {
|
||||
$tables_selected = $tables_names_only;
|
||||
} elseif (isset($_REQUEST['unselectall'])) {
|
||||
$tables_selected = array();
|
||||
}
|
||||
|
||||
if (empty($_REQUEST['field_str']) || ! is_string($_REQUEST['field_str'])) {
|
||||
unset($field_str);
|
||||
} else {
|
||||
$field_str = PMA_sqlAddslashes($_REQUEST['field_str'], true);
|
||||
}
|
||||
|
||||
/**
|
||||
* Displays top links
|
||||
*/
|
||||
$sub_part = '';
|
||||
require './libraries/db_info.inc.php';
|
||||
|
||||
|
||||
/**
|
||||
* 1. Main search form has been submitted
|
||||
*/
|
||||
if (isset($_REQUEST['submit_search'])) {
|
||||
|
||||
/**
|
||||
* Builds the SQL search query
|
||||
*
|
||||
* @todo can we make use of fulltextsearch IN BOOLEAN MODE for this?
|
||||
* @uses PMA_DBI_query
|
||||
* PMA_backquote
|
||||
* PMA_DBI_free_result
|
||||
* PMA_DBI_fetch_assoc
|
||||
* $GLOBALS['db']
|
||||
* explode
|
||||
* count
|
||||
* strlen
|
||||
* @param string the table name
|
||||
* @param string restrict the search to this field
|
||||
* @param string the string to search
|
||||
* @param integer type of search (1 -> 1 word at least, 2 -> all words,
|
||||
* 3 -> exact string, 4 -> regexp)
|
||||
*
|
||||
* @return array 3 SQL querys (for count, display and delete results)
|
||||
*
|
||||
* @global string the url to return to in case of errors
|
||||
* @global string charset connection
|
||||
*/
|
||||
function PMA_getSearchSqls($table, $field, $search_str, $search_option)
|
||||
{
|
||||
global $err_url;
|
||||
|
||||
// Statement types
|
||||
$sqlstr_select = 'SELECT';
|
||||
$sqlstr_delete = 'DELETE';
|
||||
|
||||
// Fields to select
|
||||
$tblfields = PMA_DBI_fetch_result('SHOW FIELDS FROM ' . PMA_backquote($table) . ' FROM ' . PMA_backquote($GLOBALS['db']),
|
||||
null, 'Field');
|
||||
|
||||
// Table to use
|
||||
$sqlstr_from = ' FROM ' . PMA_backquote($GLOBALS['db']) . '.' . PMA_backquote($table);
|
||||
|
||||
$search_words = (($search_option > 2) ? array($search_str) : explode(' ', $search_str));
|
||||
$search_wds_cnt = count($search_words);
|
||||
|
||||
$like_or_regex = (($search_option == 4) ? 'REGEXP' : 'LIKE');
|
||||
$automatic_wildcard = (($search_option < 3) ? '%' : '');
|
||||
|
||||
$fieldslikevalues = array();
|
||||
foreach ($search_words as $search_word) {
|
||||
// Eliminates empty values
|
||||
if (strlen($search_word) === 0) {
|
||||
continue;
|
||||
}
|
||||
|
||||
$thefieldlikevalue = array();
|
||||
foreach ($tblfields as $tblfield) {
|
||||
if (! isset($field) || strlen($field) == 0 || $tblfield == $field) {
|
||||
$thefieldlikevalue[] = PMA_backquote($tblfield)
|
||||
. ' ' . $like_or_regex . ' '
|
||||
. "'" . $automatic_wildcard
|
||||
. $search_word
|
||||
. $automatic_wildcard . "'";
|
||||
}
|
||||
} // end for
|
||||
|
||||
if (count($thefieldlikevalue) > 0) {
|
||||
$fieldslikevalues[] = implode(' OR ', $thefieldlikevalue);
|
||||
}
|
||||
} // end for
|
||||
|
||||
$implode_str = ($search_option == 1 ? ' OR ' : ' AND ');
|
||||
if ( empty($fieldslikevalues)) {
|
||||
// this could happen when the "inside field" does not exist
|
||||
// in any selected tables
|
||||
$sqlstr_where = ' WHERE FALSE';
|
||||
} else {
|
||||
$sqlstr_where = ' WHERE (' . implode(') ' . $implode_str . ' (', $fieldslikevalues) . ')';
|
||||
}
|
||||
unset($fieldslikevalues);
|
||||
|
||||
// Builds complete queries
|
||||
$sql['select_fields'] = $sqlstr_select . ' * ' . $sqlstr_from . $sqlstr_where;
|
||||
// here, I think we need to still use the COUNT clause, even for
|
||||
// VIEWs, anyway we have a WHERE clause that should limit results
|
||||
$sql['select_count'] = $sqlstr_select . ' COUNT(*) AS `count`' . $sqlstr_from . $sqlstr_where;
|
||||
$sql['delete'] = $sqlstr_delete . $sqlstr_from . $sqlstr_where;
|
||||
|
||||
return $sql;
|
||||
} // end of the "PMA_getSearchSqls()" function
|
||||
|
||||
|
||||
/**
|
||||
* Displays the results
|
||||
*/
|
||||
$this_url_params = array(
|
||||
'db' => $GLOBALS['db'],
|
||||
'goto' => 'db_sql.php',
|
||||
'pos' => 0,
|
||||
'is_js_confirmed' => 0,
|
||||
);
|
||||
|
||||
// Displays search string
|
||||
echo '<br />' . "\n"
|
||||
.'<table class="data">' . "\n"
|
||||
.'<caption class="tblHeaders">' . "\n"
|
||||
.sprintf($GLOBALS['strSearchResultsFor'],
|
||||
$searched, $option_str) . "\n"
|
||||
.'</caption>' . "\n";
|
||||
|
||||
$num_search_result_total = 0;
|
||||
$odd_row = true;
|
||||
|
||||
foreach ($tables_selected as $each_table) {
|
||||
// Gets the SQL statements
|
||||
$newsearchsqls = PMA_getSearchSqls($each_table, (! empty($field_str) ? $field_str : ''), $search_str, $search_option);
|
||||
|
||||
// Executes the "COUNT" statement
|
||||
$res_cnt = PMA_DBI_fetch_value($newsearchsqls['select_count']);
|
||||
$num_search_result_total += $res_cnt;
|
||||
|
||||
$sql_query .= $newsearchsqls['select_count'];
|
||||
|
||||
echo '<tr class="' . ($odd_row ? 'odd' : 'even') . '">'
|
||||
.'<td>' . sprintf($GLOBALS['strNumSearchResultsInTable'], $res_cnt,
|
||||
htmlspecialchars($each_table)) . "</td>\n";
|
||||
|
||||
if ($res_cnt > 0) {
|
||||
$this_url_params['sql_query'] = $newsearchsqls['select_fields'];
|
||||
echo '<td>' . PMA_linkOrButton(
|
||||
'sql.php' . PMA_generate_common_url($this_url_params),
|
||||
$GLOBALS['strBrowse'], '') . "</td>\n";
|
||||
|
||||
$this_url_params['sql_query'] = $newsearchsqls['delete'];
|
||||
echo '<td>' . PMA_linkOrButton(
|
||||
'sql.php' . PMA_generate_common_url($this_url_params),
|
||||
$GLOBALS['strDelete'], $newsearchsqls['delete']) . "</td>\n";
|
||||
|
||||
} else {
|
||||
echo '<td> </td>' . "\n"
|
||||
.'<td> </td>' . "\n";
|
||||
}// end if else
|
||||
$odd_row = ! $odd_row;
|
||||
echo '</tr>' . "\n";
|
||||
} // end for
|
||||
|
||||
echo '</table>' . "\n";
|
||||
|
||||
if (count($tables_selected) > 1) {
|
||||
echo '<p>' . sprintf($GLOBALS['strNumSearchResultsTotal'],
|
||||
$num_search_result_total) . '</p>' . "\n";
|
||||
}
|
||||
} // end 1.
|
||||
|
||||
|
||||
/**
|
||||
* 2. Displays the main search form
|
||||
*/
|
||||
?>
|
||||
<a name="db_search"></a>
|
||||
<form method="post" action="db_search.php" name="db_search">
|
||||
<?php echo PMA_generate_common_hidden_inputs($GLOBALS['db']); ?>
|
||||
<fieldset>
|
||||
<legend><?php echo $GLOBALS['strSearchFormTitle']; ?></legend>
|
||||
|
||||
<table class="formlayout">
|
||||
<tr><td><?php echo $GLOBALS['strSearchNeedle']; ?></td>
|
||||
<td><input type="text" name="search_str" size="60"
|
||||
value="<?php echo $searched; ?>" /></td>
|
||||
</tr>
|
||||
<tr><td align="right" valign="top">
|
||||
<?php echo $GLOBALS['strSearchType']; ?></td>
|
||||
<td><?php
|
||||
|
||||
$choices = array(
|
||||
'1' => $GLOBALS['strSearchOption1'] . PMA_showHint($GLOBALS['strSplitWordsWithSpace']),
|
||||
'2' => $GLOBALS['strSearchOption2'] . PMA_showHint($GLOBALS['strSplitWordsWithSpace']),
|
||||
'3' => $GLOBALS['strSearchOption3'],
|
||||
'4' => $GLOBALS['strSearchOption4'] . ' ' . PMA_showMySQLDocu('Regexp', 'Regexp')
|
||||
);
|
||||
// 4th parameter set to false to add line breaks
|
||||
// 5th parameter set to false to avoid htmlspecialchars() escaping in the label
|
||||
// since we have some HTML in some labels
|
||||
PMA_generate_html_radio('search_option', $choices, $search_option, true, false);
|
||||
unset($choices);
|
||||
?>
|
||||
</td>
|
||||
</tr>
|
||||
<tr><td align="right" valign="top">
|
||||
<?php echo $GLOBALS['strSearchInTables']; ?></td>
|
||||
<td rowspan="2">
|
||||
<?php
|
||||
echo ' <select name="table_select[]" size="6" multiple="multiple">' . "\n";
|
||||
foreach ($tables_names_only as $each_table) {
|
||||
if (in_array($each_table, $tables_selected)) {
|
||||
$is_selected = ' selected="selected"';
|
||||
} else {
|
||||
$is_selected = '';
|
||||
}
|
||||
|
||||
echo ' <option value="' . htmlspecialchars($each_table) . '"'
|
||||
. $is_selected . '>'
|
||||
. str_replace(' ', ' ', htmlspecialchars($each_table)) . '</option>' . "\n";
|
||||
} // end while
|
||||
|
||||
echo ' </select>' . "\n";
|
||||
$alter_select =
|
||||
'<a href="db_search.php' . PMA_generate_common_url(array_merge($url_params, array('selectall' => 1))) . '#db_search"'
|
||||
. ' onclick="setSelectOptions(\'db_search\', \'table_select[]\', true); return false;">' . $GLOBALS['strSelectAll'] . '</a>'
|
||||
. ' / '
|
||||
. '<a href="db_search.php' . PMA_generate_common_url(array_merge($url_params, array('unselectall' => 1))) . '#db_search"'
|
||||
. ' onclick="setSelectOptions(\'db_search\', \'table_select[]\', false); return false;">' . $GLOBALS['strUnselectAll'] . '</a>';
|
||||
?>
|
||||
</td>
|
||||
</tr>
|
||||
<tr><td align="right" valign="bottom">
|
||||
<?php echo $alter_select; ?></td></tr>
|
||||
</tr>
|
||||
<tr><td align="right">
|
||||
<?php echo $GLOBALS['strSearchInField']; ?></td>
|
||||
<td><input type="text" name="field_str" size="60"
|
||||
value="<?php echo ! empty($field_str) ? $field_str : ''; ?>" /></td>
|
||||
</tr>
|
||||
</table>
|
||||
</fieldset>
|
||||
<fieldset class="tblFooters">
|
||||
<input type="submit" name="submit_search" value="<?php echo $GLOBALS['strGo']; ?>"
|
||||
id="buttonGo" />
|
||||
</fieldset>
|
||||
</form>
|
||||
|
||||
<?php
|
||||
/**
|
||||
* Displays the footer
|
||||
*/
|
||||
require_once './libraries/footer.inc.php';
|
||||
?>
|
45
db_sql.php
@@ -1,45 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
*
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
|
||||
/**
|
||||
* Runs common work
|
||||
*/
|
||||
require './libraries/db_common.inc.php';
|
||||
require_once './libraries/sql_query_form.lib.php';
|
||||
|
||||
// After a syntax error, we return to this script
|
||||
// with the typed query in the textarea.
|
||||
$goto = 'db_sql.php';
|
||||
$back = 'db_sql.php';
|
||||
|
||||
/**
|
||||
* Gets informations about the database and, if it is empty, move to the
|
||||
* "db_structure.php" script where table can be created
|
||||
*/
|
||||
require './libraries/db_info.inc.php';
|
||||
if ($num_tables == 0 && empty($db_query_force)) {
|
||||
$sub_part = '';
|
||||
$is_info = TRUE;
|
||||
require './db_structure.php';
|
||||
exit();
|
||||
}
|
||||
|
||||
/**
|
||||
* Query box, bookmark, insert data from textfile
|
||||
*/
|
||||
PMA_sqlQueryForm(true, false, isset($_REQUEST['delimiter']) ? $_REQUEST['delimiter'] : ';');
|
||||
|
||||
/**
|
||||
* Displays the footer
|
||||
*/
|
||||
require_once './libraries/footer.inc.php';
|
||||
?>
|
581
db_structure.php
@@ -1,581 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
*
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
require_once './libraries/Table.class.php';
|
||||
|
||||
$GLOBALS['js_include'][] = 'mootools.js';
|
||||
|
||||
/**
|
||||
* Prepares the tables list if the user where not redirected to this script
|
||||
* because there is no table in the database ($is_info is true)
|
||||
*/
|
||||
if (empty($is_info)) {
|
||||
// Drops/deletes/etc. multiple tables if required
|
||||
if ((!empty($submit_mult) && isset($selected_tbl))
|
||||
|| isset($mult_btn)) {
|
||||
$action = 'db_structure.php';
|
||||
$err_url = 'db_structure.php?'. PMA_generate_common_url($db);
|
||||
require './libraries/mult_submits.inc.php';
|
||||
if (empty($message)) {
|
||||
$message = PMA_Message::success();
|
||||
}
|
||||
}
|
||||
require './libraries/db_common.inc.php';
|
||||
$url_query .= '&goto=db_structure.php';
|
||||
|
||||
// Gets the database structure
|
||||
$sub_part = '_structure';
|
||||
require './libraries/db_info.inc.php';
|
||||
}
|
||||
|
||||
// 1. No tables
|
||||
if ($num_tables == 0) {
|
||||
echo '<p>' . $strNoTablesFound . '</p>' . "\n";
|
||||
|
||||
if (empty($db_is_information_schema)) {
|
||||
require './libraries/display_create_table.lib.php';
|
||||
} // end if (Create Table dialog)
|
||||
|
||||
/**
|
||||
* Displays the footer
|
||||
*/
|
||||
require_once './libraries/footer.inc.php';
|
||||
exit;
|
||||
}
|
||||
|
||||
// else
|
||||
// 2. Shows table informations - staybyte - 11 June 2001
|
||||
|
||||
require_once './libraries/bookmark.lib.php';
|
||||
|
||||
require_once './libraries/mysql_charsets.lib.php';
|
||||
$db_collation = PMA_getDbCollation($db);
|
||||
|
||||
// Display function
|
||||
/**
|
||||
* void PMA_TableHeader([bool $db_is_information_schema = false])
|
||||
* display table header (<table><thead>...</thead><tbody>)
|
||||
*
|
||||
* @uses PMA_showHint()
|
||||
* @uses $GLOBALS['cfg']['PropertiesNumColumns']
|
||||
* @uses $GLOBALS['is_show_stats']
|
||||
* @uses $GLOBALS['strTable']
|
||||
* @uses $GLOBALS['strAction']
|
||||
* @uses $GLOBALS['strRecords']
|
||||
* @uses $GLOBALS['strApproximateCount']
|
||||
* @uses $GLOBALS['strType']
|
||||
* @uses $GLOBALS['strCollation']
|
||||
* @uses $GLOBALS['strSize']
|
||||
* @uses $GLOBALS['strOverhead']
|
||||
* @uses $GLOBALS['structure_tbl_col_cnt']
|
||||
* @param boolean $db_is_information_schema
|
||||
*/
|
||||
function PMA_TableHeader($db_is_information_schema = false)
|
||||
{
|
||||
$cnt = 0; // Let's count the columns...
|
||||
|
||||
if ($db_is_information_schema) {
|
||||
$action_colspan = 3;
|
||||
} else {
|
||||
$action_colspan = 6;
|
||||
}
|
||||
|
||||
echo '<table class="data" style="float: left;">' . "\n"
|
||||
.'<thead>' . "\n"
|
||||
.'<tr><td></td>' . "\n"
|
||||
.' <th>' . $GLOBALS['strTable'] . '</th>' . "\n"
|
||||
.' <th colspan="' . $action_colspan . '">' . "\n"
|
||||
.' ' . $GLOBALS['strAction'] . "\n"
|
||||
.' </th>'
|
||||
.' <th>' . $GLOBALS['strRecords']
|
||||
.PMA_showHint(PMA_sanitize($GLOBALS['strApproximateCount'])) . "\n"
|
||||
.' </th>' . "\n";
|
||||
if (!($GLOBALS['cfg']['PropertiesNumColumns'] > 1)) {
|
||||
echo ' <th>' . $GLOBALS['strType'] . '</th>' . "\n";
|
||||
$cnt++;
|
||||
echo ' <th>' . $GLOBALS['strCollation'] . '</th>' . "\n";
|
||||
$cnt++;
|
||||
}
|
||||
if ($GLOBALS['is_show_stats']) {
|
||||
echo ' <th>' . $GLOBALS['strSize'] . '</th>' . "\n"
|
||||
. ' <th>' . $GLOBALS['strOverhead'] . '</th>' . "\n";
|
||||
$cnt += 2;
|
||||
}
|
||||
echo '</tr>' . "\n";
|
||||
echo '</thead>' . "\n";
|
||||
echo '<tbody>' . "\n";
|
||||
$GLOBALS['structure_tbl_col_cnt'] = $cnt + $action_colspan + 3;
|
||||
} // end function PMA_TableHeader()
|
||||
|
||||
$titles = array();
|
||||
if (true == $cfg['PropertiesIconic']) {
|
||||
$titles['Browse'] = '<img class="icon" width="16" height="16" src="' .$pmaThemeImage . 'b_browse.png" alt="' . $strBrowse . '" title="' . $strBrowse . '" />';
|
||||
$titles['NoBrowse'] = '<img class="icon" width="16" height="16" src="' .$pmaThemeImage . 'bd_browse.png" alt="' . $strBrowse . '" title="' . $strBrowse . '" />';
|
||||
$titles['Search'] = '<img class="icon" width="16" height="16" src="' .$pmaThemeImage . 'b_select.png" alt="' . $strSearch . '" title="' . $strSearch . '" />';
|
||||
$titles['NoSearch'] = '<img class="icon" width="16" height="16" src="' .$pmaThemeImage . 'bd_select.png" alt="' . $strSearch . '" title="' . $strSearch . '" />';
|
||||
$titles['Insert'] = '<img class="icon" width="16" height="16" src="' .$pmaThemeImage . 'b_insrow.png" alt="' . $strInsert . '" title="' . $strInsert . '" />';
|
||||
$titles['NoInsert'] = '<img class="icon" width="16" height="16" src="' .$pmaThemeImage . 'bd_insrow.png" alt="' . $strInsert . '" title="' . $strInsert . '" />';
|
||||
$titles['Structure'] = '<img class="icon" width="16" height="16" src="' .$pmaThemeImage . 'b_props.png" alt="' . $strStructure . '" title="' . $strStructure . '" />';
|
||||
$titles['Drop'] = '<img class="icon" width="16" height="16" src="' .$pmaThemeImage . 'b_drop.png" alt="' . $strDrop . '" title="' . $strDrop . '" />';
|
||||
$titles['NoDrop'] = '<img class="icon" width="16" height="16" src="' .$pmaThemeImage . 'bd_drop.png" alt="' . $strDrop . '" title="' . $strDrop . '" />';
|
||||
$titles['Empty'] = '<img class="icon" width="16" height="16" src="' .$pmaThemeImage . 'b_empty.png" alt="' . $strEmpty . '" title="' . $strEmpty . '" />';
|
||||
$titles['NoEmpty'] = '<img class="icon" width="16" height="16" src="' .$pmaThemeImage . 'bd_empty.png" alt="' . $strEmpty . '" title="' . $strEmpty . '" />';
|
||||
|
||||
if ('both' === $cfg['PropertiesIconic']) {
|
||||
$titles['Browse'] .= $strBrowse;
|
||||
$titles['Search'] .= $strSearch;
|
||||
$titles['NoBrowse'] .= $strBrowse;
|
||||
$titles['NoSearch'] .= $strSearch;
|
||||
$titles['Insert'] .= $strInsert;
|
||||
$titles['NoInsert'] .= $strInsert;
|
||||
$titles['Structure'] .= $strStructure;
|
||||
$titles['Drop'] .= $strDrop;
|
||||
$titles['NoDrop'] .= $strDrop;
|
||||
$titles['Empty'] .= $strEmpty;
|
||||
$titles['NoEmpty'] .= $strEmpty;
|
||||
}
|
||||
} else {
|
||||
$titles['Browse'] = $strBrowse;
|
||||
$titles['Search'] = $strSearch;
|
||||
$titles['NoBrowse'] = $strBrowse;
|
||||
$titles['NoSearch'] = $strSearch;
|
||||
$titles['Insert'] = $strInsert;
|
||||
$titles['NoInsert'] = $strInsert;
|
||||
$titles['Structure'] = $strStructure;
|
||||
$titles['Drop'] = $strDrop;
|
||||
$titles['NoDrop'] = $strDrop;
|
||||
$titles['Empty'] = $strEmpty;
|
||||
$titles['NoEmpty'] = $strEmpty;
|
||||
}
|
||||
|
||||
/**
|
||||
* Displays the tables list
|
||||
*/
|
||||
|
||||
$_url_params = array(
|
||||
'pos' => $pos,
|
||||
'db' => $db);
|
||||
|
||||
PMA_listNavigator($total_num_tables, $pos, $_url_params, 'db_structure.php', 'frame_content', $GLOBALS['cfg']['MaxTableList']);
|
||||
|
||||
?>
|
||||
<form method="post" action="db_structure.php" name="tablesForm" id="tablesForm">
|
||||
<?php
|
||||
echo PMA_generate_common_hidden_inputs($db);
|
||||
|
||||
PMA_TableHeader($db_is_information_schema);
|
||||
|
||||
$i = $sum_entries = 0;
|
||||
$sum_size = (double) 0;
|
||||
$overhead_size = (double) 0;
|
||||
$overhead_check = '';
|
||||
$checked = !empty($checkall) ? ' checked="checked"' : '';
|
||||
$num_columns = $cfg['PropertiesNumColumns'] > 1 ? ceil($num_tables / $cfg['PropertiesNumColumns']) + 1 : 0;
|
||||
$row_count = 0;
|
||||
|
||||
|
||||
$hidden_fields = array();
|
||||
$odd_row = true;
|
||||
$sum_row_count_pre = '';
|
||||
|
||||
// added by rajk - for blobstreaming
|
||||
$PMA_Config = $_SESSION['PMA_Config'];
|
||||
|
||||
if (!empty ($PMA_Config))
|
||||
$session_bs_tables = $PMA_Config->get('BLOBSTREAMING_TABLES'); // list of blobstreaming tables
|
||||
|
||||
$tableReductionCount = 0; // the amount to reduce the table count by
|
||||
|
||||
foreach ($tables as $keyname => $each_table) {
|
||||
if (isset($session_bs_tables))
|
||||
{
|
||||
// compare table name against blobstreaming tables
|
||||
foreach ($session_bs_tables as $table_key=>$table_val)
|
||||
// if the table is a blobstreaming table, reduce table count and skip outer foreach loop
|
||||
if ($table_key == $keyname)
|
||||
{
|
||||
$tableReductionCount++;
|
||||
continue 2;
|
||||
}
|
||||
}
|
||||
|
||||
// loic1: Patch from Joshua Nye <josh at boxcarmedia.com> to get valid
|
||||
// statistics whatever is the table type
|
||||
|
||||
$table_is_view = false;
|
||||
$table_encoded = urlencode($each_table['TABLE_NAME']);
|
||||
// Sets parameters for links
|
||||
$tbl_url_query = $url_query . '&table=' . $table_encoded;
|
||||
|
||||
switch ( $each_table['ENGINE']) {
|
||||
// MyISAM, ISAM or Heap table: Row count, data size and index size
|
||||
// are accurate.
|
||||
case 'MyISAM' :
|
||||
case 'ISAM' :
|
||||
case 'HEAP' :
|
||||
case 'MEMORY' :
|
||||
if ($is_show_stats) {
|
||||
$tblsize = doubleval($each_table['Data_length']) + doubleval($each_table['Index_length']);
|
||||
$sum_size += $tblsize;
|
||||
list($formatted_size, $unit) = PMA_formatByteDown($tblsize, 3, ($tblsize > 0) ? 1 : 0);
|
||||
if (isset($each_table['Data_free']) && $each_table['Data_free'] > 0) {
|
||||
list($formatted_overhead, $overhead_unit) = PMA_formatByteDown($each_table['Data_free'], 3, ($each_table['Data_free'] > 0) ? 1 : 0);
|
||||
$overhead_size += $each_table['Data_free'];
|
||||
}
|
||||
}
|
||||
break;
|
||||
case 'InnoDB' :
|
||||
// InnoDB table: Row count is not accurate but data and index
|
||||
// sizes are.
|
||||
|
||||
if ($each_table['TABLE_ROWS'] < $GLOBALS['cfg']['MaxExactCount']) {
|
||||
$each_table['COUNTED'] = true;
|
||||
$each_table['TABLE_ROWS'] = PMA_Table::countRecords($db,
|
||||
$each_table['TABLE_NAME'], $return = true, $force_exact = true,
|
||||
$is_view = false);
|
||||
} else {
|
||||
$each_table['COUNTED'] = false;
|
||||
}
|
||||
|
||||
if ($is_show_stats) {
|
||||
$tblsize = $each_table['Data_length'] + $each_table['Index_length'];
|
||||
$sum_size += $tblsize;
|
||||
list($formatted_size, $unit) = PMA_formatByteDown($tblsize, 3, ($tblsize > 0) ? 1 : 0);
|
||||
}
|
||||
//$display_rows = ' - ';
|
||||
break;
|
||||
case 'MRG_MyISAM' :
|
||||
case 'BerkeleyDB' :
|
||||
// Merge or BerkleyDB table: Only row count is accurate.
|
||||
if ($is_show_stats) {
|
||||
$formatted_size = ' - ';
|
||||
$unit = '';
|
||||
}
|
||||
break;
|
||||
// for a view, the ENGINE is null
|
||||
case null :
|
||||
case 'SYSTEM VIEW' :
|
||||
// countRecords() takes care of $cfg['MaxExactCountViews']
|
||||
$each_table['TABLE_ROWS'] = PMA_Table::countRecords($db,
|
||||
$each_table['TABLE_NAME'], $return = true, $force_exact = true,
|
||||
$is_view = true);
|
||||
$table_is_view = true;
|
||||
break;
|
||||
default :
|
||||
// Unknown table type.
|
||||
if ($is_show_stats) {
|
||||
$formatted_size = 'unknown';
|
||||
$unit = '';
|
||||
}
|
||||
} // end switch
|
||||
$sum_entries += $each_table['TABLE_ROWS'];
|
||||
|
||||
if (isset($each_table['Collation'])) {
|
||||
$collation = '<dfn title="'
|
||||
. PMA_getCollationDescr($each_table['Collation']) . '">'
|
||||
. $each_table['Collation'] . '</dfn>';
|
||||
} else {
|
||||
$collation = '---';
|
||||
}
|
||||
|
||||
if ($is_show_stats) {
|
||||
if (isset($formatted_overhead)) {
|
||||
$overhead = '<a href="tbl_structure.php?'
|
||||
. $tbl_url_query . '#showusage">' . $formatted_overhead
|
||||
. ' ' . $overhead_unit . '</a>' . "\n";
|
||||
unset($formatted_overhead);
|
||||
$overhead_check .=
|
||||
"document.getElementById('checkbox_tbl_" . ($i + 1) . "').checked = true;";
|
||||
} else {
|
||||
$overhead = '-';
|
||||
}
|
||||
} // end if
|
||||
|
||||
$alias = (!empty($tooltip_aliasname) && isset($tooltip_aliasname[$each_table['TABLE_NAME']]))
|
||||
? str_replace(' ', ' ', htmlspecialchars($tooltip_truename[$each_table['TABLE_NAME']]))
|
||||
: str_replace(' ', ' ', htmlspecialchars($each_table['TABLE_NAME']));
|
||||
$truename = (!empty($tooltip_truename) && isset($tooltip_truename[$each_table['TABLE_NAME']]))
|
||||
? str_replace(' ', ' ', htmlspecialchars($tooltip_truename[$each_table['TABLE_NAME']]))
|
||||
: str_replace(' ', ' ', htmlspecialchars($each_table['TABLE_NAME']));
|
||||
|
||||
$i++;
|
||||
|
||||
$row_count++;
|
||||
if ($table_is_view) {
|
||||
$hidden_fields[] = '<input type="hidden" name="views[]" value="' . $each_table['TABLE_NAME'] . '" />';
|
||||
}
|
||||
|
||||
if ($each_table['TABLE_ROWS'] > 0) {
|
||||
$browse_table = '<a href="sql.php?' . $tbl_url_query . '&pos=0">' . $titles['Browse'] . '</a>';
|
||||
$search_table = '<a href="tbl_select.php?' . $tbl_url_query . '">' . $titles['Search'] . '</a>';
|
||||
} else {
|
||||
$browse_table = $titles['NoBrowse'];
|
||||
$search_table = $titles['NoSearch'];
|
||||
}
|
||||
|
||||
if (! $db_is_information_schema) {
|
||||
if (! empty($each_table['TABLE_ROWS'])) {
|
||||
$empty_table = '<a href="sql.php?' . $tbl_url_query
|
||||
. '&sql_query=';
|
||||
$empty_table .= urlencode('TRUNCATE ' . PMA_backquote($each_table['TABLE_NAME']))
|
||||
. '&zero_rows='
|
||||
. urlencode(sprintf($strTableHasBeenEmptied, htmlspecialchars($each_table['TABLE_NAME'])))
|
||||
. '" onclick="return confirmLink(this, \'TRUNCATE ';
|
||||
$empty_table .= PMA_jsFormat($each_table['TABLE_NAME']) . '\')">' . $titles['Empty'] . '</a>';
|
||||
} else {
|
||||
$empty_table = $titles['NoEmpty'];
|
||||
}
|
||||
$drop_query = 'DROP '
|
||||
. ($table_is_view ? 'VIEW' : 'TABLE')
|
||||
. ' ' . PMA_backquote($each_table['TABLE_NAME']);
|
||||
$drop_message = sprintf(
|
||||
$table_is_view ? $strViewHasBeenDropped : $strTableHasBeenDropped,
|
||||
str_replace(' ', ' ', htmlspecialchars($each_table['TABLE_NAME'])));
|
||||
}
|
||||
|
||||
if ($num_columns > 0 && $num_tables > $num_columns
|
||||
&& (($row_count % $num_columns) == 0)) {
|
||||
$row_count = 1;
|
||||
$odd_row = true;
|
||||
?>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
<?php
|
||||
PMA_TableHeader();
|
||||
}
|
||||
?>
|
||||
<tr class="<?php echo $odd_row ? 'odd' : 'even'; $odd_row = ! $odd_row; ?>">
|
||||
<td align="center">
|
||||
<input type="checkbox" name="selected_tbl[]"
|
||||
value="<?php echo $each_table['TABLE_NAME']; ?>"
|
||||
id="checkbox_tbl_<?php echo $i; ?>"<?php echo $checked; ?> /></td>
|
||||
<th><label for="checkbox_tbl_<?php echo $i; ?>"
|
||||
title="<?php echo $alias; ?>"><?php echo $truename; ?></label>
|
||||
</th>
|
||||
<td align="center"><?php echo $browse_table; ?></td>
|
||||
<td align="center">
|
||||
<a href="tbl_structure.php?<?php echo $tbl_url_query; ?>">
|
||||
<?php echo $titles['Structure']; ?></a></td>
|
||||
<td align="center"><?php echo $search_table; ?></td>
|
||||
<?php if (! $db_is_information_schema) { ?>
|
||||
<td align="center">
|
||||
<a href="tbl_change.php?<?php echo $tbl_url_query; ?>">
|
||||
<?php echo $titles['Insert']; ?></a></td>
|
||||
<td align="center"><?php echo $empty_table; ?></td>
|
||||
<td align="center">
|
||||
<a href="sql.php?<?php echo $tbl_url_query;
|
||||
?>&reload=1&purge=1&sql_query=<?php
|
||||
echo urlencode($drop_query); ?>&zero_rows=<?php
|
||||
echo urlencode($drop_message); ?>"
|
||||
onclick="return confirmLink(this, '<?php echo PMA_jsFormat($drop_query, false); ?>')">
|
||||
<?php echo $titles['Drop']; ?></a></td>
|
||||
<?php } // end if (! $db_is_information_schema)
|
||||
|
||||
// there is a null value in the ENGINE
|
||||
// - when the table needs to be repaired, or
|
||||
// - when it's a view
|
||||
// so ensure that we'll display "in use" below for a table
|
||||
// that needs to be repaired
|
||||
if (isset($each_table['TABLE_ROWS']) && ($each_table['ENGINE'] != null || $table_is_view)) {
|
||||
if ($table_is_view) {
|
||||
$row_count_pre = '~';
|
||||
$sum_row_count_pre = '~';
|
||||
$show_superscript = PMA_showHint(PMA_sanitize(sprintf($strViewHasAtLeast, '[a@./Documentation.html#cfg_MaxExactCountViews@_blank]', '[/a]')));
|
||||
} elseif($each_table['ENGINE'] == 'InnoDB' && (! $each_table['COUNTED'])) {
|
||||
// InnoDB table: we did not get an accurate row count
|
||||
$row_count_pre = '~';
|
||||
$sum_row_count_pre = '~';
|
||||
$show_superscript = '';
|
||||
} else {
|
||||
$row_count_pre = '';
|
||||
$show_superscript = '';
|
||||
}
|
||||
?>
|
||||
<td class="value"><?php echo $row_count_pre . PMA_formatNumber($each_table['TABLE_ROWS'], 0) . $show_superscript; ?></td>
|
||||
<?php if (!($cfg['PropertiesNumColumns'] > 1)) { ?>
|
||||
<td nowrap="nowrap"><?php echo ($table_is_view ? $strView : $each_table['ENGINE']); ?></td>
|
||||
<?php if (isset($collation)) { ?>
|
||||
<td nowrap="nowrap"><?php echo $collation ?></td>
|
||||
<?php } ?>
|
||||
<?php } ?>
|
||||
|
||||
<?php if ($is_show_stats) { ?>
|
||||
<td class="value"><a
|
||||
href="tbl_structure.php?<?php echo $tbl_url_query; ?>#showusage"
|
||||
><?php echo $formatted_size . ' ' . $unit; ?></a></td>
|
||||
<td class="value"><?php echo $overhead; ?></td>
|
||||
<?php } // end if ?>
|
||||
<?php } elseif ($table_is_view) { ?>
|
||||
<td class="value">-</td>
|
||||
<td><?php echo $strView; ?></td>
|
||||
<td>---</td>
|
||||
<?php if ($is_show_stats) { ?>
|
||||
<td class="value">-</td>
|
||||
<td class="value">-</td>
|
||||
<?php } ?>
|
||||
<?php } else { ?>
|
||||
<td colspan="<?php echo ($structure_tbl_col_cnt - ($db_is_information_schema ? 5 : 8)) ?>"
|
||||
align="center">
|
||||
<?php echo $strInUse; ?></td>
|
||||
<?php } // end if (isset($each_table['TABLE_ROWS'])) else ?>
|
||||
</tr>
|
||||
<?php
|
||||
} // end foreach
|
||||
|
||||
// Show Summary
|
||||
if ($is_show_stats) {
|
||||
list($sum_formatted, $unit) = PMA_formatByteDown($sum_size, 3, 1);
|
||||
list($overhead_formatted, $overhead_unit) =
|
||||
PMA_formatByteDown($overhead_size, 3, 1);
|
||||
}
|
||||
?>
|
||||
</tbody>
|
||||
<tbody>
|
||||
<tr><td></td>
|
||||
<th align="center" nowrap="nowrap">
|
||||
<?php
|
||||
// for blobstreaming - if the number of tables is 0, set tableReductionCount to 0
|
||||
// (we don't want negative numbers here) - rajk
|
||||
if ($num_tables == 0)
|
||||
$tableReductionCount = 0;
|
||||
|
||||
echo sprintf($strTables, PMA_formatNumber($num_tables - $tableReductionCount, 0));
|
||||
?>
|
||||
</th>
|
||||
<th colspan="<?php echo ($db_is_information_schema ? 3 : 6) ?>" align="center">
|
||||
<?php echo $strSum; ?></th>
|
||||
<th class="value"><?php echo $sum_row_count_pre . PMA_formatNumber($sum_entries, 0); ?></th>
|
||||
<?php
|
||||
if (!($cfg['PropertiesNumColumns'] > 1)) {
|
||||
$default_engine = PMA_DBI_get_default_engine();
|
||||
echo ' <th align="center">' . "\n"
|
||||
. ' <dfn title="'
|
||||
. sprintf($strDefaultEngine, $default_engine) . '">' .$default_engine . '</dfn></th>' . "\n";
|
||||
// we got a case where $db_collation was empty
|
||||
echo ' <th align="center">' . "\n";
|
||||
if (! empty($db_collation)) {
|
||||
echo ' <dfn title="'
|
||||
. PMA_getCollationDescr($db_collation) . ' (' . $strDefault . ')">' . $db_collation
|
||||
. '</dfn>';
|
||||
}
|
||||
echo '</th>';
|
||||
}
|
||||
|
||||
if ($is_show_stats) {
|
||||
?>
|
||||
<th class="value"><?php echo $sum_formatted . ' ' . $unit; ?></th>
|
||||
<th class="value"><?php echo $overhead_formatted . ' ' . $overhead_unit; ?></th>
|
||||
<?php
|
||||
}
|
||||
?>
|
||||
</tr>
|
||||
</tbody>
|
||||
</table>
|
||||
|
||||
<div class="clearfloat">
|
||||
<?php
|
||||
// Check all tables url
|
||||
$checkall_url = 'db_structure.php?' . PMA_generate_common_url($db);
|
||||
?>
|
||||
<img class="selectallarrow" src="<?php echo $pmaThemeImage .'arrow_'.$text_dir.'.png'; ?>"
|
||||
width="38" height="22" alt="<?php echo $strWithChecked; ?>" />
|
||||
<a href="<?php echo $checkall_url; ?>&checkall=1"
|
||||
onclick="if (markAllRows('tablesForm')) return false;">
|
||||
<?php echo $strCheckAll; ?></a>
|
||||
/
|
||||
<a href="<?php echo $checkall_url; ?>"
|
||||
onclick="if (unMarkAllRows('tablesForm')) return false;">
|
||||
<?php echo $strUncheckAll; ?></a>
|
||||
<?php if ($overhead_check != '') { ?>
|
||||
/
|
||||
<a href="#" onclick="unMarkAllRows('tablesForm');
|
||||
<?php echo $overhead_check; ?> return false;">
|
||||
<?php echo $strCheckOverhead; ?></a>
|
||||
<?php } ?>
|
||||
|
||||
<select name="submit_mult" onchange="this.form.submit();" style="margin: 0 3em 0 3em;">
|
||||
<?php
|
||||
echo ' <option value="' . $strWithChecked . '" selected="selected">'
|
||||
. $strWithChecked . '</option>' . "\n";
|
||||
echo ' <option value="' . $strEmpty . '" >'
|
||||
. $strEmpty . '</option>' . "\n";
|
||||
echo ' <option value="' . $strDrop . '" >'
|
||||
. $strDrop . '</option>' . "\n";
|
||||
echo ' <option value="' . $strPrintView . '" >'
|
||||
. $strPrintView . '</option>' . "\n";
|
||||
echo ' <option value="' . $strCheckTable . '" >'
|
||||
. $strCheckTable . '</option>' . "\n";
|
||||
echo ' <option value="' . $strOptimizeTable . '" >'
|
||||
. $strOptimizeTable . '</option>' . "\n";
|
||||
echo ' <option value="' . $strRepairTable . '" >'
|
||||
. $strRepairTable . '</option>' . "\n";
|
||||
echo ' <option value="' . $strAnalyzeTable . '" >'
|
||||
. $strAnalyzeTable . '</option>' . "\n";
|
||||
?>
|
||||
</select>
|
||||
<script type="text/javascript">
|
||||
<!--
|
||||
// Fake js to allow the use of the <noscript> tag
|
||||
//-->
|
||||
</script>
|
||||
<noscript>
|
||||
<input type="submit" value="<?php echo $strGo; ?>" />
|
||||
</noscript>
|
||||
<?php echo implode("\n", $hidden_fields) . "\n"; ?>
|
||||
</div>
|
||||
</form>
|
||||
<?php
|
||||
// display again the table list navigator
|
||||
PMA_listNavigator($total_num_tables, $pos, $_url_params, 'db_structure.php', 'frame_content', $GLOBALS['cfg']['MaxTableList']);
|
||||
?>
|
||||
<hr />
|
||||
|
||||
<?php
|
||||
// Routines
|
||||
require './libraries/db_routines.inc.php';
|
||||
|
||||
// Events
|
||||
if (PMA_MYSQL_INT_VERSION > 50100) {
|
||||
require './libraries/db_events.inc.php';
|
||||
}
|
||||
|
||||
/**
|
||||
* Work on the database
|
||||
* redesigned 2004-05-08 by mkkeck
|
||||
*/
|
||||
/* DATABASE WORK */
|
||||
/* Printable view of a table */
|
||||
echo '<p>';
|
||||
echo '<a href="db_printview.php?' . $url_query . '">';
|
||||
if ($cfg['PropertiesIconic']) {
|
||||
echo '<img class="icon" src="' . $pmaThemeImage
|
||||
.'b_print.png" width="16" height="16" alt="" />';
|
||||
}
|
||||
echo $strPrintView . '</a> ';
|
||||
|
||||
echo '<a href="./db_datadict.php?' . $url_query . '">';
|
||||
if ($cfg['PropertiesIconic']) {
|
||||
echo '<img class="icon" src="' . $pmaThemeImage
|
||||
.'b_tblanalyse.png" width="16" height="16" alt="" />';
|
||||
}
|
||||
echo $strDataDict . '</a>';
|
||||
echo '</p>';
|
||||
|
||||
if (empty($db_is_information_schema)) {
|
||||
require './libraries/display_create_table.lib.php';
|
||||
} // end if (Create Table dialog)
|
||||
|
||||
/**
|
||||
* Displays the footer
|
||||
*/
|
||||
require_once './libraries/footer.inc.php';
|
||||
?>
|
277
docs.css
@@ -1,277 +0,0 @@
|
||||
/* $Id$ */
|
||||
/* Stylesheet for phpMyAdmin documentation */
|
||||
/* vim: expandtab ts=4 sw=4 sts=4 tw=78
|
||||
*/
|
||||
|
||||
body {
|
||||
background-color: #ffffff;
|
||||
font-family: sans-serif;
|
||||
color: #000000;
|
||||
margin: 0;
|
||||
padding: 2em 0 2em 0;
|
||||
}
|
||||
|
||||
img {
|
||||
border: 0;
|
||||
}
|
||||
|
||||
abbr, acronym {
|
||||
border-bottom: 1px dotted;
|
||||
}
|
||||
|
||||
abbr, acronym {
|
||||
cursor: help;
|
||||
}
|
||||
|
||||
a {
|
||||
text-decoration: none;
|
||||
color: #000099;
|
||||
background-color: #ffffff;
|
||||
/* font-weight: normal;*/
|
||||
}
|
||||
|
||||
a:hover {
|
||||
/* background-color: #99CCFF;*/
|
||||
color: #000099;
|
||||
background-color: #ffffff;
|
||||
text-decoration: underline;
|
||||
/* font-weight: bolder */
|
||||
}
|
||||
|
||||
sup {
|
||||
font-size: 0.7em;
|
||||
}
|
||||
|
||||
sup:before {
|
||||
content: ' [';
|
||||
}
|
||||
|
||||
sup:after {
|
||||
content: ']';
|
||||
}
|
||||
|
||||
|
||||
ul.header {
|
||||
width: 100%;
|
||||
background-color: #ddeeff;
|
||||
color: #000000;
|
||||
text-align: center;
|
||||
padding: 0 0 2px 0;
|
||||
border-bottom: 1px solid #000000;
|
||||
font-weight: bold;
|
||||
left: 0;
|
||||
top: 0;
|
||||
position: fixed;
|
||||
margin: 0;
|
||||
/* following MSIE hack was originally written by Riki Fridrich
|
||||
* <http://www.fczbkk.com> */
|
||||
/* position: expression("absolute");*/
|
||||
/* width: expression(document.body.clientWidth);*/
|
||||
/* top: expression(document.body.scrollTop + this.offsetHeight - this.offsetHeight);*/
|
||||
}
|
||||
|
||||
ul.header li {
|
||||
margin: 0;
|
||||
padding: 0;
|
||||
display: inline;
|
||||
}
|
||||
|
||||
ul.header li:before {
|
||||
content: ' - ';
|
||||
}
|
||||
ul.header li:first-child:before {
|
||||
content: '';
|
||||
}
|
||||
|
||||
ul.header a {
|
||||
text-decoration: none;
|
||||
font-size: medium;
|
||||
color: #000099;
|
||||
background-color: #ddeeff;
|
||||
font-weight: normal;
|
||||
}
|
||||
ul.header a:hover {
|
||||
color: #000099;
|
||||
background-color: #99CCFF;
|
||||
/* font-weight: bolder;*/
|
||||
}
|
||||
|
||||
h1 {
|
||||
text-align: center;
|
||||
padding-left: 8%;
|
||||
margin-top: 1em;
|
||||
color: #000000;
|
||||
background-color: #ddeeff;
|
||||
font-size: x-large;
|
||||
border-top: 1px solid #000000;
|
||||
border-bottom: 1px solid #000000;
|
||||
clear: both;
|
||||
}
|
||||
|
||||
h2 {
|
||||
padding-left: 8%;
|
||||
padding-top: 2em;
|
||||
margin-top: 1em;
|
||||
color: #000000;
|
||||
background-color: #ddeeff;
|
||||
font-size: large;
|
||||
border-top: 1px solid #000000;
|
||||
border-bottom: 1px solid #000000;
|
||||
clear: both;
|
||||
/* counter-reset: heading3;
|
||||
counter-increment: heading2; */
|
||||
}
|
||||
|
||||
/*h2:before {
|
||||
content: counter(heading2) '. ';
|
||||
} */
|
||||
|
||||
h3 {
|
||||
padding-left: 10%;
|
||||
padding-top: 3em;
|
||||
margin-top: 1em;
|
||||
color: #000000;
|
||||
background-color: #ddeeff;
|
||||
font-size: medium;
|
||||
border-top: 1px solid #000000;
|
||||
border-bottom: 1px solid #000000;
|
||||
clear: both;
|
||||
/* counter-reset: heading4;
|
||||
counter-increment: heading3; */
|
||||
}
|
||||
|
||||
/*h3:before {
|
||||
content: counter(heading2) '.' counter(heading3) '. ';
|
||||
} */
|
||||
|
||||
h4, h5 {
|
||||
padding: 3em 0 0 0;
|
||||
margin: 10px 5% 2px 5%;
|
||||
font-weight: bold;
|
||||
color: #000099;
|
||||
background-color: #ffffff;
|
||||
/* counter-increment: heading4; */
|
||||
}
|
||||
|
||||
/* h4:before {
|
||||
content: counter(heading2) '.' counter(heading3) '.' counter(heading4) '. ';
|
||||
}
|
||||
|
||||
h5 {
|
||||
counter-increment: heading5;
|
||||
}
|
||||
|
||||
h5:before {
|
||||
content: counter(heading2) '.' counter(heading3) '.' counter(heading4) counter(heading5,lower-alpha);
|
||||
} */
|
||||
|
||||
p {
|
||||
margin: 2px 5% 1em 5%;
|
||||
}
|
||||
|
||||
table {
|
||||
margin: 2px 5% 2px 5%;
|
||||
border: none;
|
||||
}
|
||||
|
||||
table tr,table td,table th {
|
||||
border: none;
|
||||
}
|
||||
|
||||
table.translators {
|
||||
text-align: center;
|
||||
display: table; margin-left: auto; margin-right: auto;
|
||||
border-collapse: collapse;
|
||||
}
|
||||
|
||||
table.translators th {
|
||||
color: #000000;
|
||||
background-color: #d3dce3;
|
||||
}
|
||||
|
||||
table.translators td, table.translators th {
|
||||
border: 1px solid #000000;
|
||||
padding: 5px;
|
||||
}
|
||||
|
||||
ul {
|
||||
margin: 2px 5% 2px 5%;
|
||||
}
|
||||
|
||||
pre {
|
||||
margin: 1em 5% 1em 5%;
|
||||
border: 1px solid silver;
|
||||
color: #000000;
|
||||
background-color: #eeeeee;
|
||||
padding: 0.5em;
|
||||
}
|
||||
|
||||
/* no more intend inside li */
|
||||
li pre {
|
||||
margin: 1em 0 1em 0;
|
||||
}
|
||||
|
||||
pre.wrap {
|
||||
white-space: normal;
|
||||
}
|
||||
|
||||
dl {
|
||||
margin: 1em 6% 1em 6%;
|
||||
}
|
||||
dt {
|
||||
font-weight: bold;
|
||||
margin-left: 2em;
|
||||
padding-top: 3em;
|
||||
}
|
||||
dd {
|
||||
margin-left: 4em;
|
||||
margin-bottom: 1em;
|
||||
}
|
||||
|
||||
ol {
|
||||
margin: 1em 6% 1em 6%;
|
||||
}
|
||||
|
||||
li {
|
||||
margin-bottom: 1em;
|
||||
}
|
||||
|
||||
.configrule {
|
||||
font-family: monospace;
|
||||
}
|
||||
|
||||
dt.configrule {
|
||||
font-weight: bold;
|
||||
}
|
||||
|
||||
.important {
|
||||
color: #bb0000;
|
||||
background-color: #ffeeee;
|
||||
padding: 0 0.5em 0 0.5em;
|
||||
}
|
||||
|
||||
p.important {
|
||||
border: 1px dotted #ff0000;
|
||||
padding: 0.5em;
|
||||
}
|
||||
|
||||
.important:first-word {
|
||||
font-weight: bold;
|
||||
}
|
||||
|
||||
p.footnote {
|
||||
margin: 0 5% 2px 7%;
|
||||
padding-top: 3em;
|
||||
}
|
||||
|
||||
p.footnote:first-line {
|
||||
margin-left: -2%;
|
||||
}
|
||||
|
||||
p#bottom {
|
||||
text-align: right;
|
||||
}
|
||||
|
||||
p#bottom img {
|
||||
margin: 1em;
|
||||
}
|
83
error.php
@@ -1,83 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* phpMyAdmin fatal error display page
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/* Input sanitizing */
|
||||
require_once './libraries/sanitizing.lib.php';
|
||||
|
||||
/* Get variables */
|
||||
if (! empty($_REQUEST['lang']) && is_string($_REQUEST['lang'])) {
|
||||
$lang = htmlspecialchars($_REQUEST['lang']);
|
||||
} else {
|
||||
$lang = 'en';
|
||||
}
|
||||
|
||||
if (! empty($_REQUEST['dir']) && is_string($_REQUEST['dir'])) {
|
||||
$dir = htmlspecialchars($_REQUEST['dir']);
|
||||
} else {
|
||||
$dir = 'ltr';
|
||||
}
|
||||
|
||||
if (! empty($_REQUEST['type']) && is_string($_REQUEST['type'])) {
|
||||
$type = htmlspecialchars($_REQUEST['type']);
|
||||
} else {
|
||||
$type = 'error';
|
||||
}
|
||||
|
||||
// force utf-8 to avoid XSS with crafted URL and utf-7 in charset parameter
|
||||
$charset = 'utf-8';
|
||||
|
||||
header('Content-Type: text/html; charset=' . $charset);
|
||||
?>
|
||||
<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd">
|
||||
<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="<?php echo $lang; ?>" dir="<?php echo $dir; ?>">
|
||||
<head>
|
||||
<link rel="icon" href="./favicon.ico" type="image/x-icon" />
|
||||
<link rel="shortcut icon" href="./favicon.ico" type="image/x-icon" />
|
||||
<title>phpMyAdmin</title>
|
||||
<meta http-equiv="Content-Type" content="text/html; charset=<?php echo $charset; ?>" />
|
||||
<style type="text/css">
|
||||
<!--
|
||||
html {
|
||||
padding: 0;
|
||||
margin: 0;
|
||||
}
|
||||
body {
|
||||
font-family: sans-serif;
|
||||
font-size: small;
|
||||
color: #000000;
|
||||
background-color: #F5F5F5;
|
||||
margin: 1em;
|
||||
}
|
||||
h1 {
|
||||
margin: 0;
|
||||
padding: 0.3em;
|
||||
font-size: 1.4em;
|
||||
font-weight: bold;
|
||||
color: #ffffff;
|
||||
background-color: #ff0000;
|
||||
}
|
||||
p {
|
||||
margin: 0;
|
||||
padding: 0.5em;
|
||||
border: 0.1em solid red;
|
||||
background-color: #ffeeee;
|
||||
}
|
||||
//-->
|
||||
</style>
|
||||
</head>
|
||||
<body>
|
||||
<h1>phpMyAdmin - <?php echo $type; ?></h1>
|
||||
<p><?php
|
||||
if (function_exists('get_magic_quotes_gpc') && get_magic_quotes_gpc()) {
|
||||
echo PMA_sanitize(stripslashes($_REQUEST['error']));
|
||||
} else {
|
||||
echo PMA_sanitize($_REQUEST['error']);
|
||||
}
|
||||
?></p>
|
||||
</body>
|
||||
</html>
|
676
export.php
@@ -1,676 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* @todo too much die here, or?
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
* Get the variables sent or posted to this script and a core script
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
require_once './libraries/zip.lib.php';
|
||||
require_once './libraries/plugin_interface.lib.php';
|
||||
|
||||
PMA_checkParameters(array('what', 'export_type'));
|
||||
|
||||
// Scan plugins
|
||||
$export_list = PMA_getPlugins('./libraries/export/', array('export_type' => $export_type, 'single_table' => isset($single_table)));
|
||||
|
||||
// Backward compatbility
|
||||
$type = $what;
|
||||
|
||||
// Check export type
|
||||
if (!isset($export_list[$type])) {
|
||||
die('Bad type!');
|
||||
}
|
||||
|
||||
/**
|
||||
* valid compression methods
|
||||
*/
|
||||
$compression_methods = array(
|
||||
'zip',
|
||||
'gzip',
|
||||
'bzip',
|
||||
);
|
||||
|
||||
/**
|
||||
* init and variable checking
|
||||
*/
|
||||
$compression = false;
|
||||
$onserver = false;
|
||||
$save_on_server = false;
|
||||
$buffer_needed = false;
|
||||
if (empty($_REQUEST['asfile'])) {
|
||||
$asfile = false;
|
||||
} else {
|
||||
$asfile = true;
|
||||
if (in_array($_REQUEST['compression'], $compression_methods)) {
|
||||
$compression = $_REQUEST['compression'];
|
||||
$buffer_needed = true;
|
||||
}
|
||||
if (!empty($_REQUEST['onserver'])) {
|
||||
$onserver = $_REQUEST['onserver'];
|
||||
// Will we save dump on server?
|
||||
$save_on_server = ! empty($cfg['SaveDir']) && $onserver;
|
||||
}
|
||||
}
|
||||
|
||||
// Does export require to be into file?
|
||||
if (isset($export_list[$type]['force_file']) && ! $asfile) {
|
||||
$message = PMA_Message::error('strExportMustBeFile');
|
||||
$GLOBALS['js_include'][] = 'functions.js';
|
||||
require_once './libraries/header.inc.php';
|
||||
if ($export_type == 'server') {
|
||||
$active_page = 'server_export.php';
|
||||
require './server_export.php';
|
||||
} elseif ($export_type == 'database') {
|
||||
$active_page = 'db_export.php';
|
||||
require './db_export.php';
|
||||
} else {
|
||||
$active_page = 'tbl_export.php';
|
||||
require './tbl_export.php';
|
||||
}
|
||||
exit();
|
||||
}
|
||||
|
||||
// Generate error url and check for needed variables
|
||||
if ($export_type == 'server') {
|
||||
$err_url = 'server_export.php?' . PMA_generate_common_url();
|
||||
} elseif ($export_type == 'database' && strlen($db)) {
|
||||
$err_url = 'db_export.php?' . PMA_generate_common_url($db);
|
||||
// Check if we have something to export
|
||||
if (isset($table_select)) {
|
||||
$tables = $table_select;
|
||||
} else {
|
||||
$tables = array();
|
||||
}
|
||||
} elseif ($export_type == 'table' && strlen($db) && strlen($table)) {
|
||||
$err_url = 'tbl_export.php?' . PMA_generate_common_url($db, $table);
|
||||
} else {
|
||||
die('Bad parameters!');
|
||||
}
|
||||
|
||||
// Get the functions specific to the export type
|
||||
require './libraries/export/' . PMA_securePath($type) . '.php';
|
||||
|
||||
/**
|
||||
* Increase time limit for script execution and initializes some variables
|
||||
*/
|
||||
@set_time_limit($cfg['ExecTimeLimit']);
|
||||
if (!empty($cfg['MemoryLimit'])) {
|
||||
@ini_set('memory_limit', $cfg['MemoryLimit']);
|
||||
}
|
||||
|
||||
// Start with empty buffer
|
||||
$dump_buffer = '';
|
||||
$dump_buffer_len = 0;
|
||||
|
||||
// We send fake headers to avoid browser timeout when buffering
|
||||
$time_start = time();
|
||||
|
||||
|
||||
/**
|
||||
* Output handler for all exports, if needed buffering, it stores data into
|
||||
* $dump_buffer, otherwise it prints thems out.
|
||||
*
|
||||
* @param string the insert statement
|
||||
*
|
||||
* @return bool Whether output suceeded
|
||||
*/
|
||||
function PMA_exportOutputHandler($line)
|
||||
{
|
||||
global $time_start, $dump_buffer, $dump_buffer_len, $save_filename;
|
||||
|
||||
// Kanji encoding convert feature
|
||||
if ($GLOBALS['output_kanji_conversion']) {
|
||||
$line = PMA_kanji_str_conv($line, $GLOBALS['knjenc'], isset($GLOBALS['xkana']) ? $GLOBALS['xkana'] : '');
|
||||
}
|
||||
// If we have to buffer data, we will perform everything at once at the end
|
||||
if ($GLOBALS['buffer_needed']) {
|
||||
|
||||
$dump_buffer .= $line;
|
||||
if ($GLOBALS['onfly_compression']) {
|
||||
|
||||
$dump_buffer_len += strlen($line);
|
||||
|
||||
if ($dump_buffer_len > $GLOBALS['memory_limit']) {
|
||||
if ($GLOBALS['output_charset_conversion']) {
|
||||
$dump_buffer = PMA_convert_string($GLOBALS['charset'], $GLOBALS['charset_of_file'], $dump_buffer);
|
||||
}
|
||||
// as bzipped
|
||||
if ($GLOBALS['compression'] == 'bzip' && @function_exists('bzcompress')) {
|
||||
$dump_buffer = bzcompress($dump_buffer);
|
||||
}
|
||||
// as a gzipped file
|
||||
elseif ($GLOBALS['compression'] == 'gzip' && @function_exists('gzencode')) {
|
||||
// without the optional parameter level because it bug
|
||||
$dump_buffer = gzencode($dump_buffer);
|
||||
}
|
||||
if ($GLOBALS['save_on_server']) {
|
||||
$write_result = @fwrite($GLOBALS['file_handle'], $dump_buffer);
|
||||
if (!$write_result || ($write_result != strlen($dump_buffer))) {
|
||||
$GLOBALS['message'] = PMA_Message::error('strNoSpace');
|
||||
$GLOBALS['message']->addParam($save_filename);
|
||||
return false;
|
||||
}
|
||||
} else {
|
||||
echo $dump_buffer;
|
||||
}
|
||||
$dump_buffer = '';
|
||||
$dump_buffer_len = 0;
|
||||
}
|
||||
} else {
|
||||
$time_now = time();
|
||||
if ($time_start >= $time_now + 30) {
|
||||
$time_start = $time_now;
|
||||
header('X-pmaPing: Pong');
|
||||
} // end if
|
||||
}
|
||||
} else {
|
||||
if ($GLOBALS['asfile']) {
|
||||
if ($GLOBALS['output_charset_conversion']) {
|
||||
$line = PMA_convert_string($GLOBALS['charset'], $GLOBALS['charset_of_file'], $line);
|
||||
}
|
||||
if ($GLOBALS['save_on_server'] && strlen($line) > 0) {
|
||||
$write_result = @fwrite($GLOBALS['file_handle'], $line);
|
||||
if (!$write_result || ($write_result != strlen($line))) {
|
||||
$GLOBALS['message'] = PMA_Message::error('strNoSpace');
|
||||
$GLOBALS['message']->addParam($save_filename);
|
||||
return false;
|
||||
}
|
||||
$time_now = time();
|
||||
if ($time_start >= $time_now + 30) {
|
||||
$time_start = $time_now;
|
||||
header('X-pmaPing: Pong');
|
||||
} // end if
|
||||
} else {
|
||||
// We export as file - output normally
|
||||
echo $line;
|
||||
}
|
||||
} else {
|
||||
// We export as html - replace special chars
|
||||
echo htmlspecialchars($line);
|
||||
}
|
||||
}
|
||||
return true;
|
||||
} // end of the 'PMA_exportOutputHandler()' function
|
||||
|
||||
// Defines the default <CR><LF> format. For SQL always use \n as MySQL wants this on all platforms.
|
||||
if ($what == 'sql') {
|
||||
$crlf = "\n";
|
||||
} else {
|
||||
$crlf = PMA_whichCrlf();
|
||||
}
|
||||
|
||||
$output_kanji_conversion = function_exists('PMA_kanji_str_conv') && $type != 'xls';
|
||||
|
||||
// Do we need to convert charset?
|
||||
$output_charset_conversion = $asfile && $cfg['AllowAnywhereRecoding']
|
||||
&& isset($charset_of_file) && $charset_of_file != $charset
|
||||
&& $type != 'xls';
|
||||
|
||||
// Use on the fly compression?
|
||||
$onfly_compression = $GLOBALS['cfg']['CompressOnFly'] && ($compression == 'gzip' || $compression == 'bzip');
|
||||
if ($onfly_compression) {
|
||||
$memory_limit = trim(@ini_get('memory_limit'));
|
||||
// 2 MB as default
|
||||
if (empty($memory_limit)) {
|
||||
$memory_limit = 2 * 1024 * 1024;
|
||||
}
|
||||
|
||||
if (strtolower(substr($memory_limit, -1)) == 'm') {
|
||||
$memory_limit = (int)substr($memory_limit, 0, -1) * 1024 * 1024;
|
||||
} elseif (strtolower(substr($memory_limit, -1)) == 'k') {
|
||||
$memory_limit = (int)substr($memory_limit, 0, -1) * 1024;
|
||||
} elseif (strtolower(substr($memory_limit, -1)) == 'g') {
|
||||
$memory_limit = (int)substr($memory_limit, 0, -1) * 1024 * 1024 * 1024;
|
||||
} else {
|
||||
$memory_limit = (int)$memory_limit;
|
||||
}
|
||||
|
||||
// Some of memory is needed for other thins and as treshold.
|
||||
// Nijel: During export I had allocated (see memory_get_usage function)
|
||||
// approx 1.2MB so this comes from that.
|
||||
if ($memory_limit > 1500000) {
|
||||
$memory_limit -= 1500000;
|
||||
}
|
||||
|
||||
// Some memory is needed for compression, assume 1/3
|
||||
$memory_limit /= 8;
|
||||
}
|
||||
|
||||
// Generate filename and mime type if needed
|
||||
if ($asfile) {
|
||||
$pma_uri_parts = parse_url($cfg['PmaAbsoluteUri']);
|
||||
if ($export_type == 'server') {
|
||||
if (isset($remember_template)) {
|
||||
PMA_setCookie('pma_server_filename_template', $filename_template);
|
||||
}
|
||||
$filename = str_replace('__SERVER__', $GLOBALS['cfg']['Server']['host'], strftime($filename_template));
|
||||
} elseif ($export_type == 'database') {
|
||||
if (isset($remember_template)) {
|
||||
PMA_setCookie('pma_db_filename_template', $filename_template);
|
||||
}
|
||||
$filename = str_replace('__DB__', $db, str_replace('__SERVER__', $GLOBALS['cfg']['Server']['host'], strftime($filename_template)));
|
||||
} else {
|
||||
if (isset($remember_template)) {
|
||||
PMA_setCookie('pma_table_filename_template', $filename_template);
|
||||
}
|
||||
$filename = str_replace('__TABLE__', $table, str_replace('__DB__', $db, str_replace('__SERVER__', $GLOBALS['cfg']['Server']['host'], strftime($filename_template))));
|
||||
}
|
||||
|
||||
// convert filename to iso-8859-1, it is safer
|
||||
if (!(isset($cfg['AllowAnywhereRecoding']) && $cfg['AllowAnywhereRecoding'] )) {
|
||||
$filename = PMA_convert_string($charset, 'iso-8859-1', $filename);
|
||||
} else {
|
||||
$filename = PMA_convert_string($convcharset, 'iso-8859-1', $filename);
|
||||
}
|
||||
|
||||
// Grab basic dump extension and mime type
|
||||
$filename .= '.' . $export_list[$type]['extension'];
|
||||
$mime_type = $export_list[$type]['mime_type'];
|
||||
|
||||
// If dump is going to be compressed, set correct encoding or mime_type and add
|
||||
// compression to extension
|
||||
$content_encoding = '';
|
||||
if ($compression == 'bzip') {
|
||||
$filename .= '.bz2';
|
||||
// browsers don't like this:
|
||||
//$content_encoding = 'x-bzip2';
|
||||
$mime_type = 'application/x-bzip2';
|
||||
} elseif ($compression == 'gzip') {
|
||||
$filename .= '.gz';
|
||||
// Needed to avoid recompression by server modules like mod_gzip.
|
||||
// It seems necessary to check about zlib.output_compression
|
||||
// to avoid compressing twice
|
||||
if (!@ini_get('zlib.output_compression')) {
|
||||
// On Firefox 3, sending this content encoding corrupts the .gz
|
||||
// (as tested on Windows and Linux) but detect GECKO 1.9
|
||||
if (! (PMA_USR_BROWSER_AGENT == 'GECKO' && PMA_USR_BROWSER_VER == '1.9')) {
|
||||
$content_encoding = 'x-gzip';
|
||||
}
|
||||
$mime_type = 'application/x-gzip';
|
||||
}
|
||||
} elseif ($compression == 'zip') {
|
||||
$filename .= '.zip';
|
||||
$mime_type = 'application/zip';
|
||||
}
|
||||
}
|
||||
|
||||
// Open file on server if needed
|
||||
if ($save_on_server) {
|
||||
$save_filename = PMA_userDir($cfg['SaveDir']) . preg_replace('@[/\\\\]@', '_', $filename);
|
||||
unset($message);
|
||||
if (file_exists($save_filename) && empty($onserverover)) {
|
||||
$message = PMA_Message::error('strFileAlreadyExists');
|
||||
$message->addParam($save_filename);
|
||||
} else {
|
||||
if (is_file($save_filename) && !is_writable($save_filename)) {
|
||||
$message = PMA_Message::error('strNoPermission');
|
||||
$message->addParam($save_filename);
|
||||
} else {
|
||||
if (!$file_handle = @fopen($save_filename, 'w')) {
|
||||
$message = PMA_Message::error('strNoPermission');
|
||||
$message->addParam($save_filename);
|
||||
}
|
||||
}
|
||||
}
|
||||
if (isset($message)) {
|
||||
$GLOBALS['js_include'][] = 'functions.js';
|
||||
require_once './libraries/header.inc.php';
|
||||
if ($export_type == 'server') {
|
||||
$active_page = 'server_export.php';
|
||||
require './server_export.php';
|
||||
} elseif ($export_type == 'database') {
|
||||
$active_page = 'db_export.php';
|
||||
require './db_export.php';
|
||||
} else {
|
||||
$active_page = 'tbl_export.php';
|
||||
require './tbl_export.php';
|
||||
}
|
||||
exit();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Send headers depending on whether the user chose to download a dump file
|
||||
* or not
|
||||
*/
|
||||
if (!$save_on_server) {
|
||||
if ($asfile) {
|
||||
// Download
|
||||
// (avoid rewriting data containing HTML with anchors and forms;
|
||||
// this was reported to happen under Plesk)
|
||||
@ini_set('url_rewriter.tags','');
|
||||
|
||||
if (!empty($content_encoding)) {
|
||||
header('Content-Encoding: ' . $content_encoding);
|
||||
}
|
||||
header('Content-Type: ' . $mime_type);
|
||||
header('Expires: ' . gmdate('D, d M Y H:i:s') . ' GMT');
|
||||
// lem9: Tested behavior of
|
||||
// IE 5.50.4807.2300
|
||||
// IE 6.0.2800.1106 (small glitch, asks twice when I click Open)
|
||||
// IE 6.0.2900.2180
|
||||
// Firefox 1.0.6
|
||||
// in http and https
|
||||
header('Content-Disposition: attachment; filename="' . $filename . '"');
|
||||
if (PMA_USR_BROWSER_AGENT == 'IE') {
|
||||
header('Cache-Control: must-revalidate, post-check=0, pre-check=0');
|
||||
header('Pragma: public');
|
||||
} else {
|
||||
header('Pragma: no-cache');
|
||||
// test case: exporting a database into a .gz file with Safari
|
||||
// would produce files not having the current time
|
||||
// (added this header for Safari but should not harm other browsers)
|
||||
header('Last-Modified: ' . gmdate('D, d M Y H:i:s') . ' GMT');
|
||||
}
|
||||
} else {
|
||||
// HTML
|
||||
if ($export_type == 'database') {
|
||||
$num_tables = count($tables);
|
||||
if ($num_tables == 0) {
|
||||
$message = PMA_Message::error('strNoTablesFound');
|
||||
$GLOBALS['js_include'][] = 'functions.js';
|
||||
require_once './libraries/header.inc.php';
|
||||
$active_page = 'db_export.php';
|
||||
require './db_export.php';
|
||||
exit();
|
||||
}
|
||||
}
|
||||
$backup_cfgServer = $cfg['Server'];
|
||||
require_once './libraries/header.inc.php';
|
||||
$cfg['Server'] = $backup_cfgServer;
|
||||
unset($backup_cfgServer);
|
||||
echo "\n" . '<div align="' . $cell_align_left . '">' . "\n";
|
||||
//echo ' <pre>' . "\n";
|
||||
echo ' <form name="nofunction">' . "\n"
|
||||
// remove auto-select for now: there is no way to select
|
||||
// only a part of the text; anyway, it should obey
|
||||
// $cfg['TextareaAutoSelect']
|
||||
//. ' <textarea name="sqldump" cols="50" rows="30" onclick="this.select();" id="textSQLDUMP" wrap="OFF">' . "\n";
|
||||
. ' <textarea name="sqldump" cols="50" rows="30" id="textSQLDUMP" wrap="OFF">' . "\n";
|
||||
} // end download
|
||||
}
|
||||
|
||||
// Fake loop just to allow skip of remain of this code by break, I'd really
|
||||
// need exceptions here :-)
|
||||
do {
|
||||
|
||||
// Add possibly some comments to export
|
||||
if (!PMA_exportHeader()) {
|
||||
break;
|
||||
}
|
||||
|
||||
// Will we need relation & co. setup?
|
||||
$do_relation = isset($GLOBALS[$what . '_relation']);
|
||||
$do_comments = isset($GLOBALS[$what . '_comments']);
|
||||
$do_mime = isset($GLOBALS[$what . '_mime']);
|
||||
if ($do_relation || $do_comments || $do_mime) {
|
||||
require_once './libraries/relation.lib.php';
|
||||
$cfgRelation = PMA_getRelationsParam();
|
||||
}
|
||||
if ($do_mime) {
|
||||
require_once './libraries/transformations.lib.php';
|
||||
}
|
||||
|
||||
// Include dates in export?
|
||||
$do_dates = isset($GLOBALS[$what . '_dates']);
|
||||
|
||||
/**
|
||||
* Builds the dump
|
||||
*/
|
||||
// Gets the number of tables if a dump of a database has been required
|
||||
if ($export_type == 'server') {
|
||||
if (isset($db_select)) {
|
||||
$tmp_select = implode($db_select, '|');
|
||||
$tmp_select = '|' . $tmp_select . '|';
|
||||
}
|
||||
// Walk over databases
|
||||
foreach ($GLOBALS['pma']->databases as $current_db) {
|
||||
if ((isset($tmp_select) && strpos(' ' . $tmp_select, '|' . $current_db . '|'))
|
||||
|| !isset($tmp_select)) {
|
||||
if (!PMA_exportDBHeader($current_db)) {
|
||||
break 2;
|
||||
}
|
||||
if (!PMA_exportDBCreate($current_db)) {
|
||||
break 2;
|
||||
}
|
||||
$tables = PMA_DBI_get_tables($current_db);
|
||||
$views = array();
|
||||
foreach ($tables as $table) {
|
||||
// if this is a view, collect it for later; views must be exported
|
||||
// after the tables
|
||||
$is_view = PMA_Table::isView($current_db, $table);
|
||||
if ($is_view) {
|
||||
$views[] = $table;
|
||||
}
|
||||
if (isset($GLOBALS[$what . '_structure'])) {
|
||||
// for a view, export a stand-in definition of the table
|
||||
// to resolve view dependencies
|
||||
if (!PMA_exportStructure($current_db, $table, $crlf, $err_url, $do_relation, $do_comments, $do_mime, $do_dates, $is_view ? 'stand_in' : 'create_table', $export_type)) {
|
||||
break 3;
|
||||
}
|
||||
}
|
||||
if (isset($GLOBALS[$what . '_data']) && ! $is_view) {
|
||||
$local_query = 'SELECT * FROM ' . PMA_backquote($current_db) . '.' . PMA_backquote($table);
|
||||
if (!PMA_exportData($current_db, $table, $crlf, $err_url, $local_query)) {
|
||||
break 3;
|
||||
}
|
||||
}
|
||||
}
|
||||
foreach($views as $view) {
|
||||
// no data export for a view
|
||||
if (isset($GLOBALS[$what . '_structure'])) {
|
||||
if (!PMA_exportStructure($current_db, $view, $crlf, $err_url, $do_relation, $do_comments, $do_mime, $do_dates, 'create_view', $export_type)) {
|
||||
break 3;
|
||||
}
|
||||
}
|
||||
}
|
||||
if (!PMA_exportDBFooter($current_db)) {
|
||||
break 2;
|
||||
}
|
||||
}
|
||||
}
|
||||
} elseif ($export_type == 'database') {
|
||||
if (!PMA_exportDBHeader($db)) {
|
||||
break;
|
||||
}
|
||||
$i = 0;
|
||||
$views = array();
|
||||
// $tables contains the choices from the user (via $table_select)
|
||||
foreach ($tables as $table) {
|
||||
// if this is a view, collect it for later; views must be exported after
|
||||
// the tables
|
||||
$is_view = PMA_Table::isView($db, $table);
|
||||
if ($is_view) {
|
||||
$views[] = $table;
|
||||
}
|
||||
if (isset($GLOBALS[$what . '_structure'])) {
|
||||
// for a view, export a stand-in definition of the table
|
||||
// to resolve view dependencies
|
||||
if (!PMA_exportStructure($db, $table, $crlf, $err_url, $do_relation, $do_comments, $do_mime, $do_dates, $is_view ? 'stand_in' : 'create_table', $export_type)) {
|
||||
break 2;
|
||||
}
|
||||
}
|
||||
if (isset($GLOBALS[$what . '_data']) && ! $is_view) {
|
||||
$local_query = 'SELECT * FROM ' . PMA_backquote($db) . '.' . PMA_backquote($table);
|
||||
if (!PMA_exportData($db, $table, $crlf, $err_url, $local_query)) {
|
||||
break 2;
|
||||
}
|
||||
}
|
||||
}
|
||||
foreach ($views as $view) {
|
||||
// no data export for a view
|
||||
if (isset($GLOBALS[$what . '_structure'])) {
|
||||
if (!PMA_exportStructure($db, $view, $crlf, $err_url, $do_relation, $do_comments, $do_mime, $do_dates, 'create_view', $export_type)) {
|
||||
break 2;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if (!PMA_exportDBFooter($db)) {
|
||||
break;
|
||||
}
|
||||
} else {
|
||||
if (!PMA_exportDBHeader($db)) {
|
||||
break;
|
||||
}
|
||||
// We export just one table
|
||||
|
||||
if ($limit_to > 0 && $limit_from >= 0) {
|
||||
$add_query = ' LIMIT '
|
||||
. (($limit_from > 0) ? $limit_from . ', ' : '')
|
||||
. $limit_to;
|
||||
} else {
|
||||
$add_query = '';
|
||||
}
|
||||
|
||||
$is_view = PMA_Table::isView($db, $table);
|
||||
if (isset($GLOBALS[$what . '_structure'])) {
|
||||
if (!PMA_exportStructure($db, $table, $crlf, $err_url, $do_relation, $do_comments, $do_mime, $do_dates, $is_view ? 'create_view' : 'create_table', $export_type)) {
|
||||
break;
|
||||
}
|
||||
}
|
||||
// If this is an export of a single view, we have to export data;
|
||||
// for example, a PDF report
|
||||
if (isset($GLOBALS[$what . '_data'])) {
|
||||
if (!empty($sql_query)) {
|
||||
// only preg_replace if needed
|
||||
if (!empty($add_query)) {
|
||||
// remove trailing semicolon before adding a LIMIT
|
||||
$sql_query = preg_replace('%;\s*$%', '', $sql_query);
|
||||
}
|
||||
$local_query = $sql_query . $add_query;
|
||||
PMA_DBI_select_db($db);
|
||||
} else {
|
||||
$local_query = 'SELECT * FROM ' . PMA_backquote($db) . '.' . PMA_backquote($table) . $add_query;
|
||||
}
|
||||
if (!PMA_exportData($db, $table, $crlf, $err_url, $local_query)) {
|
||||
break;
|
||||
}
|
||||
}
|
||||
if (!PMA_exportDBFooter($db)) {
|
||||
break;
|
||||
}
|
||||
}
|
||||
if (!PMA_exportFooter()) {
|
||||
break;
|
||||
}
|
||||
|
||||
} while (false);
|
||||
// End of fake loop
|
||||
|
||||
if ($save_on_server && isset($message)) {
|
||||
$GLOBALS['js_include'][] = 'functions.js';
|
||||
require_once './libraries/header.inc.php';
|
||||
if ($export_type == 'server') {
|
||||
$active_page = 'server_export.php';
|
||||
require './server_export.php';
|
||||
} elseif ($export_type == 'database') {
|
||||
$active_page = 'db_export.php';
|
||||
require './db_export.php';
|
||||
} else {
|
||||
$active_page = 'tbl_export.php';
|
||||
require './tbl_export.php';
|
||||
}
|
||||
exit();
|
||||
}
|
||||
|
||||
/**
|
||||
* Send the dump as a file...
|
||||
*/
|
||||
if (!empty($asfile)) {
|
||||
// Convert the charset if required.
|
||||
if ($output_charset_conversion) {
|
||||
$dump_buffer = PMA_convert_string($GLOBALS['charset'], $GLOBALS['charset_of_file'], $dump_buffer);
|
||||
}
|
||||
|
||||
// Do the compression
|
||||
// 1. as a zipped file
|
||||
if ($compression == 'zip') {
|
||||
if (@function_exists('gzcompress')) {
|
||||
$zipfile = new zipfile();
|
||||
$zipfile -> addFile($dump_buffer, substr($filename, 0, -4));
|
||||
$dump_buffer = $zipfile -> file();
|
||||
}
|
||||
}
|
||||
// 2. as a bzipped file
|
||||
elseif ($compression == 'bzip') {
|
||||
if (@function_exists('bzcompress')) {
|
||||
$dump_buffer = bzcompress($dump_buffer);
|
||||
}
|
||||
}
|
||||
// 3. as a gzipped file
|
||||
elseif ($compression == 'gzip') {
|
||||
if (@function_exists('gzencode')) {
|
||||
// without the optional parameter level because it bug
|
||||
$dump_buffer = gzencode($dump_buffer);
|
||||
}
|
||||
}
|
||||
|
||||
/* If ve saved on server, we have to close file now */
|
||||
if ($save_on_server) {
|
||||
$write_result = @fwrite($file_handle, $dump_buffer);
|
||||
fclose($file_handle);
|
||||
if (strlen($dump_buffer) !=0 && (!$write_result || ($write_result != strlen($dump_buffer)))) {
|
||||
$message = new PMA_Message('strNoSpace', PMA_Message::ERROR, $save_filename);
|
||||
} else {
|
||||
$message = new PMA_Message('strDumpSaved', PMA_Message::SUCCESS, $save_filename);
|
||||
}
|
||||
|
||||
$GLOBALS['js_include'][] = 'functions.js';
|
||||
require_once './libraries/header.inc.php';
|
||||
if ($export_type == 'server') {
|
||||
$active_page = 'server_export.php';
|
||||
require_once './server_export.php';
|
||||
} elseif ($export_type == 'database') {
|
||||
$active_page = 'db_export.php';
|
||||
require_once './db_export.php';
|
||||
} else {
|
||||
$active_page = 'tbl_export.php';
|
||||
require_once './tbl_export.php';
|
||||
}
|
||||
exit();
|
||||
} else {
|
||||
echo $dump_buffer;
|
||||
}
|
||||
}
|
||||
/**
|
||||
* Displays the dump...
|
||||
*/
|
||||
else {
|
||||
/**
|
||||
* Close the html tags and add the footers in dump is displayed on screen
|
||||
*/
|
||||
//echo ' </pre>' . "\n";
|
||||
echo '</textarea>' . "\n"
|
||||
. ' </form>' . "\n";
|
||||
echo '</div>' . "\n";
|
||||
echo "\n";
|
||||
?>
|
||||
<script type="text/javascript">
|
||||
//<![CDATA[
|
||||
var bodyWidth=null; var bodyHeight=null;
|
||||
if (document.getElementById('textSQLDUMP')) {
|
||||
bodyWidth = self.innerWidth;
|
||||
bodyHeight = self.innerHeight;
|
||||
if (!bodyWidth && !bodyHeight) {
|
||||
if (document.compatMode && document.compatMode == "BackCompat") {
|
||||
bodyWidth = document.body.clientWidth;
|
||||
bodyHeight = document.body.clientHeight;
|
||||
} else if (document.compatMode && document.compatMode == "CSS1Compat") {
|
||||
bodyWidth = document.documentElement.clientWidth;
|
||||
bodyHeight = document.documentElement.clientHeight;
|
||||
}
|
||||
}
|
||||
document.getElementById('textSQLDUMP').style.width=(bodyWidth-50) + 'px';
|
||||
document.getElementById('textSQLDUMP').style.height=(bodyHeight-100) + 'px';
|
||||
}
|
||||
//]]>
|
||||
</script>
|
||||
<?php
|
||||
require_once './libraries/footer.inc.php';
|
||||
} // end if
|
||||
?>
|
BIN
favicon.ico
Before Width: | Height: | Size: 18 KiB |
412
import.php
@@ -1,412 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* Core script for import, this is just the glue around all other stuff
|
||||
*
|
||||
* @uses PMA_Bookmark_getList()
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
* Get the variables sent or posted to this script and a core script
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
$GLOBALS['js_include'][] = 'functions.js';
|
||||
|
||||
// default values
|
||||
$GLOBALS['reload'] = false;
|
||||
|
||||
// Are we just executing plain query or sql file? (eg. non import, but query box/window run)
|
||||
if (!empty($sql_query)) {
|
||||
// run SQL query
|
||||
$import_text = $sql_query;
|
||||
$import_type = 'query';
|
||||
$format = 'sql';
|
||||
|
||||
// refresh left frame on changes in table or db structure
|
||||
if (preg_match('/^(CREATE|ALTER|DROP)\s+(VIEW|TABLE|DATABASE|SCHEMA)\s+/i', $sql_query)) {
|
||||
$GLOBALS['reload'] = true;
|
||||
}
|
||||
|
||||
$sql_query = '';
|
||||
} elseif (!empty($sql_localfile)) {
|
||||
// run SQL file on server
|
||||
$local_import_file = $sql_localfile;
|
||||
$import_type = 'queryfile';
|
||||
$format = 'sql';
|
||||
unset($sql_localfile);
|
||||
} elseif (!empty($sql_file)) {
|
||||
// run uploaded SQL file
|
||||
$import_file = $sql_file;
|
||||
$import_type = 'queryfile';
|
||||
$format = 'sql';
|
||||
unset($sql_file);
|
||||
} elseif (!empty($id_bookmark)) {
|
||||
// run bookmark
|
||||
$import_type = 'query';
|
||||
$format = 'sql';
|
||||
}
|
||||
|
||||
// If we didn't get any parameters, either user called this directly, or
|
||||
// upload limit has been reached, let's assume the second possibility.
|
||||
if ($_POST == array() && $_GET == array()) {
|
||||
require_once './libraries/header.inc.php';
|
||||
$message = PMA_Message::error('strUploadLimit');
|
||||
$message->addParam('[a@./Documentation.html#faq1_16@_blank]');
|
||||
$message->addParam('[/a]');
|
||||
$message->display();
|
||||
require './libraries/footer.inc.php';
|
||||
}
|
||||
|
||||
// Check needed parameters
|
||||
PMA_checkParameters(array('import_type', 'format'));
|
||||
|
||||
// We don't want anything special in format
|
||||
$format = PMA_securePath($format);
|
||||
|
||||
// Import functions
|
||||
require_once './libraries/import.lib.php';
|
||||
|
||||
// Create error and goto url
|
||||
if ($import_type == 'table') {
|
||||
$err_url = 'tbl_import.php?' . PMA_generate_common_url($db, $table);
|
||||
$goto = 'tbl_import.php';
|
||||
} elseif ($import_type == 'database') {
|
||||
$err_url = 'db_import.php?' . PMA_generate_common_url($db);
|
||||
$goto = 'db_import.php';
|
||||
} elseif ($import_type == 'server') {
|
||||
$err_url = 'server_import.php?' . PMA_generate_common_url();
|
||||
$goto = 'server_import.php';
|
||||
} else {
|
||||
if (empty($goto) || !preg_match('@^(server|db|tbl)(_[a-z]*)*\.php$@i', $goto)) {
|
||||
if (strlen($table) && strlen($db)) {
|
||||
$goto = 'tbl_structure.php';
|
||||
} elseif (strlen($db)) {
|
||||
$goto = 'db_structure.php';
|
||||
} else {
|
||||
$goto = 'server_sql.php';
|
||||
}
|
||||
}
|
||||
if (strlen($table) && strlen($db)) {
|
||||
$common = PMA_generate_common_url($db, $table);
|
||||
} elseif (strlen($db)) {
|
||||
$common = PMA_generate_common_url($db);
|
||||
} else {
|
||||
$common = PMA_generate_common_url();
|
||||
}
|
||||
$err_url = $goto
|
||||
. '?' . $common
|
||||
. (preg_match('@^tbl_[a-z]*\.php$@', $goto) ? '&table=' . urlencode($table) : '');
|
||||
}
|
||||
|
||||
|
||||
if (strlen($db)) {
|
||||
PMA_DBI_select_db($db);
|
||||
}
|
||||
|
||||
@set_time_limit($cfg['ExecTimeLimit']);
|
||||
if (!empty($cfg['MemoryLimit'])) {
|
||||
@ini_set('memory_limit', $cfg['MemoryLimit']);
|
||||
}
|
||||
|
||||
$timestamp = time();
|
||||
if (isset($allow_interrupt)) {
|
||||
$maximum_time = ini_get('max_execution_time');
|
||||
} else {
|
||||
$maximum_time = 0;
|
||||
}
|
||||
|
||||
// set default values
|
||||
$timeout_passed = FALSE;
|
||||
$error = FALSE;
|
||||
$read_multiply = 1;
|
||||
$finished = FALSE;
|
||||
$offset = 0;
|
||||
$max_sql_len = 0;
|
||||
$file_to_unlink = '';
|
||||
$sql_query = '';
|
||||
$sql_query_disabled = FALSE;
|
||||
$go_sql = FALSE;
|
||||
$executed_queries = 0;
|
||||
$run_query = TRUE;
|
||||
$charset_conversion = FALSE;
|
||||
$reset_charset = FALSE;
|
||||
$bookmark_created = FALSE;
|
||||
|
||||
// Bookmark Support: get a query back from bookmark if required
|
||||
if (!empty($id_bookmark)) {
|
||||
require_once './libraries/bookmark.lib.php';
|
||||
switch ($action_bookmark) {
|
||||
case 0: // bookmarked query that have to be run
|
||||
$import_text = PMA_Bookmark_get($db, $id_bookmark, 'id', isset($action_bookmark_all));
|
||||
if (isset($bookmark_variable) && !empty($bookmark_variable)) {
|
||||
$import_text = preg_replace('|/\*(.*)\[VARIABLE\](.*)\*/|imsU', '${1}' . PMA_sqlAddslashes($bookmark_variable) . '${2}', $import_text);
|
||||
}
|
||||
|
||||
// refresh left frame on changes in table or db structure
|
||||
if (preg_match('/^(CREATE|ALTER|DROP)\s+(VIEW|TABLE|DATABASE|SCHEMA)\s+/i', $import_text)) {
|
||||
$GLOBALS['reload'] = true;
|
||||
}
|
||||
|
||||
break;
|
||||
case 1: // bookmarked query that have to be displayed
|
||||
$import_text = PMA_Bookmark_get($db, $id_bookmark);
|
||||
$run_query = FALSE;
|
||||
break;
|
||||
case 2: // bookmarked query that have to be deleted
|
||||
$import_text = PMA_Bookmark_get($db, $id_bookmark);
|
||||
PMA_Bookmark_delete($db, $id_bookmark);
|
||||
$run_query = FALSE;
|
||||
$error = TRUE; // this is kind of hack to skip processing the query
|
||||
break;
|
||||
}
|
||||
} // end bookmarks reading
|
||||
|
||||
// Do no run query if we show PHP code
|
||||
if (isset($GLOBALS['show_as_php'])) {
|
||||
$run_query = FALSE;
|
||||
$go_sql = TRUE;
|
||||
}
|
||||
|
||||
// Store the query as a bookmark before executing it if bookmarklabel was given
|
||||
if (!empty($bkm_label) && !empty($import_text)) {
|
||||
require_once './libraries/bookmark.lib.php';
|
||||
$bfields = array(
|
||||
'dbase' => $db,
|
||||
'user' => $cfg['Bookmark']['user'],
|
||||
'query' => urlencode($import_text),
|
||||
'label' => $bkm_label
|
||||
);
|
||||
|
||||
// Should we replace bookmark?
|
||||
if (isset($bkm_replace)) {
|
||||
$bookmarks = PMA_Bookmark_getList($db);
|
||||
foreach ($bookmarks as $key => $val) {
|
||||
if ($val == $bkm_label) {
|
||||
PMA_Bookmark_delete($db, $key);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
PMA_Bookmark_save($bfields, isset($bkm_all_users));
|
||||
|
||||
$bookmark_created = TRUE;
|
||||
} // end store bookmarks
|
||||
|
||||
// We can not read all at once, otherwise we can run out of memory
|
||||
$memory_limit = trim(@ini_get('memory_limit'));
|
||||
// 2 MB as default
|
||||
if (empty($memory_limit)) {
|
||||
$memory_limit = 2 * 1024 * 1024;
|
||||
}
|
||||
// In case no memory limit we work on 10MB chunks
|
||||
if ($memory_limit == -1) {
|
||||
$memory_limit = 10 * 1024 * 1024;
|
||||
}
|
||||
|
||||
// Calculate value of the limit
|
||||
if (strtolower(substr($memory_limit, -1)) == 'm') {
|
||||
$memory_limit = (int)substr($memory_limit, 0, -1) * 1024 * 1024;
|
||||
} elseif (strtolower(substr($memory_limit, -1)) == 'k') {
|
||||
$memory_limit = (int)substr($memory_limit, 0, -1) * 1024;
|
||||
} elseif (strtolower(substr($memory_limit, -1)) == 'g') {
|
||||
$memory_limit = (int)substr($memory_limit, 0, -1) * 1024 * 1024 * 1024;
|
||||
} else {
|
||||
$memory_limit = (int)$memory_limit;
|
||||
}
|
||||
|
||||
$read_limit = $memory_limit / 8; // Just to be sure, there might be lot of memory needed for uncompression
|
||||
|
||||
// handle filenames
|
||||
if (!empty($local_import_file) && !empty($cfg['UploadDir'])) {
|
||||
|
||||
// sanitize $local_import_file as it comes from a POST
|
||||
$local_import_file = PMA_securePath($local_import_file);
|
||||
|
||||
$import_file = PMA_userDir($cfg['UploadDir']) . $local_import_file;
|
||||
} elseif (empty($import_file) || !is_uploaded_file($import_file)) {
|
||||
$import_file = 'none';
|
||||
}
|
||||
|
||||
// Do we have file to import?
|
||||
if ($import_file != 'none' && !$error) {
|
||||
// work around open_basedir and other limitations
|
||||
$open_basedir = @ini_get('open_basedir');
|
||||
|
||||
// If we are on a server with open_basedir, we must move the file
|
||||
// before opening it. The doc explains how to create the "./tmp"
|
||||
// directory
|
||||
|
||||
if (!empty($open_basedir)) {
|
||||
|
||||
$tmp_subdir = (PMA_IS_WINDOWS ? '.\\tmp\\' : './tmp/');
|
||||
|
||||
if (is_writable($tmp_subdir)) {
|
||||
$import_file_new = $tmp_subdir . basename($import_file);
|
||||
if (move_uploaded_file($import_file, $import_file_new)) {
|
||||
$import_file = $import_file_new;
|
||||
$file_to_unlink = $import_file_new;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Handle file compression
|
||||
* @todo duplicate code exists in File.class.php
|
||||
*/
|
||||
$compression = PMA_detectCompression($import_file);
|
||||
if ($compression === FALSE) {
|
||||
$message = PMA_Message::error('strFileCouldNotBeRead');
|
||||
$error = TRUE;
|
||||
} else {
|
||||
switch ($compression) {
|
||||
case 'application/bzip2':
|
||||
if ($cfg['BZipDump'] && @function_exists('bzopen')) {
|
||||
$import_handle = @bzopen($import_file, 'r');
|
||||
} else {
|
||||
$message = PMA_Message::error('strUnsupportedCompressionDetected');
|
||||
$message->addParam($compression);
|
||||
$error = TRUE;
|
||||
}
|
||||
break;
|
||||
case 'application/gzip':
|
||||
if ($cfg['GZipDump'] && @function_exists('gzopen')) {
|
||||
$import_handle = @gzopen($import_file, 'r');
|
||||
} else {
|
||||
$message = PMA_Message::error('strUnsupportedCompressionDetected');
|
||||
$message->addParam($compression);
|
||||
$error = TRUE;
|
||||
}
|
||||
break;
|
||||
case 'application/zip':
|
||||
if ($cfg['ZipDump'] && @function_exists('zip_open')) {
|
||||
include_once './libraries/zip_extension.lib.php';
|
||||
$result = PMA_getZipContents($import_file);
|
||||
if (! empty($result['error'])) {
|
||||
$message = PMA_Message::rawError($result['error']);
|
||||
$error = TRUE;
|
||||
} else {
|
||||
$import_text = $result['data'];
|
||||
}
|
||||
} else {
|
||||
$message = PMA_Message::error('strUnsupportedCompressionDetected');
|
||||
$message->addParam($compression);
|
||||
$error = TRUE;
|
||||
}
|
||||
break;
|
||||
case 'none':
|
||||
$import_handle = @fopen($import_file, 'r');
|
||||
break;
|
||||
default:
|
||||
$message = PMA_Message::error('strUnsupportedCompressionDetected');
|
||||
$message->addParam($compression);
|
||||
$error = TRUE;
|
||||
break;
|
||||
}
|
||||
}
|
||||
if (!$error && $import_handle === FALSE) {
|
||||
$message = PMA_Message::error('strFileCouldNotBeRead');
|
||||
$error = TRUE;
|
||||
}
|
||||
} elseif (!$error) {
|
||||
if (!isset($import_text) || empty($import_text)) {
|
||||
$message = PMA_Message::error('strNoDataReceived');
|
||||
$error = TRUE;
|
||||
}
|
||||
}
|
||||
|
||||
// Convert the file's charset if necessary
|
||||
if ($cfg['AllowAnywhereRecoding'] && isset($charset_of_file)) {
|
||||
if ($charset_of_file != $charset) {
|
||||
$charset_conversion = TRUE;
|
||||
}
|
||||
} elseif (isset($charset_of_file) && $charset_of_file != 'utf8') {
|
||||
PMA_DBI_query('SET NAMES \'' . $charset_of_file . '\'');
|
||||
// We can not show query in this case, it is in different charset
|
||||
$sql_query_disabled = TRUE;
|
||||
$reset_charset = TRUE;
|
||||
}
|
||||
|
||||
// Something to skip?
|
||||
if (!$error && isset($skip)) {
|
||||
$original_skip = $skip;
|
||||
while ($skip > 0) {
|
||||
PMA_importGetNextChunk($skip < $read_limit ? $skip : $read_limit);
|
||||
$read_multiply = 1; // Disable read progresivity, otherwise we eat all memory!
|
||||
$skip -= $read_limit;
|
||||
}
|
||||
unset($skip);
|
||||
}
|
||||
|
||||
if (!$error) {
|
||||
// Check for file existance
|
||||
if (!file_exists('./libraries/import/' . $format . '.php')) {
|
||||
$error = TRUE;
|
||||
$message = PMA_Message::error('strCanNotLoadImportPlugins');
|
||||
} else {
|
||||
// Do the real import
|
||||
$plugin_param = $import_type;
|
||||
require './libraries/import/' . $format . '.php';
|
||||
}
|
||||
}
|
||||
|
||||
if (! $error && $import_handle !== FALSE) {
|
||||
fclose($import_handle);
|
||||
}
|
||||
|
||||
// Cleanup temporary file
|
||||
if ($file_to_unlink != '') {
|
||||
unlink($file_to_unlink);
|
||||
}
|
||||
|
||||
// Reset charset back, if we did some changes
|
||||
if ($reset_charset) {
|
||||
PMA_DBI_query('SET CHARACTER SET utf8');
|
||||
PMA_DBI_query('SET SESSION collation_connection =\'' . $collation_connection . '\'');
|
||||
}
|
||||
|
||||
// Show correct message
|
||||
if (!empty($id_bookmark) && $action_bookmark == 2) {
|
||||
$message = PMA_Message::success('strBookmarkDeleted');
|
||||
$display_query = $import_text;
|
||||
$error = FALSE; // unset error marker, it was used just to skip processing
|
||||
} elseif (!empty($id_bookmark) && $action_bookmark == 1) {
|
||||
$message = PMA_Message::notice('strShowingBookmark');
|
||||
} elseif ($bookmark_created) {
|
||||
$special_message = '[br]' . sprintf($strBookmarkCreated, htmlspecialchars($bkm_label));
|
||||
} elseif ($finished && !$error) {
|
||||
if ($import_type == 'query') {
|
||||
$message = PMA_Message::success();
|
||||
} else {
|
||||
$message = PMA_Message::success('strImportSuccessfullyFinished');
|
||||
$message->addParam($executed_queries);
|
||||
}
|
||||
}
|
||||
|
||||
// Did we hit timeout? Tell it user.
|
||||
if ($timeout_passed) {
|
||||
$message = PMA_Message::error('strTimeoutPassed');
|
||||
if ($offset == 0 || (isset($original_skip) && $original_skip == $offset)) {
|
||||
$message->addString('strTimeoutNothingParsed');
|
||||
}
|
||||
}
|
||||
|
||||
// Parse and analyze the query, for correct db and table name
|
||||
// in case of a query typed in the query window
|
||||
require_once './libraries/parse_analyze.lib.php';
|
||||
|
||||
// There was an error?
|
||||
if (isset($my_die)) {
|
||||
foreach ($my_die AS $key => $die) {
|
||||
PMA_mysqlDie($die['error'], $die['sql'], '', $err_url, $error);
|
||||
}
|
||||
}
|
||||
|
||||
if ($go_sql) {
|
||||
require './sql.php';
|
||||
} else {
|
||||
$active_page = $goto;
|
||||
require './' . $goto;
|
||||
}
|
||||
exit();
|
||||
?>
|
189
index.php
@@ -1,189 +0,0 @@
|
||||
<?php
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* forms frameset
|
||||
*
|
||||
* @version $Id$
|
||||
* @uses $GLOBALS['strNoFrames']
|
||||
* @uses $GLOBALS['cfg']['QueryHistoryDB']
|
||||
* @uses $GLOBALS['cfg']['Server']['user']
|
||||
* @uses $GLOBALS['cfg']['DefaultTabServer'] as src for the mainframe
|
||||
* @uses $GLOBALS['cfg']['DefaultTabDatabase'] as src for the mainframe
|
||||
* @uses $GLOBALS['cfg']['NaviWidth'] for navi frame width
|
||||
* @uses $GLOBALS['collation_connection'] from $_REQUEST (grab_globals.lib.php)
|
||||
* or common.inc.php
|
||||
* @uses $GLOBALS['available_languages'] from common.inc.php (select_lang.lib.php)
|
||||
* @uses $GLOBALS['db']
|
||||
* @uses $GLOBALS['charset']
|
||||
* @uses $GLOBALS['lang']
|
||||
* @uses $GLOBALS['text_dir']
|
||||
* @uses $_ENV['HTTP_HOST']
|
||||
* @uses PMA_getRelationsParam()
|
||||
* @uses PMA_purgeHistory()
|
||||
* @uses PMA_generate_common_url()
|
||||
* @uses PMA_VERSION
|
||||
* @uses session_write_close()
|
||||
* @uses time()
|
||||
* @uses PMA_getenv()
|
||||
* @uses header() to send charset
|
||||
*/
|
||||
|
||||
/**
|
||||
* Gets core libraries and defines some variables
|
||||
*/
|
||||
require_once './libraries/common.inc.php';
|
||||
|
||||
/**
|
||||
* Includes the ThemeManager if it hasn't been included yet
|
||||
*/
|
||||
require_once './libraries/relation.lib.php';
|
||||
|
||||
// free the session file, for the other frames to be loaded
|
||||
session_write_close();
|
||||
|
||||
// Gets the host name
|
||||
if (empty($HTTP_HOST)) {
|
||||
if (PMA_getenv('HTTP_HOST')) {
|
||||
$HTTP_HOST = PMA_getenv('HTTP_HOST');
|
||||
} else {
|
||||
$HTTP_HOST = '';
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
// purge querywindow history
|
||||
$cfgRelation = PMA_getRelationsParam();
|
||||
if ($GLOBALS['cfg']['QueryHistoryDB'] && $cfgRelation['historywork']) {
|
||||
PMA_purgeHistory($GLOBALS['cfg']['Server']['user']);
|
||||
}
|
||||
unset($cfgRelation);
|
||||
|
||||
|
||||
/**
|
||||
* pass variables to child pages
|
||||
*/
|
||||
$drops = array('lang', 'server', 'convcharset', 'collation_connection',
|
||||
'db', 'table');
|
||||
|
||||
foreach ($drops as $each_drop) {
|
||||
if (! array_key_exists($each_drop, $_GET)) {
|
||||
unset($_GET[$each_drop]);
|
||||
}
|
||||
}
|
||||
unset($drops, $each_drop);
|
||||
|
||||
if (! strlen($GLOBALS['db'])) {
|
||||
$main_target = $GLOBALS['cfg']['DefaultTabServer'];
|
||||
} elseif (! strlen($GLOBALS['table'])) {
|
||||
$_GET['db'] = $GLOBALS['db'];
|
||||
$main_target = $GLOBALS['cfg']['DefaultTabDatabase'];
|
||||
} else {
|
||||
$_GET['db'] = $GLOBALS['db'];
|
||||
$_GET['table'] = $GLOBALS['table'];
|
||||
$main_target = $GLOBALS['cfg']['DefaultTabTable'];
|
||||
}
|
||||
|
||||
$url_query = PMA_generate_common_url($_GET);
|
||||
|
||||
if (isset($GLOBALS['target']) && is_string($GLOBALS['target']) && !empty($GLOBALS['target']) && in_array($GLOBALS['target'], $goto_whitelist)) {
|
||||
$main_target = $GLOBALS['target'];
|
||||
}
|
||||
|
||||
$main_target .= $url_query;
|
||||
|
||||
$lang_iso_code = $GLOBALS['available_languages'][$GLOBALS['lang']][2];
|
||||
|
||||
|
||||
// start output
|
||||
header('Content-Type: text/html; charset=' . $GLOBALS['charset']);
|
||||
?>
|
||||
<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Frameset//EN"
|
||||
"http://www.w3.org/TR/xhtml1/DTD/xhtml1-frameset.dtd">
|
||||
<html xmlns="http://www.w3.org/1999/xhtml"
|
||||
xml:lang="<?php echo $lang_iso_code; ?>"
|
||||
lang="<?php echo $lang_iso_code; ?>"
|
||||
dir="<?php echo $GLOBALS['text_dir']; ?>">
|
||||
<head>
|
||||
<link rel="icon" href="./favicon.ico" type="image/x-icon" />
|
||||
<link rel="shortcut icon" href="./favicon.ico" type="image/x-icon" />
|
||||
<title>phpMyAdmin <?php echo PMA_VERSION; ?> -
|
||||
<?php echo htmlspecialchars($HTTP_HOST); ?></title>
|
||||
<meta http-equiv="Content-Type"
|
||||
content="text/html; charset=<?php echo $GLOBALS['charset']; ?>" />
|
||||
<meta name="robots" content="noindex,nofollow" />
|
||||
<script type="text/javascript">
|
||||
// <![CDATA[
|
||||
// definitions used in common.js
|
||||
var common_query = '<?php echo PMA_escapeJsString(PMA_generate_common_url('', '', '&'));?>';
|
||||
var opendb_url = '<?php echo PMA_escapeJsString($GLOBALS['cfg']['DefaultTabDatabase']); ?>';
|
||||
var safari_browser = <?php echo PMA_USR_BROWSER_AGENT == 'SAFARI' ? 'true' : 'false' ?>;
|
||||
var querywindow_height = <?php echo PMA_escapeJsString($GLOBALS['cfg']['QueryWindowHeight']); ?>;
|
||||
var querywindow_width = <?php echo PMA_escapeJsString($GLOBALS['cfg']['QueryWindowWidth']); ?>;
|
||||
var collation_connection = '<?php echo PMA_escapeJsString($GLOBALS['collation_connection']); ?>';
|
||||
var lang = '<?php echo PMA_escapeJsString($GLOBALS['lang']); ?>';
|
||||
var server = '<?php echo PMA_escapeJsString($GLOBALS['server']); ?>';
|
||||
var table = '<?php echo PMA_escapeJsString($GLOBALS['table']); ?>';
|
||||
var db = '<?php echo PMA_escapeJsString($GLOBALS['db']); ?>';
|
||||
var token = '<?php echo PMA_escapeJsString($_SESSION[' PMA_token ']); ?>';
|
||||
var text_dir = '<?php echo PMA_escapeJsString($GLOBALS['text_dir']); ?>';
|
||||
var pma_absolute_uri = '<?php echo PMA_escapeJsString($GLOBALS['cfg']['PmaAbsoluteUri']); ?>';
|
||||
|
||||
// for content and navigation frames
|
||||
|
||||
var frame_content = 0;
|
||||
var frame_navigation = 0;
|
||||
function getFrames() {
|
||||
<?php if ($GLOBALS['text_dir'] === 'ltr') { ?>
|
||||
frame_content = window.frames[1];
|
||||
frame_navigation = window.frames[0];
|
||||
<?php } else { ?>
|
||||
frame_content = window.frames[0];
|
||||
frame_navigation = window.frames[1];
|
||||
<?php } ?>
|
||||
}
|
||||
var onloadCnt = 0;
|
||||
var onLoadHandler = window.onload;
|
||||
window.onload = function() {
|
||||
if (onloadCnt == 0) {
|
||||
if (typeof(onLoadHandler) == "function") {
|
||||
onLoadHandler();
|
||||
}
|
||||
if (typeof(getFrames) != 'undefined' && typeof(getFrames) == 'function') {
|
||||
getFrames();
|
||||
}
|
||||
onloadCnt++;
|
||||
}
|
||||
};
|
||||
// ]]>
|
||||
</script>
|
||||
<script src="./js/common.js" type="text/javascript"></script>
|
||||
</head>
|
||||
<frameset cols="<?php
|
||||
if ($GLOBALS['text_dir'] === 'rtl') {
|
||||
echo '*,';
|
||||
}
|
||||
echo $GLOBALS['cfg']['NaviWidth'];
|
||||
if ($GLOBALS['text_dir'] === 'ltr') {
|
||||
echo ',*';
|
||||
}
|
||||
?>" rows="*" id="mainFrameset">
|
||||
<?php if ($GLOBALS['text_dir'] === 'ltr') { ?>
|
||||
<frame frameborder="0" id="frame_navigation"
|
||||
src="navigation.php<?php echo $url_query; ?>"
|
||||
name="frame_navigation" />
|
||||
<?php } ?>
|
||||
<frame frameborder="0" id="frame_content"
|
||||
src="<?php echo $main_target; ?>"
|
||||
name="frame_content" />
|
||||
<?php if ($GLOBALS['text_dir'] === 'rtl') { ?>
|
||||
<frame frameborder="0" id="frame_navigation"
|
||||
src="navigation.php<?php echo $url_query; ?>"
|
||||
name="frame_navigation" />
|
||||
<?php } ?>
|
||||
<noframes>
|
||||
<body>
|
||||
<p><?php echo $GLOBALS['strNoFrames']; ?></p>
|
||||
</body>
|
||||
</noframes>
|
||||
</frameset>
|
||||
</html>
|
449
js/common.js
@@ -1,449 +0,0 @@
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* common functions used for communicating between main, navigation and querywindow
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
* holds the browser query window
|
||||
*/
|
||||
var querywindow = '';
|
||||
|
||||
/**
|
||||
* holds the query to be load from a new query window
|
||||
*/
|
||||
var query_to_load = '';
|
||||
|
||||
/**
|
||||
* attach a function to object event
|
||||
*
|
||||
* <code>
|
||||
* addEvent(window, 'load', PMA_initPage);
|
||||
* </code>
|
||||
* @param object or id
|
||||
* @param string event type (load, mouseover, focus, ...)
|
||||
* @param function to be attached
|
||||
*/
|
||||
function addEvent(obj, type, fn)
|
||||
{
|
||||
if (obj.attachEvent) {
|
||||
obj['e' + type + fn] = fn;
|
||||
obj[type + fn] = function() {obj['e' + type + fn](window.event);}
|
||||
obj.attachEvent('on' + type, obj[type + fn]);
|
||||
} else {
|
||||
obj.addEventListener(type, fn, false);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* detach/remove a function from an object event
|
||||
*
|
||||
* @param object or id
|
||||
* @param event type (load, mouseover, focus, ...)
|
||||
* @param function naem of function to be attached
|
||||
*/
|
||||
function removeEvent(obj, type, fn)
|
||||
{
|
||||
if (obj.detachEvent) {
|
||||
obj.detachEvent('on' + type, obj[type + fn]);
|
||||
obj[type + fn] = null;
|
||||
} else {
|
||||
obj.removeEventListener(type, fn, false);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* get DOM elements by html class
|
||||
*
|
||||
* @param string class_name - name of class
|
||||
* @param node node - search only sub nodes of this node (optional)
|
||||
* @param string tag - search only these tags (optional)
|
||||
*/
|
||||
function getElementsByClassName(class_name, node, tag)
|
||||
{
|
||||
var classElements = new Array();
|
||||
|
||||
if (node == null) {
|
||||
node = document;
|
||||
}
|
||||
if (tag == null) {
|
||||
tag = '*';
|
||||
}
|
||||
|
||||
var j = 0, teststr;
|
||||
var els = node.getElementsByTagName(tag);
|
||||
var elsLen = els.length;
|
||||
|
||||
for (i = 0; i < elsLen; i++) {
|
||||
if (els[i].className.indexOf(class_name) != -1) {
|
||||
teststr = "," + els[i].className.split(" ").join(",") + ",";
|
||||
if (teststr.indexOf("," + class_name + ",") != -1) {
|
||||
classElements[j] = els[i];
|
||||
j++;
|
||||
}
|
||||
}
|
||||
}
|
||||
return classElements;
|
||||
}
|
||||
|
||||
/**
|
||||
* sets current selected db
|
||||
*
|
||||
* @param string db name
|
||||
*/
|
||||
function setDb(new_db) {
|
||||
//alert('setDb(' + new_db + ')');
|
||||
if (new_db != db) {
|
||||
// db has changed
|
||||
//alert( new_db + '(' + new_db.length + ') : ' + db );
|
||||
|
||||
var old_db = db;
|
||||
db = new_db;
|
||||
|
||||
if (window.frame_navigation.document.getElementById(db) == null) {
|
||||
// db is unknown, reload complete left frame
|
||||
refreshNavigation();
|
||||
} else {
|
||||
unmarkDbTable(old_db);
|
||||
markDbTable(db);
|
||||
}
|
||||
|
||||
// TODO: add code to expand db in lightview mode
|
||||
|
||||
// refresh querywindow
|
||||
refreshQuerywindow();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* sets current selected table (called from navigation.php)
|
||||
*
|
||||
* @param string table name
|
||||
*/
|
||||
function setTable(new_table) {
|
||||
//alert('setTable(' + new_table + ')');
|
||||
if (new_table != table) {
|
||||
// table has changed
|
||||
//alert( new_table + '(' + new_table.length + ') : ' + table );
|
||||
|
||||
table = new_table;
|
||||
|
||||
if (window.frame_navigation.document.getElementById(db + '.' + table) == null
|
||||
&& table != '') {
|
||||
// table is unknown, reload complete left frame
|
||||
refreshNavigation();
|
||||
|
||||
}
|
||||
// TODO: add code to expand table in lightview mode
|
||||
|
||||
// refresh querywindow
|
||||
refreshQuerywindow();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* reloads main frame
|
||||
*
|
||||
* @uses goTo()
|
||||
* @uses opendb_url
|
||||
* @uses token
|
||||
* @uses db
|
||||
* @uses server
|
||||
* @uses table
|
||||
* @uses lang
|
||||
* @uses collation_connection
|
||||
* @uses encodeURIComponent()
|
||||
* @param string url name of page to be loaded
|
||||
*/
|
||||
function refreshMain(url) {
|
||||
if (! url) {
|
||||
if (db) {
|
||||
url = opendb_url;
|
||||
} else {
|
||||
url = 'main.php';
|
||||
}
|
||||
}
|
||||
//alert(db);
|
||||
goTo(url + '?server=' + encodeURIComponent(server) +
|
||||
'&token=' + encodeURIComponent(token) +
|
||||
'&db=' + encodeURIComponent(db) +
|
||||
'&table=' + encodeURIComponent(table) +
|
||||
'&lang=' + encodeURIComponent(lang) +
|
||||
'&collation_connection=' + encodeURIComponent(collation_connection),
|
||||
'main');
|
||||
}
|
||||
|
||||
/**
|
||||
* reloads navigation frame
|
||||
*
|
||||
* @uses goTo()
|
||||
* @uses token
|
||||
* @uses db
|
||||
* @uses server
|
||||
* @uses table
|
||||
* @uses lang
|
||||
* @uses collation_connection
|
||||
* @uses encodeURIComponent()
|
||||
*/
|
||||
function refreshNavigation() {
|
||||
goTo('navigation.php?server=' + encodeURIComponent(server) +
|
||||
'&token=' + encodeURIComponent(token) +
|
||||
'&db=' + encodeURIComponent(db) +
|
||||
'&table=' + encodeURIComponent(table) +
|
||||
'&lang=' + encodeURIComponent(lang) +
|
||||
'&collation_connection=' + encodeURIComponent(collation_connection)
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* adds class to element
|
||||
*/
|
||||
function addClass(element, classname)
|
||||
{
|
||||
if (element != null) {
|
||||
element.className += ' ' + classname;
|
||||
//alert('set class: ' + classname + ', now: ' + element.className);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* removes class from element
|
||||
*/
|
||||
function removeClass(element, classname)
|
||||
{
|
||||
if (element != null) {
|
||||
element.className = element.className.replace(' ' + classname, '');
|
||||
// if there is no other class anem there is no leading space
|
||||
element.className = element.className.replace(classname, '');
|
||||
//alert('removed class: ' + classname + ', now: ' + element.className);
|
||||
}
|
||||
}
|
||||
|
||||
function unmarkDbTable(db, table)
|
||||
{
|
||||
var element_reference = window.frame_navigation.document.getElementById(db);
|
||||
if (element_reference != null) {
|
||||
//alert('remove from: ' + db);
|
||||
removeClass(element_reference.parentNode, 'marked');
|
||||
}
|
||||
|
||||
element_reference = window.frame_navigation.document.getElementById(db + '.' + table);
|
||||
if (element_reference != null) {
|
||||
//alert('remove from: ' + db + '.' + table);
|
||||
removeClass(element_reference.parentNode, 'marked');
|
||||
}
|
||||
}
|
||||
|
||||
function markDbTable(db, table)
|
||||
{
|
||||
var element_reference = window.frame_navigation.document.getElementById(db);
|
||||
if (element_reference != null) {
|
||||
addClass(element_reference.parentNode, 'marked');
|
||||
// scrolldown
|
||||
element_reference.focus();
|
||||
// opera marks the text, we dont want this ...
|
||||
element_reference.blur();
|
||||
}
|
||||
|
||||
element_reference = window.frame_navigation.document.getElementById(db + '.' + table);
|
||||
if (element_reference != null) {
|
||||
addClass(element_reference.parentNode, 'marked');
|
||||
// scrolldown
|
||||
element_reference.focus();
|
||||
// opera marks the text, we dont want this ...
|
||||
element_reference.blur();
|
||||
}
|
||||
|
||||
// return to main frame ...
|
||||
window.frame_content.focus();
|
||||
}
|
||||
|
||||
/**
|
||||
* sets current selected server, table and db (called from libraries/footer.inc.php)
|
||||
*/
|
||||
function setAll( new_lang, new_collation_connection, new_server, new_db, new_table, new_token ) {
|
||||
//alert('setAll( ' + new_lang + ', ' + new_collation_connection + ', ' + new_server + ', ' + new_db + ', ' + new_table + ', ' + new_token + ' )');
|
||||
if (new_server != server || new_lang != lang
|
||||
|| new_collation_connection != collation_connection) {
|
||||
// something important has changed
|
||||
server = new_server;
|
||||
db = new_db;
|
||||
table = new_table;
|
||||
collation_connection = new_collation_connection;
|
||||
lang = new_lang;
|
||||
token = new_token;
|
||||
refreshNavigation();
|
||||
} else if (new_db != db || new_table != table) {
|
||||
// save new db and table
|
||||
var old_db = db;
|
||||
var old_table = table;
|
||||
db = new_db;
|
||||
table = new_table;
|
||||
|
||||
if (window.frame_navigation.document.getElementById(db) == null
|
||||
&& window.frame_navigation.document.getElementById(db + '.' + table) == null ) {
|
||||
// table or db is unknown, reload complete left frame
|
||||
refreshNavigation();
|
||||
} else {
|
||||
unmarkDbTable(old_db, old_table);
|
||||
markDbTable(db, table);
|
||||
}
|
||||
|
||||
// TODO: add code to expand db in lightview mode
|
||||
|
||||
// refresh querywindow
|
||||
refreshQuerywindow();
|
||||
}
|
||||
}
|
||||
|
||||
function reload_querywindow(db, table, sql_query)
|
||||
{
|
||||
if ( ! querywindow.closed && querywindow.location ) {
|
||||
if ( ! querywindow.document.sqlform.LockFromUpdate
|
||||
|| ! querywindow.document.sqlform.LockFromUpdate.checked ) {
|
||||
querywindow.document.getElementById('hiddenqueryform').db.value = db;
|
||||
querywindow.document.getElementById('hiddenqueryform').table.value = table;
|
||||
|
||||
if (sql_query) {
|
||||
querywindow.document.getElementById('hiddenqueryform').sql_query.value = sql_query;
|
||||
}
|
||||
|
||||
querywindow.document.getElementById('hiddenqueryform').submit();
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* brings query window to front and inserts query to be edited
|
||||
*/
|
||||
function focus_querywindow(sql_query)
|
||||
{
|
||||
/* if ( querywindow && !querywindow.closed && querywindow.location) { */
|
||||
if ( !querywindow || querywindow.closed || !querywindow.location) {
|
||||
// we need first to open the window and cannot pass the query with it
|
||||
// as we dont know if the query exceeds max url length
|
||||
/* url = 'querywindow.php?' + common_query + '&db=' + db + '&table=' + table + '&sql_query=SELECT * FROM'; */
|
||||
query_to_load = sql_query;
|
||||
open_querywindow();
|
||||
insertQuery(0);
|
||||
} else {
|
||||
//var querywindow = querywindow;
|
||||
if ( querywindow.document.getElementById('hiddenqueryform').querydisplay_tab != 'sql' ) {
|
||||
querywindow.document.getElementById('hiddenqueryform').querydisplay_tab.value = "sql";
|
||||
querywindow.document.getElementById('hiddenqueryform').sql_query.value = sql_query;
|
||||
querywindow.document.getElementById('hiddenqueryform').submit();
|
||||
querywindow.focus();
|
||||
} else {
|
||||
querywindow.focus();
|
||||
}
|
||||
}
|
||||
return true;
|
||||
}
|
||||
|
||||
/**
|
||||
* inserts query string into query window textarea
|
||||
* called from script tag in querywindow
|
||||
*/
|
||||
function insertQuery() {
|
||||
if (query_to_load != '' && querywindow.document && querywindow.document.getElementById && querywindow.document.getElementById('sqlquery')) {
|
||||
querywindow.document.getElementById('sqlquery').value = query_to_load;
|
||||
query_to_load = '';
|
||||
return true;
|
||||
}
|
||||
return false;
|
||||
}
|
||||
|
||||
function open_querywindow( url ) {
|
||||
if ( ! url ) {
|
||||
url = 'querywindow.php?' + common_query + '&db=' + encodeURIComponent(db) + '&table=' + encodeURIComponent(table);
|
||||
}
|
||||
|
||||
if (!querywindow.closed && querywindow.location) {
|
||||
goTo( url, 'query' );
|
||||
querywindow.focus();
|
||||
} else {
|
||||
querywindow = window.open( url + '&init=1', '',
|
||||
'toolbar=0,location=0,directories=0,status=1,menubar=0,' +
|
||||
'scrollbars=yes,resizable=yes,' +
|
||||
'width=' + querywindow_width + ',' +
|
||||
'height=' + querywindow_height );
|
||||
}
|
||||
|
||||
if ( ! querywindow.opener ) {
|
||||
querywindow.opener = window.window;
|
||||
}
|
||||
|
||||
if ( window.focus ) {
|
||||
querywindow.focus();
|
||||
}
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
function refreshQuerywindow( url ) {
|
||||
|
||||
if ( ! querywindow.closed && querywindow.location ) {
|
||||
if ( ! querywindow.document.sqlform.LockFromUpdate
|
||||
|| ! querywindow.document.sqlform.LockFromUpdate.checked ) {
|
||||
open_querywindow( url )
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* opens new url in target frame, with default being left frame
|
||||
* valid is 'main' and 'querywindow' all others leads to 'left'
|
||||
*
|
||||
* @param string targeturl new url to load
|
||||
* @param string target frame where to load the new url
|
||||
*/
|
||||
function goTo(targeturl, target) {
|
||||
//alert(targeturl);
|
||||
if ( target == 'main' ) {
|
||||
target = window.frame_content;
|
||||
} else if ( target == 'query' ) {
|
||||
target = querywindow;
|
||||
//return open_querywindow( targeturl );
|
||||
} else if ( ! target ) {
|
||||
target = window.frame_navigation;
|
||||
}
|
||||
|
||||
if ( target ) {
|
||||
if ( target.location.href == targeturl ) {
|
||||
return true;
|
||||
} else if ( target.location.href == pma_absolute_uri + targeturl ) {
|
||||
return true;
|
||||
}
|
||||
|
||||
if ( safari_browser ) {
|
||||
target.location.href = targeturl;
|
||||
} else {
|
||||
target.location.replace(targeturl);
|
||||
}
|
||||
}
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
// opens selected db in main frame
|
||||
function openDb(new_db) {
|
||||
//alert('opendb(' + new_db + ')');
|
||||
setDb(new_db);
|
||||
setTable('');
|
||||
refreshMain(opendb_url);
|
||||
return true;
|
||||
}
|
||||
|
||||
function updateTableTitle( table_link_id, new_title ) {
|
||||
//alert('updateTableTitle');
|
||||
if ( window.parent.frame_navigation.document.getElementById(table_link_id) ) {
|
||||
var left = window.parent.frame_navigation.document;
|
||||
left.getElementById(table_link_id).title = new_title;
|
||||
new_title = left.getElementById('icon_' + table_link_id).alt + ': ' + new_title;
|
||||
left.getElementById('quick_' + table_link_id).title = new_title;
|
||||
return true;
|
||||
}
|
||||
|
||||
return false;
|
||||
}
|
124
js/dom-drag.js
@@ -1,124 +0,0 @@
|
||||
/**************************************************
|
||||
* dom-drag.js
|
||||
* 09.25.2001
|
||||
* www.youngpup.net
|
||||
**************************************************
|
||||
* Copyright 2001, Aaron Boodman
|
||||
* This code is public domain. Please use it for good, not evil.
|
||||
**************************************************
|
||||
* 10.28.2001 - fixed minor bug where events
|
||||
* sometimes fired off the handle, not the root.
|
||||
**************************************************/
|
||||
|
||||
var Drag = {
|
||||
|
||||
obj : null,
|
||||
|
||||
init : function(o, oRoot, minX, maxX, minY, maxY, bSwapHorzRef, bSwapVertRef, fXMapper, fYMapper)
|
||||
{
|
||||
o.onmousedown = Drag.start;
|
||||
|
||||
o.hmode = bSwapHorzRef ? false : true ;
|
||||
o.vmode = bSwapVertRef ? false : true ;
|
||||
|
||||
o.root = oRoot && oRoot != null ? oRoot : o ;
|
||||
|
||||
if (o.hmode && isNaN(parseInt(o.root.style.left ))) o.root.style.left = "0px";
|
||||
if (o.vmode && isNaN(parseInt(o.root.style.top ))) o.root.style.top = "0px";
|
||||
if (!o.hmode && isNaN(parseInt(o.root.style.right ))) o.root.style.right = "0px";
|
||||
if (!o.vmode && isNaN(parseInt(o.root.style.bottom))) o.root.style.bottom = "0px";
|
||||
|
||||
o.minX = typeof minX != 'undefined' ? minX : null;
|
||||
o.minY = typeof minY != 'undefined' ? minY : null;
|
||||
o.maxX = typeof maxX != 'undefined' ? maxX : null;
|
||||
o.maxY = typeof maxY != 'undefined' ? maxY : null;
|
||||
|
||||
o.xMapper = fXMapper ? fXMapper : null;
|
||||
o.yMapper = fYMapper ? fYMapper : null;
|
||||
|
||||
o.root.onDragStart = new Function();
|
||||
o.root.onDragEnd = new Function();
|
||||
o.root.onDrag = new Function();
|
||||
},
|
||||
|
||||
start : function(e)
|
||||
{
|
||||
var o = Drag.obj = this;
|
||||
e = Drag.fixE(e);
|
||||
var y = parseInt(o.vmode ? o.root.style.top : o.root.style.bottom);
|
||||
var x = parseInt(o.hmode ? o.root.style.left : o.root.style.right );
|
||||
o.root.onDragStart(x, y);
|
||||
|
||||
o.lastMouseX = e.clientX;
|
||||
o.lastMouseY = e.clientY;
|
||||
|
||||
if (o.hmode) {
|
||||
if (o.minX != null) o.minMouseX = e.clientX - x + o.minX;
|
||||
if (o.maxX != null) o.maxMouseX = o.minMouseX + o.maxX - o.minX;
|
||||
} else {
|
||||
if (o.minX != null) o.maxMouseX = -o.minX + e.clientX + x;
|
||||
if (o.maxX != null) o.minMouseX = -o.maxX + e.clientX + x;
|
||||
}
|
||||
|
||||
if (o.vmode) {
|
||||
if (o.minY != null) o.minMouseY = e.clientY - y + o.minY;
|
||||
if (o.maxY != null) o.maxMouseY = o.minMouseY + o.maxY - o.minY;
|
||||
} else {
|
||||
if (o.minY != null) o.maxMouseY = -o.minY + e.clientY + y;
|
||||
if (o.maxY != null) o.minMouseY = -o.maxY + e.clientY + y;
|
||||
}
|
||||
|
||||
document.onmousemove = Drag.drag;
|
||||
document.onmouseup = Drag.end;
|
||||
|
||||
return false;
|
||||
},
|
||||
|
||||
drag : function(e)
|
||||
{
|
||||
e = Drag.fixE(e);
|
||||
var o = Drag.obj;
|
||||
|
||||
var ey = e.clientY;
|
||||
var ex = e.clientX;
|
||||
var y = parseInt(o.vmode ? o.root.style.top : o.root.style.bottom);
|
||||
var x = parseInt(o.hmode ? o.root.style.left : o.root.style.right );
|
||||
var nx, ny;
|
||||
|
||||
if (o.minX != null) ex = o.hmode ? Math.max(ex, o.minMouseX) : Math.min(ex, o.maxMouseX);
|
||||
if (o.maxX != null) ex = o.hmode ? Math.min(ex, o.maxMouseX) : Math.max(ex, o.minMouseX);
|
||||
if (o.minY != null) ey = o.vmode ? Math.max(ey, o.minMouseY) : Math.min(ey, o.maxMouseY);
|
||||
if (o.maxY != null) ey = o.vmode ? Math.min(ey, o.maxMouseY) : Math.max(ey, o.minMouseY);
|
||||
|
||||
nx = x + ((ex - o.lastMouseX) * (o.hmode ? 1 : -1));
|
||||
ny = y + ((ey - o.lastMouseY) * (o.vmode ? 1 : -1));
|
||||
|
||||
if (o.xMapper) nx = o.xMapper(y)
|
||||
else if (o.yMapper) ny = o.yMapper(x)
|
||||
|
||||
Drag.obj.root.style[o.hmode ? "left" : "right"] = nx + "px";
|
||||
Drag.obj.root.style[o.vmode ? "top" : "bottom"] = ny + "px";
|
||||
Drag.obj.lastMouseX = ex;
|
||||
Drag.obj.lastMouseY = ey;
|
||||
|
||||
Drag.obj.root.onDrag(nx, ny);
|
||||
return false;
|
||||
},
|
||||
|
||||
end : function()
|
||||
{
|
||||
document.onmousemove = null;
|
||||
document.onmouseup = null;
|
||||
Drag.obj.root.onDragEnd( parseInt(Drag.obj.root.style[Drag.obj.hmode ? "left" : "right"]),
|
||||
parseInt(Drag.obj.root.style[Drag.obj.vmode ? "top" : "bottom"]));
|
||||
Drag.obj = null;
|
||||
},
|
||||
|
||||
fixE : function(e)
|
||||
{
|
||||
if (typeof e == 'undefined') e = window.event;
|
||||
if (typeof e.layerX == 'undefined') e.layerX = e.offsetX;
|
||||
if (typeof e.layerY == 'undefined') e.layerY = e.offsetY;
|
||||
return e;
|
||||
}
|
||||
};
|
1306
js/functions.js
@@ -1,91 +0,0 @@
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* function used for index manipulation pages
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
* Ensures a value submitted in a form is numeric and is in a range
|
||||
*
|
||||
* @param object the form
|
||||
* @param string the name of the form field to check
|
||||
* @param integer the minimum authorized value
|
||||
* @param integer the maximum authorized value
|
||||
*
|
||||
* @return boolean whether a valid number has been submitted or not
|
||||
*/
|
||||
function checkFormElementInRange(theForm, theFieldName, message, min, max)
|
||||
{
|
||||
var theField = theForm.elements[theFieldName];
|
||||
var val = parseInt(theField.value);
|
||||
|
||||
if (typeof(min) == 'undefined') {
|
||||
min = 0;
|
||||
}
|
||||
if (typeof(max) == 'undefined') {
|
||||
max = Number.MAX_VALUE;
|
||||
}
|
||||
|
||||
// It's not a number
|
||||
if (isNaN(val)) {
|
||||
theField.select();
|
||||
alert(PMA_messages['strNotNumber']);
|
||||
theField.focus();
|
||||
return false;
|
||||
}
|
||||
// It's a number but it is not between min and max
|
||||
else if (val < min || val > max) {
|
||||
theField.select();
|
||||
alert(message.replace('%d', val));
|
||||
theField.focus();
|
||||
return false;
|
||||
}
|
||||
// It's a valid number
|
||||
else {
|
||||
theField.value = val;
|
||||
}
|
||||
|
||||
return true;
|
||||
} // end of the 'checkFormElementInRange()' function
|
||||
|
||||
|
||||
/**
|
||||
* Ensures indexes names are valid according to their type and, for a primary
|
||||
* key, lock index name to 'PRIMARY'
|
||||
*
|
||||
* @return boolean false if there is no index form, true else
|
||||
*/
|
||||
function checkIndexName()
|
||||
{
|
||||
if (typeof(document.forms['index_frm']) == 'undefined') {
|
||||
return false;
|
||||
}
|
||||
|
||||
// Gets the elements pointers
|
||||
var the_idx_name = document.forms['index_frm'].elements['index'];
|
||||
var the_idx_type = document.forms['index_frm'].elements['index_type'];
|
||||
|
||||
// Index is a primary key
|
||||
if (the_idx_type.options[0].value == 'PRIMARY' && the_idx_type.options[0].selected) {
|
||||
document.forms['index_frm'].elements['index'].value = 'PRIMARY';
|
||||
if (typeof(the_idx_name.disabled) != 'undefined') {
|
||||
document.forms['index_frm'].elements['index'].disabled = true;
|
||||
}
|
||||
}
|
||||
|
||||
// Other cases
|
||||
else {
|
||||
if (the_idx_name.value == 'PRIMARY') {
|
||||
document.forms['index_frm'].elements['index'].value = '';
|
||||
}
|
||||
if (typeof(the_idx_name.disabled) != 'undefined') {
|
||||
document.forms['index_frm'].elements['index'].disabled = false;
|
||||
}
|
||||
}
|
||||
|
||||
return true;
|
||||
} // end of the 'checkIndexName()' function
|
||||
|
||||
|
||||
onload = checkIndexName;
|
@@ -1,59 +0,0 @@
|
||||
/**
|
||||
* Allows moving around inputs/select by Ctrl+arrows
|
||||
*
|
||||
* @param object event data
|
||||
*/
|
||||
function onKeyDownArrowsHandler(e) {
|
||||
e = e||window.event;
|
||||
var o = (e.srcElement||e.target);
|
||||
if (!o) return;
|
||||
if (o.tagName != "TEXTAREA" && o.tagName != "INPUT" && o.tagName != "SELECT") return;
|
||||
if (navigator.userAgent.toLowerCase().indexOf('applewebkit/') != -1) {
|
||||
if (e.ctrlKey || e.shiftKey || !e.altKey) return;
|
||||
} else {
|
||||
if (!e.ctrlKey || e.shiftKey || e.altKey) return;
|
||||
}
|
||||
if (!o.id) return;
|
||||
|
||||
var pos = o.id.split("_");
|
||||
if (pos[0] != "field" || typeof pos[2] == "undefined") return;
|
||||
|
||||
var x = pos[2], y=pos[1];
|
||||
|
||||
// skip non existent fields
|
||||
for (i=0; i<10; i++)
|
||||
{
|
||||
if (switch_movement) {
|
||||
switch(e.keyCode) {
|
||||
case 38: x--; break; // up
|
||||
case 40: x++; break; // down
|
||||
case 37: y--; break; // left
|
||||
case 39: y++; break; // right
|
||||
default: return;
|
||||
}
|
||||
} else {
|
||||
switch(e.keyCode) {
|
||||
case 38: y--; break; // up
|
||||
case 40: y++; break; // down
|
||||
case 37: x--; break; // left
|
||||
case 39: x++; break; // right
|
||||
default: return;
|
||||
}
|
||||
}
|
||||
|
||||
var id = "field_" + y + "_" + x;
|
||||
var nO = document.getElementById(id);
|
||||
if (!nO) {
|
||||
var id = "field_" + y + "_" + x + "_0";
|
||||
var nO = document.getElementById(id);
|
||||
}
|
||||
if (nO) break;
|
||||
}
|
||||
|
||||
if (!nO) return;
|
||||
nO.focus();
|
||||
if (nO.tagName != 'SELECT') {
|
||||
nO.select();
|
||||
}
|
||||
e.returnValue = false;
|
||||
}
|
Before Width: | Height: | Size: 43 B |
Before Width: | Height: | Size: 94 B |
Before Width: | Height: | Size: 799 B |
Before Width: | Height: | Size: 80 B |
Before Width: | Height: | Size: 590 B |
Before Width: | Height: | Size: 768 B |
Before Width: | Height: | Size: 794 B |
@@ -1,114 +0,0 @@
|
||||
/***
|
||||
* - mooRainbow: defaultCSS
|
||||
* author: w00fz <w00fzIT@gmail.com>
|
||||
*/
|
||||
|
||||
#mooRainbow { font-size: 11px; color: #000; }
|
||||
|
||||
.moor-box {
|
||||
width: 390px;
|
||||
height: 310px;
|
||||
border: 1px solid #636163;
|
||||
background-color: #f9f9f9;
|
||||
}
|
||||
.moor-overlayBox {
|
||||
width: 256px; /* Width and Height of the overlay must be setted here: default 256x256 */
|
||||
height: 256px;
|
||||
margin-top: 9px;
|
||||
margin-left: 9px;
|
||||
border: 1px solid #000;
|
||||
}
|
||||
.moor-slider {
|
||||
border: 1px solid #000;
|
||||
margin-top: 9px;
|
||||
margin-left: 280px;
|
||||
width: 19px; /* if you want a bigger or smaller slider... */
|
||||
height: 256px;
|
||||
}
|
||||
.moor-colorBox {
|
||||
border: 1px solid #000;
|
||||
width: 59px;
|
||||
height: 68px;
|
||||
margin-top: 20px;
|
||||
margin-left: 315px;
|
||||
}
|
||||
.moor-currentColor { /* Bottom Box Color, the backup one */
|
||||
margin-top: 55px;
|
||||
margin-left: 316px;
|
||||
width: 59px;
|
||||
height: 34px;
|
||||
}
|
||||
.moor-okButton {
|
||||
font-family: Tahoma;
|
||||
font-weight: bold;
|
||||
font-size: 11px;
|
||||
margin-top: 278px;
|
||||
margin-left: 8px;
|
||||
background: #e6e6e6;
|
||||
height: 23px;
|
||||
border: 1px solid #d6d6d6;
|
||||
border-left-color: #f5f5f5;
|
||||
border-top-color: #f5f5f5;
|
||||
}
|
||||
#mooRainbow label {
|
||||
font-family: mono;
|
||||
}
|
||||
/* Following are just <label> */
|
||||
.moor-rLabel {
|
||||
margin-top: 100px;
|
||||
margin-left: 315px;
|
||||
}
|
||||
.moor-gLabel {
|
||||
margin-top: 125px;
|
||||
margin-left: 315px;
|
||||
}
|
||||
.moor-bLabel {
|
||||
margin-top: 150px;
|
||||
margin-left: 315px;
|
||||
}
|
||||
.moor-HueLabel {
|
||||
margin-top: 190px;
|
||||
margin-left: 315px;
|
||||
}
|
||||
span.moor-ballino { /* Style hue <20> (degree) !! */
|
||||
margin-top: 190px;
|
||||
margin-left: 370px;
|
||||
}
|
||||
.moor-SatuLabel {
|
||||
margin-top: 215px;
|
||||
margin-left: 315px;
|
||||
}
|
||||
.moor-BrighLabel {
|
||||
margin-top: 240px;
|
||||
margin-left: 315px;
|
||||
}
|
||||
.moor-hexLabel {
|
||||
margin-top: 275px;
|
||||
margin-left: 280px;
|
||||
}
|
||||
|
||||
/* <input> */
|
||||
.moor-rInput, .moor-gInput, .moor-bInput, .moor-HueInput, .moor-SatuInput, .moor-BrighInput {
|
||||
width: 30px;
|
||||
}
|
||||
.moor-hexInput {
|
||||
width: 55px;
|
||||
}
|
||||
.moor-cursor {
|
||||
background-image: url(images/moor_cursor.gif);
|
||||
width: 12px;
|
||||
height: 12px;
|
||||
}
|
||||
.moor-arrows {
|
||||
background-image: url(images/moor_arrows.gif);
|
||||
top: 9px;
|
||||
left: 270px;
|
||||
width: 41px;
|
||||
height: 9px;
|
||||
}
|
||||
.moor-chooseColor { /* Top Box Color, the choosen one */
|
||||
margin-top: 21px;
|
||||
margin-left: 316px;
|
||||
width: 59px;
|
||||
height: 34px;
|
||||
}
|
@@ -1,563 +0,0 @@
|
||||
/***
|
||||
* MooRainbow
|
||||
*
|
||||
* @version 1.2b1
|
||||
* @license MIT-style license
|
||||
* @author Djamil Legato (w00fz) - < w00fzIT [at] gmail.com >
|
||||
* @infos http://moorainbow.woolly-sheep.net
|
||||
* @copyright Author
|
||||
*
|
||||
* includes a fix for mootools 1.2 by Piotr Przybylski
|
||||
*/
|
||||
|
||||
var MooRainbow = new Class({
|
||||
Implements: [Options, Events],
|
||||
options: {
|
||||
id: 'mooRainbow',
|
||||
prefix: 'moor-',
|
||||
imgPath: 'images/',
|
||||
startColor: [255, 0, 0],
|
||||
wheel: false,
|
||||
onComplete: Class.empty,
|
||||
onChange: Class.empty,
|
||||
selectText: 'Select'
|
||||
},
|
||||
|
||||
initialize: function(el, options) {
|
||||
this.element = $(el); if (!this.element) return;
|
||||
this.setOptions(options);
|
||||
|
||||
this.sliderPos = 0;
|
||||
this.pickerPos = {x: 0, y: 0};
|
||||
this.backupColor = this.options.startColor;
|
||||
this.currentColor = this.options.startColor;
|
||||
this.sets = {
|
||||
rgb: [],
|
||||
hsb: [],
|
||||
hex: []
|
||||
};
|
||||
this.pickerClick = this.sliderClick = false;
|
||||
if (!this.layout) this.doLayout();
|
||||
this.OverlayEvents();
|
||||
this.sliderEvents();
|
||||
this.backupEvent();
|
||||
if (this.options.wheel) this.wheelEvents();
|
||||
this.element.addEvent('click', function(e) { this.toggle(e); }.bind(this));
|
||||
|
||||
this.layout.overlay.setStyle('background-color', this.options.startColor.rgbToHex());
|
||||
this.layout.backup.setStyle('background-color', this.backupColor.rgbToHex());
|
||||
|
||||
this.pickerPos.x = this.snippet('curPos').l + this.snippet('curSize', 'int').w;
|
||||
this.pickerPos.y = this.snippet('curPos').t + this.snippet('curSize', 'int').h;
|
||||
|
||||
this.manualSet(this.options.startColor);
|
||||
|
||||
this.pickerPos.x = this.snippet('curPos').l + this.snippet('curSize', 'int').w;
|
||||
this.pickerPos.y = this.snippet('curPos').t + this.snippet('curSize', 'int').h;
|
||||
this.sliderPos = this.snippet('arrPos') - this.snippet('arrSize', 'int');
|
||||
|
||||
if (Browser.Engine.webkit) this.hide();
|
||||
},
|
||||
|
||||
toggle: function() {
|
||||
this[this.visible ? 'hide' : 'show']()
|
||||
},
|
||||
|
||||
show: function() {
|
||||
this.rePosition();
|
||||
this.layout.setStyle('display', 'block');
|
||||
this.visible = true;
|
||||
},
|
||||
|
||||
hide: function() {
|
||||
this.layout.setStyles({'display': 'none'});
|
||||
this.visible = false;
|
||||
},
|
||||
|
||||
manualSet: function(color, type) {
|
||||
if (!type || (type != 'hsb' && type != 'hex')) type = 'rgb';
|
||||
var rgb, hsb, hex;
|
||||
|
||||
if (type == 'rgb') { rgb = color; hsb = color.rgbToHsb(); hex = color.rgbToHex(); }
|
||||
else if (type == 'hsb') { hsb = color; rgb = color.hsbToRgb(); hex = rgb.rgbToHex(); }
|
||||
else { hex = color; rgb = color.hexToRgb(true); hsb = rgb.rgbToHsb(); }
|
||||
|
||||
this.setMooRainbow(rgb);
|
||||
this.autoSet(hsb);
|
||||
},
|
||||
|
||||
autoSet: function(hsb) {
|
||||
var curH = this.snippet('curSize', 'int').h;
|
||||
var curW = this.snippet('curSize', 'int').w;
|
||||
var oveH = this.layout.overlay.height;
|
||||
var oveW = this.layout.overlay.width;
|
||||
var sliH = this.layout.slider.height;
|
||||
var arwH = this.snippet('arrSize', 'int');
|
||||
var hue;
|
||||
|
||||
var posx = Math.round(((oveW * hsb[1]) / 100) - curW);
|
||||
var posy = Math.round(- ((oveH * hsb[2]) / 100) + oveH - curH);
|
||||
|
||||
var c = Math.round(((sliH * hsb[0]) / 360)); c = (c == 360) ? 0 : c;
|
||||
var position = sliH - c + this.snippet('slider') - arwH;
|
||||
hue = [this.sets.hsb[0], 100, 100].hsbToRgb().rgbToHex();
|
||||
|
||||
this.layout.cursor.setStyles({'top': posy, 'left': posx});
|
||||
this.layout.arrows.setStyle('top', position);
|
||||
this.layout.overlay.setStyle('background-color', hue);
|
||||
this.sliderPos = this.snippet('arrPos') - arwH;
|
||||
this.pickerPos.x = this.snippet('curPos').l + curW;
|
||||
this.pickerPos.y = this.snippet('curPos').t + curH;
|
||||
},
|
||||
|
||||
setMooRainbow: function(color, type) {
|
||||
if (!type || (type != 'hsb' && type != 'hex')) type = 'rgb';
|
||||
var rgb, hsb, hex;
|
||||
|
||||
if (type == 'rgb') { rgb = color; hsb = color.rgbToHsb(); hex = color.rgbToHex(); }
|
||||
else if (type == 'hsb') { hsb = color; rgb = color.hsbToRgb(); hex = rgb.rgbToHex(); }
|
||||
else { hex = color; rgb = color.hexToRgb(); hsb = rgb.rgbToHsb(); }
|
||||
|
||||
this.sets = {
|
||||
rgb: rgb,
|
||||
hsb: hsb,
|
||||
hex: hex
|
||||
};
|
||||
|
||||
if (!$chk(this.pickerPos.x))
|
||||
this.autoSet(hsb);
|
||||
|
||||
this.RedInput.value = rgb[0];
|
||||
this.GreenInput.value = rgb[1];
|
||||
this.BlueInput.value = rgb[2];
|
||||
this.HueInput.value = hsb[0];
|
||||
this.SatuInput.value = hsb[1];
|
||||
this.BrighInput.value = hsb[2];
|
||||
this.hexInput.value = hex;
|
||||
|
||||
this.currentColor = rgb;
|
||||
|
||||
this.chooseColor.setStyle('background-color', rgb.rgbToHex());
|
||||
},
|
||||
|
||||
parseColors: function(x, y, z) {
|
||||
var s = Math.round((x * 100) / this.layout.overlay.width);
|
||||
var b = 100 - Math.round((y * 100) / this.layout.overlay.height);
|
||||
var h = 360 - Math.round((z * 360) / this.layout.slider.height) + this.snippet('slider') - this.snippet('arrSize', 'int');
|
||||
h -= this.snippet('arrSize', 'int');
|
||||
h = (h >= 360) ? 0 : (h < 0) ? 0 : h;
|
||||
s = (s > 100) ? 100 : (s < 0) ? 0 : s;
|
||||
b = (b > 100) ? 100 : (b < 0) ? 0 : b;
|
||||
|
||||
return [h, s, b];
|
||||
},
|
||||
|
||||
OverlayEvents: function() {
|
||||
var lim, curH, curW, inputs;
|
||||
curH = this.snippet('curSize', 'int').h;
|
||||
curW = this.snippet('curSize', 'int').w;
|
||||
inputs = $A(this.arrRGB).concat(this.arrHSB, this.hexInput);
|
||||
|
||||
document.addEvent('click', function() {
|
||||
if(this.visible) this.hide(this.layout);
|
||||
}.bind(this));
|
||||
|
||||
inputs.each(function(el) {
|
||||
if(el) {
|
||||
el.addEvent('keydown', this.eventKeydown.bindWithEvent(this, el));
|
||||
el.addEvent('keyup', this.eventKeyup.bindWithEvent(this, el));
|
||||
}
|
||||
}, this);
|
||||
[this.element, this.layout].each(function(el) {
|
||||
el.addEvents({
|
||||
'click': function(e) { new Event(e).stop();},
|
||||
'keyup': function(e) {
|
||||
e = new Event(e);
|
||||
if(e.key == 'esc' && this.visible) this.hide(this.layout);
|
||||
}.bind(this)
|
||||
}, this);
|
||||
}, this);
|
||||
|
||||
lim = {
|
||||
x: [0 - curW, (this.layout.overlay.width - curW)],
|
||||
y: [0 - curH, (this.layout.overlay.height - curH)]
|
||||
};
|
||||
|
||||
this.layout.drag = new Drag(this.layout.cursor, {
|
||||
limit: lim,
|
||||
onStart: this.overlayDrag.bind(this),
|
||||
onDrag: this.overlayDrag.bind(this),
|
||||
snap: 0
|
||||
});
|
||||
|
||||
this.layout.overlay2.addEvent('mousedown', function(e){
|
||||
e = new Event(e);
|
||||
this.layout.cursor.setStyles({
|
||||
'top': e.page.y - this.layout.overlay.getPosition().y - curH,
|
||||
'left': e.page.x - this.layout.overlay.getPosition().x - curW
|
||||
});
|
||||
this.overlayDrag();
|
||||
this.layout.drag.start(e);
|
||||
}.bind(this));
|
||||
|
||||
this.okButton.addEvent('click', function() {
|
||||
if(this.currentColor == this.options.startColor) {
|
||||
this.hide();
|
||||
this.fireEvent('onComplete', [this.sets, this]);
|
||||
}
|
||||
else {
|
||||
this.backupColor = this.currentColor;
|
||||
this.layout.backup.setStyle('background-color', this.backupColor.rgbToHex());
|
||||
this.hide();
|
||||
this.fireEvent('onComplete', [this.sets, this]);
|
||||
}
|
||||
}.bind(this));
|
||||
},
|
||||
|
||||
overlayDrag: function() {
|
||||
var curH = this.snippet('curSize', 'int').h;
|
||||
var curW = this.snippet('curSize', 'int').w;
|
||||
this.pickerPos.x = this.snippet('curPos').l + curW;
|
||||
this.pickerPos.y = this.snippet('curPos').t + curH;
|
||||
|
||||
this.setMooRainbow(this.parseColors(this.pickerPos.x, this.pickerPos.y, this.sliderPos), 'hsb');
|
||||
this.fireEvent('onChange', [this.sets, this]);
|
||||
},
|
||||
|
||||
sliderEvents: function() {
|
||||
var arwH = this.snippet('arrSize', 'int'), lim;
|
||||
|
||||
lim = [0 + this.snippet('slider') - arwH, this.layout.slider.height - arwH + this.snippet('slider')];
|
||||
this.layout.sliderDrag = new Drag(this.layout.arrows, {
|
||||
limit: {y: lim},
|
||||
modifiers: {x: false},
|
||||
onStart: this.sliderDrag.bind(this),
|
||||
onDrag: this.sliderDrag.bind(this),
|
||||
snap: 0
|
||||
});
|
||||
|
||||
this.layout.slider.addEvent('mousedown', function(e){
|
||||
e = new Event(e);
|
||||
|
||||
this.layout.arrows.setStyle(
|
||||
'top', e.page.y - this.layout.slider.getPosition().y + this.snippet('slider') - arwH
|
||||
);
|
||||
this.sliderDrag();
|
||||
this.layout.sliderDrag.start(e);
|
||||
}.bind(this));
|
||||
},
|
||||
|
||||
sliderDrag: function() {
|
||||
var arwH = this.snippet('arrSize', 'int'), hue;
|
||||
|
||||
this.sliderPos = this.snippet('arrPos') - arwH;
|
||||
this.setMooRainbow(this.parseColors(this.pickerPos.x, this.pickerPos.y, this.sliderPos), 'hsb');
|
||||
hue = [this.sets.hsb[0], 100, 100].hsbToRgb().rgbToHex();
|
||||
this.layout.overlay.setStyle('background-color', hue);
|
||||
this.fireEvent('onChange', [this.sets, this]);
|
||||
},
|
||||
|
||||
backupEvent: function() {
|
||||
this.layout.backup.addEvent('click', function() {
|
||||
this.manualSet(this.backupColor);
|
||||
this.fireEvent('onChange', [this.sets, this]);
|
||||
}.bind(this));
|
||||
},
|
||||
|
||||
wheelEvents: function() {
|
||||
var arrColors = $A(this.arrRGB).extend(this.arrHSB);
|
||||
|
||||
arrColors.each(function(el) {
|
||||
el.addEvents({
|
||||
'mousewheel': this.eventKeys.bindWithEvent(this, el),
|
||||
'keydown': this.eventKeys.bindWithEvent(this, el)
|
||||
});
|
||||
}, this);
|
||||
|
||||
[this.layout.arrows, this.layout.slider].each(function(el) {
|
||||
el.addEvents({
|
||||
'mousewheel': this.eventKeys.bindWithEvent(this, [this.arrHSB[0], 'slider']),
|
||||
'keydown': this.eventKeys.bindWithEvent(this, [this.arrHSB[0], 'slider'])
|
||||
});
|
||||
}, this);
|
||||
},
|
||||
|
||||
eventKeys: function(e, el, id) {
|
||||
var wheel, type;
|
||||
id = (!id) ? el.id : this.arrHSB[0];
|
||||
|
||||
if (e.type == 'keydown') {
|
||||
if (e.key == 'up') wheel = 1;
|
||||
else if (e.key == 'down') wheel = -1;
|
||||
else return;
|
||||
} else if (e.type == Element.Events.mousewheel.base) wheel = (e.wheel > 0) ? 1 : -1;
|
||||
|
||||
if (this.arrRGB.contains(el)) type = 'rgb';
|
||||
else if (this.arrHSB.contains(el)) type = 'hsb';
|
||||
else type = 'hsb';
|
||||
|
||||
if (type == 'rgb') {
|
||||
var rgb = this.sets.rgb, hsb = this.sets.hsb, prefix = this.options.prefix, pass;
|
||||
var value = (el.value.toInt() || 0) + wheel;
|
||||
value = (value > 255) ? 255 : (value < 0) ? 0 : value;
|
||||
|
||||
switch(el.className) {
|
||||
case prefix + 'rInput': pass = [value, rgb[1], rgb[2]]; break;
|
||||
case prefix + 'gInput': pass = [rgb[0], value, rgb[2]]; break;
|
||||
case prefix + 'bInput': pass = [rgb[0], rgb[1], value]; break;
|
||||
default : pass = rgb;
|
||||
}
|
||||
this.manualSet(pass);
|
||||
this.fireEvent('onChange', [this.sets, this]);
|
||||
} else {
|
||||
var rgb = this.sets.rgb, hsb = this.sets.hsb, prefix = this.options.prefix, pass;
|
||||
var value = (el.value.toInt() || 0) + wheel;
|
||||
|
||||
if (el.className.test(/(HueInput)/)) value = (value > 359) ? 0 : (value < 0) ? 0 : value;
|
||||
else value = (value > 100) ? 100 : (value < 0) ? 0 : value;
|
||||
|
||||
switch(el.className) {
|
||||
case prefix + 'HueInput': pass = [value, hsb[1], hsb[2]]; break;
|
||||
case prefix + 'SatuInput': pass = [hsb[0], value, hsb[2]]; break;
|
||||
case prefix + 'BrighInput': pass = [hsb[0], hsb[1], value]; break;
|
||||
default : pass = hsb;
|
||||
}
|
||||
|
||||
this.manualSet(pass, 'hsb');
|
||||
this.fireEvent('onChange', [this.sets, this]);
|
||||
}
|
||||
e.stop();
|
||||
},
|
||||
|
||||
eventKeydown: function(e, el) {
|
||||
var n = e.code, k = e.key;
|
||||
|
||||
if ((!el.className.test(/hexInput/) && !(n >= 48 && n <= 57)) &&
|
||||
(k!='backspace' && k!='tab' && k !='delete' && k!='left' && k!='right'))
|
||||
e.stop();
|
||||
},
|
||||
|
||||
eventKeyup: function(e, el) {
|
||||
var n = e.code, k = e.key, pass, prefix, chr = el.value.charAt(0);
|
||||
|
||||
if (!$chk(el.value)) return;
|
||||
if (el.className.test(/hexInput/)) {
|
||||
if (chr != "#" && el.value.length != 6) return;
|
||||
if (chr == '#' && el.value.length != 7) return;
|
||||
} else {
|
||||
if (!(n >= 48 && n <= 57) && (!['backspace', 'tab', 'delete', 'left', 'right'].contains(k)) && el.value.length > 3) return;
|
||||
}
|
||||
|
||||
prefix = this.options.prefix;
|
||||
|
||||
if (el.className.test(/(rInput|gInput|bInput)/)) {
|
||||
if (el.value < 0 || el.value > 255) return;
|
||||
switch(el.className){
|
||||
case prefix + 'rInput': pass = [el.value, this.sets.rgb[1], this.sets.rgb[2]]; break;
|
||||
case prefix + 'gInput': pass = [this.sets.rgb[0], el.value, this.sets.rgb[2]]; break;
|
||||
case prefix + 'bInput': pass = [this.sets.rgb[0], this.sets.rgb[1], el.value]; break;
|
||||
default : pass = this.sets.rgb;
|
||||
}
|
||||
this.manualSet(pass);
|
||||
this.fireEvent('onChange', [this.sets, this]);
|
||||
}
|
||||
else if (!el.className.test(/hexInput/)) {
|
||||
if (el.className.test(/HueInput/) && el.value < 0 || el.value > 360) return;
|
||||
else if (el.className.test(/HueInput/) && el.value == 360) el.value = 0;
|
||||
else if (el.className.test(/(SatuInput|BrighInput)/) && el.value < 0 || el.value > 100) return;
|
||||
switch(el.className){
|
||||
case prefix + 'HueInput': pass = [el.value, this.sets.hsb[1], this.sets.hsb[2]]; break;
|
||||
case prefix + 'SatuInput': pass = [this.sets.hsb[0], el.value, this.sets.hsb[2]]; break;
|
||||
case prefix + 'BrighInput': pass = [this.sets.hsb[0], this.sets.hsb[1], el.value]; break;
|
||||
default : pass = this.sets.hsb;
|
||||
}
|
||||
this.manualSet(pass, 'hsb');
|
||||
this.fireEvent('onChange', [this.sets, this]);
|
||||
} else {
|
||||
pass = el.value.hexToRgb(true);
|
||||
if (isNaN(pass[0])||isNaN(pass[1])||isNaN(pass[2])) return;
|
||||
|
||||
if ($chk(pass)) {
|
||||
this.manualSet(pass);
|
||||
this.fireEvent('onChange', [this.sets, this]);
|
||||
}
|
||||
}
|
||||
|
||||
},
|
||||
|
||||
doLayout: function() {
|
||||
var id = this.options.id, prefix = this.options.prefix;
|
||||
var idPrefix = id + ' .' + prefix;
|
||||
|
||||
this.layout = new Element('div', {
|
||||
'styles': {'display': 'block', 'position': 'absolute'},
|
||||
'id': id
|
||||
}).inject(document.body);
|
||||
|
||||
var box = new Element('div', {
|
||||
'styles': {'position': 'relative'},
|
||||
'class': prefix + 'box'
|
||||
}).inject(this.layout);
|
||||
|
||||
var div = new Element('div', {
|
||||
'styles': {'position': 'absolute', 'overflow': 'hidden'},
|
||||
'class': prefix + 'overlayBox'
|
||||
}).inject(box);
|
||||
|
||||
var ar = new Element('div', {
|
||||
'styles': {'position': 'absolute', 'zIndex': 1},
|
||||
'class': prefix + 'arrows'
|
||||
}).inject(box);
|
||||
ar.width = ar.getStyle('width').toInt();
|
||||
ar.height = ar.getStyle('height').toInt();
|
||||
|
||||
var ov = new Element('img', {
|
||||
'styles': {'background-color': '#fff', 'position': 'relative', 'zIndex': 2},
|
||||
'src': this.options.imgPath + 'moor_woverlay.png',
|
||||
'class': prefix + 'overlay'
|
||||
}).inject(div);
|
||||
|
||||
var ov2 = new Element('img', {
|
||||
'styles': {'position': 'absolute', 'top': 0, 'left': 0, 'zIndex': 2},
|
||||
'src': this.options.imgPath + 'moor_boverlay.png',
|
||||
'class': prefix + 'overlay'
|
||||
}).inject(div);
|
||||
|
||||
if (Browser.Engine.trident4) {
|
||||
div.setStyle('overflow', '');
|
||||
var src = ov.src;
|
||||
ov.src = this.options.imgPath + 'blank.gif';
|
||||
ov.style.filter = "progid:DXImageTransform.Microsoft.AlphaImageLoader(src='" + src + "', sizingMethod='scale')";
|
||||
src = ov2.src;
|
||||
ov2.src = this.options.imgPath + 'blank.gif';
|
||||
ov2.style.filter = "progid:DXImageTransform.Microsoft.AlphaImageLoader(src='" + src + "', sizingMethod='scale')";
|
||||
}
|
||||
ov.width = ov2.width = div.getStyle('width').toInt();
|
||||
ov.height = ov2.height = div.getStyle('height').toInt();
|
||||
|
||||
var cr = new Element('div', {
|
||||
'styles': {'overflow': 'hidden', 'position': 'absolute', 'zIndex': 2},
|
||||
'class': prefix + 'cursor'
|
||||
}).inject(div);
|
||||
cr.width = cr.getStyle('width').toInt();
|
||||
cr.height = cr.getStyle('height').toInt();
|
||||
|
||||
var sl = new Element('img', {
|
||||
'styles': {'position': 'absolute', 'z-index': 2},
|
||||
'src': this.options.imgPath + 'moor_slider.png',
|
||||
'class': prefix + 'slider'
|
||||
}).inject(box);
|
||||
this.layout.slider = sl;
|
||||
sl.width = sl.getStyle('width').toInt();
|
||||
sl.height = sl.getStyle('height').toInt();
|
||||
|
||||
new Element('div', {
|
||||
'styles': {'position': 'absolute'},
|
||||
'class': prefix + 'colorBox'
|
||||
}).inject(box);
|
||||
|
||||
new Element('div', {
|
||||
'styles': {'zIndex': 2, 'position': 'absolute'},
|
||||
'class': prefix + 'chooseColor'
|
||||
}).inject(box);
|
||||
|
||||
this.layout.backup = new Element('div', {
|
||||
'styles': {'zIndex': 2, 'position': 'absolute', 'cursor': 'pointer'},
|
||||
'class': prefix + 'currentColor'
|
||||
}).inject(box);
|
||||
|
||||
var R = new Element('label').inject(box).setStyle('position', 'absolute');
|
||||
var G = R.clone().inject(box).addClass(prefix + 'gLabel').set('html', 'G: ');
|
||||
var B = R.clone().inject(box).addClass(prefix + 'bLabel').set('html', 'B: ');
|
||||
R.set('html', 'R: ').addClass(prefix + 'rLabel');
|
||||
|
||||
var inputR = new Element('input');
|
||||
var inputG = inputR.clone().inject(G).addClass(prefix + 'gInput');
|
||||
var inputB = inputR.clone().inject(B).addClass(prefix + 'bInput');
|
||||
inputR.inject(R).addClass(prefix + 'rInput');
|
||||
|
||||
var HU = new Element('label').inject(box).setStyle('position', 'absolute');
|
||||
var SA = HU.clone().inject(box).addClass(prefix + 'SatuLabel').set('html', 'S: ');
|
||||
var BR = HU.clone().inject(box).addClass(prefix + 'BrighLabel').set('html', 'B: ');
|
||||
HU.set('html', 'H: ').addClass(prefix + 'HueLabel');
|
||||
|
||||
var inputHU = new Element('input');
|
||||
var inputSA = inputHU.clone().inject(SA).addClass(prefix + 'SatuInput');
|
||||
var inputBR = inputHU.clone().inject(BR).addClass(prefix + 'BrighInput');
|
||||
inputHU.inject(HU).addClass(prefix + 'HueInput');
|
||||
SA.innerHTML += " %"; BR.innerHTML += " %";
|
||||
SP = new Element('span', {'styles': {'position': 'absolute'}, 'class': prefix + 'ballino'})
|
||||
SP.innerHTML = " °"
|
||||
SP.inject(HU,'after');
|
||||
|
||||
var hex = new Element('label').inject(box).setStyle('position', 'absolute').addClass(prefix + 'hexLabel').set('html', '#hex: ').adopt(new Element('input').addClass(prefix + 'hexInput'));
|
||||
|
||||
var ok = new Element('input', {
|
||||
'styles': {'position': 'absolute'},
|
||||
'type': 'button',
|
||||
'value': this.options.selectText,
|
||||
'class': prefix + 'okButton'
|
||||
}).inject(box);
|
||||
|
||||
this.rePosition();
|
||||
|
||||
var overlays = $$('#' + id + ' .' + prefix + 'overlay');
|
||||
this.layout.overlay = overlays[0];
|
||||
this.layout.overlay2 = overlays[1];
|
||||
this.layout.cursor = cr;
|
||||
this.layout.arrows = ar;
|
||||
this.chooseColor = this.layout.getElement('.' + prefix + 'chooseColor');
|
||||
this.RedInput = inputR;
|
||||
this.GreenInput = inputG;
|
||||
this.BlueInput = inputB;
|
||||
this.HueInput = inputHU;
|
||||
this.SatuInput = this.layout.getElement('.' + prefix + 'SatuInput');
|
||||
this.BrighInput = this.layout.getElement('.' + prefix + 'BrighInput');
|
||||
this.hexInput = this.layout.getElement('.' + prefix + 'hexInput');;
|
||||
|
||||
this.arrRGB = [this.RedInput, this.GreenInput, this.BlueInput];
|
||||
this.arrHSB = [this.HueInput, this.SatuInput, this.BrighInput];
|
||||
this.okButton = ok;
|
||||
|
||||
if (!Browser.Engine.webkit419) this.hide();
|
||||
},
|
||||
rePosition: function() {
|
||||
var coords = this.element.getCoordinates();
|
||||
this.layout.setStyles({
|
||||
'left': coords.left,
|
||||
'top': coords.top + coords.height + 1
|
||||
});
|
||||
},
|
||||
|
||||
snippet: function(mode, type) {
|
||||
var size; type = (type) ? type : 'none';
|
||||
|
||||
switch(mode) {
|
||||
case 'arrPos':
|
||||
var t = this.layout.arrows.getStyle('top').toInt();
|
||||
size = t;
|
||||
break;
|
||||
case 'arrSize':
|
||||
var h = this.layout.arrows.height;
|
||||
h = (type == 'int') ? (h/2).toInt() : h;
|
||||
size = h;
|
||||
break;
|
||||
case 'curPos':
|
||||
var l = this.layout.cursor.getStyle('left').toInt();
|
||||
var t = this.layout.cursor.getStyle('top').toInt();
|
||||
size = {'l': l, 't': t};
|
||||
break;
|
||||
case 'slider':
|
||||
var t = this.layout.slider.getStyle('marginTop').toInt();
|
||||
size = t;
|
||||
break;
|
||||
default :
|
||||
var h = this.layout.cursor.height;
|
||||
var w = this.layout.cursor.width;
|
||||
h = (type == 'int') ? (h/2).toInt() : h;
|
||||
w = (type == 'int') ? (w/2).toInt() : w;
|
||||
size = {w: w, h: h};
|
||||
};
|
||||
return size;
|
||||
}
|
||||
});
|
@@ -1,16 +0,0 @@
|
||||
window.addEvent('domready', function() {
|
||||
var r = new MooRainbow('myRainbow', {
|
||||
'startColor': [58, 142, 246],
|
||||
'imgPath': 'js/mooRainbow/images/',
|
||||
'onChange': function(color) {
|
||||
top.frame_navigation.document.getElementById('body_leftFrame').style.backgroundColor = color.hex;
|
||||
top.frame_navigation.document.getElementById('pmalogo').style.backgroundColor = color.hex;
|
||||
top.frame_content.document.body.style.backgroundColor = color.hex;
|
||||
},
|
||||
'onComplete': function(color) {
|
||||
top.frame_content.document.getElementById('rainbowform').custom_color.value = color.hex;
|
||||
top.frame_content.document.getElementById('rainbowform').custom_color_rgb.value = color.rgb;
|
||||
top.frame_content.document.getElementById('rainbowform').submit();
|
||||
}
|
||||
});
|
||||
});
|
496
js/mootools.js
@@ -1,496 +0,0 @@
|
||||
//MooTools, <http://mootools.net>, My Object Oriented (JavaScript) Tools. Copyright (c) 2006-2008 Valerio Proietti, <http://mad4milk.net>, MIT Style License.
|
||||
|
||||
var MooTools={version:"1.2.0",build:""};var Native=function(J){J=J||{};var F=J.afterImplement||function(){};var G=J.generics;G=(G!==false);var H=J.legacy;
|
||||
var E=J.initialize;var B=J.protect;var A=J.name;var C=E||H;C.constructor=Native;C.$family={name:"native"};if(H&&E){C.prototype=H.prototype;}C.prototype.constructor=C;
|
||||
if(A){var D=A.toLowerCase();C.prototype.$family={name:D};Native.typize(C,D);}var I=function(M,K,N,L){if(!B||L||!M.prototype[K]){M.prototype[K]=N;}if(G){Native.genericize(M,K,B);
|
||||
}F.call(M,K,N);return M;};C.implement=function(L,K,N){if(typeof L=="string"){return I(this,L,K,N);}for(var M in L){I(this,M,L[M],K);}return this;};C.alias=function(M,K,N){if(typeof M=="string"){M=this.prototype[M];
|
||||
if(M){I(this,K,M,N);}}else{for(var L in M){this.alias(L,M[L],K);}}return this;};return C;};Native.implement=function(D,C){for(var B=0,A=D.length;B<A;B++){D[B].implement(C);
|
||||
}};Native.genericize=function(B,C,A){if((!A||!B[C])&&typeof B.prototype[C]=="function"){B[C]=function(){var D=Array.prototype.slice.call(arguments);return B.prototype[C].apply(D.shift(),D);
|
||||
};}};Native.typize=function(A,B){if(!A.type){A.type=function(C){return($type(C)===B);};}};Native.alias=function(E,B,A,F){for(var D=0,C=E.length;D<C;D++){E[D].alias(B,A,F);
|
||||
}};(function(B){for(var A in B){Native.typize(B[A],A);}})({"boolean":Boolean,"native":Native,object:Object});(function(B){for(var A in B){new Native({name:A,initialize:B[A],protect:true});
|
||||
}})({String:String,Function:Function,Number:Number,Array:Array,RegExp:RegExp,Date:Date});(function(B,A){for(var C=A.length;C--;C){Native.genericize(B,A[C],true);
|
||||
}return arguments.callee;})(Array,["pop","push","reverse","shift","sort","splice","unshift","concat","join","slice","toString","valueOf","indexOf","lastIndexOf"])(String,["charAt","charCodeAt","concat","indexOf","lastIndexOf","match","replace","search","slice","split","substr","substring","toLowerCase","toUpperCase","valueOf"]);
|
||||
function $chk(A){return !!(A||A===0);}function $clear(A){clearTimeout(A);clearInterval(A);return null;}function $defined(A){return(A!=undefined);}function $empty(){}function $arguments(A){return function(){return arguments[A];
|
||||
};}function $lambda(A){return(typeof A=="function")?A:function(){return A;};}function $extend(C,A){for(var B in (A||{})){C[B]=A[B];}return C;}function $unlink(C){var B;
|
||||
switch($type(C)){case"object":B={};for(var E in C){B[E]=$unlink(C[E]);}break;case"hash":B=$unlink(C.getClean());break;case"array":B=[];for(var D=0,A=C.length;
|
||||
D<A;D++){B[D]=$unlink(C[D]);}break;default:return C;}return B;}function $merge(){var E={};for(var D=0,A=arguments.length;D<A;D++){var B=arguments[D];if($type(B)!="object"){continue;
|
||||
}for(var C in B){var G=B[C],F=E[C];E[C]=(F&&$type(G)=="object"&&$type(F)=="object")?$merge(F,G):$unlink(G);}}return E;}function $pick(){for(var B=0,A=arguments.length;
|
||||
B<A;B++){if(arguments[B]!=undefined){return arguments[B];}}return null;}function $random(B,A){return Math.floor(Math.random()*(A-B+1)+B);}function $splat(B){var A=$type(B);
|
||||
return(A)?((A!="array"&&A!="arguments")?[B]:B):[];}var $time=Date.now||function(){return new Date().getTime();};function $try(){for(var B=0,A=arguments.length;
|
||||
B<A;B++){try{return arguments[B]();}catch(C){}}return null;}function $type(A){if(A==undefined){return false;}if(A.$family){return(A.$family.name=="number"&&!isFinite(A))?false:A.$family.name;
|
||||
}if(A.nodeName){switch(A.nodeType){case 1:return"element";case 3:return(/\S/).test(A.nodeValue)?"textnode":"whitespace";}}else{if(typeof A.length=="number"){if(A.callee){return"arguments";
|
||||
}else{if(A.item){return"collection";}}}}return typeof A;}var Hash=new Native({name:"Hash",initialize:function(A){if($type(A)=="hash"){A=$unlink(A.getClean());
|
||||
}for(var B in A){this[B]=A[B];}return this;}});Hash.implement({getLength:function(){var B=0;for(var A in this){if(this.hasOwnProperty(A)){B++;}}return B;
|
||||
},forEach:function(B,C){for(var A in this){if(this.hasOwnProperty(A)){B.call(C,this[A],A,this);}}},getClean:function(){var B={};for(var A in this){if(this.hasOwnProperty(A)){B[A]=this[A];
|
||||
}}return B;}});Hash.alias("forEach","each");function $H(A){return new Hash(A);}Array.implement({forEach:function(C,D){for(var B=0,A=this.length;B<A;B++){C.call(D,this[B],B,this);
|
||||
}}});Array.alias("forEach","each");function $A(C){if(C.item){var D=[];for(var B=0,A=C.length;B<A;B++){D[B]=C[B];}return D;}return Array.prototype.slice.call(C);
|
||||
}function $each(C,B,D){var A=$type(C);((A=="arguments"||A=="collection"||A=="array")?Array:Hash).each(C,B,D);}var Browser=new Hash({Engine:{name:"unknown",version:""},Platform:{name:(navigator.platform.match(/mac|win|linux/i)||["other"])[0].toLowerCase()},Features:{xpath:!!(document.evaluate),air:!!(window.runtime)},Plugins:{}});
|
||||
if(window.opera){Browser.Engine={name:"presto",version:(document.getElementsByClassName)?950:925};}else{if(window.ActiveXObject){Browser.Engine={name:"trident",version:(window.XMLHttpRequest)?5:4};
|
||||
}else{if(!navigator.taintEnabled){Browser.Engine={name:"webkit",version:(Browser.Features.xpath)?420:419};}else{if(document.getBoxObjectFor!=null){Browser.Engine={name:"gecko",version:(document.getElementsByClassName)?19:18};
|
||||
}}}}Browser.Engine[Browser.Engine.name]=Browser.Engine[Browser.Engine.name+Browser.Engine.version]=true;if(window.orientation!=undefined){Browser.Platform.name="ipod";
|
||||
}Browser.Platform[Browser.Platform.name]=true;Browser.Request=function(){return $try(function(){return new XMLHttpRequest();},function(){return new ActiveXObject("MSXML2.XMLHTTP");
|
||||
});};Browser.Features.xhr=!!(Browser.Request());Browser.Plugins.Flash=(function(){var A=($try(function(){return navigator.plugins["Shockwave Flash"].description;
|
||||
},function(){return new ActiveXObject("ShockwaveFlash.ShockwaveFlash").GetVariable("$version");})||"0 r0").match(/\d+/g);return{version:parseInt(A[0]||0+"."+A[1]||0),build:parseInt(A[2]||0)};
|
||||
})();function $exec(B){if(!B){return B;}if(window.execScript){window.execScript(B);}else{var A=document.createElement("script");A.setAttribute("type","text/javascript");
|
||||
A.text=B;document.head.appendChild(A);document.head.removeChild(A);}return B;}Native.UID=1;var $uid=(Browser.Engine.trident)?function(A){return(A.uid||(A.uid=[Native.UID++]))[0];
|
||||
}:function(A){return A.uid||(A.uid=Native.UID++);};var Window=new Native({name:"Window",legacy:(Browser.Engine.trident)?null:window.Window,initialize:function(A){$uid(A);
|
||||
if(!A.Element){A.Element=$empty;if(Browser.Engine.webkit){A.document.createElement("iframe");}A.Element.prototype=(Browser.Engine.webkit)?window["[[DOMElement.prototype]]"]:{};
|
||||
}return $extend(A,Window.Prototype);},afterImplement:function(B,A){window[B]=Window.Prototype[B]=A;}});Window.Prototype={$family:{name:"window"}};new Window(window);
|
||||
var Document=new Native({name:"Document",legacy:(Browser.Engine.trident)?null:window.Document,initialize:function(A){$uid(A);A.head=A.getElementsByTagName("head")[0];
|
||||
A.html=A.getElementsByTagName("html")[0];A.window=A.defaultView||A.parentWindow;if(Browser.Engine.trident4){$try(function(){A.execCommand("BackgroundImageCache",false,true);
|
||||
});}return $extend(A,Document.Prototype);},afterImplement:function(B,A){document[B]=Document.Prototype[B]=A;}});Document.Prototype={$family:{name:"document"}};
|
||||
new Document(document);Array.implement({every:function(C,D){for(var B=0,A=this.length;B<A;B++){if(!C.call(D,this[B],B,this)){return false;}}return true;
|
||||
},filter:function(D,E){var C=[];for(var B=0,A=this.length;B<A;B++){if(D.call(E,this[B],B,this)){C.push(this[B]);}}return C;},clean:function(){return this.filter($defined);
|
||||
},indexOf:function(C,D){var A=this.length;for(var B=(D<0)?Math.max(0,A+D):D||0;B<A;B++){if(this[B]===C){return B;}}return -1;},map:function(D,E){var C=[];
|
||||
for(var B=0,A=this.length;B<A;B++){C[B]=D.call(E,this[B],B,this);}return C;},some:function(C,D){for(var B=0,A=this.length;B<A;B++){if(C.call(D,this[B],B,this)){return true;
|
||||
}}return false;},associate:function(C){var D={},B=Math.min(this.length,C.length);for(var A=0;A<B;A++){D[C[A]]=this[A];}return D;},link:function(C){var A={};
|
||||
for(var E=0,B=this.length;E<B;E++){for(var D in C){if(C[D](this[E])){A[D]=this[E];delete C[D];break;}}}return A;},contains:function(A,B){return this.indexOf(A,B)!=-1;
|
||||
},extend:function(C){for(var B=0,A=C.length;B<A;B++){this.push(C[B]);}return this;},getLast:function(){return(this.length)?this[this.length-1]:null;},getRandom:function(){return(this.length)?this[$random(0,this.length-1)]:null;
|
||||
},include:function(A){if(!this.contains(A)){this.push(A);}return this;},combine:function(C){for(var B=0,A=C.length;B<A;B++){this.include(C[B]);}return this;
|
||||
},erase:function(B){for(var A=this.length;A--;A){if(this[A]===B){this.splice(A,1);}}return this;},empty:function(){this.length=0;return this;},flatten:function(){var D=[];
|
||||
for(var B=0,A=this.length;B<A;B++){var C=$type(this[B]);if(!C){continue;}D=D.concat((C=="array"||C=="collection"||C=="arguments")?Array.flatten(this[B]):this[B]);
|
||||
}return D;},hexToRgb:function(B){if(this.length!=3){return null;}var A=this.map(function(C){if(C.length==1){C+=C;}return C.toInt(16);});return(B)?A:"rgb("+A+")";
|
||||
},rgbToHex:function(D){if(this.length<3){return null;}if(this.length==4&&this[3]==0&&!D){return"transparent";}var B=[];for(var A=0;A<3;A++){var C=(this[A]-0).toString(16);
|
||||
B.push((C.length==1)?"0"+C:C);}return(D)?B:"#"+B.join("");}});Function.implement({extend:function(A){for(var B in A){this[B]=A[B];}return this;},create:function(B){var A=this;
|
||||
B=B||{};return function(D){var C=B.arguments;C=(C!=undefined)?$splat(C):Array.slice(arguments,(B.event)?1:0);if(B.event){C=[D||window.event].extend(C);
|
||||
}var E=function(){return A.apply(B.bind||null,C);};if(B.delay){return setTimeout(E,B.delay);}if(B.periodical){return setInterval(E,B.periodical);}if(B.attempt){return $try(E);
|
||||
}return E();};},pass:function(A,B){return this.create({arguments:A,bind:B});},attempt:function(A,B){return this.create({arguments:A,bind:B,attempt:true})();
|
||||
},bind:function(B,A){return this.create({bind:B,arguments:A});},bindWithEvent:function(B,A){return this.create({bind:B,event:true,arguments:A});},delay:function(B,C,A){return this.create({delay:B,bind:C,arguments:A})();
|
||||
},periodical:function(A,C,B){return this.create({periodical:A,bind:C,arguments:B})();},run:function(A,B){return this.apply(B,$splat(A));}});Number.implement({limit:function(B,A){return Math.min(A,Math.max(B,this));
|
||||
},round:function(A){A=Math.pow(10,A||0);return Math.round(this*A)/A;},times:function(B,C){for(var A=0;A<this;A++){B.call(C,A,this);}},toFloat:function(){return parseFloat(this);
|
||||
},toInt:function(A){return parseInt(this,A||10);}});Number.alias("times","each");(function(B){var A={};B.each(function(C){if(!Number[C]){A[C]=function(){return Math[C].apply(null,[this].concat($A(arguments)));
|
||||
};}});Number.implement(A);})(["abs","acos","asin","atan","atan2","ceil","cos","exp","floor","log","max","min","pow","sin","sqrt","tan"]);String.implement({test:function(A,B){return((typeof A=="string")?new RegExp(A,B):A).test(this);
|
||||
},contains:function(A,B){return(B)?(B+this+B).indexOf(B+A+B)>-1:this.indexOf(A)>-1;},trim:function(){return this.replace(/^\s+|\s+$/g,"");},clean:function(){return this.replace(/\s+/g," ").trim();
|
||||
},camelCase:function(){return this.replace(/-\D/g,function(A){return A.charAt(1).toUpperCase();});},hyphenate:function(){return this.replace(/[A-Z]/g,function(A){return("-"+A.charAt(0).toLowerCase());
|
||||
});},capitalize:function(){return this.replace(/\b[a-z]/g,function(A){return A.toUpperCase();});},escapeRegExp:function(){return this.replace(/([-.*+?^${}()|[\]\/\\])/g,"\\$1");
|
||||
},toInt:function(A){return parseInt(this,A||10);},toFloat:function(){return parseFloat(this);},hexToRgb:function(B){var A=this.match(/^#?(\w{1,2})(\w{1,2})(\w{1,2})$/);
|
||||
return(A)?A.slice(1).hexToRgb(B):null;},rgbToHex:function(B){var A=this.match(/\d{1,3}/g);return(A)?A.rgbToHex(B):null;},stripScripts:function(B){var A="";
|
||||
var C=this.replace(/<script[^>]*>([\s\S]*?)<\/script>/gi,function(){A+=arguments[1]+"\n";return"";});if(B===true){$exec(A);}else{if($type(B)=="function"){B(A,C);
|
||||
}}return C;},substitute:function(A,B){return this.replace(B||(/\\?\{([^}]+)\}/g),function(D,C){if(D.charAt(0)=="\\"){return D.slice(1);}return(A[C]!=undefined)?A[C]:"";
|
||||
});}});Hash.implement({has:Object.prototype.hasOwnProperty,keyOf:function(B){for(var A in this){if(this.hasOwnProperty(A)&&this[A]===B){return A;}}return null;
|
||||
},hasValue:function(A){return(Hash.keyOf(this,A)!==null);},extend:function(A){Hash.each(A,function(C,B){Hash.set(this,B,C);},this);return this;},combine:function(A){Hash.each(A,function(C,B){Hash.include(this,B,C);
|
||||
},this);return this;},erase:function(A){if(this.hasOwnProperty(A)){delete this[A];}return this;},get:function(A){return(this.hasOwnProperty(A))?this[A]:null;
|
||||
},set:function(A,B){if(!this[A]||this.hasOwnProperty(A)){this[A]=B;}return this;},empty:function(){Hash.each(this,function(B,A){delete this[A];},this);
|
||||
return this;},include:function(B,C){var A=this[B];if(A==undefined){this[B]=C;}return this;},map:function(B,C){var A=new Hash;Hash.each(this,function(E,D){A.set(D,B.call(C,E,D,this));
|
||||
},this);return A;},filter:function(B,C){var A=new Hash;Hash.each(this,function(E,D){if(B.call(C,E,D,this)){A.set(D,E);}},this);return A;},every:function(B,C){for(var A in this){if(this.hasOwnProperty(A)&&!B.call(C,this[A],A)){return false;
|
||||
}}return true;},some:function(B,C){for(var A in this){if(this.hasOwnProperty(A)&&B.call(C,this[A],A)){return true;}}return false;},getKeys:function(){var A=[];
|
||||
Hash.each(this,function(C,B){A.push(B);});return A;},getValues:function(){var A=[];Hash.each(this,function(B){A.push(B);});return A;},toQueryString:function(A){var B=[];
|
||||
Hash.each(this,function(F,E){if(A){E=A+"["+E+"]";}var D;switch($type(F)){case"object":D=Hash.toQueryString(F,E);break;case"array":var C={};F.each(function(H,G){C[G]=H;
|
||||
});D=Hash.toQueryString(C,E);break;default:D=E+"="+encodeURIComponent(F);}if(F!=undefined){B.push(D);}});return B.join("&");}});Hash.alias({keyOf:"indexOf",hasValue:"contains"});
|
||||
var Event=new Native({name:"Event",initialize:function(A,F){F=F||window;var K=F.document;A=A||F.event;if(A.$extended){return A;}this.$extended=true;var J=A.type;
|
||||
var G=A.target||A.srcElement;while(G&&G.nodeType==3){G=G.parentNode;}if(J.test(/key/)){var B=A.which||A.keyCode;var M=Event.Keys.keyOf(B);if(J=="keydown"){var D=B-111;
|
||||
if(D>0&&D<13){M="f"+D;}}M=M||String.fromCharCode(B).toLowerCase();}else{if(J.match(/(click|mouse|menu)/i)){K=(!K.compatMode||K.compatMode=="CSS1Compat")?K.html:K.body;
|
||||
var I={x:A.pageX||A.clientX+K.scrollLeft,y:A.pageY||A.clientY+K.scrollTop};var C={x:(A.pageX)?A.pageX-F.pageXOffset:A.clientX,y:(A.pageY)?A.pageY-F.pageYOffset:A.clientY};
|
||||
if(J.match(/DOMMouseScroll|mousewheel/)){var H=(A.wheelDelta)?A.wheelDelta/120:-(A.detail||0)/3;}var E=(A.which==3)||(A.button==2);var L=null;if(J.match(/over|out/)){switch(J){case"mouseover":L=A.relatedTarget||A.fromElement;
|
||||
break;case"mouseout":L=A.relatedTarget||A.toElement;}if(!(function(){while(L&&L.nodeType==3){L=L.parentNode;}return true;}).create({attempt:Browser.Engine.gecko})()){L=false;
|
||||
}}}}return $extend(this,{event:A,type:J,page:I,client:C,rightClick:E,wheel:H,relatedTarget:L,target:G,code:B,key:M,shift:A.shiftKey,control:A.ctrlKey,alt:A.altKey,meta:A.metaKey});
|
||||
}});Event.Keys=new Hash({enter:13,up:38,down:40,left:37,right:39,esc:27,space:32,backspace:8,tab:9,"delete":46});Event.implement({stop:function(){return this.stopPropagation().preventDefault();
|
||||
},stopPropagation:function(){if(this.event.stopPropagation){this.event.stopPropagation();}else{this.event.cancelBubble=true;}return this;},preventDefault:function(){if(this.event.preventDefault){this.event.preventDefault();
|
||||
}else{this.event.returnValue=false;}return this;}});var Class=new Native({name:"Class",initialize:function(B){B=B||{};var A=function(E){for(var D in this){this[D]=$unlink(this[D]);
|
||||
}for(var F in Class.Mutators){if(!this[F]){continue;}Class.Mutators[F](this,this[F]);delete this[F];}this.constructor=A;if(E===$empty){return this;}var C=(this.initialize)?this.initialize.apply(this,arguments):this;
|
||||
if(this.options&&this.options.initialize){this.options.initialize.call(this);}return C;};$extend(A,this);A.constructor=Class;A.prototype=B;return A;}});
|
||||
Class.implement({implement:function(){Class.Mutators.Implements(this.prototype,Array.slice(arguments));return this;}});Class.Mutators={Implements:function(A,B){$splat(B).each(function(C){$extend(A,($type(C)=="class")?new C($empty):C);
|
||||
});},Extends:function(self,klass){var instance=new klass($empty);delete instance.parent;delete instance.parentOf;for(var key in instance){var current=self[key],previous=instance[key];
|
||||
if(current==undefined){self[key]=previous;continue;}var ctype=$type(current),ptype=$type(previous);if(ctype!=ptype){continue;}switch(ctype){case"function":if(!arguments.callee.caller){self[key]=eval("("+String(current).replace(/\bthis\.parent\(\s*(\))?/g,function(full,close){return"arguments.callee._parent_.call(this"+(close||", ");
|
||||
})+")");}self[key]._parent_=previous;break;case"object":self[key]=$merge(previous,current);}}self.parent=function(){return arguments.callee.caller._parent_.apply(this,arguments);
|
||||
};self.parentOf=function(descendant){return descendant._parent_.apply(this,Array.slice(arguments,1));};}};var Chain=new Class({chain:function(){this.$chain=(this.$chain||[]).extend(arguments);
|
||||
return this;},callChain:function(){return(this.$chain&&this.$chain.length)?this.$chain.shift().apply(this,arguments):false;},clearChain:function(){if(this.$chain){this.$chain.empty();
|
||||
}return this;}});var Events=new Class({addEvent:function(C,B,A){C=Events.removeOn(C);if(B!=$empty){this.$events=this.$events||{};this.$events[C]=this.$events[C]||[];
|
||||
this.$events[C].include(B);if(A){B.internal=true;}}return this;},addEvents:function(A){for(var B in A){this.addEvent(B,A[B]);}return this;},fireEvent:function(C,B,A){C=Events.removeOn(C);
|
||||
if(!this.$events||!this.$events[C]){return this;}this.$events[C].each(function(D){D.create({bind:this,delay:A,"arguments":B})();},this);return this;},removeEvent:function(B,A){B=Events.removeOn(B);
|
||||
if(!this.$events||!this.$events[B]){return this;}if(!A.internal){this.$events[B].erase(A);}return this;},removeEvents:function(C){for(var D in this.$events){if(C&&C!=D){continue;
|
||||
}var B=this.$events[D];for(var A=B.length;A--;A){this.removeEvent(D,B[A]);}}return this;}});Events.removeOn=function(A){return A.replace(/^on([A-Z])/,function(B,C){return C.toLowerCase();
|
||||
});};var Options=new Class({setOptions:function(){this.options=$merge.run([this.options].extend(arguments));if(!this.addEvent){return this;}for(var A in this.options){if($type(this.options[A])!="function"||!(/^on[A-Z]/).test(A)){continue;
|
||||
}this.addEvent(A,this.options[A]);delete this.options[A];}return this;}});Document.implement({newElement:function(A,B){if(Browser.Engine.trident&&B){["name","type","checked"].each(function(C){if(!B[C]){return ;
|
||||
}A+=" "+C+'="'+B[C]+'"';if(C!="checked"){delete B[C];}});A="<"+A+">";}return $.element(this.createElement(A)).set(B);},newTextNode:function(A){return this.createTextNode(A);
|
||||
},getDocument:function(){return this;},getWindow:function(){return this.defaultView||this.parentWindow;},purge:function(){var C=this.getElementsByTagName("*");
|
||||
for(var B=0,A=C.length;B<A;B++){Browser.freeMem(C[B]);}}});var Element=new Native({name:"Element",legacy:window.Element,initialize:function(A,B){var C=Element.Constructors.get(A);
|
||||
if(C){return C(B);}if(typeof A=="string"){return document.newElement(A,B);}return $(A).set(B);},afterImplement:function(A,B){if(!Array[A]){Elements.implement(A,Elements.multi(A));
|
||||
}Element.Prototype[A]=B;}});Element.Prototype={$family:{name:"element"}};Element.Constructors=new Hash;var IFrame=new Native({name:"IFrame",generics:false,initialize:function(){var E=Array.link(arguments,{properties:Object.type,iframe:$defined});
|
||||
var C=E.properties||{};var B=$(E.iframe)||false;var D=C.onload||$empty;delete C.onload;C.id=C.name=$pick(C.id,C.name,B.id,B.name,"IFrame_"+$time());B=new Element(B||"iframe",C);
|
||||
var A=function(){var F=$try(function(){return B.contentWindow.location.host;});if(F&&F==window.location.host){var H=new Window(B.contentWindow);var G=new Document(B.contentWindow.document);
|
||||
$extend(H.Element.prototype,Element.Prototype);}D.call(B.contentWindow,B.contentWindow.document);};(!window.frames[C.id])?B.addListener("load",A):A();return B;
|
||||
}});var Elements=new Native({initialize:function(F,B){B=$extend({ddup:true,cash:true},B);F=F||[];if(B.ddup||B.cash){var G={},E=[];for(var C=0,A=F.length;
|
||||
C<A;C++){var D=$.element(F[C],!B.cash);if(B.ddup){if(G[D.uid]){continue;}G[D.uid]=true;}E.push(D);}F=E;}return(B.cash)?$extend(F,this):F;}});Elements.implement({filter:function(A,B){if(!A){return this;
|
||||
}return new Elements(Array.filter(this,(typeof A=="string")?function(C){return C.match(A);}:A,B));}});Elements.multi=function(A){return function(){var B=[];
|
||||
var F=true;for(var D=0,C=this.length;D<C;D++){var E=this[D][A].apply(this[D],arguments);B.push(E);if(F){F=($type(E)=="element");}}return(F)?new Elements(B):B;
|
||||
};};Window.implement({$:function(B,C){if(B&&B.$family&&B.uid){return B;}var A=$type(B);return($[A])?$[A](B,C,this.document):null;},$$:function(A){if(arguments.length==1&&typeof A=="string"){return this.document.getElements(A);
|
||||
}var F=[];var C=Array.flatten(arguments);for(var D=0,B=C.length;D<B;D++){var E=C[D];switch($type(E)){case"element":E=[E];break;case"string":E=this.document.getElements(E,true);
|
||||
break;default:E=false;}if(E){F.extend(E);}}return new Elements(F);},getDocument:function(){return this.document;},getWindow:function(){return this;}});
|
||||
$.string=function(C,B,A){C=A.getElementById(C);return(C)?$.element(C,B):null;};$.element=function(A,D){$uid(A);if(!D&&!A.$family&&!(/^object|embed$/i).test(A.tagName)){var B=Element.Prototype;
|
||||
for(var C in B){A[C]=B[C];}}return A;};$.object=function(B,C,A){if(B.toElement){return $.element(B.toElement(A),C);}return null;};$.textnode=$.whitespace=$.window=$.document=$arguments(0);
|
||||
Native.implement([Element,Document],{getElement:function(A,B){return $(this.getElements(A,true)[0]||null,B);},getElements:function(A,D){A=A.split(",");
|
||||
var C=[];var B=(A.length>1);A.each(function(E){var F=this.getElementsByTagName(E.trim());(B)?C.extend(F):C=F;},this);return new Elements(C,{ddup:B,cash:!D});
|
||||
}});Element.Storage={get:function(A){return(this[A]||(this[A]={}));}};Element.Inserters=new Hash({before:function(B,A){if(A.parentNode){A.parentNode.insertBefore(B,A);
|
||||
}},after:function(B,A){if(!A.parentNode){return ;}var C=A.nextSibling;(C)?A.parentNode.insertBefore(B,C):A.parentNode.appendChild(B);},bottom:function(B,A){A.appendChild(B);
|
||||
},top:function(B,A){var C=A.firstChild;(C)?A.insertBefore(B,C):A.appendChild(B);}});Element.Inserters.inside=Element.Inserters.bottom;Element.Inserters.each(function(C,B){var A=B.capitalize();
|
||||
Element.implement("inject"+A,function(D){C(this,$(D,true));return this;});Element.implement("grab"+A,function(D){C($(D,true),this);return this;});});Element.implement({getDocument:function(){return this.ownerDocument;
|
||||
},getWindow:function(){return this.ownerDocument.getWindow();},getElementById:function(D,C){var B=this.ownerDocument.getElementById(D);if(!B){return null;
|
||||
}for(var A=B.parentNode;A!=this;A=A.parentNode){if(!A){return null;}}return $.element(B,C);},set:function(D,B){switch($type(D)){case"object":for(var C in D){this.set(C,D[C]);
|
||||
}break;case"string":var A=Element.Properties.get(D);(A&&A.set)?A.set.apply(this,Array.slice(arguments,1)):this.setProperty(D,B);}return this;},get:function(B){var A=Element.Properties.get(B);
|
||||
return(A&&A.get)?A.get.apply(this,Array.slice(arguments,1)):this.getProperty(B);},erase:function(B){var A=Element.Properties.get(B);(A&&A.erase)?A.erase.apply(this,Array.slice(arguments,1)):this.removeProperty(B);
|
||||
return this;},match:function(A){return(!A||Element.get(this,"tag")==A);},inject:function(B,A){Element.Inserters.get(A||"bottom")(this,$(B,true));return this;
|
||||
},wraps:function(B,A){B=$(B,true);return this.replaces(B).grab(B,A);},grab:function(B,A){Element.Inserters.get(A||"bottom")($(B,true),this);return this;
|
||||
},appendText:function(B,A){return this.grab(this.getDocument().newTextNode(B),A);},adopt:function(){Array.flatten(arguments).each(function(A){A=$(A,true);
|
||||
if(A){this.appendChild(A);}},this);return this;},dispose:function(){return(this.parentNode)?this.parentNode.removeChild(this):this;},clone:function(D,C){switch($type(this)){case"element":var H={};
|
||||
for(var G=0,E=this.attributes.length;G<E;G++){var B=this.attributes[G],L=B.nodeName.toLowerCase();if(Browser.Engine.trident&&(/input/i).test(this.tagName)&&(/width|height/).test(L)){continue;
|
||||
}var K=(L=="style"&&this.style)?this.style.cssText:B.nodeValue;if(!$chk(K)||L=="uid"||(L=="id"&&!C)){continue;}if(K!="inherit"&&["string","number"].contains($type(K))){H[L]=K;
|
||||
}}var J=new Element(this.nodeName.toLowerCase(),H);if(D!==false){for(var I=0,F=this.childNodes.length;I<F;I++){var A=Element.clone(this.childNodes[I],true,C);
|
||||
if(A){J.grab(A);}}}return J;case"textnode":return document.newTextNode(this.nodeValue);}return null;},replaces:function(A){A=$(A,true);A.parentNode.replaceChild(this,A);
|
||||
return this;},hasClass:function(A){return this.className.contains(A," ");},addClass:function(A){if(!this.hasClass(A)){this.className=(this.className+" "+A).clean();
|
||||
}return this;},removeClass:function(A){this.className=this.className.replace(new RegExp("(^|\\s)"+A+"(?:\\s|$)"),"$1").clean();return this;},toggleClass:function(A){return this.hasClass(A)?this.removeClass(A):this.addClass(A);
|
||||
},getComputedStyle:function(B){if(this.currentStyle){return this.currentStyle[B.camelCase()];}var A=this.getWindow().getComputedStyle(this,null);return(A)?A.getPropertyValue([B.hyphenate()]):null;
|
||||
},empty:function(){$A(this.childNodes).each(function(A){Browser.freeMem(A);Element.empty(A);Element.dispose(A);},this);return this;},destroy:function(){Browser.freeMem(this.empty().dispose());
|
||||
return null;},getSelected:function(){return new Elements($A(this.options).filter(function(A){return A.selected;}));},toQueryString:function(){var A=[];
|
||||
this.getElements("input, select, textarea").each(function(B){if(!B.name||B.disabled){return ;}var C=(B.tagName.toLowerCase()=="select")?Element.getSelected(B).map(function(D){return D.value;
|
||||
}):((B.type=="radio"||B.type=="checkbox")&&!B.checked)?null:B.value;$splat(C).each(function(D){if(D){A.push(B.name+"="+encodeURIComponent(D));}});});return A.join("&");
|
||||
},getProperty:function(C){var B=Element.Attributes,A=B.Props[C];var D=(A)?this[A]:this.getAttribute(C,2);return(B.Bools[C])?!!D:(A)?D:D||null;},getProperties:function(){var A=$A(arguments);
|
||||
return A.map(function(B){return this.getProperty(B);},this).associate(A);},setProperty:function(D,E){var C=Element.Attributes,B=C.Props[D],A=$defined(E);
|
||||
if(B&&C.Bools[D]){E=(E||!A)?true:false;}else{if(!A){return this.removeProperty(D);}}(B)?this[B]=E:this.setAttribute(D,E);return this;},setProperties:function(A){for(var B in A){this.setProperty(B,A[B]);
|
||||
}return this;},removeProperty:function(D){var C=Element.Attributes,B=C.Props[D],A=(B&&C.Bools[D]);(B)?this[B]=(A)?false:"":this.removeAttribute(D);return this;
|
||||
},removeProperties:function(){Array.each(arguments,this.removeProperty,this);return this;}});(function(){var A=function(D,B,I,C,F,H){var E=D[I||B];var G=[];
|
||||
while(E){if(E.nodeType==1&&(!C||Element.match(E,C))){G.push(E);if(!F){break;}}E=E[B];}return(F)?new Elements(G,{ddup:false,cash:!H}):$(G[0],H);};Element.implement({getPrevious:function(B,C){return A(this,"previousSibling",null,B,false,C);
|
||||
},getAllPrevious:function(B,C){return A(this,"previousSibling",null,B,true,C);},getNext:function(B,C){return A(this,"nextSibling",null,B,false,C);},getAllNext:function(B,C){return A(this,"nextSibling",null,B,true,C);
|
||||
},getFirst:function(B,C){return A(this,"nextSibling","firstChild",B,false,C);},getLast:function(B,C){return A(this,"previousSibling","lastChild",B,false,C);
|
||||
},getParent:function(B,C){return A(this,"parentNode",null,B,false,C);},getParents:function(B,C){return A(this,"parentNode",null,B,true,C);},getChildren:function(B,C){return A(this,"nextSibling","firstChild",B,true,C);
|
||||
},hasChild:function(B){B=$(B,true);return(!!B&&$A(this.getElementsByTagName(B.tagName)).contains(B));}});})();Element.Properties=new Hash;Element.Properties.style={set:function(A){this.style.cssText=A;
|
||||
},get:function(){return this.style.cssText;},erase:function(){this.style.cssText="";}};Element.Properties.tag={get:function(){return this.tagName.toLowerCase();
|
||||
}};Element.Properties.href={get:function(){return(!this.href)?null:this.href.replace(new RegExp("^"+document.location.protocol+"//"+document.location.host),"");
|
||||
}};Element.Properties.html={set:function(){return this.innerHTML=Array.flatten(arguments).join("");}};Native.implement([Element,Window,Document],{addListener:function(B,A){if(this.addEventListener){this.addEventListener(B,A,false);
|
||||
}else{this.attachEvent("on"+B,A);}return this;},removeListener:function(B,A){if(this.removeEventListener){this.removeEventListener(B,A,false);}else{this.detachEvent("on"+B,A);
|
||||
}return this;},retrieve:function(B,A){var D=Element.Storage.get(this.uid);var C=D[B];if($defined(A)&&!$defined(C)){C=D[B]=A;}return $pick(C);},store:function(B,A){var C=Element.Storage.get(this.uid);
|
||||
C[B]=A;return this;},eliminate:function(A){var B=Element.Storage.get(this.uid);delete B[A];return this;}});Element.Attributes=new Hash({Props:{html:"innerHTML","class":"className","for":"htmlFor",text:(Browser.Engine.trident)?"innerText":"textContent"},Bools:["compact","nowrap","ismap","declare","noshade","checked","disabled","readonly","multiple","selected","noresize","defer"],Camels:["value","accessKey","cellPadding","cellSpacing","colSpan","frameBorder","maxLength","readOnly","rowSpan","tabIndex","useMap"]});
|
||||
Browser.freeMem=function(A){if(!A){return ;}if(Browser.Engine.trident&&(/object/i).test(A.tagName)){for(var B in A){if(typeof A[B]=="function"){A[B]=$empty;
|
||||
}}Element.dispose(A);}if(A.uid&&A.removeEvents){A.removeEvents();}};(function(B){var C=B.Bools,A=B.Camels;B.Bools=C=C.associate(C);Hash.extend(Hash.combine(B.Props,C),A.associate(A.map(function(D){return D.toLowerCase();
|
||||
})));B.erase("Camels");})(Element.Attributes);window.addListener("unload",function(){window.removeListener("unload",arguments.callee);document.purge();
|
||||
if(Browser.Engine.trident){CollectGarbage();}});Element.Properties.events={set:function(A){this.addEvents(A);}};Native.implement([Element,Window,Document],{addEvent:function(E,G){var H=this.retrieve("events",{});
|
||||
H[E]=H[E]||{keys:[],values:[]};if(H[E].keys.contains(G)){return this;}H[E].keys.push(G);var F=E,A=Element.Events.get(E),C=G,I=this;if(A){if(A.onAdd){A.onAdd.call(this,G);
|
||||
}if(A.condition){C=function(J){if(A.condition.call(this,J)){return G.call(this,J);}return false;};}F=A.base||F;}var D=function(){return G.call(I);};var B=Element.NativeEvents[F]||0;
|
||||
if(B){if(B==2){D=function(J){J=new Event(J,I.getWindow());if(C.call(I,J)===false){J.stop();}};}this.addListener(F,D);}H[E].values.push(D);return this;},removeEvent:function(D,C){var B=this.retrieve("events");
|
||||
if(!B||!B[D]){return this;}var G=B[D].keys.indexOf(C);if(G==-1){return this;}var A=B[D].keys.splice(G,1)[0];var F=B[D].values.splice(G,1)[0];var E=Element.Events.get(D);
|
||||
if(E){if(E.onRemove){E.onRemove.call(this,C);}D=E.base||D;}return(Element.NativeEvents[D])?this.removeListener(D,F):this;},addEvents:function(A){for(var B in A){this.addEvent(B,A[B]);
|
||||
}return this;},removeEvents:function(B){var A=this.retrieve("events");if(!A){return this;}if(!B){for(var C in A){this.removeEvents(C);}A=null;}else{if(A[B]){while(A[B].keys[0]){this.removeEvent(B,A[B].keys[0]);
|
||||
}A[B]=null;}}return this;},fireEvent:function(D,B,A){var C=this.retrieve("events");if(!C||!C[D]){return this;}C[D].keys.each(function(E){E.create({bind:this,delay:A,"arguments":B})();
|
||||
},this);return this;},cloneEvents:function(D,A){D=$(D);var C=D.retrieve("events");if(!C){return this;}if(!A){for(var B in C){this.cloneEvents(D,B);}}else{if(C[A]){C[A].keys.each(function(E){this.addEvent(A,E);
|
||||
},this);}}return this;}});Element.NativeEvents={click:2,dblclick:2,mouseup:2,mousedown:2,contextmenu:2,mousewheel:2,DOMMouseScroll:2,mouseover:2,mouseout:2,mousemove:2,selectstart:2,selectend:2,keydown:2,keypress:2,keyup:2,focus:2,blur:2,change:2,reset:2,select:2,submit:2,load:1,unload:1,beforeunload:2,resize:1,move:1,DOMContentLoaded:1,readystatechange:1,error:1,abort:1,scroll:1};
|
||||
(function(){var A=function(B){var C=B.relatedTarget;if(C==undefined){return true;}if(C===false){return false;}return($type(this)!="document"&&C!=this&&C.prefix!="xul"&&!this.hasChild(C));
|
||||
};Element.Events=new Hash({mouseenter:{base:"mouseover",condition:A},mouseleave:{base:"mouseout",condition:A},mousewheel:{base:(Browser.Engine.gecko)?"DOMMouseScroll":"mousewheel"}});
|
||||
})();Element.Properties.styles={set:function(A){this.setStyles(A);}};Element.Properties.opacity={set:function(A,B){if(!B){if(A==0){if(this.style.visibility!="hidden"){this.style.visibility="hidden";
|
||||
}}else{if(this.style.visibility!="visible"){this.style.visibility="visible";}}}if(!this.currentStyle||!this.currentStyle.hasLayout){this.style.zoom=1;}if(Browser.Engine.trident){this.style.filter=(A==1)?"":"alpha(opacity="+A*100+")";
|
||||
}this.style.opacity=A;this.store("opacity",A);},get:function(){return this.retrieve("opacity",1);}};Element.implement({setOpacity:function(A){return this.set("opacity",A,true);
|
||||
},getOpacity:function(){return this.get("opacity");},setStyle:function(B,A){switch(B){case"opacity":return this.set("opacity",parseFloat(A));case"float":B=(Browser.Engine.trident)?"styleFloat":"cssFloat";
|
||||
}B=B.camelCase();if($type(A)!="string"){var C=(Element.Styles.get(B)||"@").split(" ");A=$splat(A).map(function(E,D){if(!C[D]){return"";}return($type(E)=="number")?C[D].replace("@",Math.round(E)):E;
|
||||
}).join(" ");}else{if(A==String(Number(A))){A=Math.round(A);}}this.style[B]=A;return this;},getStyle:function(G){switch(G){case"opacity":return this.get("opacity");
|
||||
case"float":G=(Browser.Engine.trident)?"styleFloat":"cssFloat";}G=G.camelCase();var A=this.style[G];if(!$chk(A)){A=[];for(var F in Element.ShortStyles){if(G!=F){continue;
|
||||
}for(var E in Element.ShortStyles[F]){A.push(this.getStyle(E));}return A.join(" ");}A=this.getComputedStyle(G);}if(A){A=String(A);var C=A.match(/rgba?\([\d\s,]+\)/);
|
||||
if(C){A=A.replace(C[0],C[0].rgbToHex());}}if(Browser.Engine.presto||(Browser.Engine.trident&&!$chk(parseInt(A)))){if(G.test(/^(height|width)$/)){var B=(G=="width")?["left","right"]:["top","bottom"],D=0;
|
||||
B.each(function(H){D+=this.getStyle("border-"+H+"-width").toInt()+this.getStyle("padding-"+H).toInt();},this);return this["offset"+G.capitalize()]-D+"px";
|
||||
}if(Browser.Engine.presto&&String(A).test("px")){return A;}if(G.test(/(border(.+)Width|margin|padding)/)){return"0px";}}return A;},setStyles:function(B){for(var A in B){this.setStyle(A,B[A]);
|
||||
}return this;},getStyles:function(){var A={};Array.each(arguments,function(B){A[B]=this.getStyle(B);},this);return A;}});Element.Styles=new Hash({left:"@px",top:"@px",bottom:"@px",right:"@px",width:"@px",height:"@px",maxWidth:"@px",maxHeight:"@px",minWidth:"@px",minHeight:"@px",backgroundColor:"rgb(@, @, @)",backgroundPosition:"@px @px",color:"rgb(@, @, @)",fontSize:"@px",letterSpacing:"@px",lineHeight:"@px",clip:"rect(@px @px @px @px)",margin:"@px @px @px @px",padding:"@px @px @px @px",border:"@px @ rgb(@, @, @) @px @ rgb(@, @, @) @px @ rgb(@, @, @)",borderWidth:"@px @px @px @px",borderStyle:"@ @ @ @",borderColor:"rgb(@, @, @) rgb(@, @, @) rgb(@, @, @) rgb(@, @, @)",zIndex:"@",zoom:"@",fontWeight:"@",textIndent:"@px",opacity:"@"});
|
||||
Element.ShortStyles={margin:{},padding:{},border:{},borderWidth:{},borderStyle:{},borderColor:{}};["Top","Right","Bottom","Left"].each(function(G){var F=Element.ShortStyles;
|
||||
var B=Element.Styles;["margin","padding"].each(function(H){var I=H+G;F[H][I]=B[I]="@px";});var E="border"+G;F.border[E]=B[E]="@px @ rgb(@, @, @)";var D=E+"Width",A=E+"Style",C=E+"Color";
|
||||
F[E]={};F.borderWidth[D]=F[E][D]=B[D]="@px";F.borderStyle[A]=F[E][A]=B[A]="@";F.borderColor[C]=F[E][C]=B[C]="rgb(@, @, @)";});(function(){Element.implement({scrollTo:function(H,I){if(B(this)){this.getWindow().scrollTo(H,I);
|
||||
}else{this.scrollLeft=H;this.scrollTop=I;}return this;},getSize:function(){if(B(this)){return this.getWindow().getSize();}return{x:this.offsetWidth,y:this.offsetHeight};
|
||||
},getScrollSize:function(){if(B(this)){return this.getWindow().getScrollSize();}return{x:this.scrollWidth,y:this.scrollHeight};},getScroll:function(){if(B(this)){return this.getWindow().getScroll();
|
||||
}return{x:this.scrollLeft,y:this.scrollTop};},getScrolls:function(){var I=this,H={x:0,y:0};while(I&&!B(I)){H.x+=I.scrollLeft;H.y+=I.scrollTop;I=I.parentNode;
|
||||
}return H;},getOffsetParent:function(){var H=this;if(B(H)){return null;}if(!Browser.Engine.trident){return H.offsetParent;}while((H=H.parentNode)&&!B(H)){if(D(H,"position")!="static"){return H;
|
||||
}}return null;},getOffsets:function(){var I=this,H={x:0,y:0};if(B(this)){return H;}while(I&&!B(I)){H.x+=I.offsetLeft;H.y+=I.offsetTop;if(Browser.Engine.gecko){if(!F(I)){H.x+=C(I);
|
||||
H.y+=G(I);}var J=I.parentNode;if(J&&D(J,"overflow")!="visible"){H.x+=C(J);H.y+=G(J);}}else{if(I!=this&&(Browser.Engine.trident||Browser.Engine.webkit)){H.x+=C(I);
|
||||
H.y+=G(I);}}I=I.offsetParent;if(Browser.Engine.trident){while(I&&!I.currentStyle.hasLayout){I=I.offsetParent;}}}if(Browser.Engine.gecko&&!F(this)){H.x-=C(this);
|
||||
H.y-=G(this);}return H;},getPosition:function(K){if(B(this)){return{x:0,y:0};}var L=this.getOffsets(),I=this.getScrolls();var H={x:L.x-I.x,y:L.y-I.y};var J=(K&&(K=$(K)))?K.getPosition():{x:0,y:0};
|
||||
return{x:H.x-J.x,y:H.y-J.y};},getCoordinates:function(J){if(B(this)){return this.getWindow().getCoordinates();}var H=this.getPosition(J),I=this.getSize();
|
||||
var K={left:H.x,top:H.y,width:I.x,height:I.y};K.right=K.left+K.width;K.bottom=K.top+K.height;return K;},computePosition:function(H){return{left:H.x-E(this,"margin-left"),top:H.y-E(this,"margin-top")};
|
||||
},position:function(H){return this.setStyles(this.computePosition(H));}});Native.implement([Document,Window],{getSize:function(){var I=this.getWindow();
|
||||
if(Browser.Engine.presto||Browser.Engine.webkit){return{x:I.innerWidth,y:I.innerHeight};}var H=A(this);return{x:H.clientWidth,y:H.clientHeight};},getScroll:function(){var I=this.getWindow();
|
||||
var H=A(this);return{x:I.pageXOffset||H.scrollLeft,y:I.pageYOffset||H.scrollTop};},getScrollSize:function(){var I=A(this);var H=this.getSize();return{x:Math.max(I.scrollWidth,H.x),y:Math.max(I.scrollHeight,H.y)};
|
||||
},getPosition:function(){return{x:0,y:0};},getCoordinates:function(){var H=this.getSize();return{top:0,left:0,bottom:H.y,right:H.x,height:H.y,width:H.x};
|
||||
}});var D=Element.getComputedStyle;function E(H,I){return D(H,I).toInt()||0;}function F(H){return D(H,"-moz-box-sizing")=="border-box";}function G(H){return E(H,"border-top-width");
|
||||
}function C(H){return E(H,"border-left-width");}function B(H){return(/^(?:body|html)$/i).test(H.tagName);}function A(H){var I=H.getDocument();return(!I.compatMode||I.compatMode=="CSS1Compat")?I.html:I.body;
|
||||
}})();Native.implement([Window,Document,Element],{getHeight:function(){return this.getSize().y;},getWidth:function(){return this.getSize().x;},getScrollTop:function(){return this.getScroll().y;
|
||||
},getScrollLeft:function(){return this.getScroll().x;},getScrollHeight:function(){return this.getScrollSize().y;},getScrollWidth:function(){return this.getScrollSize().x;
|
||||
},getTop:function(){return this.getPosition().y;},getLeft:function(){return this.getPosition().x;}});Native.implement([Document,Element],{getElements:function(H,G){H=H.split(",");
|
||||
var C,E={};for(var D=0,B=H.length;D<B;D++){var A=H[D],F=Selectors.Utils.search(this,A,E);if(D!=0&&F.item){F=$A(F);}C=(D==0)?F:(C.item)?$A(C).concat(F):C.concat(F);
|
||||
}return new Elements(C,{ddup:(H.length>1),cash:!G});}});Element.implement({match:function(B){if(!B){return true;}var D=Selectors.Utils.parseTagAndID(B);
|
||||
var A=D[0],E=D[1];if(!Selectors.Filters.byID(this,E)||!Selectors.Filters.byTag(this,A)){return false;}var C=Selectors.Utils.parseSelector(B);return(C)?Selectors.Utils.filter(this,C,{}):true;
|
||||
}});var Selectors={Cache:{nth:{},parsed:{}}};Selectors.RegExps={id:(/#([\w-]+)/),tag:(/^(\w+|\*)/),quick:(/^(\w+|\*)$/),splitter:(/\s*([+>~\s])\s*([a-zA-Z#.*:\[])/g),combined:(/\.([\w-]+)|\[(\w+)(?:([!*^$~|]?=)["']?(.*?)["']?)?\]|:([\w-]+)(?:\(["']?(.*?)?["']?\)|$)/g)};
|
||||
Selectors.Utils={chk:function(B,C){if(!C){return true;}var A=$uid(B);if(!C[A]){return C[A]=true;}return false;},parseNthArgument:function(F){if(Selectors.Cache.nth[F]){return Selectors.Cache.nth[F];
|
||||
}var C=F.match(/^([+-]?\d*)?([a-z]+)?([+-]?\d*)?$/);if(!C){return false;}var E=parseInt(C[1]);var B=(E||E===0)?E:1;var D=C[2]||false;var A=parseInt(C[3])||0;
|
||||
if(B!=0){A--;while(A<1){A+=B;}while(A>=B){A-=B;}}else{B=A;D="index";}switch(D){case"n":C={a:B,b:A,special:"n"};break;case"odd":C={a:2,b:0,special:"n"};
|
||||
break;case"even":C={a:2,b:1,special:"n"};break;case"first":C={a:0,special:"index"};break;case"last":C={special:"last-child"};break;case"only":C={special:"only-child"};
|
||||
break;default:C={a:(B-1),special:"index"};}return Selectors.Cache.nth[F]=C;},parseSelector:function(E){if(Selectors.Cache.parsed[E]){return Selectors.Cache.parsed[E];
|
||||
}var D,H={classes:[],pseudos:[],attributes:[]};while((D=Selectors.RegExps.combined.exec(E))){var I=D[1],G=D[2],F=D[3],B=D[4],C=D[5],J=D[6];if(I){H.classes.push(I);
|
||||
}else{if(C){var A=Selectors.Pseudo.get(C);if(A){H.pseudos.push({parser:A,argument:J});}else{H.attributes.push({name:C,operator:"=",value:J});}}else{if(G){H.attributes.push({name:G,operator:F,value:B});
|
||||
}}}}if(!H.classes.length){delete H.classes;}if(!H.attributes.length){delete H.attributes;}if(!H.pseudos.length){delete H.pseudos;}if(!H.classes&&!H.attributes&&!H.pseudos){H=null;
|
||||
}return Selectors.Cache.parsed[E]=H;},parseTagAndID:function(B){var A=B.match(Selectors.RegExps.tag);var C=B.match(Selectors.RegExps.id);return[(A)?A[1]:"*",(C)?C[1]:false];
|
||||
},filter:function(F,C,E){var D;if(C.classes){for(D=C.classes.length;D--;D){var G=C.classes[D];if(!Selectors.Filters.byClass(F,G)){return false;}}}if(C.attributes){for(D=C.attributes.length;
|
||||
D--;D){var B=C.attributes[D];if(!Selectors.Filters.byAttribute(F,B.name,B.operator,B.value)){return false;}}}if(C.pseudos){for(D=C.pseudos.length;D--;D){var A=C.pseudos[D];
|
||||
if(!Selectors.Filters.byPseudo(F,A.parser,A.argument,E)){return false;}}}return true;},getByTagAndID:function(B,A,D){if(D){var C=(B.getElementById)?B.getElementById(D,true):Element.getElementById(B,D,true);
|
||||
return(C&&Selectors.Filters.byTag(C,A))?[C]:[];}else{return B.getElementsByTagName(A);}},search:function(J,I,O){var B=[];var C=I.trim().replace(Selectors.RegExps.splitter,function(Z,Y,X){B.push(Y);
|
||||
return":)"+X;}).split(":)");var K,F,E,V;for(var U=0,Q=C.length;U<Q;U++){var T=C[U];if(U==0&&Selectors.RegExps.quick.test(T)){K=J.getElementsByTagName(T);
|
||||
continue;}var A=B[U-1];var L=Selectors.Utils.parseTagAndID(T);var W=L[0],M=L[1];if(U==0){K=Selectors.Utils.getByTagAndID(J,W,M);}else{var D={},H=[];for(var S=0,R=K.length;
|
||||
S<R;S++){H=Selectors.Getters[A](H,K[S],W,M,D);}K=H;}var G=Selectors.Utils.parseSelector(T);if(G){E=[];for(var P=0,N=K.length;P<N;P++){V=K[P];if(Selectors.Utils.filter(V,G,O)){E.push(V);
|
||||
}}K=E;}}return K;}};Selectors.Getters={" ":function(H,G,I,A,E){var D=Selectors.Utils.getByTagAndID(G,I,A);for(var C=0,B=D.length;C<B;C++){var F=D[C];if(Selectors.Utils.chk(F,E)){H.push(F);
|
||||
}}return H;},">":function(H,G,I,A,F){var C=Selectors.Utils.getByTagAndID(G,I,A);for(var E=0,D=C.length;E<D;E++){var B=C[E];if(B.parentNode==G&&Selectors.Utils.chk(B,F)){H.push(B);
|
||||
}}return H;},"+":function(C,B,A,E,D){while((B=B.nextSibling)){if(B.nodeType==1){if(Selectors.Utils.chk(B,D)&&Selectors.Filters.byTag(B,A)&&Selectors.Filters.byID(B,E)){C.push(B);
|
||||
}break;}}return C;},"~":function(C,B,A,E,D){while((B=B.nextSibling)){if(B.nodeType==1){if(!Selectors.Utils.chk(B,D)){break;}if(Selectors.Filters.byTag(B,A)&&Selectors.Filters.byID(B,E)){C.push(B);
|
||||
}}}return C;}};Selectors.Filters={byTag:function(B,A){return(A=="*"||(B.tagName&&B.tagName.toLowerCase()==A));},byID:function(A,B){return(!B||(A.id&&A.id==B));
|
||||
},byClass:function(B,A){return(B.className&&B.className.contains(A," "));},byPseudo:function(A,D,C,B){return D.call(A,C,B);},byAttribute:function(C,D,B,E){var A=Element.prototype.getProperty.call(C,D);
|
||||
if(!A){return false;}if(!B||E==undefined){return true;}switch(B){case"=":return(A==E);case"*=":return(A.contains(E));case"^=":return(A.substr(0,E.length)==E);
|
||||
case"$=":return(A.substr(A.length-E.length)==E);case"!=":return(A!=E);case"~=":return A.contains(E," ");case"|=":return A.contains(E,"-");}return false;
|
||||
}};Selectors.Pseudo=new Hash({empty:function(){return !(this.innerText||this.textContent||"").length;},not:function(A){return !Element.match(this,A);},contains:function(A){return(this.innerText||this.textContent||"").contains(A);
|
||||
},"first-child":function(){return Selectors.Pseudo.index.call(this,0);},"last-child":function(){var A=this;while((A=A.nextSibling)){if(A.nodeType==1){return false;
|
||||
}}return true;},"only-child":function(){var B=this;while((B=B.previousSibling)){if(B.nodeType==1){return false;}}var A=this;while((A=A.nextSibling)){if(A.nodeType==1){return false;
|
||||
}}return true;},"nth-child":function(G,E){G=(G==undefined)?"n":G;var C=Selectors.Utils.parseNthArgument(G);if(C.special!="n"){return Selectors.Pseudo[C.special].call(this,C.a,E);
|
||||
}var F=0;E.positions=E.positions||{};var D=$uid(this);if(!E.positions[D]){var B=this;while((B=B.previousSibling)){if(B.nodeType!=1){continue;}F++;var A=E.positions[$uid(B)];
|
||||
if(A!=undefined){F=A+F;break;}}E.positions[D]=F;}return(E.positions[D]%C.a==C.b);},index:function(A){var B=this,C=0;while((B=B.previousSibling)){if(B.nodeType==1&&++C>A){return false;
|
||||
}}return(C==A);},even:function(B,A){return Selectors.Pseudo["nth-child"].call(this,"2n+1",A);},odd:function(B,A){return Selectors.Pseudo["nth-child"].call(this,"2n",A);
|
||||
}});Element.Events.domready={onAdd:function(A){if(Browser.loaded){A.call(this);}}};(function(){var B=function(){if(Browser.loaded){return ;}Browser.loaded=true;
|
||||
window.fireEvent("domready");document.fireEvent("domready");};switch(Browser.Engine.name){case"webkit":(function(){(["loaded","complete"].contains(document.readyState))?B():arguments.callee.delay(50);
|
||||
})();break;case"trident":var A=document.createElement("div");(function(){($try(function(){A.doScroll("left");return $(A).inject(document.body).set("html","temp").dispose();
|
||||
}))?B():arguments.callee.delay(50);})();break;default:window.addEvent("load",B);document.addEvent("DOMContentLoaded",B);}})();var JSON=new Hash({encode:function(B){switch($type(B)){case"string":return'"'+B.replace(/[\x00-\x1f\\"]/g,JSON.$replaceChars)+'"';
|
||||
case"array":return"["+String(B.map(JSON.encode).filter($defined))+"]";case"object":case"hash":var A=[];Hash.each(B,function(E,D){var C=JSON.encode(E);if(C){A.push(JSON.encode(D)+":"+C);
|
||||
}});return"{"+A+"}";case"number":case"boolean":return String(B);case false:return"null";}return null;},$specialChars:{"\b":"\\b","\t":"\\t","\n":"\\n","\f":"\\f","\r":"\\r",'"':'\\"',"\\":"\\\\"},$replaceChars:function(A){return JSON.$specialChars[A]||"\\u00"+Math.floor(A.charCodeAt()/16).toString(16)+(A.charCodeAt()%16).toString(16);
|
||||
},decode:function(string,secure){if($type(string)!="string"||!string.length){return null;}if(secure&&!(/^[,:{}\[\]0-9.\-+Eaeflnr-u \n\r\t]*$/).test(string.replace(/\\./g,"@").replace(/"[^"\\\n\r]*"/g,""))){return null;
|
||||
}return eval("("+string+")");}});Native.implement([Hash,Array,String,Number],{toJSON:function(){return JSON.encode(this);}});var Cookie=new Class({Implements:Options,options:{path:false,domain:false,duration:false,secure:false,document:document},initialize:function(B,A){this.key=B;
|
||||
this.setOptions(A);},write:function(B){B=encodeURIComponent(B);if(this.options.domain){B+="; domain="+this.options.domain;}if(this.options.path){B+="; path="+this.options.path;
|
||||
}if(this.options.duration){var A=new Date();A.setTime(A.getTime()+this.options.duration*24*60*60*1000);B+="; expires="+A.toGMTString();}if(this.options.secure){B+="; secure";
|
||||
}this.options.document.cookie=this.key+"="+B;return this;},read:function(){var A=this.options.document.cookie.match("(?:^|;)\\s*"+this.key.escapeRegExp()+"=([^;]*)");
|
||||
return(A)?decodeURIComponent(A[1]):null;},dispose:function(){new Cookie(this.key,$merge(this.options,{duration:-1})).write("");return this;}});Cookie.write=function(B,C,A){return new Cookie(B,A).write(C);
|
||||
};Cookie.read=function(A){return new Cookie(A).read();};Cookie.dispose=function(B,A){return new Cookie(B,A).dispose();};var Swiff=new Class({Implements:[Options],options:{id:null,height:1,width:1,container:null,properties:{},params:{quality:"high",allowScriptAccess:"always",wMode:"transparent",swLiveConnect:true},callBacks:{},vars:{}},toElement:function(){return this.object;
|
||||
},initialize:function(L,M){this.instance="Swiff_"+$time();this.setOptions(M);M=this.options;var B=this.id=M.id||this.instance;var A=$(M.container);Swiff.CallBacks[this.instance]={};
|
||||
var E=M.params,G=M.vars,F=M.callBacks;var H=$extend({height:M.height,width:M.width},M.properties);var K=this;for(var D in F){Swiff.CallBacks[this.instance][D]=(function(N){return function(){return N.apply(K.object,arguments);
|
||||
};})(F[D]);G[D]="Swiff.CallBacks."+this.instance+"."+D;}E.flashVars=Hash.toQueryString(G);if(Browser.Engine.trident){H.classid="clsid:D27CDB6E-AE6D-11cf-96B8-444553540000";
|
||||
E.movie=L;}else{H.type="application/x-shockwave-flash";H.data=L;}var J='<object id="'+B+'"';for(var I in H){J+=" "+I+'="'+H[I]+'"';}J+=">";for(var C in E){if(E[C]){J+='<param name="'+C+'" value="'+E[C]+'" />';
|
||||
}}J+="</object>";this.object=((A)?A.empty():new Element("div")).set("html",J).firstChild;},replaces:function(A){A=$(A,true);A.parentNode.replaceChild(this.toElement(),A);
|
||||
return this;},inject:function(A){$(A,true).appendChild(this.toElement());return this;},remote:function(){return Swiff.remote.apply(Swiff,[this.toElement()].extend(arguments));
|
||||
}});Swiff.CallBacks={};Swiff.remote=function(obj,fn){var rs=obj.CallFunction('<invoke name="'+fn+'" returntype="javascript">'+__flash__argumentsToXML(arguments,2)+"</invoke>");
|
||||
return eval(rs);};var Fx=new Class({Implements:[Chain,Events,Options],options:{fps:50,unit:false,duration:500,link:"ignore",transition:function(A){return -(Math.cos(Math.PI*A)-1)/2;
|
||||
}},initialize:function(A){this.subject=this.subject||this;this.setOptions(A);this.options.duration=Fx.Durations[this.options.duration]||this.options.duration.toInt();
|
||||
var B=this.options.wait;if(B===false){this.options.link="cancel";}},step:function(){var A=$time();if(A<this.time+this.options.duration){var B=this.options.transition((A-this.time)/this.options.duration);
|
||||
this.set(this.compute(this.from,this.to,B));}else{this.set(this.compute(this.from,this.to,1));this.complete();}},set:function(A){return A;},compute:function(C,B,A){return Fx.compute(C,B,A);
|
||||
},check:function(A){if(!this.timer){return true;}switch(this.options.link){case"cancel":this.cancel();return true;case"chain":this.chain(A.bind(this,Array.slice(arguments,1)));
|
||||
return false;}return false;},start:function(B,A){if(!this.check(arguments.callee,B,A)){return this;}this.from=B;this.to=A;this.time=0;this.startTimer();
|
||||
this.onStart();return this;},complete:function(){if(this.stopTimer()){this.onComplete();}return this;},cancel:function(){if(this.stopTimer()){this.onCancel();
|
||||
}return this;},onStart:function(){this.fireEvent("start",this.subject);},onComplete:function(){this.fireEvent("complete",this.subject);if(!this.callChain()){this.fireEvent("chainComplete",this.subject);
|
||||
}},onCancel:function(){this.fireEvent("cancel",this.subject).clearChain();},pause:function(){this.stopTimer();return this;},resume:function(){this.startTimer();
|
||||
return this;},stopTimer:function(){if(!this.timer){return false;}this.time=$time()-this.time;this.timer=$clear(this.timer);return true;},startTimer:function(){if(this.timer){return false;
|
||||
}this.time=$time()-this.time;this.timer=this.step.periodical(Math.round(1000/this.options.fps),this);return true;}});Fx.compute=function(C,B,A){return(B-C)*A+C;
|
||||
};Fx.Durations={"short":250,normal:500,"long":1000};Fx.CSS=new Class({Extends:Fx,prepare:function(D,E,B){B=$splat(B);var C=B[1];if(!$chk(C)){B[1]=B[0];
|
||||
B[0]=D.getStyle(E);}var A=B.map(this.parse);return{from:A[0],to:A[1]};},parse:function(A){A=$lambda(A)();A=(typeof A=="string")?A.split(" "):$splat(A);
|
||||
return A.map(function(C){C=String(C);var B=false;Fx.CSS.Parsers.each(function(F,E){if(B){return ;}var D=F.parse(C);if($chk(D)){B={value:D,parser:F};}});
|
||||
B=B||{value:C,parser:Fx.CSS.Parsers.String};return B;});},compute:function(D,C,B){var A=[];(Math.min(D.length,C.length)).times(function(E){A.push({value:D[E].parser.compute(D[E].value,C[E].value,B),parser:D[E].parser});
|
||||
});A.$family={name:"fx:css:value"};return A;},serve:function(C,B){if($type(C)!="fx:css:value"){C=this.parse(C);}var A=[];C.each(function(D){A=A.concat(D.parser.serve(D.value,B));
|
||||
});return A;},render:function(A,D,C,B){A.setStyle(D,this.serve(C,B));},search:function(A){if(Fx.CSS.Cache[A]){return Fx.CSS.Cache[A];}var B={};Array.each(document.styleSheets,function(E,D){var C=E.href;
|
||||
if(C&&C.contains("://")&&!C.contains(document.domain)){return ;}var F=E.rules||E.cssRules;Array.each(F,function(I,G){if(!I.style){return ;}var H=(I.selectorText)?I.selectorText.replace(/^\w+/,function(J){return J.toLowerCase();
|
||||
}):null;if(!H||!H.test("^"+A+"$")){return ;}Element.Styles.each(function(K,J){if(!I.style[J]||Element.ShortStyles[J]){return ;}K=String(I.style[J]);B[J]=(K.test(/^rgb/))?K.rgbToHex():K;
|
||||
});});});return Fx.CSS.Cache[A]=B;}});Fx.CSS.Cache={};Fx.CSS.Parsers=new Hash({Color:{parse:function(A){if(A.match(/^#[0-9a-f]{3,6}$/i)){return A.hexToRgb(true);
|
||||
}return((A=A.match(/(\d+),\s*(\d+),\s*(\d+)/)))?[A[1],A[2],A[3]]:false;},compute:function(C,B,A){return C.map(function(E,D){return Math.round(Fx.compute(C[D],B[D],A));
|
||||
});},serve:function(A){return A.map(Number);}},Number:{parse:parseFloat,compute:Fx.compute,serve:function(B,A){return(A)?B+A:B;}},String:{parse:$lambda(false),compute:$arguments(1),serve:$arguments(0)}});
|
||||
Fx.Tween=new Class({Extends:Fx.CSS,initialize:function(B,A){this.element=this.subject=$(B);this.parent(A);},set:function(B,A){if(arguments.length==1){A=B;
|
||||
B=this.property||this.options.property;}this.render(this.element,B,A,this.options.unit);return this;},start:function(C,E,D){if(!this.check(arguments.callee,C,E,D)){return this;
|
||||
}var B=Array.flatten(arguments);this.property=this.options.property||B.shift();var A=this.prepare(this.element,this.property,B);return this.parent(A.from,A.to);
|
||||
}});Element.Properties.tween={set:function(A){var B=this.retrieve("tween");if(B){B.cancel();}return this.eliminate("tween").store("tween:options",$extend({link:"cancel"},A));
|
||||
},get:function(A){if(A||!this.retrieve("tween")){if(A||!this.retrieve("tween:options")){this.set("tween",A);}this.store("tween",new Fx.Tween(this,this.retrieve("tween:options")));
|
||||
}return this.retrieve("tween");}};Element.implement({tween:function(A,C,B){this.get("tween").start(arguments);return this;},fade:function(C){var E=this.get("tween"),D="opacity",A;
|
||||
C=$pick(C,"toggle");switch(C){case"in":E.start(D,1);break;case"out":E.start(D,0);break;case"show":E.set(D,1);break;case"hide":E.set(D,0);break;case"toggle":var B=this.retrieve("fade:flag",this.get("opacity")==1);
|
||||
E.start(D,(B)?0:1);this.store("fade:flag",!B);A=true;break;default:E.start(D,arguments);}if(!A){this.eliminate("fade:flag");}return this;},highlight:function(C,A){if(!A){A=this.retrieve("highlight:original",this.getStyle("background-color"));
|
||||
A=(A=="transparent")?"#fff":A;}var B=this.get("tween");B.start("background-color",C||"#ffff88",A).chain(function(){this.setStyle("background-color",this.retrieve("highlight:original"));
|
||||
B.callChain();}.bind(this));return this;}});Fx.Morph=new Class({Extends:Fx.CSS,initialize:function(B,A){this.element=this.subject=$(B);this.parent(A);},set:function(A){if(typeof A=="string"){A=this.search(A);
|
||||
}for(var B in A){this.render(this.element,B,A[B],this.options.unit);}return this;},compute:function(E,D,C){var A={};for(var B in E){A[B]=this.parent(E[B],D[B],C);
|
||||
}return A;},start:function(B){if(!this.check(arguments.callee,B)){return this;}if(typeof B=="string"){B=this.search(B);}var E={},D={};for(var C in B){var A=this.prepare(this.element,C,B[C]);
|
||||
E[C]=A.from;D[C]=A.to;}return this.parent(E,D);}});Element.Properties.morph={set:function(A){var B=this.retrieve("morph");if(B){B.cancel();}return this.eliminate("morph").store("morph:options",$extend({link:"cancel"},A));
|
||||
},get:function(A){if(A||!this.retrieve("morph")){if(A||!this.retrieve("morph:options")){this.set("morph",A);}this.store("morph",new Fx.Morph(this,this.retrieve("morph:options")));
|
||||
}return this.retrieve("morph");}};Element.implement({morph:function(A){this.get("morph").start(A);return this;}});(function(){var A=Fx.prototype.initialize;
|
||||
Fx.prototype.initialize=function(B){A.call(this,B);var C=this.options.transition;if(typeof C=="string"&&(C=C.split(":"))){var D=Fx.Transitions;D=D[C[0]]||D[C[0].capitalize()];
|
||||
if(C[1]){D=D["ease"+C[1].capitalize()+(C[2]?C[2].capitalize():"")];}this.options.transition=D;}};})();Fx.Transition=function(B,A){A=$splat(A);return $extend(B,{easeIn:function(C){return B(C,A);
|
||||
},easeOut:function(C){return 1-B(1-C,A);},easeInOut:function(C){return(C<=0.5)?B(2*C,A)/2:(2-B(2*(1-C),A))/2;}});};Fx.Transitions=new Hash({linear:$arguments(0)});
|
||||
Fx.Transitions.extend=function(A){for(var B in A){Fx.Transitions[B]=new Fx.Transition(A[B]);}};Fx.Transitions.extend({Pow:function(B,A){return Math.pow(B,A[0]||6);
|
||||
},Expo:function(A){return Math.pow(2,8*(A-1));},Circ:function(A){return 1-Math.sin(Math.acos(A));},Sine:function(A){return 1-Math.sin((1-A)*Math.PI/2);
|
||||
},Back:function(B,A){A=A[0]||1.618;return Math.pow(B,2)*((A+1)*B-A);},Bounce:function(D){var C;for(var B=0,A=1;1;B+=A,A/=2){if(D>=(7-4*B)/11){C=-Math.pow((11-6*B-11*D)/4,2)+A*A;
|
||||
break;}}return C;},Elastic:function(B,A){return Math.pow(2,10*--B)*Math.cos(20*B*Math.PI*(A[0]||1)/3);}});["Quad","Cubic","Quart","Quint"].each(function(B,A){Fx.Transitions[B]=new Fx.Transition(function(C){return Math.pow(C,[A+2]);
|
||||
});});var Request=new Class({Implements:[Chain,Events,Options],options:{url:"",data:"",headers:{"X-Requested-With":"XMLHttpRequest",Accept:"text/javascript, text/html, application/xml, text/xml, */*"},async:true,format:false,method:"post",link:"ignore",isSuccess:null,emulation:true,urlEncoded:true,encoding:"utf-8",evalScripts:false,evalResponse:false},initialize:function(A){this.xhr=new Browser.Request();
|
||||
this.setOptions(A);this.options.isSuccess=this.options.isSuccess||this.isSuccess;this.headers=new Hash(this.options.headers);},onStateChange:function(){if(this.xhr.readyState!=4||!this.running){return ;
|
||||
}this.running=false;this.status=0;$try(function(){this.status=this.xhr.status;}.bind(this));if(this.options.isSuccess.call(this,this.status)){this.response={text:this.xhr.responseText,xml:this.xhr.responseXML};
|
||||
this.success(this.response.text,this.response.xml);}else{this.response={text:null,xml:null};this.failure();}this.xhr.onreadystatechange=$empty;},isSuccess:function(){return((this.status>=200)&&(this.status<300));
|
||||
},processScripts:function(A){if(this.options.evalResponse||(/(ecma|java)script/).test(this.getHeader("Content-type"))){return $exec(A);}return A.stripScripts(this.options.evalScripts);
|
||||
},success:function(B,A){this.onSuccess(this.processScripts(B),A);},onSuccess:function(){this.fireEvent("complete",arguments).fireEvent("success",arguments).callChain();
|
||||
},failure:function(){this.onFailure();},onFailure:function(){this.fireEvent("complete").fireEvent("failure",this.xhr);},setHeader:function(A,B){this.headers.set(A,B);
|
||||
return this;},getHeader:function(A){return $try(function(){return this.xhr.getResponseHeader(A);}.bind(this));},check:function(A){if(!this.running){return true;
|
||||
}switch(this.options.link){case"cancel":this.cancel();return true;case"chain":this.chain(A.bind(this,Array.slice(arguments,1)));return false;}return false;
|
||||
},send:function(I){if(!this.check(arguments.callee,I)){return this;}this.running=true;var G=$type(I);if(G=="string"||G=="element"){I={data:I};}var D=this.options;
|
||||
I=$extend({data:D.data,url:D.url,method:D.method},I);var E=I.data,B=I.url,A=I.method;switch($type(E)){case"element":E=$(E).toQueryString();break;case"object":case"hash":E=Hash.toQueryString(E);
|
||||
}if(this.options.format){var H="format="+this.options.format;E=(E)?H+"&"+E:H;}if(this.options.emulation&&["put","delete"].contains(A)){var F="_method="+A;
|
||||
E=(E)?F+"&"+E:F;A="post";}if(this.options.urlEncoded&&A=="post"){var C=(this.options.encoding)?"; charset="+this.options.encoding:"";this.headers.set("Content-type","application/x-www-form-urlencoded"+C);
|
||||
}if(E&&A=="get"){B=B+(B.contains("?")?"&":"?")+E;E=null;}this.xhr.open(A.toUpperCase(),B,this.options.async);this.xhr.onreadystatechange=this.onStateChange.bind(this);
|
||||
this.headers.each(function(K,J){if(!$try(function(){this.xhr.setRequestHeader(J,K);return true;}.bind(this))){this.fireEvent("exception",[J,K]);}},this);
|
||||
this.fireEvent("request");this.xhr.send(E);if(!this.options.async){this.onStateChange();}return this;},cancel:function(){if(!this.running){return this;
|
||||
}this.running=false;this.xhr.abort();this.xhr.onreadystatechange=$empty;this.xhr=new Browser.Request();this.fireEvent("cancel");return this;}});(function(){var A={};
|
||||
["get","post","put","delete","GET","POST","PUT","DELETE"].each(function(B){A[B]=function(){var C=Array.link(arguments,{url:String.type,data:$defined});
|
||||
return this.send($extend(C,{method:B.toLowerCase()}));};});Request.implement(A);})();Element.Properties.send={set:function(A){var B=this.retrieve("send");
|
||||
if(B){B.cancel();}return this.eliminate("send").store("send:options",$extend({data:this,link:"cancel",method:this.get("method")||"post",url:this.get("action")},A));
|
||||
},get:function(A){if(A||!this.retrieve("send")){if(A||!this.retrieve("send:options")){this.set("send",A);}this.store("send",new Request(this.retrieve("send:options")));
|
||||
}return this.retrieve("send");}};Element.implement({send:function(A){var B=this.get("send");B.send({data:this,url:A||B.options.url});return this;}});Request.HTML=new Class({Extends:Request,options:{update:false,evalScripts:true,filter:false},processHTML:function(C){var B=C.match(/<body[^>]*>([\s\S]*?)<\/body>/i);
|
||||
C=(B)?B[1]:C;var A=new Element("div");return $try(function(){var D="<root>"+C+"</root>",G;if(Browser.Engine.trident){G=new ActiveXObject("Microsoft.XMLDOM");
|
||||
G.async=false;G.loadXML(D);}else{G=new DOMParser().parseFromString(D,"text/xml");}D=G.getElementsByTagName("root")[0];for(var F=0,E=D.childNodes.length;
|
||||
F<E;F++){var H=Element.clone(D.childNodes[F],true,true);if(H){A.grab(H);}}return A;})||A.set("html",C);},success:function(D){var C=this.options,B=this.response;
|
||||
B.html=D.stripScripts(function(E){B.javascript=E;});var A=this.processHTML(B.html);B.tree=A.childNodes;B.elements=A.getElements("*");if(C.filter){B.tree=B.elements.filter(C.filter);
|
||||
}if(C.update){$(C.update).empty().adopt(B.tree);}if(C.evalScripts){$exec(B.javascript);}this.onSuccess(B.tree,B.elements,B.html,B.javascript);}});Element.Properties.load={set:function(A){var B=this.retrieve("load");
|
||||
if(B){send.cancel();}return this.eliminate("load").store("load:options",$extend({data:this,link:"cancel",update:this,method:"get"},A));},get:function(A){if(A||!this.retrieve("load")){if(A||!this.retrieve("load:options")){this.set("load",A);
|
||||
}this.store("load",new Request.HTML(this.retrieve("load:options")));}return this.retrieve("load");}};Element.implement({load:function(){this.get("load").send(Array.link(arguments,{data:Object.type,url:String.type}));
|
||||
return this;}});Request.JSON=new Class({Extends:Request,options:{secure:true},initialize:function(A){this.parent(A);this.headers.extend({Accept:"application/json","X-Request":"JSON"});
|
||||
},success:function(A){this.response.json=JSON.decode(A,this.options.secure);this.onSuccess(this.response.json,A);}});
|
||||
|
||||
|
||||
//MooTools More, <http://mootools.net/more>. Copyright (c) 2006-2008 Valerio Proietti, <http://mad4milk.net>, MIT Style License.
|
||||
|
||||
Fx.Slide=new Class({Extends:Fx,options:{mode:"vertical"},initialize:function(B,A){this.addEvent("complete",function(){this.open=(this.wrapper["offset"+this.layout.capitalize()]!=0);
|
||||
if(this.open&&Browser.Engine.webkit419){this.element.dispose().inject(this.wrapper);}},true);this.element=this.subject=$(B);this.parent(A);var C=this.element.retrieve("wrapper");
|
||||
this.wrapper=C||new Element("div",{styles:$extend(this.element.getStyles("margin","position"),{overflow:"hidden"})}).wraps(this.element);this.element.store("wrapper",this.wrapper).setStyle("margin",0);
|
||||
this.now=[];this.open=true;},vertical:function(){this.margin="margin-top";this.layout="height";this.offset=this.element.offsetHeight;},horizontal:function(){this.margin="margin-left";
|
||||
this.layout="width";this.offset=this.element.offsetWidth;},set:function(A){this.element.setStyle(this.margin,A[0]);this.wrapper.setStyle(this.layout,A[1]);
|
||||
return this;},compute:function(E,D,C){var B=[];var A=2;A.times(function(F){B[F]=Fx.compute(E[F],D[F],C);});return B;},start:function(B,E){if(!this.check(arguments.callee,B,E)){return this;
|
||||
}this[E||this.options.mode]();var D=this.element.getStyle(this.margin).toInt();var C=this.wrapper.getStyle(this.layout).toInt();var A=[[D,C],[0,this.offset]];
|
||||
var G=[[D,C],[-this.offset,0]];var F;switch(B){case"in":F=A;break;case"out":F=G;break;case"toggle":F=(this.wrapper["offset"+this.layout.capitalize()]==0)?A:G;
|
||||
}return this.parent(F[0],F[1]);},slideIn:function(A){return this.start("in",A);},slideOut:function(A){return this.start("out",A);},hide:function(A){this[A||this.options.mode]();
|
||||
this.open=false;return this.set([-this.offset,0]);},show:function(A){this[A||this.options.mode]();this.open=true;return this.set([0,this.offset]);},toggle:function(A){return this.start("toggle",A);
|
||||
}});Element.Properties.slide={set:function(B){var A=this.retrieve("slide");if(A){A.cancel();}return this.eliminate("slide").store("slide:options",$extend({link:"cancel"},B));
|
||||
},get:function(A){if(A||!this.retrieve("slide")){if(A||!this.retrieve("slide:options")){this.set("slide",A);}this.store("slide",new Fx.Slide(this,this.retrieve("slide:options")));
|
||||
}return this.retrieve("slide");}};Element.implement({slide:function(D,E){D=D||"toggle";var B=this.get("slide"),A;switch(D){case"hide":B.hide(E);break;case"show":B.show(E);
|
||||
break;case"toggle":var C=this.retrieve("slide:flag",B.open);B[(C)?"slideOut":"slideIn"](E);this.store("slide:flag",!C);A=true;break;default:B.start(D,E);
|
||||
}if(!A){this.eliminate("slide:flag");}return this;}});Fx.Scroll=new Class({Extends:Fx,options:{offset:{x:0,y:0},wheelStops:true},initialize:function(B,A){this.element=this.subject=$(B);
|
||||
this.parent(A);var D=this.cancel.bind(this,false);if($type(this.element)!="element"){this.element=$(this.element.getDocument().body);}var C=this.element;
|
||||
if(this.options.wheelStops){this.addEvent("start",function(){C.addEvent("mousewheel",D);},true);this.addEvent("complete",function(){C.removeEvent("mousewheel",D);
|
||||
},true);}},set:function(){var A=Array.flatten(arguments);this.element.scrollTo(A[0],A[1]);},compute:function(E,D,C){var B=[];var A=2;A.times(function(F){B.push(Fx.compute(E[F],D[F],C));
|
||||
});return B;},start:function(C,H){if(!this.check(arguments.callee,C,H)){return this;}var E=this.element.getSize(),F=this.element.getScrollSize();var B=this.element.getScroll(),D={x:C,y:H};
|
||||
for(var G in D){var A=F[G]-E[G];if($chk(D[G])){D[G]=($type(D[G])=="number")?D[G].limit(0,A):A;}else{D[G]=B[G];}D[G]+=this.options.offset[G];}return this.parent([B.x,B.y],[D.x,D.y]);
|
||||
},toTop:function(){return this.start(false,0);},toLeft:function(){return this.start(0,false);},toRight:function(){return this.start("right",false);},toBottom:function(){return this.start(false,"bottom");
|
||||
},toElement:function(B){var A=$(B).getPosition(this.element);return this.start(A.x,A.y);}});Fx.Elements=new Class({Extends:Fx.CSS,initialize:function(B,A){this.elements=this.subject=$$(B);
|
||||
this.parent(A);},compute:function(G,H,I){var C={};for(var D in G){var A=G[D],E=H[D],F=C[D]={};for(var B in A){F[B]=this.parent(A[B],E[B],I);}}return C;
|
||||
},set:function(B){for(var C in B){var A=B[C];for(var D in A){this.render(this.elements[C],D,A[D],this.options.unit);}}return this;},start:function(C){if(!this.check(arguments.callee,C)){return this;
|
||||
}var H={},I={};for(var D in C){var F=C[D],A=H[D]={},G=I[D]={};for(var B in F){var E=this.prepare(this.elements[D],B,F[B]);A[B]=E.from;G[B]=E.to;}}return this.parent(H,I);
|
||||
}});var Drag=new Class({Implements:[Events,Options],options:{snap:6,unit:"px",grid:false,style:true,limit:false,handle:false,invert:false,preventDefault:false,modifiers:{x:"left",y:"top"}},initialize:function(){var B=Array.link(arguments,{options:Object.type,element:$defined});
|
||||
this.element=$(B.element);this.document=this.element.getDocument();this.setOptions(B.options||{});var A=$type(this.options.handle);this.handles=(A=="array"||A=="collection")?$$(this.options.handle):$(this.options.handle)||this.element;
|
||||
this.mouse={now:{},pos:{}};this.value={start:{},now:{}};this.selection=(Browser.Engine.trident)?"selectstart":"mousedown";this.bound={start:this.start.bind(this),check:this.check.bind(this),drag:this.drag.bind(this),stop:this.stop.bind(this),cancel:this.cancel.bind(this),eventStop:$lambda(false)};
|
||||
this.attach();},attach:function(){this.handles.addEvent("mousedown",this.bound.start);return this;},detach:function(){this.handles.removeEvent("mousedown",this.bound.start);
|
||||
return this;},start:function(C){if(this.options.preventDefault){C.preventDefault();}this.fireEvent("beforeStart",this.element);this.mouse.start=C.page;
|
||||
var A=this.options.limit;this.limit={x:[],y:[]};for(var D in this.options.modifiers){if(!this.options.modifiers[D]){continue;}if(this.options.style){this.value.now[D]=this.element.getStyle(this.options.modifiers[D]).toInt();
|
||||
}else{this.value.now[D]=this.element[this.options.modifiers[D]];}if(this.options.invert){this.value.now[D]*=-1;}this.mouse.pos[D]=C.page[D]-this.value.now[D];
|
||||
if(A&&A[D]){for(var B=2;B--;B){if($chk(A[D][B])){this.limit[D][B]=$lambda(A[D][B])();}}}}if($type(this.options.grid)=="number"){this.options.grid={x:this.options.grid,y:this.options.grid};
|
||||
}this.document.addEvents({mousemove:this.bound.check,mouseup:this.bound.cancel});this.document.addEvent(this.selection,this.bound.eventStop);},check:function(A){if(this.options.preventDefault){A.preventDefault();
|
||||
}var B=Math.round(Math.sqrt(Math.pow(A.page.x-this.mouse.start.x,2)+Math.pow(A.page.y-this.mouse.start.y,2)));if(B>this.options.snap){this.cancel();this.document.addEvents({mousemove:this.bound.drag,mouseup:this.bound.stop});
|
||||
this.fireEvent("start",this.element).fireEvent("snap",this.element);}},drag:function(A){if(this.options.preventDefault){A.preventDefault();}this.mouse.now=A.page;
|
||||
for(var B in this.options.modifiers){if(!this.options.modifiers[B]){continue;}this.value.now[B]=this.mouse.now[B]-this.mouse.pos[B];if(this.options.invert){this.value.now[B]*=-1;
|
||||
}if(this.options.limit&&this.limit[B]){if($chk(this.limit[B][1])&&(this.value.now[B]>this.limit[B][1])){this.value.now[B]=this.limit[B][1];}else{if($chk(this.limit[B][0])&&(this.value.now[B]<this.limit[B][0])){this.value.now[B]=this.limit[B][0];
|
||||
}}}if(this.options.grid[B]){this.value.now[B]-=(this.value.now[B]%this.options.grid[B]);}if(this.options.style){this.element.setStyle(this.options.modifiers[B],this.value.now[B]+this.options.unit);
|
||||
}else{this.element[this.options.modifiers[B]]=this.value.now[B];}}this.fireEvent("drag",this.element);},cancel:function(A){this.document.removeEvent("mousemove",this.bound.check);
|
||||
this.document.removeEvent("mouseup",this.bound.cancel);if(A){this.document.removeEvent(this.selection,this.bound.eventStop);this.fireEvent("cancel",this.element);
|
||||
}},stop:function(A){this.document.removeEvent(this.selection,this.bound.eventStop);this.document.removeEvent("mousemove",this.bound.drag);this.document.removeEvent("mouseup",this.bound.stop);
|
||||
if(A){this.fireEvent("complete",this.element);}}});Element.implement({makeResizable:function(A){return new Drag(this,$merge({modifiers:{x:"width",y:"height"}},A));
|
||||
}});Drag.Move=new Class({Extends:Drag,options:{droppables:[],container:false},initialize:function(C,B){this.parent(C,B);this.droppables=$$(this.options.droppables);
|
||||
this.container=$(this.options.container);if(this.container&&$type(this.container)!="element"){this.container=$(this.container.getDocument().body);}C=this.element;
|
||||
var D=C.getStyle("position");var A=(D!="static")?D:"absolute";if(C.getStyle("left")=="auto"||C.getStyle("top")=="auto"){C.position(C.getPosition(C.offsetParent));
|
||||
}C.setStyle("position",A);this.addEvent("start",function(){this.checkDroppables();},true);},start:function(B){if(this.container){var D=this.element,J=this.container,E=J.getCoordinates(D.offsetParent),F={},A={};
|
||||
["top","right","bottom","left"].each(function(K){F[K]=J.getStyle("padding-"+K).toInt();A[K]=D.getStyle("margin-"+K).toInt();},this);var C=D.offsetWidth+A.left+A.right,I=D.offsetHeight+A.top+A.bottom;
|
||||
var H=[E.left+F.left,E.right-F.right-C];var G=[E.top+F.top,E.bottom-F.bottom-I];this.options.limit={x:H,y:G};}this.parent(B);},checkAgainst:function(B){B=B.getCoordinates();
|
||||
var A=this.mouse.now;return(A.x>B.left&&A.x<B.right&&A.y<B.bottom&&A.y>B.top);},checkDroppables:function(){var A=this.droppables.filter(this.checkAgainst,this).getLast();
|
||||
if(this.overed!=A){if(this.overed){this.fireEvent("leave",[this.element,this.overed]);}if(A){this.overed=A;this.fireEvent("enter",[this.element,A]);}else{this.overed=null;
|
||||
}}},drag:function(A){this.parent(A);if(this.droppables.length){this.checkDroppables();}},stop:function(A){this.checkDroppables();this.fireEvent("drop",[this.element,this.overed]);
|
||||
this.overed=null;return this.parent(A);}});Element.implement({makeDraggable:function(A){return new Drag.Move(this,A);}});Hash.Cookie=new Class({Extends:Cookie,options:{autoSave:true},initialize:function(B,A){this.parent(B,A);
|
||||
this.load();},save:function(){var A=JSON.encode(this.hash);if(!A||A.length>4096){return false;}if(A=="{}"){this.dispose();}else{this.write(A);}return true;
|
||||
},load:function(){this.hash=new Hash(JSON.decode(this.read(),true));return this;}});Hash.Cookie.implement((function(){var A={};Hash.each(Hash.prototype,function(C,B){A[B]=function(){var D=C.apply(this.hash,arguments);
|
||||
if(this.options.autoSave){this.save();}return D;};});return A;})());var Color=new Native({initialize:function(B,C){if(arguments.length>=3){C="rgb";B=Array.slice(arguments,0,3);
|
||||
}else{if(typeof B=="string"){if(B.match(/rgb/)){B=B.rgbToHex().hexToRgb(true);}else{if(B.match(/hsb/)){B=B.hsbToRgb();}else{B=B.hexToRgb(true);}}}}C=C||"rgb";
|
||||
switch(C){case"hsb":var A=B;B=B.hsbToRgb();B.hsb=A;break;case"hex":B=B.hexToRgb(true);break;}B.rgb=B.slice(0,3);B.hsb=B.hsb||B.rgbToHsb();B.hex=B.rgbToHex();
|
||||
return $extend(B,this);}});Color.implement({mix:function(){var A=Array.slice(arguments);var C=($type(A.getLast())=="number")?A.pop():50;var B=this.slice();
|
||||
A.each(function(D){D=new Color(D);for(var E=0;E<3;E++){B[E]=Math.round((B[E]/100*(100-C))+(D[E]/100*C));}});return new Color(B,"rgb");},invert:function(){return new Color(this.map(function(A){return 255-A;
|
||||
}));},setHue:function(A){return new Color([A,this.hsb[1],this.hsb[2]],"hsb");},setSaturation:function(A){return new Color([this.hsb[0],A,this.hsb[2]],"hsb");
|
||||
},setBrightness:function(A){return new Color([this.hsb[0],this.hsb[1],A],"hsb");}});function $RGB(C,B,A){return new Color([C,B,A],"rgb");}function $HSB(C,B,A){return new Color([C,B,A],"hsb");
|
||||
}function $HEX(A){return new Color(A,"hex");}Array.implement({rgbToHsb:function(){var B=this[0],C=this[1],J=this[2];var G,F,H;var I=Math.max(B,C,J),E=Math.min(B,C,J);
|
||||
var K=I-E;H=I/255;F=(I!=0)?K/I:0;if(F==0){G=0;}else{var D=(I-B)/K;var A=(I-C)/K;var L=(I-J)/K;if(B==I){G=L-A;}else{if(C==I){G=2+D-L;}else{G=4+A-D;}}G/=6;
|
||||
if(G<0){G++;}}return[Math.round(G*360),Math.round(F*100),Math.round(H*100)];},hsbToRgb:function(){var C=Math.round(this[2]/100*255);if(this[1]==0){return[C,C,C];
|
||||
}else{var A=this[0]%360;var E=A%60;var F=Math.round((this[2]*(100-this[1]))/10000*255);var D=Math.round((this[2]*(6000-this[1]*E))/600000*255);var B=Math.round((this[2]*(6000-this[1]*(60-E)))/600000*255);
|
||||
switch(Math.floor(A/60)){case 0:return[C,B,F];case 1:return[D,C,F];case 2:return[F,C,B];case 3:return[F,D,C];case 4:return[B,F,C];case 5:return[C,F,D];
|
||||
}}return false;}});String.implement({rgbToHsb:function(){var A=this.match(/\d{1,3}/g);return(A)?hsb.rgbToHsb():null;},hsbToRgb:function(){var A=this.match(/\d{1,3}/g);
|
||||
return(A)?A.hsbToRgb():null;}});var Group=new Class({initialize:function(){this.instances=Array.flatten(arguments);this.events={};this.checker={};},addEvent:function(B,A){this.checker[B]=this.checker[B]||{};
|
||||
this.events[B]=this.events[B]||[];if(this.events[B].contains(A)){return false;}else{this.events[B].push(A);}this.instances.each(function(C,D){C.addEvent(B,this.check.bind(this,[B,C,D]));
|
||||
},this);return this;},check:function(C,A,B){this.checker[C][B]=true;var D=this.instances.every(function(F,E){return this.checker[C][E]||false;},this);if(!D){return ;
|
||||
}this.checker[C]={};this.events[C].each(function(E){E.call(this,this.instances,A);},this);}});var Asset=new Hash({javascript:function(F,D){D=$extend({onload:$empty,document:document,check:$lambda(true)},D);
|
||||
var B=new Element("script",{src:F,type:"text/javascript"});var E=D.onload.bind(B),A=D.check,G=D.document;delete D.onload;delete D.check;delete D.document;
|
||||
B.addEvents({load:E,readystatechange:function(){if(["loaded","complete"].contains(this.readyState)){E();}}}).setProperties(D);if(Browser.Engine.webkit419){var C=(function(){if(!$try(A)){return ;
|
||||
}$clear(C);E();}).periodical(50);}return B.inject(G.head);},css:function(B,A){return new Element("link",$merge({rel:"stylesheet",media:"screen",type:"text/css",href:B},A)).inject(document.head);
|
||||
},image:function(C,B){B=$merge({onload:$empty,onabort:$empty,onerror:$empty},B);var D=new Image();var A=$(D)||new Element("img");["load","abort","error"].each(function(E){var F="on"+E;
|
||||
var G=B[F];delete B[F];D[F]=function(){if(!D){return ;}if(!A.parentNode){A.width=D.width;A.height=D.height;}D=D.onload=D.onabort=D.onerror=null;G.delay(1,A,A);
|
||||
A.fireEvent(E,A,1);};});D.src=A.src=C;if(D&&D.complete){D.onload.delay(1);}return A.setProperties(B);},images:function(D,C){C=$merge({onComplete:$empty,onProgress:$empty},C);
|
||||
if(!D.push){D=[D];}var A=[];var B=0;D.each(function(F){var E=new Asset.image(F,{onload:function(){C.onProgress.call(this,B,D.indexOf(F));B++;if(B==D.length){C.onComplete();
|
||||
}}});A.push(E);});return new Elements(A);}});var Sortables=new Class({Implements:[Events,Options],options:{snap:4,opacity:1,clone:false,revert:false,handle:false,constrain:false},initialize:function(A,B){this.setOptions(B);
|
||||
this.elements=[];this.lists=[];this.idle=true;this.addLists($$($(A)||A));if(!this.options.clone){this.options.revert=false;}if(this.options.revert){this.effect=new Fx.Morph(null,$merge({duration:250,link:"cancel"},this.options.revert));
|
||||
}},attach:function(){this.addLists(this.lists);return this;},detach:function(){this.lists=this.removeLists(this.lists);return this;},addItems:function(){Array.flatten(arguments).each(function(A){this.elements.push(A);
|
||||
var B=A.retrieve("sortables:start",this.start.bindWithEvent(this,A));(this.options.handle?A.getElement(this.options.handle)||A:A).addEvent("mousedown",B);
|
||||
},this);return this;},addLists:function(){Array.flatten(arguments).each(function(A){this.lists.push(A);this.addItems(A.getChildren());},this);return this;
|
||||
},removeItems:function(){var A=[];Array.flatten(arguments).each(function(B){A.push(B);this.elements.erase(B);var C=B.retrieve("sortables:start");(this.options.handle?B.getElement(this.options.handle)||B:B).removeEvent("mousedown",C);
|
||||
},this);return $$(A);},removeLists:function(){var A=[];Array.flatten(arguments).each(function(B){A.push(B);this.lists.erase(B);this.removeItems(B.getChildren());
|
||||
},this);return $$(A);},getClone:function(B,A){if(!this.options.clone){return new Element("div").inject(document.body);}if($type(this.options.clone)=="function"){return this.options.clone.call(this,B,A,this.list);
|
||||
}return A.clone(true).setStyles({margin:"0px",position:"absolute",visibility:"hidden",width:A.getStyle("width")}).inject(this.list).position(A.getPosition(A.getOffsetParent()));
|
||||
},getDroppables:function(){var A=this.list.getChildren();if(!this.options.constrain){A=this.lists.concat(A).erase(this.list);}return A.erase(this.clone).erase(this.element);
|
||||
},insert:function(C,B){var A="inside";if(this.lists.contains(B)){this.list=B;this.drag.droppables=this.getDroppables();}else{A=this.element.getAllPrevious().contains(B)?"before":"after";
|
||||
}this.element.inject(B,A);this.fireEvent("sort",[this.element,this.clone]);},start:function(B,A){if(!this.idle){return ;}this.idle=false;this.element=A;
|
||||
this.opacity=A.get("opacity");this.list=A.getParent();this.clone=this.getClone(B,A);this.drag=new Drag.Move(this.clone,{snap:this.options.snap,container:this.options.constrain&&this.element.getParent(),droppables:this.getDroppables(),onSnap:function(){B.stop();
|
||||
this.clone.setStyle("visibility","visible");this.element.set("opacity",this.options.opacity||0);this.fireEvent("start",[this.element,this.clone]);}.bind(this),onEnter:this.insert.bind(this),onCancel:this.reset.bind(this),onComplete:this.end.bind(this)});
|
||||
this.clone.inject(this.element,"before");this.drag.start(B);},end:function(){this.drag.detach();this.element.set("opacity",this.opacity);if(this.effect){var A=this.element.getStyles("width","height");
|
||||
var B=this.clone.computePosition(this.element.getPosition(this.clone.offsetParent));this.effect.element=this.clone;this.effect.start({top:B.top,left:B.left,width:A.width,height:A.height,opacity:0.25}).chain(this.reset.bind(this));
|
||||
}else{this.reset();}},reset:function(){this.idle=true;this.clone.destroy();this.fireEvent("complete",this.element);},serialize:function(){var C=Array.link(arguments,{modifier:Function.type,index:$defined});
|
||||
var B=this.lists.map(function(D){return D.getChildren().map(C.modifier||function(E){return E.get("id");},this);},this);var A=C.index;if(this.lists.length==1){A=0;
|
||||
}return $chk(A)&&A>=0&&A<this.lists.length?B[A]:B;}});var Tips=new Class({Implements:[Events,Options],options:{onShow:function(A){A.setStyle("visibility","visible");
|
||||
},onHide:function(A){A.setStyle("visibility","hidden");},showDelay:100,hideDelay:100,className:null,offsets:{x:16,y:16},fixed:false},initialize:function(){var C=Array.link(arguments,{options:Object.type,elements:$defined});
|
||||
this.setOptions(C.options||null);this.tip=new Element("div").inject(document.body);if(this.options.className){this.tip.addClass(this.options.className);
|
||||
}var B=new Element("div",{"class":"tip-top"}).inject(this.tip);this.container=new Element("div",{"class":"tip"}).inject(this.tip);var A=new Element("div",{"class":"tip-bottom"}).inject(this.tip);
|
||||
this.tip.setStyles({position:"absolute",top:0,left:0,visibility:"hidden"});if(C.elements){this.attach(C.elements);}},attach:function(A){$$(A).each(function(D){var G=D.retrieve("tip:title",D.get("title"));
|
||||
var F=D.retrieve("tip:text",D.get("rel")||D.get("href"));var E=D.retrieve("tip:enter",this.elementEnter.bindWithEvent(this,D));var C=D.retrieve("tip:leave",this.elementLeave.bindWithEvent(this,D));
|
||||
D.addEvents({mouseenter:E,mouseleave:C});if(!this.options.fixed){var B=D.retrieve("tip:move",this.elementMove.bindWithEvent(this,D));D.addEvent("mousemove",B);
|
||||
}D.store("tip:native",D.get("title"));D.erase("title");},this);return this;},detach:function(A){$$(A).each(function(C){C.removeEvent("mouseenter",C.retrieve("tip:enter")||$empty);
|
||||
C.removeEvent("mouseleave",C.retrieve("tip:leave")||$empty);C.removeEvent("mousemove",C.retrieve("tip:move")||$empty);C.eliminate("tip:enter").eliminate("tip:leave").eliminate("tip:move");
|
||||
var B=C.retrieve("tip:native");if(B){C.set("title",B);}});return this;},elementEnter:function(B,A){$A(this.container.childNodes).each(Element.dispose);
|
||||
var D=A.retrieve("tip:title");if(D){this.titleElement=new Element("div",{"class":"tip-title"}).inject(this.container);this.fill(this.titleElement,D);}var C=A.retrieve("tip:text");
|
||||
if(C){this.textElement=new Element("div",{"class":"tip-text"}).inject(this.container);this.fill(this.textElement,C);}this.timer=$clear(this.timer);this.timer=this.show.delay(this.options.showDelay,this);
|
||||
this.position((!this.options.fixed)?B:{page:A.getPosition()});},elementLeave:function(A){$clear(this.timer);this.timer=this.hide.delay(this.options.hideDelay,this);
|
||||
},elementMove:function(A){this.position(A);},position:function(D){var B=window.getSize(),A=window.getScroll();var E={x:this.tip.offsetWidth,y:this.tip.offsetHeight};
|
||||
var C={x:"left",y:"top"};for(var F in C){var G=D.page[F]+this.options.offsets[F];if((G+E[F]-A[F])>B[F]){G=D.page[F]-this.options.offsets[F]-E[F];}this.tip.setStyle(C[F],G);
|
||||
}},fill:function(A,B){(typeof B=="string")?A.set("html",B):A.adopt(B);},show:function(){this.fireEvent("show",this.tip);},hide:function(){this.fireEvent("hide",this.tip);
|
||||
}});var SmoothScroll=new Class({Extends:Fx.Scroll,initialize:function(B,C){C=C||document;var E=C.getDocument(),D=C.getWindow();this.parent(E,B);this.links=(this.options.links)?$$(this.options.links):$$(E.links);
|
||||
var A=D.location.href.match(/^[^#]*/)[0]+"#";this.links.each(function(G){if(G.href.indexOf(A)!=0){return ;}var F=G.href.substr(A.length);if(F&&$(F)){this.useLink(G,F);
|
||||
}},this);if(!Browser.Engine.webkit419){this.addEvent("complete",function(){D.location.hash=this.anchor;},true);}},useLink:function(B,A){B.addEvent("click",function(C){this.anchor=A;
|
||||
this.toElement(A);C.stop();}.bind(this));}});var Slider=new Class({Implements:[Events,Options],options:{onTick:function(A){if(this.options.snap){A=this.toPosition(this.step);
|
||||
}this.knob.setStyle(this.property,A);},snap:false,offset:0,range:false,wheel:false,steps:100,mode:"horizontal"},initialize:function(E,A,D){this.setOptions(D);
|
||||
this.element=$(E);this.knob=$(A);this.previousChange=this.previousEnd=this.step=-1;this.element.addEvent("mousedown",this.clickedElement.bind(this));if(this.options.wheel){this.element.addEvent("mousewheel",this.scrolledElement.bindWithEvent(this));
|
||||
}var F,B={},C={x:false,y:false};switch(this.options.mode){case"vertical":this.axis="y";this.property="top";F="offsetHeight";break;case"horizontal":this.axis="x";
|
||||
this.property="left";F="offsetWidth";}this.half=this.knob[F]/2;this.full=this.element[F]-this.knob[F]+(this.options.offset*2);this.min=$chk(this.options.range[0])?this.options.range[0]:0;
|
||||
this.max=$chk(this.options.range[1])?this.options.range[1]:this.options.steps;this.range=this.max-this.min;this.steps=this.options.steps||this.full;this.stepSize=Math.abs(this.range)/this.steps;
|
||||
this.stepWidth=this.stepSize*this.full/Math.abs(this.range);this.knob.setStyle("position","relative").setStyle(this.property,-this.options.offset);C[this.axis]=this.property;
|
||||
B[this.axis]=[-this.options.offset,this.full-this.options.offset];this.drag=new Drag(this.knob,{snap:0,limit:B,modifiers:C,onDrag:this.draggedKnob.bind(this),onStart:this.draggedKnob.bind(this),onComplete:function(){this.draggedKnob();
|
||||
this.end();}.bind(this)});if(this.options.snap){this.drag.options.grid=Math.ceil(this.stepWidth);this.drag.options.limit[this.axis][1]=this.full;}},set:function(A){if(!((this.range>0)^(A<this.min))){A=this.min;
|
||||
}if(!((this.range>0)^(A>this.max))){A=this.max;}this.step=Math.round(A);this.checkStep();this.end();this.fireEvent("tick",this.toPosition(this.step));return this;
|
||||
},clickedElement:function(C){var B=this.range<0?-1:1;var A=C.page[this.axis]-this.element.getPosition()[this.axis]-this.half;A=A.limit(-this.options.offset,this.full-this.options.offset);
|
||||
this.step=Math.round(this.min+B*this.toStep(A));this.checkStep();this.end();this.fireEvent("tick",A);},scrolledElement:function(A){var B=(this.options.mode=="horizontal")?(A.wheel<0):(A.wheel>0);
|
||||
this.set(B?this.step-this.stepSize:this.step+this.stepSize);A.stop();},draggedKnob:function(){var B=this.range<0?-1:1;var A=this.drag.value.now[this.axis];
|
||||
A=A.limit(-this.options.offset,this.full-this.options.offset);this.step=Math.round(this.min+B*this.toStep(A));this.checkStep();},checkStep:function(){if(this.previousChange!=this.step){this.previousChange=this.step;
|
||||
this.fireEvent("change",this.step);}},end:function(){if(this.previousEnd!==this.step){this.previousEnd=this.step;this.fireEvent("complete",this.step+"");
|
||||
}},toStep:function(A){var B=(A+this.options.offset)*this.stepSize/this.full*this.steps;return this.options.steps?Math.round(B-=B%this.stepSize):B;},toPosition:function(A){return(this.full*Math.abs(this.min-A))/(this.steps*this.stepSize)-this.options.offset;
|
||||
}});var Scroller=new Class({Implements:[Events,Options],options:{area:20,velocity:1,onChange:function(A,B){this.element.scrollTo(A,B);}},initialize:function(B,A){this.setOptions(A);
|
||||
this.element=$(B);this.listener=($type(this.element)!="element")?$(this.element.getDocument().body):this.element;this.timer=null;this.coord=this.getCoords.bind(this);
|
||||
},start:function(){this.listener.addEvent("mousemove",this.coord);},stop:function(){this.listener.removeEvent("mousemove",this.coord);this.timer=$clear(this.timer);
|
||||
},getCoords:function(A){this.page=(this.listener.get("tag")=="body")?A.client:A.page;if(!this.timer){this.timer=this.scroll.periodical(50,this);}},scroll:function(){var B=this.element.getSize(),A=this.element.getScroll(),E=this.element.getPosition(),D={x:0,y:0};
|
||||
for(var C in this.page){if(this.page[C]<(this.options.area+E[C])&&A[C]!=0){D[C]=(this.page[C]-this.options.area-E[C])*this.options.velocity;}else{if(this.page[C]+this.options.area>(B[C]+E[C])&&B[C]+B[C]!=A[C]){D[C]=(this.page[C]-B[C]+this.options.area-E[C])*this.options.velocity;
|
||||
}}}if(D.y||D.x){this.fireEvent("change",[A.x+D.x,A.y+D.y]);}}});var Accordion=new Class({Extends:Fx.Elements,options:{display:0,show:false,height:true,width:false,opacity:true,fixedHeight:false,fixedWidth:false,wait:false,alwaysHide:false},initialize:function(){var C=Array.link(arguments,{container:Element.type,options:Object.type,togglers:$defined,elements:$defined});
|
||||
this.parent(C.elements,C.options);this.togglers=$$(C.togglers);this.container=$(C.container);this.previous=-1;if(this.options.alwaysHide){this.options.wait=true;
|
||||
}if($chk(this.options.show)){this.options.display=false;this.previous=this.options.show;}if(this.options.start){this.options.display=false;this.options.show=false;
|
||||
}this.effects={};if(this.options.opacity){this.effects.opacity="fullOpacity";}if(this.options.width){this.effects.width=this.options.fixedWidth?"fullWidth":"offsetWidth";
|
||||
}if(this.options.height){this.effects.height=this.options.fixedHeight?"fullHeight":"scrollHeight";}for(var B=0,A=this.togglers.length;B<A;B++){this.addSection(this.togglers[B],this.elements[B]);
|
||||
}this.elements.each(function(E,D){if(this.options.show===D){this.fireEvent("active",[this.togglers[D],E]);}else{for(var F in this.effects){E.setStyle(F,0);
|
||||
}}},this);if($chk(this.options.display)){this.display(this.options.display);}},addSection:function(E,C,G){E=$(E);C=$(C);var F=this.togglers.contains(E);
|
||||
var B=this.togglers.length;this.togglers.include(E);this.elements.include(C);if(B&&(!F||G)){G=$pick(G,B-1);E.inject(this.togglers[G],"before");C.inject(E,"after");
|
||||
}else{if(this.container&&!F){E.inject(this.container);C.inject(this.container);}}var A=this.togglers.indexOf(E);E.addEvent("click",this.display.bind(this,A));
|
||||
if(this.options.height){C.setStyles({"padding-top":0,"border-top":"none","padding-bottom":0,"border-bottom":"none"});}if(this.options.width){C.setStyles({"padding-left":0,"border-left":"none","padding-right":0,"border-right":"none"});
|
||||
}C.fullOpacity=1;if(this.options.fixedWidth){C.fullWidth=this.options.fixedWidth;}if(this.options.fixedHeight){C.fullHeight=this.options.fixedHeight;}C.setStyle("overflow","hidden");
|
||||
if(!F){for(var D in this.effects){C.setStyle(D,0);}}return this;},display:function(A){A=($type(A)=="element")?this.elements.indexOf(A):A;if((this.timer&&this.options.wait)||(A===this.previous&&!this.options.alwaysHide)){return this;
|
||||
}this.previous=A;var B={};this.elements.each(function(E,D){B[D]={};var C=(D!=A)||(this.options.alwaysHide&&(E.offsetHeight>0));this.fireEvent(C?"background":"active",[this.togglers[D],E]);
|
||||
for(var F in this.effects){B[D][F]=C?0:E[this.effects[F]];}},this);return this.start(B);}});
|
139
js/navigation.js
@@ -1,139 +0,0 @@
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* function used in or for navigation frame
|
||||
*/
|
||||
|
||||
/**
|
||||
* init
|
||||
*/
|
||||
var today = new Date();
|
||||
var expires = new Date(today.getTime() + (56 * 86400000));
|
||||
var pma_navi_width;
|
||||
var pma_saveframesize_timeout = null;
|
||||
|
||||
/**
|
||||
* opens/closes (hides/shows) tree elements
|
||||
*
|
||||
* @param string id id of the element in the DOM
|
||||
* @param boolean only_open do not close/hide element
|
||||
*/
|
||||
function toggle(id, only_open) {
|
||||
var el = document.getElementById('subel' + id);
|
||||
if (! el) {
|
||||
return false;
|
||||
}
|
||||
|
||||
var img = document.getElementById('el' + id + 'Img');
|
||||
|
||||
if (el.style.display == 'none' || only_open) {
|
||||
el.style.display = '';
|
||||
if (img) {
|
||||
img.src = image_minus;
|
||||
img.alt = '-';
|
||||
}
|
||||
} else {
|
||||
el.style.display = 'none';
|
||||
if (img) {
|
||||
img.src = image_plus;
|
||||
img.alt = '+';
|
||||
}
|
||||
}
|
||||
return true;
|
||||
}
|
||||
|
||||
function PMA_callFunctionDelayed(myfunction, delay)
|
||||
{
|
||||
if (typeof pma_saveframesize_timeout == "number") {
|
||||
window.clearTimeout(pma_saveframesize_timeout);
|
||||
pma_saveframesize_timeout = null;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* saves current navigation frame width in a cookie
|
||||
* usally called on resize of the navigation frame
|
||||
*/
|
||||
function PMA_saveFrameSizeReal()
|
||||
{
|
||||
if (parent.text_dir == 'ltr') {
|
||||
pma_navi_width = parseInt(parent.document.getElementById('mainFrameset').cols)
|
||||
} else {
|
||||
pma_navi_width = parent.document.getElementById('mainFrameset').cols.match(/\d+$/)
|
||||
}
|
||||
if ((pma_navi_width > 0) && (pma_navi_width != PMA_getCookie('pma_navi_width'))) {
|
||||
PMA_setCookie('pma_navi_width', pma_navi_width, expires);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* calls PMA_saveFrameSizeReal with delay
|
||||
*/
|
||||
function PMA_saveFrameSize()
|
||||
{
|
||||
//alert(typeof(pma_saveframesize_timeout) + ' : ' + pma_saveframesize_timeout);
|
||||
|
||||
if (typeof pma_saveframesize_timeout == "number") {
|
||||
window.clearTimeout(pma_saveframesize_timeout);
|
||||
pma_saveframesize_timeout = null;
|
||||
}
|
||||
|
||||
pma_saveframesize_timeout = window.setTimeout(PMA_saveFrameSizeReal, 2000);
|
||||
}
|
||||
|
||||
/**
|
||||
* sets navigation frame width to the value stored in the cookie
|
||||
* usally called on document load
|
||||
*/
|
||||
function PMA_setFrameSize()
|
||||
{
|
||||
pma_navi_width = PMA_getCookie('pma_navi_width');
|
||||
//alert('from cookie: ' + typeof(pma_navi_width) + ' : ' + pma_navi_width);
|
||||
if (pma_navi_width != null) {
|
||||
if (parent.text_dir == 'ltr') {
|
||||
parent.document.getElementById('mainFrameset').cols = pma_navi_width + ',*';
|
||||
} else {
|
||||
parent.document.getElementById('mainFrameset').cols = '*,' + pma_navi_width;
|
||||
}
|
||||
//alert('framesize set');
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* retrieves a named value from cookie
|
||||
*
|
||||
* @param string name name of the value to retrieve
|
||||
* @return string value value for the given name from cookie
|
||||
*/
|
||||
function PMA_getCookie(name) {
|
||||
var start = document.cookie.indexOf(name + "=");
|
||||
var len = start + name.length + 1;
|
||||
if ((!start) && (name != document.cookie.substring(0, name.length))) {
|
||||
return null;
|
||||
}
|
||||
if (start == -1) {
|
||||
return null;
|
||||
}
|
||||
var end = document.cookie.indexOf(";", len);
|
||||
if (end == -1) {
|
||||
end = document.cookie.length;
|
||||
}
|
||||
return unescape(document.cookie.substring(len,end));
|
||||
}
|
||||
|
||||
/**
|
||||
* stores a named value into cookie
|
||||
*
|
||||
* @param string name name of value
|
||||
* @param string value value to be stored
|
||||
* @param Date expires expire time
|
||||
* @param string path
|
||||
* @param string domain
|
||||
* @param boolean secure
|
||||
*/
|
||||
function PMA_setCookie(name, value, expires, path, domain, secure) {
|
||||
document.cookie = name + "=" + escape(value) +
|
||||
( (expires) ? ";expires=" + expires.toGMTString() : "") +
|
||||
( (path) ? ";path=" + path : "") +
|
||||
( (domain) ? ";domain=" + domain : "") +
|
||||
( (secure) ? ";secure" : "");
|
||||
}
|
@@ -1,42 +0,0 @@
|
||||
function PMA_queryAutoCommit()
|
||||
{
|
||||
document.getElementById('sqlqueryform').target = window.opener.frame_content.name;
|
||||
document.getElementById('sqlqueryform').submit();
|
||||
return;
|
||||
}
|
||||
|
||||
function PMA_querywindowCommit(tab)
|
||||
{
|
||||
document.getElementById('hiddenqueryform').querydisplay_tab.value = tab;
|
||||
document.getElementById('hiddenqueryform').submit();
|
||||
return false;
|
||||
}
|
||||
|
||||
function PMA_querywindowSetFocus()
|
||||
{
|
||||
document.getElementById('sqlquery').focus();
|
||||
}
|
||||
|
||||
function PMA_querywindowResize()
|
||||
{
|
||||
// for Gecko
|
||||
if (typeof(self.sizeToContent) == 'function') {
|
||||
self.sizeToContent();
|
||||
//self.scrollbars.visible = false;
|
||||
// give some more space ... to prevent 'fli(pp/ck)ing'
|
||||
self.resizeBy(10, 50);
|
||||
return;
|
||||
}
|
||||
|
||||
// for IE, Opera
|
||||
if (document.getElementById && typeof(document.getElementById('querywindowcontainer')) != 'undefined') {
|
||||
|
||||
// get content size
|
||||
var newWidth = document.getElementById('querywindowcontainer').offsetWidth;
|
||||
var newHeight = document.getElementById('querywindowcontainer').offsetHeight;
|
||||
|
||||
// set size to contentsize
|
||||
// plus some offset for scrollbars, borders, statusbar, menus ...
|
||||
self.resizeTo(newWidth + 45, newHeight + 75);
|
||||
}
|
||||
}
|
@@ -1,108 +0,0 @@
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* function used in server privilege pages
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
* Validates the password field in a form
|
||||
*
|
||||
* @uses PMA_messages['strPasswordEmpty']
|
||||
* @uses PMA_messages['strPasswordNotSame']
|
||||
* @param object the form
|
||||
* @return boolean whether the field value is valid or not
|
||||
*/
|
||||
function checkPassword(the_form)
|
||||
{
|
||||
// Did the user select 'no password'?
|
||||
if (typeof(the_form.elements['nopass']) != 'undefined'
|
||||
&& the_form.elements['nopass'][0].checked) {
|
||||
return true;
|
||||
} else if (typeof(the_form.elements['pred_password']) != 'undefined'
|
||||
&& (the_form.elements['pred_password'].value == 'none'
|
||||
|| the_form.elements['pred_password'].value == 'keep')) {
|
||||
return true;
|
||||
}
|
||||
|
||||
var password = the_form.elements['pma_pw'];
|
||||
var password_repeat = the_form.elements['pma_pw2'];
|
||||
var alert_msg = false;
|
||||
|
||||
if (password.value == '') {
|
||||
alert_msg = PMA_messages['strPasswordEmpty'];
|
||||
} else if (password.value != password_repeat.value) {
|
||||
alert_msg = PMA_messages['strPasswordNotSame'];
|
||||
}
|
||||
|
||||
if (alert_msg) {
|
||||
alert(alert_msg);
|
||||
password.value = '';
|
||||
password_repeat.value = '';
|
||||
password.focus();
|
||||
return false;
|
||||
}
|
||||
|
||||
return true;
|
||||
} // end of the 'checkPassword()' function
|
||||
|
||||
|
||||
/**
|
||||
* Validates the "add a user" form
|
||||
*
|
||||
* @return boolean whether the form is validated or not
|
||||
*/
|
||||
function checkAddUser(the_form)
|
||||
{
|
||||
if (the_form.elements['pred_hostname'].value == 'userdefined' && the_form.elements['hostname'].value == '') {
|
||||
alert(PMA_messages['strHostEmpty']);
|
||||
the_form.elements['hostname'].focus();
|
||||
return false;
|
||||
}
|
||||
|
||||
if (the_form.elements['pred_username'].value == 'userdefined' && the_form.elements['username'].value == '') {
|
||||
alert(PMA_messages['strUserEmpty']);
|
||||
the_form.elements['username'].focus();
|
||||
return false;
|
||||
}
|
||||
|
||||
return checkPassword(the_form);
|
||||
} // end of the 'checkAddUser()' function
|
||||
|
||||
|
||||
/**
|
||||
* Generate a new password, which may then be copied to the form
|
||||
* with suggestPasswordCopy().
|
||||
*
|
||||
* @param string the form name
|
||||
*
|
||||
* @return boolean always true
|
||||
*/
|
||||
function suggestPassword() {
|
||||
// restrict the password to just letters and numbers to avoid problems:
|
||||
// "editors and viewers regard the password as multiple words and
|
||||
// things like double click no longer work"
|
||||
var pwchars = "abcdefhjmnpqrstuvwxyz23456789ABCDEFGHJKLMNPQRSTUVWYXZ";
|
||||
var passwordlength = 16; // do we want that to be dynamic? no, keep it simple :)
|
||||
var passwd = document.getElementById('generated_pw');
|
||||
passwd.value = '';
|
||||
|
||||
for ( i = 0; i < passwordlength; i++ ) {
|
||||
passwd.value += pwchars.charAt( Math.floor( Math.random() * pwchars.length ) )
|
||||
}
|
||||
return passwd.value;
|
||||
}
|
||||
|
||||
|
||||
/**
|
||||
* Copy the generated password (or anything in the field) to the form
|
||||
*
|
||||
* @param string the form name
|
||||
*
|
||||
* @return boolean always true
|
||||
*/
|
||||
function suggestPasswordCopy() {
|
||||
document.getElementById('text_pma_pw').value = document.getElementById('generated_pw').value;
|
||||
document.getElementById('text_pma_pw2').value = document.getElementById('generated_pw').value;
|
||||
return true;
|
||||
}
|
345
js/tbl_change.js
@@ -1,345 +0,0 @@
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* function used in table data manipulation pages
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
* Modify from controls when the "NULL" checkbox is selected
|
||||
*
|
||||
* @param string the MySQL field type
|
||||
* @param string the urlencoded field name
|
||||
* @param string the md5 hashed field name
|
||||
*
|
||||
* @return boolean always true
|
||||
*/
|
||||
function nullify(theType, urlField, md5Field, multi_edit)
|
||||
{
|
||||
var rowForm = document.forms['insertForm'];
|
||||
|
||||
if (typeof(rowForm.elements['funcs' + multi_edit + '[' + urlField + ']']) != 'undefined') {
|
||||
rowForm.elements['funcs' + multi_edit + '[' + urlField + ']'].selectedIndex = -1;
|
||||
}
|
||||
|
||||
// "SET" field , "ENUM" field with more than 20 characters
|
||||
// or foreign key field
|
||||
if (theType == 1 || theType == 3 || theType == 4) {
|
||||
rowForm.elements['field_' + md5Field + multi_edit + '[]'].selectedIndex = -1;
|
||||
}
|
||||
// Other "ENUM" field
|
||||
else if (theType == 2) {
|
||||
var elts = rowForm.elements['field_' + md5Field + multi_edit + '[]'];
|
||||
// when there is just one option in ENUM:
|
||||
if (elts.checked) {
|
||||
elts.checked = false;
|
||||
} else {
|
||||
var elts_cnt = elts.length;
|
||||
for (var i = 0; i < elts_cnt; i++ ) {
|
||||
elts[i].checked = false;
|
||||
} // end for
|
||||
|
||||
} // end if
|
||||
}
|
||||
// Other field types
|
||||
else /*if (theType == 5)*/ {
|
||||
rowForm.elements['fields' + multi_edit + '[' + urlField + ']'].value = '';
|
||||
} // end if... else if... else
|
||||
|
||||
return true;
|
||||
} // end of the 'nullify()' function
|
||||
|
||||
|
||||
/**
|
||||
* Unchecks the "NULL" control when a function has been selected or a value
|
||||
* entered
|
||||
*
|
||||
* @param string the urlencoded field name
|
||||
*
|
||||
* @return boolean always true
|
||||
*/
|
||||
function unNullify(urlField, multi_edit)
|
||||
{
|
||||
var rowForm = document.forms['insertForm'];
|
||||
|
||||
if (typeof(rowForm.elements['fields_null[multi_edit][' + multi_edit + '][' + urlField + ']']) != 'undefined') {
|
||||
rowForm.elements['fields_null[multi_edit][' + multi_edit + '][' + urlField + ']'].checked = false
|
||||
} // end if
|
||||
|
||||
if (typeof(rowForm.elements['insert_ignore_' + multi_edit]) != 'undefined') {
|
||||
rowForm.elements['insert_ignore_' + multi_edit].checked = false
|
||||
} // end if
|
||||
|
||||
return true;
|
||||
} // end of the 'unNullify()' function
|
||||
|
||||
var day;
|
||||
var month;
|
||||
var year;
|
||||
var hour;
|
||||
var minute;
|
||||
var second;
|
||||
var clock_set = 0;
|
||||
|
||||
/**
|
||||
* Opens calendar window.
|
||||
*
|
||||
* @param string calendar.php parameters
|
||||
* @param string form name
|
||||
* @param string field name
|
||||
* @param string edit type - date/timestamp
|
||||
*/
|
||||
function openCalendar(params, form, field, type) {
|
||||
window.open("./calendar.php?" + params, "calendar", "width=400,height=200,status=yes");
|
||||
dateField = eval("document." + form + "." + field);
|
||||
dateType = type;
|
||||
}
|
||||
|
||||
/**
|
||||
* Formats number to two digits.
|
||||
*
|
||||
* @param int number to format.
|
||||
* @param string type of number
|
||||
*/
|
||||
function formatNum2(i, valtype) {
|
||||
f = (i < 10 ? '0' : '') + i;
|
||||
if (valtype && valtype != '') {
|
||||
switch(valtype) {
|
||||
case 'month':
|
||||
f = (f > 12 ? 12 : f);
|
||||
break;
|
||||
|
||||
case 'day':
|
||||
f = (f > 31 ? 31 : f);
|
||||
break;
|
||||
|
||||
case 'hour':
|
||||
f = (f > 24 ? 24 : f);
|
||||
break;
|
||||
|
||||
default:
|
||||
case 'second':
|
||||
case 'minute':
|
||||
f = (f > 59 ? 59 : f);
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
return f;
|
||||
}
|
||||
|
||||
/**
|
||||
* Formats number to two digits.
|
||||
*
|
||||
* @param int number to format.
|
||||
* @param int default value
|
||||
* @param string type of number
|
||||
*/
|
||||
function formatNum2d(i, default_v, valtype) {
|
||||
i = parseInt(i, 10);
|
||||
if (isNaN(i)) return default_v;
|
||||
return formatNum2(i, valtype)
|
||||
}
|
||||
|
||||
/**
|
||||
* Formats number to four digits.
|
||||
*
|
||||
* @param int number to format.
|
||||
*/
|
||||
function formatNum4(i) {
|
||||
i = parseInt(i, 10)
|
||||
return (i < 1000 ? i < 100 ? i < 10 ? '000' : '00' : '0' : '') + i;
|
||||
}
|
||||
|
||||
/**
|
||||
* Initializes calendar window.
|
||||
*/
|
||||
function initCalendar() {
|
||||
if (!year && !month && !day) {
|
||||
/* Called for first time */
|
||||
if (window.opener.dateField.value) {
|
||||
value = window.opener.dateField.value;
|
||||
if (window.opener.dateType == 'datetime' || window.opener.dateType == 'date') {
|
||||
if (window.opener.dateType == 'datetime') {
|
||||
parts = value.split(' ');
|
||||
value = parts[0];
|
||||
|
||||
if (parts[1]) {
|
||||
time = parts[1].split(':');
|
||||
hour = parseInt(time[0],10);
|
||||
minute = parseInt(time[1],10);
|
||||
second = parseInt(time[2],10);
|
||||
}
|
||||
}
|
||||
date = value.split("-");
|
||||
day = parseInt(date[2],10);
|
||||
month = parseInt(date[1],10) - 1;
|
||||
year = parseInt(date[0],10);
|
||||
} else {
|
||||
year = parseInt(value.substr(0,4),10);
|
||||
month = parseInt(value.substr(4,2),10) - 1;
|
||||
day = parseInt(value.substr(6,2),10);
|
||||
hour = parseInt(value.substr(8,2),10);
|
||||
minute = parseInt(value.substr(10,2),10);
|
||||
second = parseInt(value.substr(12,2),10);
|
||||
}
|
||||
}
|
||||
if (isNaN(year) || isNaN(month) || isNaN(day) || day == 0) {
|
||||
dt = new Date();
|
||||
year = dt.getFullYear();
|
||||
month = dt.getMonth();
|
||||
day = dt.getDate();
|
||||
}
|
||||
if (isNaN(hour) || isNaN(minute) || isNaN(second)) {
|
||||
dt = new Date();
|
||||
hour = dt.getHours();
|
||||
minute = dt.getMinutes();
|
||||
second = dt.getSeconds();
|
||||
}
|
||||
} else {
|
||||
/* Moving in calendar */
|
||||
if (month > 11) {
|
||||
month = 0;
|
||||
year++;
|
||||
}
|
||||
if (month < 0) {
|
||||
month = 11;
|
||||
year--;
|
||||
}
|
||||
}
|
||||
|
||||
if (document.getElementById) {
|
||||
cnt = document.getElementById("calendar_data");
|
||||
} else if (document.all) {
|
||||
cnt = document.all["calendar_data"];
|
||||
}
|
||||
|
||||
cnt.innerHTML = "";
|
||||
|
||||
str = ""
|
||||
|
||||
//heading table
|
||||
str += '<table class="calendar"><tr><th width="50%">';
|
||||
str += '<form method="NONE" onsubmit="return 0">';
|
||||
str += '<a href="javascript:month--; initCalendar();">«</a> ';
|
||||
str += '<select id="select_month" name="monthsel" onchange="month = parseInt(document.getElementById(\'select_month\').value); initCalendar();">';
|
||||
for (i =0; i < 12; i++) {
|
||||
if (i == month) selected = ' selected="selected"';
|
||||
else selected = '';
|
||||
str += '<option value="' + i + '" ' + selected + '>' + month_names[i] + '</option>';
|
||||
}
|
||||
str += '</select>';
|
||||
str += ' <a href="javascript:month++; initCalendar();">»</a>';
|
||||
str += '</form>';
|
||||
str += '</th><th width="50%">';
|
||||
str += '<form method="NONE" onsubmit="return 0">';
|
||||
str += '<a href="javascript:year--; initCalendar();">«</a> ';
|
||||
str += '<select id="select_year" name="yearsel" onchange="year = parseInt(document.getElementById(\'select_year\').value); initCalendar();">';
|
||||
for (i = year - 25; i < year + 25; i++) {
|
||||
if (i == year) selected = ' selected="selected"';
|
||||
else selected = '';
|
||||
str += '<option value="' + i + '" ' + selected + '>' + i + '</option>';
|
||||
}
|
||||
str += '</select>';
|
||||
str += ' <a href="javascript:year++; initCalendar();">»</a>';
|
||||
str += '</form>';
|
||||
str += '</th></tr></table>';
|
||||
|
||||
str += '<table class="calendar"><tr>';
|
||||
for (i = 0; i < 7; i++) {
|
||||
str += "<th>" + day_names[i] + "</th>";
|
||||
}
|
||||
str += "</tr>";
|
||||
|
||||
var firstDay = new Date(year, month, 1).getDay();
|
||||
var lastDay = new Date(year, month + 1, 0).getDate();
|
||||
|
||||
str += "<tr>";
|
||||
|
||||
dayInWeek = 0;
|
||||
for (i = 0; i < firstDay; i++) {
|
||||
str += "<td> </td>";
|
||||
dayInWeek++;
|
||||
}
|
||||
for (i = 1; i <= lastDay; i++) {
|
||||
if (dayInWeek == 7) {
|
||||
str += "</tr><tr>";
|
||||
dayInWeek = 0;
|
||||
}
|
||||
|
||||
dispmonth = 1 + month;
|
||||
|
||||
if (window.opener.dateType == 'datetime' || window.opener.dateType == 'date') {
|
||||
actVal = "" + formatNum4(year) + "-" + formatNum2(dispmonth, 'month') + "-" + formatNum2(i, 'day');
|
||||
} else {
|
||||
actVal = "" + formatNum4(year) + formatNum2(dispmonth, 'month') + formatNum2(i, 'day');
|
||||
}
|
||||
if (i == day) {
|
||||
style = ' class="selected"';
|
||||
current_date = actVal;
|
||||
} else {
|
||||
style = '';
|
||||
}
|
||||
str += "<td" + style + "><a href=\"javascript:returnDate('" + actVal + "');\">" + i + "</a></td>"
|
||||
dayInWeek++;
|
||||
}
|
||||
for (i = dayInWeek; i < 7; i++) {
|
||||
str += "<td> </td>";
|
||||
}
|
||||
|
||||
str += "</tr></table>";
|
||||
|
||||
cnt.innerHTML = str;
|
||||
|
||||
// Should we handle time also?
|
||||
if (window.opener.dateType != 'date' && !clock_set) {
|
||||
|
||||
if (document.getElementById) {
|
||||
cnt = document.getElementById("clock_data");
|
||||
} else if (document.all) {
|
||||
cnt = document.all["clock_data"];
|
||||
}
|
||||
|
||||
str = '';
|
||||
init_hour = hour;
|
||||
init_minute = minute;
|
||||
init_second = second;
|
||||
str += '<fieldset>';
|
||||
str += '<form method="NONE" class="clock" onsubmit="returnDate(\'' + current_date + '\')">';
|
||||
str += '<input id="hour" type="text" size="2" maxlength="2" onblur="this.value=formatNum2d(this.value, init_hour, \'hour\'); init_hour = this.value;" value="' + formatNum2(hour, 'hour') + '" />:';
|
||||
str += '<input id="minute" type="text" size="2" maxlength="2" onblur="this.value=formatNum2d(this.value, init_minute, \'minute\'); init_minute = this.value;" value="' + formatNum2(minute, 'minute') + '" />:';
|
||||
str += '<input id="second" type="text" size="2" maxlength="2" onblur="this.value=formatNum2d(this.value, init_second, \'second\'); init_second = this.value;" value="' + formatNum2(second, 'second') + '" />';
|
||||
str += ' ';
|
||||
str += '<input type="submit" value="' + submit_text + '"/>';
|
||||
str += '</form>';
|
||||
str += '</fieldset>';
|
||||
|
||||
cnt.innerHTML = str;
|
||||
clock_set = 1;
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
/**
|
||||
* Returns date from calendar.
|
||||
*
|
||||
* @param string date text
|
||||
*/
|
||||
function returnDate(d) {
|
||||
txt = d;
|
||||
if (window.opener.dateType != 'date') {
|
||||
// need to get time
|
||||
h = parseInt(document.getElementById('hour').value,10);
|
||||
m = parseInt(document.getElementById('minute').value,10);
|
||||
s = parseInt(document.getElementById('second').value,10);
|
||||
if (window.opener.dateType == 'datetime') {
|
||||
txt += ' ' + formatNum2(h, 'hour') + ':' + formatNum2(m, 'minute') + ':' + formatNum2(s, 'second');
|
||||
} else {
|
||||
// timestamp
|
||||
txt += formatNum2(h, 'hour') + formatNum2(m, 'minute') + formatNum2(s, 'second');
|
||||
}
|
||||
}
|
||||
|
||||
window.opener.dateField.value = txt;
|
||||
window.close();
|
||||
}
|
212
js/tooltip.js
@@ -1,212 +0,0 @@
|
||||
/* vim: set expandtab sw=4 ts=4 sts=4: */
|
||||
/**
|
||||
* Displays the Tooltips (hints), if we have some
|
||||
* 2005-01-20 added by Michael Keck (mkkeck)
|
||||
*
|
||||
* @version $Id$
|
||||
*/
|
||||
|
||||
/**
|
||||
*
|
||||
*/
|
||||
var ttXpos = 0, ttYpos = 0;
|
||||
var ttXadd = 10, ttYadd = -10;
|
||||
var ttDisplay = 0, ttHoldIt = 0;
|
||||
|
||||
// Check if browser does support dynamic content and dhtml
|
||||
if (document.getElementById) {
|
||||
// DOM-compatible browsers
|
||||
var ttDOM = 1;
|
||||
} else {
|
||||
// the old Netscape 4
|
||||
var ttNS4 = (document.layers) ? 1 : 0;
|
||||
// browser wich uses document.all
|
||||
var ttIE4 = (document.all) ? 1 : 0;
|
||||
}
|
||||
|
||||
var myTooltipContainer = null;
|
||||
|
||||
/**
|
||||
* initialize tooltip
|
||||
*/
|
||||
function PMA_TT_init()
|
||||
{
|
||||
// get all 'light bubbles' on page
|
||||
var tooltip_icons = window.parent.getElementsByClassName('footnotemarker', document, 'sup');
|
||||
var tooltip_count = tooltip_icons.length;
|
||||
|
||||
if (tooltip_count < 1) {
|
||||
// no 'bubbles' found
|
||||
return;
|
||||
}
|
||||
|
||||
// insert tooltip container
|
||||
myTooltipContainer = document.createElement("div");
|
||||
myTooltipContainer.id = 'TooltipContainer';
|
||||
window.parent.addEvent(myTooltipContainer, 'mouseover', holdTooltip);
|
||||
window.parent.addEvent(myTooltipContainer, 'mouseout', swapTooltip);
|
||||
document.body.appendChild(myTooltipContainer);
|
||||
|
||||
// capture mouse-events
|
||||
for (i = 0; i < tooltip_count; i++) {
|
||||
window.parent.addEvent(tooltip_icons[i], 'mousemove', mouseMove);
|
||||
window.parent.addEvent(tooltip_icons[i], 'mouseover', pmaTooltip);
|
||||
window.parent.addEvent(tooltip_icons[i], 'mouseout', swapTooltip);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* init the tooltip and write the text into it
|
||||
*
|
||||
* @param string theText tooltip content
|
||||
*/
|
||||
function PMA_TT_setText(theText)
|
||||
{
|
||||
if (ttDOM || ttIE4) { // document.getEelementById || document.all
|
||||
myTooltipContainer.innerHTML = ""; // we should empty it first
|
||||
myTooltipContainer.innerHTML = theText;
|
||||
} else if (ttNS4) { // document.layers
|
||||
var layerNS4 = myTooltipContainer.document;
|
||||
layerNS4.write(theText);
|
||||
layerNS4.close();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* @var integer
|
||||
*/
|
||||
var ttTimerID = 0;
|
||||
|
||||
/**
|
||||
* swap the Tooltip // show and hide
|
||||
*
|
||||
* @param boolean stat view status
|
||||
*/
|
||||
function swapTooltip(stat)
|
||||
{
|
||||
if (ttHoldIt != 1) {
|
||||
if (stat == 'true') {
|
||||
showTooltip(true);
|
||||
} else if (ttDisplay) {
|
||||
ttTimerID = setTimeout("showTooltip(false);", 500);
|
||||
} else {
|
||||
showTooltip(true);
|
||||
}
|
||||
} else {
|
||||
if (ttTimerID) {
|
||||
clearTimeout(ttTimerID);
|
||||
ttTimerID = 0;
|
||||
}
|
||||
showTooltip(true);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* show / hide the Tooltip
|
||||
*
|
||||
* @param boolean stat view status
|
||||
*/
|
||||
function showTooltip(stat)
|
||||
{
|
||||
if (stat == false) {
|
||||
if (ttNS4)
|
||||
myTooltipContainer.visibility = "hide";
|
||||
else
|
||||
myTooltipContainer.style.visibility = "hidden";
|
||||
ttDisplay = 0;
|
||||
} else {
|
||||
if (ttNS4)
|
||||
myTooltipContainer.visibility = "show";
|
||||
else
|
||||
myTooltipContainer.style.visibility = "visible";
|
||||
ttDisplay = 1;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* hold it, if we create or move the mouse over the tooltip
|
||||
*/
|
||||
function holdTooltip()
|
||||
{
|
||||
ttHoldIt = 1;
|
||||
swapTooltip('true');
|
||||
ttHoldIt = 0;
|
||||
}
|
||||
|
||||
/**
|
||||
* move the tooltip to mouse position
|
||||
*
|
||||
* @param integer posX horiz. position
|
||||
* @param integer posY vert. position
|
||||
*/
|
||||
function moveTooltip(posX, posY)
|
||||
{
|
||||
if (ttDOM || ttIE4) {
|
||||
myTooltipContainer.style.left = posX + "px";
|
||||
myTooltipContainer.style.top = posY + "px";
|
||||
} else if (ttNS4) {
|
||||
myTooltipContainer.left = posX;
|
||||
myTooltipContainer.top = posY;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* build the tooltip
|
||||
* usally called from eventhandler
|
||||
*
|
||||
* @param string theText tooltip content
|
||||
*/
|
||||
function pmaTooltip(e)
|
||||
{
|
||||
var theText = document.getElementById('footnote_' + this.innerHTML).innerHTML;
|
||||
|
||||
var plusX = 0, plusY = 0, docX = 0, docY = 0;
|
||||
var divHeight = myTooltipContainer.clientHeight;
|
||||
var divWidth = myTooltipContainer.clientWidth;
|
||||
|
||||
if (navigator.appName.indexOf("Explorer") != -1) {
|
||||
// IE ...
|
||||
if (document.documentElement && document.documentElement.scrollTop) {
|
||||
plusX = document.documentElement.scrollLeft;
|
||||
plusY = document.documentElement.scrollTop;
|
||||
docX = document.documentElement.offsetWidth + plusX;
|
||||
docY = document.documentElement.offsetHeight + plusY;
|
||||
} else {
|
||||
plusX = document.body.scrollLeft;
|
||||
plusY = document.body.scrollTop;
|
||||
docX = document.body.offsetWidth + plusX;
|
||||
docY = document.body.offsetHeight + plusY;
|
||||
}
|
||||
} else {
|
||||
docX = document.body.clientWidth;
|
||||
docY = document.body.clientHeight;
|
||||
}
|
||||
|
||||
ttXpos = ttXpos + plusX;
|
||||
ttYpos = ttYpos + plusY;
|
||||
|
||||
if ((ttXpos + divWidth) > docX)
|
||||
ttXpos = ttXpos - (divWidth + (ttXadd * 2));
|
||||
if ((ttYpos + divHeight) > docY)
|
||||
ttYpos = ttYpos - (divHeight + (ttYadd * 2));
|
||||
|
||||
PMA_TT_setText(theText);
|
||||
moveTooltip((ttXpos + ttXadd), (ttYpos + ttYadd));
|
||||
holdTooltip();
|
||||
}
|
||||
|
||||
/**
|
||||
* register mouse moves
|
||||
*
|
||||
* @param event e
|
||||
*/
|
||||
function mouseMove(e) {
|
||||
if ( typeof( event ) != 'undefined' ) {
|
||||
ttXpos = event.x;
|
||||
ttYpos = event.y;
|
||||
} else {
|
||||
ttXpos = e.pageX;
|
||||
ttYpos = e.pageY;
|
||||
}
|
||||
moveTooltip((ttXpos + ttXadd), (ttYpos + ttYadd));
|
||||
}
|
@@ -1,32 +0,0 @@
|
||||
#!/bin/bash
|
||||
# $Id$
|
||||
#
|
||||
# Shell script that adds a message to all message files (Lem9)
|
||||
#
|
||||
# Example: add_message.sh '$strNewMessage' 'new message contents'
|
||||
#
|
||||
|
||||
if [ $# -ne 2 ] ; then
|
||||
echo "usage: add_message.sh '\$strNewMessage' 'new message contents'"
|
||||
exit 1
|
||||
fi
|
||||
|
||||
for file in *.inc.php
|
||||
do
|
||||
echo $file " "
|
||||
grep -v '?>' ${file} > ${file}.new
|
||||
case $file in
|
||||
english*)
|
||||
echo "$1 = '"$2"';" >> ${file}.new
|
||||
;;
|
||||
*)
|
||||
echo "$1 = '"$2"'; //to translate" >> ${file}.new
|
||||
;;
|
||||
esac
|
||||
echo "?>" >> ${file}.new
|
||||
rm $file
|
||||
mv ${file}.new $file
|
||||
done
|
||||
./sort_lang.sh english*
|
||||
echo " "
|
||||
echo "Message added to all message files (including english)"
|
@@ -1,32 +0,0 @@
|
||||
#!/bin/bash
|
||||
# $Id$
|
||||
#
|
||||
# Shell script that adds a message file to all message files
|
||||
# adding "//to translate" on each line
|
||||
#
|
||||
# Example: add_message_file.sh xxx
|
||||
#
|
||||
if [ $# -ne 1 ] ; then
|
||||
echo "usage: add_message_file.sh filename"
|
||||
exit 1
|
||||
fi
|
||||
|
||||
for file in *.inc.php
|
||||
do
|
||||
echo $file " "
|
||||
grep -v '?>' ${file} > ${file}.new
|
||||
case $file in
|
||||
english*)
|
||||
sed -n 's/\(.*\);/\1;/p' $1 >> ${file}.new
|
||||
;;
|
||||
*)
|
||||
sed -n 's/\(.*\);/\1; \/\/to translate/p' $1 >> ${file}.new
|
||||
;;
|
||||
esac
|
||||
echo "?>" >> ${file}.new
|
||||
rm $file
|
||||
mv ${file}.new $file
|
||||
done
|
||||
./sort_lang.sh english*
|
||||
echo " "
|
||||
echo "Messages added to add message files (including english)"
|
@@ -1,62 +0,0 @@
|
||||
#!/bin/sh
|
||||
# $Id$
|
||||
##
|
||||
# Shell script to check that all language files are syncronized
|
||||
# Catches duplicate/missing strings
|
||||
#
|
||||
# Robin Johnson <robbat2@users.sourceforge.net>
|
||||
# August 9, 2002
|
||||
##
|
||||
|
||||
MASTER="english-utf-8.inc.php"
|
||||
TMPDIR="tmp-check"
|
||||
FILEPAT="*.inc.php"
|
||||
STRINGMATCH='^[[:space:]]*\$[[:alnum:]_]+[[:blank:]]+='
|
||||
IGNOREMATCH='strEncto|strKanjiEncodConvert|strXkana|allow_recoding|doc_lang'
|
||||
|
||||
if [ "`which diffstat`" = "" ] ; then
|
||||
echo 'You need diffstat to use this!'
|
||||
exit 1
|
||||
fi
|
||||
|
||||
rm -rf $TMPDIR
|
||||
mkdir -p $TMPDIR
|
||||
|
||||
# Build the list of variables in each file
|
||||
echo "Building data"
|
||||
for f in $FILEPAT;
|
||||
do
|
||||
awk "/$STRINGMATCH/ && ! /$IGNOREMATCH/ { print \$1 }" $f | sort > $TMPDIR/$f
|
||||
done
|
||||
|
||||
|
||||
# Build the diff files used for checking
|
||||
# And if there are no differences, delete the empty files
|
||||
echo "Comparing data"
|
||||
for f in $FILEPAT;
|
||||
do
|
||||
if [ ! $MASTER = $f ]; then
|
||||
if diff -u $TMPDIR/$MASTER $TMPDIR/$f >$TMPDIR/$f.diff ; then
|
||||
rm -f $TMPDIR/$f.diff $TMPDIR/$f
|
||||
fi
|
||||
fi
|
||||
done
|
||||
|
||||
# Cleanup
|
||||
rm -f $TMPDIR/$MASTER
|
||||
|
||||
# Build the nice difference table
|
||||
echo "Differences"
|
||||
diffstat -f 0 $TMPDIR/*.diff >$TMPDIR/diffstat 2>/dev/null
|
||||
echo "Dupe Miss Filename"
|
||||
head -n -1 $TMPDIR/diffstat | \
|
||||
while read filename sep change add plus sub minus edits exclaim;
|
||||
do
|
||||
echo "$add $sub $filename";
|
||||
done
|
||||
|
||||
echo
|
||||
echo "Dupe = Duplicate Variables"
|
||||
echo "Miss = Missing Variables"
|
||||
echo "For exact problem listings, look in the $TMPDIR/ directory"
|
||||
echo "Please remember to remove '$TMPDIR/' once you are done"
|